%!PS-Adobe-2.0 %%Creator: dvipsk 5.58f Copyright 1986, 1994 Radical Eye Software %%Title: xfs.dvi %%Pages: 15 %%PageOrder: Ascend %%BoundingBox: 0 0 612 792 %%DocumentFonts: Times-Roman Times-Bold Times-Italic %%DocumentPaperSizes: Letter %%EndComments %DVIPSCommandLine: dvips -o xfs.ps xfs.dvi %DVIPSParameters: dpi=600, comments removed %DVIPSSource: TeX output 1999.10.12:1218 %%BeginProcSet: tex.pro /TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N}B /TR{translate}N /isls false N /vsize 11 72 mul N /hsize 8.5 72 mul N /landplus90{false}def /@rigin{isls{[0 landplus90{1 -1}{-1 1} ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[matrix currentmatrix{dup dup round sub abs 0.00001 lt{round}if} forall round exch round exch]setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N /IE 0 N /ctr 0 N /df-tail{ /nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[}B /df{ /sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0] N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{ 128 ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type /stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N /cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0 -1 -.1 ch-xoff sub ch-yoff .1 sub]{ch-image}imagemask restore}B /D{/cc X dup type /stringtype ne{]} if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}B /I{ cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin 0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N /eop{SI restore userdict /eop-hook known{eop-hook}if showpage}N /@start{userdict /start-hook known{start-hook}if pop /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div /hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley 0 N /v{/ruley X /rulex X V}B /V {}B /RV statusdict begin /product where{pop product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval(NeXT)eq or}{pop false} ifelse}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR rulex ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /QV{gsave newpath transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail {dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M} B /d{-3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{ 4 M}B /w{0 rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{ p 1 w}B /r{p 2 w}B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B /eos{SS restore}B end %%EndProcSet %%BeginFont: Times-Roman % @@psencodingfile@{ % author = "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry", % version = "0.6", % date = "22 June 1996", % filename = "8r.enc", % email = "kb@@mail.tug.org", % address = "135 Center Hill Rd. // Plymouth, MA 02360", % codetable = "ISO/ASCII", % checksum = "119 662 4424", % docstring = "Encoding for TrueType or Type 1 fonts to be used with TeX." % @} % % Idea is to have all the characters normally included in Type 1 fonts % available for typesetting. This is effectively the characters in Adobe % Standard Encoding + ISO Latin 1 + extra characters from Lucida. % % Character code assignments were made as follows: % % (1) the Windows ANSI characters are almost all in their Windows ANSI % positions, because some Windows users cannot easily reencode the % fonts, and it makes no difference on other systems. The only Windows % ANSI characters not available are those that make no sense for % typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen % (173). quotesingle and grave are moved just because it's such an % irritation not having them in TeX positions. % % (2) Remaining characters are assigned arbitrarily to the lower part % of the range, avoiding 0, 10 and 13 in case we meet dumb software. % % (3) Y&Y Lucida Bright includes some extra text characters; in the % hopes that other PostScript fonts, perhaps created for public % consumption, will include them, they are included starting at 0x12. % % (4) Remaining positions left undefined are for use in (hopefully) % upward-compatible revisions, if someday more characters are generally % available. % % (5) hyphen appears twice for compatibility with both ASCII and Windows. % /TeXBase1Encoding [ % 0x00 (encoded characters from Adobe Standard not in Windows 3.1) /.notdef /dotaccent /fi /fl /fraction /hungarumlaut /Lslash /lslash /ogonek /ring /.notdef /breve /minus /.notdef % These are the only two remaining unencoded characters, so may as % well include them. /Zcaron /zcaron % 0x10 /caron /dotlessi % (unusual TeX characters available in, e.g., Lucida Bright) /dotlessj /ff /ffi /ffl /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef % very contentious; it's so painful not having quoteleft and quoteright % at 96 and 145 that we move the things normally found there down to here. /grave /quotesingle % 0x20 (ASCII begins) /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash % 0x30 /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question % 0x40 /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O % 0x50 /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore % 0x60 /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o % 0x70 /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef % rubout; ASCII ends % 0x80 /.notdef /.notdef /quotesinglbase /florin /quotedblbase /ellipsis /dagger /daggerdbl /circumflex /perthousand /Scaron /guilsinglleft /OE /.notdef /.notdef /.notdef % 0x90 /.notdef /.notdef /.notdef /quotedblleft /quotedblright /bullet /endash /emdash /tilde /trademark /scaron /guilsinglright /oe /.notdef /.notdef /Ydieresis % 0xA0 /.notdef % nobreakspace /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen % Y&Y (also at 45); Windows' softhyphen /registered /macron % 0xD0 /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown % 0xC0 /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis % 0xD0 /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls % 0xE0 /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis % 0xF0 /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def %%EndFont %%BeginProcSet: texps.pro TeXDict begin /rf{findfont dup length 1 add dict begin{1 index /FID ne 2 index /UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]/Metrics exch def dict begin Encoding{exch dup type /integertype ne{pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get div def} ifelse}forall Metrics /Metrics currentdict end def[2 index currentdict end definefont 3 -1 roll makefont /setfont load]cvx def}def /ObliqueSlant{dup sin S cos div neg}B /SlantFont{4 index mul add}def /ExtendFont{3 -1 roll mul exch}def /ReEncodeFont{/Encoding exch def}def end %%EndProcSet %%BeginProcSet: special.pro TeXDict begin /SDict 200 dict N SDict begin /@SpecialDefaults{/hs 612 N /vs 792 N /ho 0 N /vo 0 N /hsc 1 N /vsc 1 N /ang 0 N /CLIP 0 N /rwiSeen false N /rhiSeen false N /letter{}N /note{}N /a4{}N /legal{}N}B /@scaleunit 100 N /@hscale{@scaleunit div /hsc X}B /@vscale{@scaleunit div /vsc X}B /@hsize{/hs X /CLIP 1 N}B /@vsize{/vs X /CLIP 1 N}B /@clip{ /CLIP 2 N}B /@hoffset{/ho X}B /@voffset{/vo X}B /@angle{/ang X}B /@rwi{ 10 div /rwi X /rwiSeen true N}B /@rhi{10 div /rhi X /rhiSeen true N}B /@llx{/llx X}B /@lly{/lly X}B /@urx{/urx X}B /@ury{/ury X}B /magscale true def end /@MacSetUp{userdict /md known{userdict /md get type /dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N /note{}N /legal{} N /od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{itransform lineto} }{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{ itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{ closepath}}pathforall newpath counttomark array astore /gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack}if}N /txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N /cp {pop pop showpage pm restore}N end}if}if}N /normalscale{Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale}if 0 setgray} N /psfts{S 65781.76 div N}N /startTexFig{/psf$SavedState save N userdict maxlength dict begin /magscale true def normalscale currentpoint TR /psf$ury psfts /psf$urx psfts /psf$lly psfts /psf$llx psfts /psf$y psfts /psf$x psfts currentpoint /psf$cy X /psf$cx X /psf$sx psf$x psf$urx psf$llx sub div N /psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR /showpage{}N /erasepage{}N /copypage{}N /p 3 def @MacSetUp}N /doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N /endTexFig{end psf$SavedState restore}N /@beginspecial{SDict begin /SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count /ocount X /dcount countdictstack N}N /@setspecial {CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if /showpage{}N /erasepage{}N /copypage{}N newpath }N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{ end}repeat grestore SpecialSave restore end}N /@defspecial{SDict begin} N /@fedspecial{end}B /li{lineto}B /rl{rlineto}B /rc{rcurveto}B /np{ /SaveX currentpoint /SaveY X N 1 setlinecap newpath}N /st{stroke SaveX SaveY moveto}N /fil{fill SaveX SaveY moveto}N /ellipse{/endangle X /startangle X /yrad X /xrad X /savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 40258431 52099146 1000 600 600 (xfs.dvi) @start /Fa 107[42 42 24[37 42 42 60 42 46 28 32 37 46 46 42 46 69 23 46 1[23 46 42 28 37 46 37 46 42 8[60 4[46 2[51 2[78 55 5[51 55 60 1[55 60 12[42 42 42 42 2[21 42[46 46 2[{ TeXBase1Encoding ReEncodeFont }44 83.333336 /Times-Bold rf /Fb 134[37 37 55 37 42 23 32 32 1[42 42 42 60 23 37 23 23 42 42 23 37 42 37 42 42 8[51 69 1[60 46 42 2[51 60 55 1[46 55 1[28 2[51 51 60 55 51 51 6[28 42 42 1[42 42 42 2[42 1[23 21 28 42[42 2[{ TeXBase1Encoding ReEncodeFont }52 83.333336 /Times-Italic rf /Fc 1 16 df<000FE000007FFC0000FFFE0003FFFF80 07FFFFC00FFFFFE01FFFFFF03FFFFFF83FFFFFF87FFFFFFC7FFFFFFC7FFFFFFCFFFFFFFE FFFFFFFEFFFFFFFEFFFFFFFEFFFFFFFEFFFFFFFEFFFFFFFEFFFFFFFE7FFFFFFC7FFFFFFC 7FFFFFFC3FFFFFF83FFFFFF81FFFFFF00FFFFFE007FFFFC003FFFF8000FFFE00007FFC00 000FE0001F207BA42A>15 D E /Fd 134[50 50 72 50 55 33 39 44 1[55 50 55 83 28 2[28 55 50 33 44 55 44 55 50 8[72 1[72 1[66 55 2[61 78 1[94 66 1[50 39 2[61 1[72 72 66 72 10[50 50 50 50 50 50 1[28 25 43[55 2[{ TeXBase1Encoding ReEncodeFont }46 100.000000 /Times-Bold rf /Fe 75[28 27[28 1[42 1[37 37 24[37 42 42 60 42 42 23 32 28 42 42 42 42 65 23 42 23 23 42 42 28 37 42 37 42 37 3[28 1[28 51 60 60 78 60 60 51 46 55 60 46 60 60 74 51 60 32 28 60 60 46 51 60 55 55 60 5[23 23 42 42 42 42 42 42 42 42 42 42 23 21 28 21 47 1[28 28 28 1[69 33[46 46 2[{ TeXBase1Encoding ReEncodeFont }82 83.333336 /Times-Roman rf /Ff 134[60 60 86 60 66 40 47 53 2[60 66 100 33 66 1[33 66 60 40 53 66 53 66 60 8[86 1[86 1[80 66 86 1[73 3[80 93 1[47 2[73 4[86 10[60 60 60 60 60 60 1[33 47[{ TeXBase1Encoding ReEncodeFont }40 119.999947 /Times-Bold rf /Fg 136[72 1[50 28 39 33 2[50 50 78 28 50 1[28 50 1[33 44 50 44 1[44 9[94 3[55 66 1[55 72 1[89 1[72 39 33 1[72 1[61 72 66 20[25 1[25 4[33 39[{ TeXBase1Encoding ReEncodeFont }33 100.000000 /Times-Roman rf /Fh 134[72 72 2[72 40 56 48 2[72 72 112 40 2[40 72 72 1[64 12[104 4[80 2[80 3[88 2[48 1[104 80 70[{ TeXBase1Encoding ReEncodeFont }21 144.000000 /Times-Roman rf end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%PaperSize: Letter %%EndSetup %%Page: 1 1 1 0 bop 728 656 a Fh(Porting)35 b(the)g(SGI)g(XFS)g(File)g(System)f(to) i(Linux)1107 897 y Fg(Jim)24 b(Mostek,)g(W)l(illiam)f(Earl,)i(and)g (Dan)g(K)m(oren)1870 1013 y(SGI)806 1179 y(Russell)f(Cattelan,)h(K)n (enneth)f(Preslan,)h(and)f(Matthe)n(w)g(O'K)n(eefe)1522 1295 y(Sistina)g(Softw)o(are,)h(Inc.)0 1621 y Ff(Abstract)0 1814 y Fe(In)17 b(late)h(1994,)e(SGI)i(released)f(an)g(adv)n(anced,)f (journaled)g(\002le)i(sys-)0 1914 y(tem)23 b(called)g(XFS)h(on)f(IRIX,) g(their)g(System-V)-8 b(-deri)n(v)o(ed)20 b(v)o(ersion)0 2013 y(of)26 b(UNIX.)h(Since)g(that)f(time,)i(XFS)g(has)f(pro)o(v)o(en) d(itself)j(in)g(pro-)0 2113 y(duction)e(as)i(a)f(f)o(ast,)i(highly)d (scalable)h(\002le)h(system)g(suitable)f(for)0 2212 y(computer)18 b(systems)i(ranging)e(from)h(the)h(desktop)e(to)i(supercom-)0 2312 y(puters.)58 b(In)31 b(early)g(1999,)i(SGI)e(announced)e(that)j (XFS)g(w)o(ould)0 2412 y(be)c(released)g(under)f(an)h(open)g(source)f (license)i(and)f(inte)o(grated)0 2511 y(into)19 b(the)g(Linux)f(k)o (ernel.)23 b(In)c(this)h(paper)m(,)d(we)j(outline)e(the)h(history)0 2611 y(of)26 b(XFS,)h(its)g(current)e(architecture)f(and)i (implementation,)f(our)0 2711 y(porting)i(strate)o(gy)g(for)h (migrating)f(XFS)i(to)f(Linux,)h(and)f(future)0 2810 y(plans,)38 b(including)33 b(coordinating)f(our)i(w)o(ork)g(with)h(the) g(Linux)0 2910 y(hack)o(er)19 b(community)-5 b(.)0 3213 y Ff(1)119 b(Intr)n(oduction)31 b(to)e(XFS)0 3406 y Fe(In)22 b(the)g(early)g(1990')-5 b(s,)21 b(SGI)i(realized)f(its)h(e)o(xisting)e (EFS)i(\(Extent)0 3506 y(File)g(System\))f(w)o(ould)f(be)i(inadequate)d (to)i(support)f(the)h(ne)n(w)g(ap-)0 3605 y(plication)g(demands)g (arising)h(from)f(the)h(increased)f(disk)h(capac-)0 3705 y(ity)-5 b(,)29 b(bandwidth,)d(and)h(parallelism)g(a)n(v)n(ailable)g (on)g(its)h(w)o(orksta-)0 3805 y(tions.)59 b(Applications)30 b(in)i(\002lm)g(and)f(video,)i(supercomputing,)0 3904 y(and)23 b(huge)g(databases)g(all)i(required)d(performance)f(and)i (capaci-)0 4004 y(ties)d(be)o(yond)e(what)h(EFS,)h(with)g(a)g(design)f (similar)h(to)g(the)f(Berk)o(e-)0 4104 y(le)o(y)25 b(F)o(ast)h(File)g (System)g([1)o(],)h(could)d(pro)o(vide.)38 b(EFS)26 b(limitations)0 4203 y(were)17 b(similar)h(to)f(those)g(found)f(recently)g(in)h(Linux)g (\002le)g(systems:)0 4303 y(small)h(\002le)h(system)f(sizes)h(\(8)f (gigabytes\),)e(small)j(\002le)g(sizes)g(\(2)e(gi-)0 4402 y(gabytes\),)h(and)i(slo)n(w)h(reco)o(v)o(ery)c(times)k(using)f (fsck.)0 4663 y Fd(1.1)99 b(XFS)25 b(F)n(eatur)n(es)0 4826 y Fe(In)e(response,)f(SGI)i(be)o(gan)d(the)i(de)n(v)o(elopment)d (of)j(XFS)h([2)o(],)g([3)o(],)0 4926 y(a)e(completely)e(ne)n(w)i (\002le)g(system)g(designed)e(to)i(support)e(the)i(fol-)0 5025 y(lo)n(wing)d(requirements:)83 5225 y Fc(\017)41 b Fe(f)o(ast)21 b(crash)f(reco)o(v)o(ery)83 5407 y Fc(\017)41 b Fe(lar)o(ge)19 b(\002le)i(systems)2075 1621 y Fc(\017)41 b Fe(lar)o(ge)19 b(sparse)h(\002les)2075 1792 y Fc(\017)41 b Fe(lar)o(ge)19 b(contiguous)f(\002les)2075 1964 y Fc(\017)41 b Fe(lar)o(ge)19 b(directories)2075 2135 y Fc(\017)41 b Fe(lar)o(ge)19 b(numbers)f(of)i(\002les)2075 2323 y(File)31 b(systems)h(without)e(journaling)f(must)i(run)f(an)h(fsck)g([4)o(])1992 2423 y(\(the)d(\002le)i(system)f(check)o(er\))e(o)o(v)o(er)h(the)h (entire)g(\002le)g(system;)34 b(in-)1992 2523 y(stead,)17 b(XFS)h(uses)f(database)f(reco)o(v)o(ery)e(techniques)i(that)h(reco)o (v)o(er)1992 2622 y(a)h(consistent)g(\002le)g(system)g(state)h(follo)n (wing)e(a)h(crash)g(in)g(less)h(than)1992 2722 y(a)i(second.)28 b(XFS)23 b(meets)e(the)h(requirements)d(for)i(lar)o(ge)g(\002les)h (sys-)1992 2821 y(tems,)j(\002les,)h(and)e(directories)f(through)g(the) h(follo)n(wing)f(mecha-)1992 2921 y(nisms:)2075 3109 y Fc(\017)41 b Fe(B+)22 b(tree)f(indices)h(on)f(all)h(\002le)g(system)g (data)g(structures)e([5],)2158 3209 y([6)o(])2075 3380 y Fc(\017)41 b Fe(tight)36 b(inte)o(gration)e(with)i(the)h(k)o(ernel,)i (including)34 b(use)j(of)2158 3480 y(adv)n(anced)32 b(page/b)n(uf)n (fer)g(cache)i(features,)j(the)d(directory)2158 3580 y(name)19 b(lookup)g(cache,)g(and)h(the)g(dynamic)f(vnode)f(cache)2075 3751 y Fc(\017)41 b Fe(dynamic)18 b(allocation)h(of)h(disk)g(blocks)g (to)g(inodes)2075 3923 y Fc(\017)41 b Fe(sophisticated)34 b(space)h(management)d(techniques)i(which)2158 4022 y(e)o(xploit)19 b(contiguity)-5 b(,)18 b(parallelism,)h(and)h(f)o(ast)g(logging.)2075 4210 y(XFS)31 b(uses)g(B+)g(trees)f(e)o(xtensi)n(v)o(ely)f(in)h(place)h (of)f(traditional)1992 4310 y(linear)20 b(\002le)i(system)f (structures.)27 b(B+)22 b(trees)f(pro)o(vide)e(an)i(ef)n(\002cient)1992 4410 y(inde)o(xing)f(method)h(that)h(is)h(used)f(to)h(rapidly)e(locate) h(free)g(space,)1992 4509 y(to)27 b(inde)o(x)e(directory)h(entries,)i (to)f(manage)f(\002le)h(e)o(xtents,)h(and)e(to)1992 4609 y(k)o(eep)15 b(track)h(of)h(the)f(locations)g(of)g(\002le)h(inde)o(x)f (information)e(within)1992 4708 y(the)20 b(\002le)h(system.)2075 4809 y(XFS)29 b(is)h(a)g(fully)f(64-bit)f(\002le)h(system.)52 b(Most)30 b(of)e(the)h(global)1992 4909 y(counters)i(in)h(the)h(system) g(are)f(64-bits)g(in)g(length,)j(as)e(are)g(the)1992 5009 y(addresses)26 b(used)g(for)g(each)g(disk)h(block)e(and)h(the)h (unique)e(num-)1992 5108 y(ber)31 b(assigned)g(to)h(each)g(\002le)g (\(the)g(inode)f(number\).)57 b(A)33 b(single)1992 5208 y(\002le)22 b(system)g(can)g(theoretically)e(be)i(as)g(lar)o(ge)f(as)i (18)e(million)g(ter)n(-)1992 5308 y(abytes.)40 b(The)25 b(\002le)h(system)g(is)g(partitioned)e(into)i(re)o(gions)e(called)1992 5407 y(Allocation)19 b(Groups)h(\(A)m(G\).)f(Lik)o(e)i(UFS)g(c)o (ylinder)e(groups,)g(each)1929 5656 y(1)p eop %%Page: 2 2 2 1 bop 0 390 a Fe(A)m(G)23 b(manages)f(its)h(o)n(wn)f(free)h(space)f (and)h(inodes.)31 b(The)23 b(primary)0 490 y(purpose)16 b(of)i(Allocation)f(Groups)g(is)i(to)f(pro)o(vide)e(scalability)i(and)0 589 y(parallelism)25 b(within)h(the)f(\002le)i(system.)41 b(This)26 b(partitioning)e(also)0 689 y(limits)e(the)g(size)g(of)g(the) g(structures)f(needed)f(to)i(track)f(this)h(infor)n(-)0 789 y(mation)c(and)g(allo)n(ws)g(the)h(internal)e(pointers)h(to)h(be)f (32-bits.)24 b(A)m(Gs)0 888 y(typically)g(range)g(in)i(size)g(from)e (0.5)g(to)i(4GB.)f(Files)h(and)f(direc-)0 988 y(tories)j(are)g(not)g (limited)g(to)g(allocating)f(space)h(within)g(a)g(single)0 1088 y(A)m(G.)83 1191 y(Other)51 b(related)g(\002le)h(system)g(w)o(ork) f(in)g(Linux)g(includes)0 1290 y([7)o(],[8)o(],[9)n(],)20 b([10)o(],[11)n(],)g([12)o(],[13)n(].)0 1548 y Fd(1.2)99 b(The)26 b(XFS)f(Ar)n(chitectur)n(e)0 1710 y Fe(The)30 b(high)g(le)n(v)o(el)g(structure)g(of)g(XFS)i(is)f(similar)g(to)g(a)g (con)m(v)o(en-)0 1810 y(tional)24 b(\002le)g(system)g(with)g(the)g (addition)f(of)h(a)g(transaction)f(man-)0 1910 y(ager)c(and)h(a)g(v)n (olume)f(manager)-5 b(.)24 b(XFS)d(supports)e(all)h(of)g(the)g(stan-)0 2009 y(dard)14 b(Unix)h(\002le)h(interf)o(aces)f(and)g(is)h(entirely)f (POSIX)h(and)e(XPG4-)0 2109 y(compliant.)52 b(It)30 b(sits)h(belo)n(w)d (the)i(vnode)e(interf)o(ace)h([14)o(])g(in)h(the)0 2208 y(IRIX)20 b(k)o(ernel)f(and)g(tak)o(es)h(full)f(adv)n(antage)f(of)h (services)h(pro)o(vided)0 2308 y(by)k(the)f(k)o(ernel,)h(including)e (the)i(b)n(uf)n(fer/page)e(cache,)i(the)g(direc-)0 2408 y(tory)c(name)f(lookup)f(cache,)i(and)g(the)g(dynamic)e(vnode)h(cache.) 83 2511 y(XFS)h(is)h(modularized)c(into)i(se)n(v)o(eral)g(parts,)g (each)g(of)g(which)g(is)0 2610 y(responsible)j(for)g(a)h(separate)g (piece)g(of)f(the)h(\002le)h(system')-5 b(s)23 b(func-)0 2710 y(tionality)-5 b(.)28 b(The)21 b(central)g(and)f(most)i(important) e(piece)h(of)g(the)g(\002le)0 2810 y(system)28 b(is)h(the)e(space)h (manager)-5 b(.)46 b(This)28 b(module)e(manages)h(the)0 2909 y(\002le)19 b(system)g(free)f(space,)h(the)g(allocation)f(of)g (inodes,)g(and)g(the)h(al-)0 3009 y(location)e(of)h(space)g(within)g (indi)n(vidual)e(\002les.)26 b(The)17 b(I/O)i(manager)0 3109 y(is)j(responsible)e(for)h(satisfying)f(\002le)i(I/O)g(requests)f (and)f(depends)0 3208 y(on)j(the)g(space)g(manager)e(for)i(allocating)f (and)g(k)o(eeping)g(track)g(of)0 3308 y(space)33 b(for)f(\002les.)64 b(The)33 b(directory)e(manager)g(implements)h(the)0 3407 y(XFS)g(\002le)f(system)g(name)g(space.)57 b(The)30 b(b)n(uf)n(fer)g (cache)g(is)i(used)0 3507 y(by)24 b(all)i(of)e(these)h(pieces)g(to)g (cache)f(the)h(contents)f(of)g(frequently)0 3607 y(accessed)g(blocks)g (from)f(the)i(underlying)d(v)n(olume)h(in)h(memory)-5 b(.)0 3706 y(It)30 b(is)h(an)e(inte)o(grated)f(page)h(and)g(\002le)i (cache)e(shared)g(by)g(all)h(\002le)0 3806 y(systems)21 b(in)f(the)g(k)o(ernel.)83 3909 y(The)i(transaction)f(manager)g(is)j (used)e(by)g(the)g(other)g(pieces)g(of)0 4009 y(the)h(\002le)g(system)f (to)h(mak)o(e)f(all)h(updates)f(to)h(the)f(metadata)g(of)g(the)0 4108 y(\002le)32 b(system)g(atomic.)59 b(This)32 b(enables)f(the)h (quick)e(reco)o(v)o(ery)f(of)0 4208 y(the)22 b(\002le)g(system)g(after) g(a)g(crash.)29 b(While)22 b(the)g(XFS)h(implementa-)0 4308 y(tion)f(is)i(modular)m(,)c(it)k(is)f(also)g(lar)o(ge)e(and)h (comple)o(x.)30 b(The)22 b(current)0 4407 y(implementation)30 b(is)j(o)o(v)o(er)e(110,00)f(lines)i(of)g(C)h(code)f(\(not)f(in-)0 4507 y(cluding)18 b(the)h(b)n(uf)n(fer)e(cache)i(or)g(vnode)e(code,)i (or)f(user)n(-le)n(v)o(el)g(XFS)0 4607 y(utilities\);)23 b(in)f(contrast,)g(the)f(EFS)i(implementation)c(is)k(approxi-)0 4706 y(mately)d(12,000)e(lines.)83 4809 y(The)e(v)n(olume)f(manager)g (used)h(by)g(XFS,)g(kno)n(wn)f(as)i(XL)-8 b(V)d(,)16 b(pro-)0 4909 y(vides)28 b(a)g(layer)f(of)g(abstraction)g(between)g (XFS)i(and)e(its)h(under)n(-)0 5009 y(lying)j(disk)g(de)n(vices.)59 b(XL)-8 b(V)32 b(pro)o(vides)d(all)k(of)e(the)h(disk)f(strip-)0 5108 y(ing,)16 b(concatenation,)f(and)g(mirroring)f(used)i(by)g(XFS.)h (XFS)f(itself)0 5208 y(kno)n(ws)22 b(nothing)e(of)i(the)h(layout)e(of)h (the)h(de)n(vices)f(upon)e(which)i(it)0 5308 y(is)29 b(stored.)47 b(This)27 b(separation)g(of)g(disk)h(management)d(from)i (the)0 5407 y(\002le)g(system)g(simpli\002es)g(the)f(\002le)h(system)g (implementation,)e(its)1992 390 y(application)15 b(interf)o(aces,)i (and)f(the)h(management)e(of)i(the)g(\002le)g(sys-)1992 490 y(tem)j(itself.)1992 834 y Fd(1.3)99 b(Support)26 b(F)n(eatur)n(es)1992 1027 y Fe(XFS)39 b(has)g(a)g(v)n(ariety)f(of)h (sophisticated)f(support)f(utilities)i(to)1992 1126 y(enhance)30 b(its)i(usability)-5 b(.)59 b(These)31 b(include)g(f)o(ast)h(mkfs)f (\(mak)o(e)g(a)1992 1226 y(\002le)24 b(system\),)g(dump)f(and)g (restore)h(utilities)g(for)g(backup,)f(xfsdb)1992 1325 y(\(XFS)18 b(deb)n(ug\),)f(xfscheck)g(\(XFS)h(check\),)f(and)h (xfsrepair)f(to)h(per)n(-)1992 1425 y(form)i(\002le)i(system)g (checking)e(and)g(repairing.)27 b(The)22 b(xfs)p 3628 1425 25 4 v 29 w(fsr)g(util-)1992 1525 y(ity)f(defragments)f(e)o (xisting)g(XFS)j(\002le)f(systems.)29 b(The)21 b(xfs)p 3691 1525 V 30 w(bmap)1992 1624 y(utility)30 b(can)h(be)f(used)g(to)h (interpret)f(the)g(metadata)g(layouts)g(for)1992 1724 y(an)f(XFS)h(\002le)g(system.)52 b(The)29 b(gro)n(wfs)f(utility)h(allo) n(ws)h(XFS)g(\002le)1992 1824 y(systems)20 b(to)h(be)f(enlar)o(ged)e (on-line.)1992 2168 y Fd(1.4)99 b(J)o(our)o(naling)1992 2360 y Fe(XFS)31 b(journals)f(metadata)h(updates)f(by)h(\002rst)g (writing)g(them)f(to)1992 2460 y(an)36 b(in-core)f(log)h(b)n(uf)n(fer)m (,)i(then)e(asynchronously)d(writing)j(log)1992 2560 y(b)n(uf)n(fers)26 b(to)i(the)g(on-disk)f(log.)48 b(The)27 b(on-disk)g(log)g(is)i(a)f(circular)1992 2659 y(b)n(uf)n(fer:)h(ne)n(w) 23 b(log)f(entries)h(are)g(written)f(to)h(the)g(head)g(of)f(the)h(log,) 1992 2759 y(and)e(old)g(log)h(entries)g(are)f(remo)o(v)o(ed)f(from)g (the)i(tail)h(once)e(the)h(in-)1992 2858 y(place)i(metadata)h(updates)f (occur)-5 b(.)39 b(After)25 b(a)g(crash,)h(the)f(on-disk)1992 2958 y(log)e(is)h(read)f(by)g(the)h(reco)o(v)o(ery)d(code)i(which)g(is) h(called)f(during)f(a)1992 3058 y(mount)c(operation.)2075 3177 y(XFS)31 b(metadata)f(modi\002cations)g(use)h(transactions:)45 b(create,)1992 3276 y(remo)o(v)o(e,)19 b(link,)i(unlink,)f(allocate,)h (truncate,)f(and)g(rename)g(oper)n(-)1992 3376 y(ations)j(all)h (require)e(transactions.)34 b(This)23 b(means)g(the)h(operation,)1992 3476 y(from)i(the)h(standpoint)f(of)h(the)g(\002le)h(system)g(on-disk)e (metadata,)1992 3575 y(either)21 b(ne)n(v)o(er)f(starts)j(or)e(al)o(w)o (ays)h(completes.)29 b(These)21 b(operations)1992 3675 y(are)32 b(ne)n(v)o(er)g(partially)g(completed)g(on-disk:)50 b(the)o(y)32 b(either)g(hap-)1992 3774 y(pened)15 b(or)h(the)o(y)g (didn')o(t.)22 b(T)m(ransactional)15 b(semantics)i(are)f(required)1992 3874 y(for)k(databases,)g(b)n(ut)h(until)g(recently)f(ha)n(v)o(e)g(not) h(been)f(considered)1992 3974 y(necessary)30 b(for)h(\002le)h(systems.) 59 b(This)32 b(is)g(lik)o(ely)g(to)f(change,)i(as)1992 4073 y(huge)23 b(disks)h(and)g(\002le)h(systems)g(require)e(the)h(f)o (ast)h(reco)o(v)o(ery)d(and)1992 4173 y(good)c(performance)g (journaling)g(can)i(pro)o(vide.)2075 4292 y(An)28 b(important)f(aspect) h(of)g(journaling)e(is)k(write-ahead)c(log-)1992 4392 y(ging:)c(metadata)16 b(objects)g(are)g(pinned)f(in)i(k)o(ernel)f (memory)f(while)1992 4491 y(the)j(transaction)f(is)i(being)f(committed) f(to)i(the)f(on-disk)f(log.)24 b(The)1992 4591 y(metadata)e(is)j (unpinned)c(once)h(the)i(in-core)e(log)h(has)h(been)f(writ-)1992 4690 y(ten)d(to)g(the)g(on-disk)f(log.)2075 4809 y(Note)k(that)h (multiple)f(transactions)f(may)h(be)h(in)g(each)f(in-core)1992 4909 y(log)e(b)n(uf)n(fer)-5 b(.)29 b(Multiple)21 b(in-core)f(log)i(b)n (uf)n(fers)e(allo)n(w)i(for)f(transac-)1992 5009 y(tions)h(when)g (another)f(b)n(uf)n(fer)g(is)j(being)d(written.)32 b(Each)22 b(transac-)1992 5108 y(tion)j(requires)g(space)h(reserv)n(ation)e(from) h(the)h(log)f(system)h(\(i.e.,)1992 5208 y(the)17 b(maximum)f(number)g (of)i(blocks)f(this)h(transaction)f(may)g(need)1992 5308 y(to)22 b(write.\))31 b(All)23 b(metadata)f(objects)g(modi\002ed)f(by)h (an)h(operation,)1992 5407 y(e.g.,)c(create,)h(must)g(be)g(contained)e (in)j(one)e(transaction.)1929 5656 y(2)p eop %%Page: 3 3 3 2 bop 0 390 a Ff(2)119 b(The)31 b(vnode/vfs)e(Interface)h(in)g(IRIX)0 576 y Fe(The)23 b(vnode/vfs)f(\002le)i(system)g(interf)o(ace)f(w)o(as)h (de)n(v)o(eloped)d(in)j(the)0 675 y(mid-80s)j([14)o(],)j([15)o(])e(to)h (allo)n(w)f(the)h(UNIX)f(k)o(ernel)g(to)g(support)0 775 y(multiple)35 b(\002le)g(systems)h(simultaneously)-5 b(.)68 b(Up)35 b(to)h(that)f(time,)0 875 y(UNIX)18 b(k)o(ernels)f (typically)g(supported)f(a)j(single)e(\002le)i(system)f(that)0 974 y(w)o(as)k(bolted)f(directly)f(into)h(the)h(k)o(ernel)e(internals.) 28 b(W)m(ith)22 b(the)f(ad-)0 1074 y(v)o(ent)30 b(of)h(local)f(area)h (netw)o(orks)f(in)h(the)g(mid-80s,)h(\002le)f(sharing)0 1174 y(across)21 b(netw)o(orks)e(became)h(possible,)g(and)g(it)i(w)o (as)f(necessary)f(to)0 1273 y(allo)n(w)31 b(multiple)f(\002le)h(system) g(types)g(to)g(be)g(installed)f(into)h(the)0 1373 y(k)o(ernel.)c(The)21 b(vnode/vfs)e(interf)o(ace)h(separates)h(the)g(\002le-system-)0 1472 y(independent)c(vnode)g(from)h(the)h(\002le-system-dependent)d (inode.)0 1572 y(This)21 b(separation)e(allo)n(ws)i(ne)n(w)g(\002le)g (systems)h(to)f(re-use)f(e)o(xisting)0 1672 y (\002le-system-independent)27 b(code,)32 b(and,)g(at)e(least)i(in)e (theory)-5 b(,)31 b(to)0 1771 y(be)22 b(de)n(v)o(eloped)e(indepently)h (of)h(the)g(internal)g(k)o(ernel)f(data)h(struc-)0 1871 y(tures.)83 1971 y(IRIX)d(and)g(XFS)h(use)f(the)g(follo)n(wing)e(major) i(structures)f(to)h(in-)0 2070 y(terf)o(ace)28 b(between)f(the)h (\002le)h(system)f(and)f(the)i(rest)f(of)g(the)g(IRIX)0 2170 y(OS)21 b(components:)83 2330 y Fc(\017)41 b Fe(vfs)20 b(\226)h(V)-5 b(irtual)19 b(File)i(System)g(structure.)83 2487 y Fc(\017)41 b Fe(vnode)19 b(\226)h(V)-5 b(irtual)20 b(node)f(\(as)i(opposed)d(to)i(inode\))83 2644 y Fc(\017)41 b Fe(bhv)p 297 2644 25 4 v 28 w(desc)24 b(\226)g(beha)n(viors)e(are)h (used)h(for)e(\002le)j(system)e(stack-)166 2744 y(ing)83 2901 y Fc(\017)41 b Fe(uio)20 b(\226)g(I/O)h(parameters)e(\(primarily)f (for)i(read)f(and)h(write\).)83 3058 y Fc(\017)41 b Fe(b)n(uf)18 b(\226)g(used)g(as)g(an)g(interf)o(ace)g(to)g(store)g(data)g(in)g (memory)e(\(to)166 3157 y(and)k(from)f(disk\))83 3315 y Fc(\017)41 b Fe(xfs)p 273 3315 V 29 w(mount)19 b(\226)i(top-le)n(v)o (el)d(per)i(XFS)h(\002le)g(system)f(structure)83 3472 y Fc(\017)41 b Fe(xfs)p 273 3472 V 29 w(inode)20 b(\226)g(top-le)n(v)o (el)e(per)i(XFS)h(\002le)g(structure.)0 3705 y Fd(2.1)99 b(vfs)0 3861 y Fe(Figure)50 b(1)i(depicts)e(the)h(vfs,)59 b(bhv)p 1114 3861 V 28 w(desc,)g(xfs)p 1472 3861 V 29 w(mount,)f(and)0 3960 y(xfs)p 107 3960 V 29 w(vfsops)20 b(structures)f(and)h(their)g(relationship)f(in)h(IRIX.)83 4060 y(The)d(vfs)g(structure)f(is)i(the)f(highest-le)n(v)o(el)f (structure)g(in)h(the)g(\002le)0 4160 y(system.)25 b(It)c(contains)e (\002elds)i(such)f(as:)83 4320 y Fc(\017)41 b Fe(the)20 b(mounted)f(de)n(vice)83 4477 y Fc(\017)41 b Fe(nati)n(v)o(e)19 b(block)h(size)83 4634 y Fc(\017)41 b Fe(\002le)21 b(system)f(type)83 4791 y Fc(\017)41 b Fe(pointer)19 b(to)h(\002rst)h(\002le)g(system)g (\(bhv)p 1195 4791 V 28 w(desc\))83 4948 y Fc(\017)41 b Fe(\003ags)83 5108 y(In)22 b(IRIX,)h(the)g(vfs)f(object)g(points)g (to)h(a)g(beha)n(vior)e(\(bhv)p 1710 5108 V 28 w(desc\))0 5208 y(structure)27 b(which)g(is)h(used)g(to)f(construct)g(layered)f (\002le)j(systems)0 5308 y(for)34 b(this)h(vfs.)68 b(The)35 b(bhv)p 774 5308 V 28 w(desc)g(structure)e(has)i(the)g(follo)n(wing)0 5407 y(\002elds:)2075 390 y Fc(\017)41 b Fe(data)15 b (\(\002le-system-dependent)d(data,)17 b(xfs)p 3373 390 V 29 w(mount)d(in)i(\002gure)2158 490 y(1\))2075 657 y Fc(\017)41 b Fe(v)n(obj)19 b(\(\002le-system-independent)d(data,)k (vfs)h(in)f(\002gure)f(1\))2075 824 y Fc(\017)41 b Fe(ops)20 b(\(pointer)e(to)j(\002le-system-dependent)c(functions\))2075 991 y Fc(\017)41 b Fe(ne)o(xt)14 b(\(ne)o(xt)g(bhv)p 2631 991 V 29 w(desc)h(in)h(list)g(of)f(\002le)h(systems)g(for)e(this)i (vfs\).)2075 1175 y(In)k(the)h(e)o(xample,)e(note)h(that)h(we)g(ha)n(v) o(e)f(one)h(\002le)g(system)g(layer)1992 1275 y(since)f(the)g(bhv)p 2436 1275 V 29 w(desc)g(structure')-5 b(s)19 b(ne)o(xt)h(pointer)f(is)i (NULL.)2075 1375 y(If)15 b(some)h(other)f(layered)g(\002le)h(system)g (w)o(as)h(added)e(abo)o(v)o(e)f(XFS,)1992 1474 y(a)29 b(ne)n(w)f(bhv)p 2354 1474 V 28 w(desc)h(w)o(ould)f(be)h(added)e(in)i (front)e(of)i(the)f(e)o(xisting)1992 1574 y(bhv)p 2123 1574 V 28 w(desc)20 b(for)g(XFS.)1992 1813 y Fd(2.2)99 b(vnode)1992 1970 y Fe(The)19 b(IRIX)h(vnode)e(structure)h(is)h (similar)g(to)g(the)f(IRIX)h(vfs)g(struc-)1992 2069 y(ture)f(as)i(can)f (be)g(seen)h(in)f(\002gure)f(2.)2075 2169 y(The)27 b(vnode)f(structure) h(points)g(at)h(the)g(\002rst)h(beha)n(vior)d(in)i(the)1992 2269 y(chain)19 b(of)g(\002le)i(systems)f(handling)e(the)i(\002le)g (associated)g(with)g(this)1992 2368 y(vnode.)i(In)17 b(\002gure)g(2,)h(there)f(is)i(one)e(beha)n(vior)f(only:)23 b(the)17 b(XFS)i(in-)1992 2468 y(ode)f(itself.)25 b(The)18 b(beha)n(vior)g(also)h(points)f(to)h(the)g(function)e(v)o(ector)m(,) 1992 2568 y(xfs)p 2099 2568 V 29 w(vnodeops,)23 b(which)i(contains)f (all)h(the)g(\002le-system-speci\002c)1992 2667 y(routines)e(at)i(the)f (\002le)h(le)n(v)o(el.)37 b(In)24 b(IRIX,)h(the)f(vnodeops)e(contains) 1992 2767 y(more)j(than)g(57)h(routines)f(which)g(can)h(be)g(in)m(v)n (ok)o(ed)e(on)i(a)g(\223\002le\224.)1992 2867 y(These)i(routines)g(co)o (v)o(er)f(man)o(y)g(functions)h(such)g(as)i(create,)g(re-)1992 2966 y(mo)o(v)o(e,)18 b(read,)h(write,)i(open,)d(close,)j(and)e (others.)1992 3205 y Fd(2.3)99 b(uio)1992 3362 y Fe(The)24 b(uio)h(structure)f(in)i(IRIX)f(is)h(used)f(to)h(pass)f(I/O)h (parameters)1992 3461 y(between)19 b(the)h(OS)h(and)f(the)g(\002le)h (system.)26 b(This)20 b(structure)g(can)g(be)1992 3561 y(seen)g(in)g(\002gure)g(3.)2075 3661 y(The)c(uio)g(structure)g(can)h (be)g(used)f(to)h(point)f(at)i(multiple)e(dif)n(fer)n(-)1992 3760 y(ent)k(b)n(uf)n(fers)f(per)g(I/O)h(operation.)j(This)e(can)e(be)h (used)g(to)g(create)g(a)1992 3860 y(scatter/gather)d(I/O)j(interf)o (ace)f(allo)n(wing)g(users)g(to)h(\002ll)g(dif)n(ferent,)1992 3960 y(discontinous)e(memory)g(areas)j(with)f(one)g(system)g(call)h ([15)n(].)2075 4060 y(The)i(uio)g(structure)g(on)g(IRIX)h(has)g(v)n (arious)e(other)h(\002elds)h(that)1992 4159 y(are)c(used)h(by)g(the)f (V)-5 b(irtual)21 b(Memory)f(\(VM\))g(system)h(to)g(commu-)1992 4259 y(nicate)k(with)i(the)f(\002le)g(system.)43 b(One)26 b(such)g(\002eld)g(is)h(uio)p 3658 4259 V 29 w(se)o(g\003g,)1992 4358 y(which)18 b(indicates)g(the)h(dif)n(ferent)e(types)i(of)g(memory) e(in)m(v)n(olv)o(ed)f(in)1992 4458 y(transfers)23 b(such)h(as)g(user)g (space,)h(system)f(space,)g(or)g(instruction)1992 4558 y(space.)42 b(This)26 b(information)d(is)k(used)f(by)f(the)h(\002le)h (system)f(when)1992 4657 y(determining)17 b(ho)n(w)i(to)h(mo)o(v)o(e)e (data)i(to)f(and)g(from)g(the)h(uio')-5 b(s)19 b(asso-)1992 4757 y(ciated)h(memory)-5 b(.)2075 4857 y(There)20 b(are)h(se)n(v)o (eral)g(other)g(\002elds)h(in)f(the)h(uio)f(which)f(are)i(used)1992 4957 y(to)16 b(communicate)e(between)i(the)g(\002le)i(system)e(and)g (the)h(rest)f(of)h(the)1992 5056 y(k)o(ernel,)i(including:)2075 5240 y Fc(\017)41 b Fe(uio)p 2270 5240 V 29 w(fmode)18 b(\226)j(\002le)g(mode)e(\003ags)2075 5407 y Fc(\017)41 b Fe(uio)p 2270 5407 V 29 w(of)n(fset)19 b(\226)i(\002le)f(of)n(fset) 1929 5656 y(3)p eop %%Page: 4 4 4 3 bop 317 2347 a @beginspecial 72 @llx 242 @lly 464 @urx 433 @ury 3920 @rwi @setspecial %%BeginDocument: fig1.eps %AI5_FileFormat 4.0 %AI3_ColorUsage: Black&White %AI3_IncludePlacedImages %AI7_ImageSettings: 1 %AI3_TemplateBox: 306.5 395.5 306.5 395.5 %AI3_TileBox: 31 31 583 761 %AI3_DocumentPreview: Header %AI5_ArtSize: 612 792 %AI5_RulerUnits: 2 %AI5_ArtFlags: 1 0 0 1 0 0 1 0 0 %AI5_TargetResolution: 800 %AI5_NumLayers: 1 %AI8_OpenToView: -133 811 1 1137 819 18 0 1 7 43 0 0 %AI5_OpenViewLayers: 7 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 userdict /Adobe_level2_AI5 26 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { (AI8_CMYK_CustomColor) 6 packedarray } bind def /findrgbcustomcolor { (AI8_RGB_CustomColor) 5 packedarray } bind def /setcustomcolor { exch aload pop dup (AI8_CMYK_CustomColor) eq { pop pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { dup (AI8_RGB_CustomColor) eq { pop pop 3 { 1 exch sub 3 index mul 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } ifelse } ifelse } def } if /setAIseparationgray { false setoverprint 0 setgray /setseparationgray where{ pop setseparationgray }{ /setcolorspace where{ pop [/Separation (All) /DeviceCMYK {dup dup dup}] setcolorspace 1 exch sub setcolor }{ setgray }ifelse }ifelse } def /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking currentpacking true setpacking userdict /Adobe_typography_AI5 68 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /havefont { systemdict /languagelevel known { /Font resourcestatus dup { exch pop exch pop } if } { systemdict /FontDirectory get 1 index known { pop true } { systemdict /fileposition known { dup length 6 add exch Ss 6 250 getinterval cvs pop Ss exch 0 exch getinterval status { pop pop pop pop true } { false } ifelse } { pop false } ifelse } ifelse } ifelse } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def /subststring { exch 2 index exch search { exch pop exch dup () eq { pop exch concatstring } { 3 -1 roll exch concatstring concatstring } ifelse exch pop true } { pop pop false } ifelse } def /concatstring { 1 index length 1 index length 1 index add string dup 0 5 index putinterval dup 2 index 4 index putinterval 4 1 roll pop pop pop } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def 2 index havefont { 3 index 255 string cvs dup (_Symbol_) eq { pop 2 index findfont } { 1 index 0 eq { dup length 1 sub 1 exch getinterval cvn findfont } { pop 2 index findfont } ifelse } ifelse } { dup 1 eq { 2 index 64 string cvs dup (-90pv-RKSJ-) (-83pv-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop dup (-90ms-RKSJ-) (-Ext-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop pop true } ifelse } ifelse { 1 index 1 eq { /Ryumin-Light-Ext-RKSJ-V havefont {/Ryumin-Light-Ext-RKSJ-V} {/Courier} ifelse } { /Ryumin-Light-83pv-RKSJ-H havefont {/Ryumin-Light-83pv-RKSJ-H} {/Courier} ifelse } ifelse findfont [1 0 0.5 1 0 0] makefont } if } { /Courier findfont } ifelse } ifelse _wv type /arraytype eq { _wv makeblendedfont } if dup length 10 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontScript exch def /FontDirection exch def /FontRequest exch def /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { W B } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { W F } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { W S } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat _shift aload pop _lineorientation 1 eq { exch } if translate _scale aload pop _lineorientation 1 eq _yokoorientation 1 eq or { exch } if scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { 1 index type /nametype eq { dup 0.75 mul 1 index 0.25 mul neg } if /_fontDescent exch ddef /_fontAscent exch ddef /_fontSize exch ddef /_fontRotateAdjust _fontAscent _fontDescent add 2 div neg ddef /_fontHeight _fontSize ddef findfont _fontSize scalefont setfont } def /Tl { pop neg 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { 0 exch _shift astore pop currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { count 1 eq { 100 } if 100 div exch 100 div exch _scale astore pop iTm } def /TA { pop } def /Tq { pop } def /Tg { pop } def /TG { pop } def /Tv { /_lineorientation exch ddef } def /TV { /_charorientation exch ddef } def /Ty { dup /_yokoorientation exch ddef 1 sub neg Tv } def /TY { pop } def /T~ { Tx } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { _fontSize mul 1000 div _lineorientation 0 eq { neg 0 } { 0 exch } ifelse rmoveto pop } def /TK { 2 npop } def /T* { _leading aload pop _lineorientation 0 ne { exch } if Td } def /T*- { _leading aload pop _lineorientation 0 ne { exch } if exch neg exch neg Td } def /T- { _ax neg 0 rmoveto _lineorientation 1 eq _charorientation 0 eq and { 1 TV _hyphen Tx 0 TV } { _hyphen Tx } ifelse } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ findfont _fontSize scalefont setfont 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking % /X^ { currentfont 5 1 roll dup havefont { findfont _fontSize scalefont setfont } { pop exch } ifelse 2 index 0 eq { Tx } { Tj } ifelse pop pop setfont } def /T^ /X^ load def userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 53 dict put } if userdict /Adobe_ColorImage_AI6 get begin /initialize { Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 41 dict def } if Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /_newproc null def /_proc1 null def /_proc2 null def /sourcearray 4 array def /_ptispace null def /_ptiname null def /_pti0 0 def /_pti1 0 def /_ptiproc null def /_ptiscale 0 def /_pticomps 0 def /_ptibuf 0 string def /_gtigray 0 def /_cticmyk null def /_rtirgb null def /XIEnable true def /XIType 0 def /XIEncoding 0 def /XICompression 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIRowBytes 0 def /XIFile null def /XIBuffer1 null def /XIBuffer2 null def /XIBuffer3 null def /XIDataProc null def /XIColorSpace /DeviceGray def /XIColorValues 0 def /XIPlateList false def end /ci6colorimage /colorimage where {/colorimage get}{null} ifelse def /ci6image systemdict /image get def /ci6curtransfer systemdict /currenttransfer get def /ci6curoverprint /currentoverprint where {/currentoverprint get}{{_of}} ifelse def /ci6foureq { 4 index ne { pop pop pop false }{ 4 index ne { pop pop false }{ 4 index ne { pop false }{ 4 index eq } ifelse } ifelse } ifelse } def /ci6testplate { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 ci6foureq { /plateindex 0 def }{ 0 1 0 0 ci6foureq { /plateindex 1 def }{ 0 0 1 0 ci6foureq { /plateindex 2 def }{ 0 0 0 1 ci6foureq { /plateindex 3 def }{ 0 0 0 0 ci6foureq { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /ci6concatprocs { /packedarray where { pop dup type /packedarraytype eq 2 index type /packedarraytype eq or }{ false } ifelse { /_proc2 exch cvlit def /_proc1 exch cvlit def _proc1 aload pop _proc2 aload pop _proc1 length _proc2 length add packedarray cvx }{ /_proc2 exch cvlit def /_proc1 exch cvlit def /_newproc _proc1 length _proc2 length add array def _newproc 0 _proc1 putinterval _newproc _proc1 length _proc2 putinterval _newproc cvx } ifelse } def /ci6istint { type /arraytype eq } def /ci6isspot { dup type /arraytype eq { dup length 1 sub get /Separation eq }{ pop false } ifelse } def /ci6spotname { dup ci6isspot {dup length 2 sub get}{pop ()} ifelse } def /ci6altspace { aload pop pop pop ci6colormake } def /ci6numcomps { dup /DeviceGray eq { pop 1 }{ dup /DeviceRGB eq { pop 3 }{ /DeviceCMYK eq { 4 }{ 1 } ifelse } ifelse } ifelse } def /ci6marksplate { dup /DeviceGray eq { pop plateindex 3 eq }{ dup /DeviceRGB eq { pop plateindex 5 ne }{ dup /DeviceCMYK eq { pop plateindex 5 ne }{ dup ci6isspot { /findcmykcustomcolor where { pop dup length 2 sub get 0.1 0.1 0.1 0.1 5 -1 roll findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop plateindex 5 ne } ifelse }{ pop plateindex 5 ne } ifelse } ifelse } ifelse } ifelse } def /ci6colormake { dup ci6numcomps exch 1 index 2 add 1 roll dup 1 eq {pop}{array astore} ifelse exch } def /ci6colorexpand { dup ci6spotname exch dup ci6istint { ci6altspace exch 4 1 roll }{ 1 3 1 roll } ifelse } def /ci6colortint { dup /DeviceGray eq { 3 1 roll 1 exch sub mul 1 exch sub exch }{ dup /DeviceRGB eq { 3 1 roll {1 exch sub 1 index mul 1 exch sub exch} forall pop 3 array astore exch }{ dup /DeviceCMYK eq { 3 1 roll {1 index mul exch} forall pop 4 array astore exch }{ 3 1 roll mul exch } ifelse } ifelse } ifelse } def /ci6colortocmyk { dup /DeviceGray eq { pop 1 exch sub 0 0 0 4 -1 roll 4 array astore }{ dup /DeviceRGB eq { pop aload pop _rgbtocmyk 4 array astore }{ dup /DeviceCMYK eq { pop }{ ci6altspace ci6colortint ci6colortocmyk } ifelse } ifelse } ifelse } def /ci6makeimagedict { 7 dict begin /ImageType 1 def /Decode exch def /DataSource exch def /ImageMatrix exch def /BitsPerComponent exch def /Height exch def /Width exch def currentdict end } def /ci6stringinvert { 0 1 2 index length 1 sub { dup 2 index exch get 255 exch sub 2 index 3 1 roll put } for } def /ci6stringknockout { 0 1 2 index length 1 sub { 255 2 index 3 1 roll put } for } def /ci6stringapply { 0 1 4 index length 1 sub { dup 4 index exch get 3 index 3 1 roll 3 index exec } for pop exch pop } def /ci6walkrgbstring { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval {} forall 5 index exec 3 index } for 5 {pop} repeat } def /ci6walkcmykstring { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval {} forall 6 index exec 3 index } for 5 { pop } repeat } def /ci6putrgbtograystr { .11 mul exch .59 mul add exch .3 mul add cvi 3 copy put pop 1 add } def /ci6putcmyktograystr { exch .11 mul add exch .59 mul add exch .3 mul add dup 255 gt { pop 255 } if 255 exch sub cvi 3 copy put pop 1 add } def /ci6rgbtograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putrgbtograystr load exch ci6walkrgbstring end } def /ci6cmyktograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putcmyktograystr load exch ci6walkcmykstring end } def /ci6separatecmykproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 0 2 index plateindex 4 2 index length 1 sub { get 255 exch sub 3 copy put pop 1 add 2 index } for pop pop exch pop end } def /ci6compositeimage { dup 1 eq { pop pop image }{ /ci6colorimage load null ne { ci6colorimage }{ 3 1 roll pop sourcearray 0 3 -1 roll put 3 eq {/ci6rgbtograyproc}{/ci6cmyktograyproc} ifelse load image } ifelse } ifelse } def /ci6knockoutimage { gsave 0 ci6curtransfer exec 1 ci6curtransfer exec eq { 0 ci6curtransfer exec 0.5 lt }{ 0 ci6curtransfer exec 1 ci6curtransfer exec gt } ifelse {{pop 0}}{{pop 1}} ifelse systemdict /settransfer get exec ci6compositeimage grestore } def /ci6drawimage { ci6testplate -1 eq { pop ci6compositeimage }{ dup type /arraytype eq { dup length plateindex gt {plateindex get}{pop false} ifelse }{ { true }{ dup 1 eq {plateindex 3 eq}{plateindex 3 le} ifelse } ifelse } ifelse { dup 1 eq { pop pop ci6image }{ dup 3 eq { ci6compositeimage }{ pop pop sourcearray 0 3 -1 roll put /ci6separatecmykproc load ci6image } ifelse } ifelse }{ ci6curoverprint { 7 {pop} repeat }{ ci6knockoutimage } ifelse } ifelse } ifelse } def /ci6proctintimage { /_ptispace exch store /_ptiname exch store /_pti1 exch store /_pti0 exch store /_ptiproc exch store /_pticomps _ptispace ci6numcomps store /_ptiscale _pti1 _pti0 sub store level2? { _ptiname length 0 gt version cvr 2012 ge and { [/Separation _ptiname _ptispace {_ptiproc}] setcolorspace [_pti0 _pti1] ci6makeimagedict ci6image }{ [/Indexed _ptispace 255 {255 div _ptiscale mul _pti0 add _ptiproc}] setcolorspace [0 255] ci6makeimagedict ci6image } ifelse }{ _pticomps 1 eq { { dup { 255 div _ptiscale mul _pti0 add _ptiproc 255 mul cvi put } ci6stringapply } ci6concatprocs ci6image }{ { dup length _pticomps mul dup _ptibuf length ne {/_ptibuf exch string store}{pop} ifelse _ptibuf { exch _pticomps mul exch 255 div _ptiscale mul _pti0 add _ptiproc _pticomps 2 add -2 roll _pticomps 1 sub -1 0 { 1 index add 2 index exch 5 -1 roll 255 mul cvi put } for pop pop } ci6stringapply } ci6concatprocs false _pticomps /ci6colorimage load null eq {7 {pop} repeat}{ci6colorimage} ifelse } ifelse } ifelse } def /ci6graytintimage { /_gtigray 5 -1 roll store {1 _gtigray sub mul 1 exch sub} 4 1 roll /DeviceGray ci6proctintimage } def /ci6cmyktintimage { /_cticmyk 5 -1 roll store {_cticmyk {1 index mul exch} forall pop} 4 1 roll /DeviceCMYK ci6proctintimage } def /ci6rgbtintimage { /_rtirgb 5 -1 roll store {_rtirgb {1 exch sub 1 index mul 1 exch sub exch} forall pop} 4 1 roll /DeviceRGB ci6proctintimage } def /ci6tintimage { ci6testplate -1 eq { ci6colorexpand 3 -1 roll 5 -1 roll {0}{0 exch} ifelse 4 2 roll dup /DeviceGray eq { pop ci6graytintimage }{ dup /DeviceRGB eq { pop ci6rgbtintimage }{ pop ci6cmyktintimage } ifelse } ifelse }{ dup ci6marksplate { plateindex 5 lt { ci6colortocmyk plateindex get dup 0 eq ci6curoverprint and { 7 {pop} repeat }{ 1 exch sub exch {1 0}{0 1} ifelse () ci6graytintimage } ifelse }{ pop exch {0}{0 exch} ifelse 0 3 1 roll () ci6graytintimage } ifelse }{ ci6curoverprint { 8 {pop} repeat }{ pop pop pop {pop 1} 0 1 () /DeviceGray ci6proctintimage } ifelse } ifelse } ifelse } def /XINullImage { } def /XIImageMask { XIImageWidth XIImageHeight false [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load imagemask } def /XIImageTint { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load XIType 3 eq XIColorValues XIColorSpace ci6tintimage } def /XIImage { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load false XIChannelCount XIPlateList ci6drawimage } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale /_lp /null ddef _fc /_lp /imagemask ddef end } def /XH { Adobe_ColorImage_AI6_Vars begin grestore end } def /XIEnable { Adobe_ColorImage_AI6_Vars /XIEnable 3 -1 roll put } def /XC { Adobe_ColorImage_AI6_Vars begin ci6colormake /XIColorSpace exch def /XIColorValues exch def end } def /XIPlates { Adobe_ColorImage_AI6_Vars begin /XIPlateList exch def end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def cvi dup 256 idiv /XICompression exch store 256 mod /XIEncoding exch store pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi }{ XIImageWidth XIChannelCount mul } ifelse /XIRowBytes exch def XIEnable { /XIBuffer3 XIImageWidth string def XICompression 0 eq { /XIBuffer1 XIRowBytes string def XIEncoding 0 eq { {currentfile XIBuffer1 readhexstring pop} }{ {currentfile XIBuffer1 readstring pop} } ifelse }{ /XIBuffer1 256 string def /XIBuffer2 XIRowBytes string def {currentfile XIBuffer1 readline pop (%) anchorsearch {pop} if} /ASCII85Decode filter /DCTDecode filter /XIFile exch def {XIFile XIBuffer2 readstring pop} } ifelse /XIDataProc exch def XIType 1 ne { 0 setgray } if XIType 1 eq { XIImageMask }{ XIType 2 eq XIType 3 eq or { XIImageTint }{ XIImage } ifelse } ifelse }{ XINullImage } ifelse /XIPlateList false def grestore end } def end currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 112 dict dup begin put /_?cmyk false def /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_lineorientation 0 def /_charorientation 0 def /_yokoorientation 0 def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_shift [0 0] def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fontSize 0 def /_fontAscent 0 def /_fontDescent 0 def /_fontHeight 0 def /_fontRotateAdjust 0 def /Ss 256 string def Ss 0 (fonts/) putinterval /_cnt 0 def /_scale [1 1] def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_hfname 100 string def /_hffound false def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_rgbf 3 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_rgbs 3 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /_lobyte 0 def /_hibyte 0 def /_cproc null def /_cscript 0 def /_hvax 0 def /_hvay 0 def /_hvwb 0 def /_hvcx 0 def /_hvcy 0 def /_bitfont null def /_bitlobyte 0 def /_bithibyte 0 def /_bitkey null def /_bitdata null def /_bitindex 0 def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 100 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin /_aicmykps where {pop /_?cmyk _aicmykps def}if discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /hswj { dup stringwidth 3 2 roll { _hvwb eq { exch _hvcx add exch _hvcy add } if exch _hvax add exch _hvay add } cforall } def /vswj { 0 0 3 -1 roll { dup 255 le _charorientation 1 eq and { dup cstring stringwidth 5 2 roll _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub 4 -1 roll sub exch 3 -1 roll sub exch } { _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub _fontHeight sub } ifelse } cforall } def /swj { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hswj } { vswj } ifelse } def /sw { 0 0 0 6 3 roll swj } def /vjss { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index setmatrix stroke grestore _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index setmatrix stroke grestore moveto pop pop } ifelse } cforall 6 npop } def /hjss { 4 1 roll { dup cstring gsave false charpath currentpoint 5 index setmatrix stroke grestore moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jss { _lineorientation 0 eq { hjss } { vjss } ifelse } def /ss { 0 0 0 7 3 roll jss } def /vjsp { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto false charpath currentpoint _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto 2 index false charpath moveto pop pop } ifelse } cforall 6 npop } def /hjsp { 4 1 roll { dup cstring false charpath _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jsp { matrix currentmatrix _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /sp { matrix currentmatrix 0 0 0 7 3 roll _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /_rgbtocmyk { 3 { 1 exch sub 3 1 roll } repeat 3 copy 1 4 1 roll 3 { 3 index 2 copy gt { exch } if pop 4 1 roll } repeat pop pop pop 4 1 roll 3 { 3 index sub 3 1 roll } repeat 4 -1 roll } def /setrgbfill { _rgbf astore pop /_fc { _lp /fill ne { _of setoverprint _rgbf aload pop setrgbcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /setrgbstroke { _rgbs astore pop /_sc { _lp /stroke ne { _os setoverprint _rgbs aload pop setrgbcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xa { _?cmyk { 3 npop k }{ setrgbfill 4 npop } ifelse } def /XA { _?cmyk { 3 npop K }{ setrgbstroke 4 npop } ifelse } def /Xs { /_gf exch ddef 5 npop /_fc { _lp /fill ne { _of setoverprint _gf setAIseparationgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XS { /_gs exch ddef 5 npop /_sc { _lp /stroke ne { _os setoverprint _gs setAIseparationgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xx { exch /_gf exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XX { exch /_gs exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /XK { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll K } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop XA } ifelse } def /Xk { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll k } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop Xa } ifelse } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /Xt { pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if endString eq { cleartomark stop } if }ifelse } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse }ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 6 npop 7 2 roll 5 npop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { /clipForward? true def /Tx /pop load def /Tj /pop load def currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 4 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setrgbcolor { 3 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end /XP { 4 npop } bind def /XD { pop } bind def end setpacking currentpacking true setpacking userdict /Adobe_cshow 14 dict dup begin put /initialize { Adobe_cshow begin Adobe_cshow { dup xcheck { bind } if pop pop } forall end Adobe_cshow begin } def /terminate { currentdict Adobe_cshow eq { end } if } def /cforall { /_lobyte 0 ddef /_hibyte 0 ddef /_cproc exch ddef /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef { /_lobyte exch ddef _hibyte 0 eq _cscript 1 eq _lobyte 129 ge _lobyte 159 le and _lobyte 224 ge _lobyte 252 le and or and _cscript 2 eq _lobyte 161 ge _lobyte 254 le and and _cscript 3 eq _lobyte 161 ge _lobyte 254 le and and _cscript 25 eq _lobyte 161 ge _lobyte 254 le and and _cscript -1 eq or or or or and { /_hibyte _lobyte ddef } { _hibyte 256 mul _lobyte add _cproc /_hibyte 0 ddef } ifelse } forall } def /cstring { dup 256 lt { (s) dup 0 4 3 roll put } { dup 256 idiv exch 256 mod (hl) dup dup 0 6 5 roll put 1 4 3 roll put } ifelse } def /clength { 0 exch { 256 lt { 1 } { 2 } ifelse add } cforall } def /hawidthshow { { dup cstring show _hvax _hvay rmoveto _hvwb eq { _hvcx _hvcy rmoveto } if } cforall } def /vawidthshow { { dup 255 le _charorientation 1 eq and { -90 rotate 0 _fontRotateAdjust rmoveto cstring _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow 0 _fontRotateAdjust neg rmoveto 90 rotate } { currentpoint _fontHeight sub exch _hvay sub exch _hvax sub 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if 3 2 roll cstring dup stringwidth pop 2 div neg _fontAscent neg rmoveto show moveto } ifelse } cforall } def /hvawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse } def /hvwidthshow { 0 0 3 -1 roll hvawidthshow } def /hvashow { 0 0 0 6 -3 roll hvawidthshow } def /hvshow { 0 0 0 0 0 6 -1 roll hvawidthshow } def currentdict readonly pop end setpacking userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_shading_AI8 10 dict dup begin put /initialize { Adobe_shading_AI8 begin Adobe_shading_AI8 bdprocs Mesh /initialize get exec } def /terminate { currentdict Adobe_shading_AI8 eq { end } if } def /bdprocs { { dup xcheck 1 index type /arraytype eq and { bind } if pop pop } forall } def /X! {pop} def /X# {pop pop} def /Mesh 40 dict def Mesh begin /initialize { Mesh bdprocs Mesh begin /emulate? /AI8MeshEmulation where { pop AI8MeshEmulation }{ systemdict /shfill known not } ifelse def end } def /bd { shadingdict begin } def /paint { emulate? { end }{ /_lp /none ddef _fc /_lp /none ddef /AIColorSpace AIColorSpace tocolorspace store /ColorSpace AIColorSpace topsspace store version_ge_3010.106 not systemdict /setsmoothness known and { 0.0001 setsmoothness } if composite? { /DataSource getdatasrc def Matrix concat currentdict end shfill }{ AIColorSpace makesmarks AIPlateList markingplate and not isoverprint and { end }{ /ColorSpace /DeviceGray store /Decode [0 1 0 1 0 1] store /DataSource getplatesrc def Matrix concat currentdict end shfill } ifelse } ifelse } ifelse } def /shadingdict 12 dict def shadingdict begin /ShadingType 6 def /BitsPerCoordinate 16 def /BitsPerComponent 8 def /BitsPerFlag 8 def end /datafile null def /databuf 256 string def /dataptr 0 def /srcspace null def /srcchannels 0 def /dstchannels 0 def /dstplate 0 def /srctodstcolor null def /getplatesrc { /srcspace AIColorSpace store /srcchannels AIColorSpace getnchannels store /dstchannels 1 store /dstplate getplateindex store /srctodstcolor srcspace makesmarks { dstplate 4 eq { {1 exch sub} }{ {srcspace tocmyk 3 dstplate sub index 1 exch sub 5 1 roll 4 {pop} repeat} } ifelse }{ {srcchannels {pop} repeat 1} } ifelse store /datafile getdatasrc store /rdpatch168 load DataLength () /SubFileDecode filter } def /getdatasrc { /rdcmntline load /ASCII85Decode filter } def /rdpatch168 { /dataptr 0 store 49 rdcount 4 { dup {pop srcchannels getint8} if dup {pop srctodstcolor dstchannels putint8 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdpatch3216 { /dataptr 0 store 97 rdcount 4 { dup {pop srcchannels getint16} if dup {pop srctodstcolor dstchannels putint16 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdcount { dup 0 gt { datafile databuf dataptr 4 -1 roll getinterval readstring exch length dataptr add /dataptr exch store }{ true } ifelse } def /getint8 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 255 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint8 { dup dataptr add /dataptr exch store dataptr exch { 1 sub exch 255 mul cvi databuf 2 index 3 -1 roll put } repeat pop } def /getint16 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 256 mul datafile read} if dup {pop add 65535 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint16 { dup 2 mul dataptr add /dataptr exch store dataptr exch { 2 sub exch 65535 mul cvi dup 256 idiv databuf 3 index 3 -1 roll put 256 mod databuf 2 index 1 add 3 -1 roll put } repeat pop } def /srcbuf 256 string def /rdcmntline { currentfile srcbuf readline pop (%) anchorsearch {pop} if } def /getplateindex { 0 [cyan? magenta? yellow? black? customColor?] {{exit} if 1 add} forall } def /aicsarray 4 array def /aicsaltvals 4 array def /aicsaltcolr aicsaltvals def /tocolorspace { dup type /arraytype eq { mark exch aload pop aicsarray 0 3 -1 roll put aicsarray 1 3 -1 roll put dup aicsarray 2 3 -1 roll put gettintxform aicsarray 3 3 -1 roll put counttomark aicsaltvals 0 3 -1 roll getinterval /aicsaltcolr exch store aicsaltcolr astore pop pop aicsarray } if } def /subtintxform {aicsaltcolr {1 index mul exch} forall pop} def /addtintxform {aicsaltcolr {1 sub 1 index mul 1 add exch} forall pop} def /gettintxform { /DeviceRGB eq {/addtintxform}{/subtintxform} ifelse load } def /getnchannels { dup type /arraytype eq {0 get} if colorspacedict exch get begin Channels end } def /makesmarks { composite? { pop true }{ dup dup type /arraytype eq {0 get} if colorspacedict exch get begin MarksPlate end } ifelse } def /markingplate { composite? { pop true }{ dup type /arraytype eq { dup length getplateindex gt {getplateindex get}{pop false} ifelse } if } ifelse } def /tocmyk { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToCMYK end } def /topsspace { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToPSSpace end } def /colorspacedict 5 dict dup begin /DeviceGray 4 dict dup begin /Channels 1 def /MarksPlate {pop black?} def /ToCMYK {pop 1 exch sub 0 0 0 4 -1 roll} def /ToPSSpace {} def end def /DeviceRGB 4 dict dup begin /Channels 3 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop _rgbtocmyk} def /ToPSSpace {} def end def /DeviceCMYK 4 dict dup begin /Channels 4 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop} def /ToPSSpace {} def end def /Separation 4 dict dup begin /Channels 1 def /MarksPlate { /findcmykcustomcolor where { pop dup 1 exch ToCMYK 5 -1 roll 1 get findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace {} def end def /Process 4 dict dup begin /Channels 1 def /MarksPlate { isCMYKSep? { 1 exch ToCMYK 4 array astore getplateindex get 0 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace { 4 array copy dup 0 /Separation put } def end def end def /isoverprint { /currentoverprint where {pop currentoverprint}{_of} ifelse } def /version_ge_3010.106 { version {cvr} stopped { pop false }{ 3010.106 ge } ifelse } def end end defaultpacking setpacking userdict /_useSmoothShade false put userdict /_aicmykps false put userdict /_forceToCMYK false put Adobe_level2_AI5 /initialize get exec Adobe_cshow /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_shading_AI8 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla /hungarumlaut/ogonek/caron TE %AI55J_Tsume: None %AI3_BeginEncoding: _Times-Roman Times-Roman [/_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType [161/degree 173/notequal 176/infinity/plusminus/lessequal/greaterequal 181/mu/partialdiff/summation/product/pi/integral 189/Omega 195/radical 197/approxequal 198/Delta 214/divide/lozenge 240/apple /_Symbol_/Symbol 0 0 0 TZ %AI5_Begin_NonPrinting Np %AI3_BeginPattern: (Brick) (Brick) 0 0 72 72 [ %AI3_Tile (0 O 0 R 0.3 0.85 0.85 0 k 0.3 0.85 0.85 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 0 m 0 72 L 72 72 L 72 0 L 0 0 L f %AI6_EndPatternLayer ) & (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 68.4097 m 72 68.4097 l S 0 61.209 m 72 61.209 L S 0 54.0088 m 72 54.0088 L S 0 46.8076 m 72 46.8076 L S 0 39.6084 m 72 39.6084 L S 0 32.4072 m 72 32.4072 L S 0 25.207 m 72 25.207 L S 0 18.0059 m 72 18.0059 L S 0 10.8057 m 72 10.8057 L S 0 3.6064 m 72 3.6064 L S 68.4102 68.4097 m 68.4102 61.2217 l S 54.0098 68.4097 m 54.0098 61.2217 L S 39.6094 68.4097 m 39.6094 61.2217 L S 25.21 68.4097 m 25.21 61.2217 L S 10.8105 68.4097 m 10.8105 61.2217 L S 68.4102 53.9717 m 68.4102 46.7842 l S 54.0098 53.9717 m 54.0098 46.7842 L S 39.6094 53.9717 m 39.6094 46.7842 L S 25.21 53.9717 m 25.21 46.7842 L S 10.8105 53.9717 m 10.8105 46.7842 L S 68.4102 39.5967 m 68.4102 32.4092 l S 54.0098 39.5967 m 54.0098 32.4092 L S 39.6094 39.5967 m 39.6094 32.4092 L S 25.21 39.5967 m 25.21 32.4092 L S 10.8105 39.5967 m 10.8105 32.4092 L S 68.4102 25.2217 m 68.4102 18.0342 l S 54.0098 25.2217 m 54.0098 18.0342 L S 39.6094 25.2217 m 39.6094 18.0342 L S 25.21 25.2217 m 25.21 18.0342 L S 10.8105 25.2217 m 10.8105 18.0342 L S 68.4102 10.7842 m 68.4102 3.5967 l S 54.0098 10.7842 m 54.0098 3.5967 L S 39.6094 10.7842 m 39.6094 3.5967 L S 25.21 10.7842 m 25.21 3.5967 L S 10.8105 10.7842 m 10.8105 3.5967 L S 61.1973 3.5967 m 61.1973 0 L S 46.7969 3.5967 m 46.7969 0 L S 32.3965 3.5967 m 32.3965 0 L S 17.9971 3.5967 m 17.9971 0 L S 3.5967 3.5967 m 3.5967 0 l S 61.1973 18.0342 m 61.1973 10.8467 L S 46.7969 18.0342 m 46.7969 10.8467 L S 32.3965 18.0342 m 32.3965 10.8467 L S 17.9971 18.0342 m 17.9971 10.8467 L S 3.5967 18.0342 m 3.5967 10.8467 l S 61.1973 32.4092 m 61.1973 25.2217 L S 46.7969 32.4092 m 46.7969 25.2217 L S 17.9971 32.4092 m 17.9971 25.2217 L S 3.5967 32.4092 m 3.5967 25.2217 l S 61.1973 46.7842 m 61.1973 39.5967 L S 46.7969 46.7842 m 46.7969 39.5967 L S 32.3965 46.7842 m 32.3965 39.5967 L S 17.9971 46.7842 m 17.9971 39.5967 L S 3.5967 46.7842 m 3.5967 39.5967 l S 61.1973 61.2217 m 61.1973 54.0347 L S 46.7969 61.2217 m 46.7969 54.0347 L S 32.3965 61.2217 m 32.3965 54.0347 L S 17.9971 61.2217 m 17.9971 54.0347 L S 3.5967 61.2217 m 3.5967 54.0347 l S 61.1973 71.959 m 61.1973 68.4717 L S 46.7969 71.959 m 46.7969 68.4717 L S 32.3965 71.959 m 32.3965 68.4717 L S 17.9971 71.959 m 17.9971 68.4717 L S 3.5967 71.959 m 3.5967 68.4717 l S 32.3965 32.4092 m 32.3965 25.2217 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Confetti) (Confetti) 4.85 3.617 76.85 75.617 [ %AI3_Tile (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 4.85 3.617 m 4.85 75.617 L 76.85 75.617 L 76.85 3.617 L 4.85 3.617 L f %AI6_EndPatternLayer ) & (0 O 0 R 0 g 0 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 10.6 64.867 m 7.85 62.867 l S 9.1 8.617 m 6.85 6.867 l S 78.1 68.617 m 74.85 67.867 l S 76.85 56.867 m 74.35 55.117 l S 79.6 51.617 m 76.6 51.617 l S 76.35 44.117 m 73.6 45.867 l S 78.6 35.867 m 76.6 34.367 l S 76.1 23.867 m 73.35 26.117 l S 78.1 12.867 m 73.85 13.617 l S 68.35 14.617 m 66.1 12.867 l S 76.6 30.617 m 73.6 30.617 l S 62.85 58.117 m 60.956 60.941 l S 32.85 59.617 m 31.196 62.181 l S 47.891 64.061 m 49.744 66.742 l S 72.814 2.769 m 73.928 5.729 l S 67.976 2.633 m 67.35 5.909 l S 61.85 27.617 m 59.956 30.441 l S 53.504 56.053 m 51.85 58.617 l S 52.762 1.779 m 52.876 4.776 l S 45.391 5.311 m 47.244 7.992 l S 37.062 3.375 m 35.639 5.43 l S 55.165 34.828 m 57.518 37.491 l S 20.795 3.242 m 22.12 5.193 l S 14.097 4.747 m 15.008 8.965 l S 9.736 1.91 m 8.073 4.225 l S 31.891 5.573 m 32.005 8.571 l S 12.1 70.367 m 15.6 68.867 l S 9.35 54.867 m 9.6 58.117 l S 12.85 31.867 m 14.35 28.117 l S 10.1 37.367 m 12.35 41.117 l S 34.1 71.117 m 31.85 68.617 l S 38.35 71.117 m 41.6 68.367 l S 55.1 71.117 m 58.35 69.117 l S 57.35 65.117 m 55.35 61.867 l S 64.35 66.367 m 69.35 68.617 l S 71.85 62.867 m 69.35 61.117 l S 23.6 70.867 m 23.6 67.867 l S 20.6 65.867 m 17.35 65.367 l S 24.85 61.367 m 25.35 58.117 l S 25.85 65.867 m 29.35 66.617 l S 14.1 54.117 m 16.85 56.117 l S 12.35 11.617 m 12.6 15.617 l S 12.1 19.867 m 14.35 22.367 l S 26.1 9.867 m 23.6 13.367 l S 34.6 47.117 m 32.1 45.367 l S 62.6 41.867 m 59.85 43.367 l S 31.6 35.617 m 27.85 36.367 l S 36.35 26.117 m 34.35 24.617 l S 33.85 14.117 m 31.1 16.367 l S 37.1 9.867 m 35.1 11.117 l S 34.35 20.867 m 31.35 20.867 l S 44.6 56.617 m 42.1 54.867 l S 47.35 51.367 m 44.35 51.367 l S 44.1 43.867 m 41.35 45.617 l S 43.35 33.117 m 42.6 30.617 l S 43.85 23.617 m 41.1 25.867 l S 44.35 15.617 m 42.35 16.867 l S 67.823 31.1 m 64.823 31.1 l S 27.1 32.617 m 29.6 30.867 l S 31.85 55.117 m 34.85 55.117 l S 19.6 40.867 m 22.1 39.117 l S 16.85 35.617 m 19.85 35.617 l S 20.1 28.117 m 22.85 29.867 l S 52.1 42.617 m 54.484 44.178 l S 52.437 50.146 m 54.821 48.325 l S 59.572 54.133 m 59.35 51.117 l S 50.185 10.055 m 53.234 9.928 l S 51.187 15.896 m 53.571 14.075 l S 58.322 19.883 m 59.445 16.823 l S 53.1 32.117 m 50.6 30.367 l S 52.85 24.617 m 49.6 25.617 l S 61.85 9.117 m 59.1 10.867 l S 69.35 34.617 m 66.6 36.367 l S 67.1 23.617 m 65.1 22.117 l S 24.435 46.055 m 27.484 45.928 l S 25.437 51.896 m 27.821 50.075 l S 62.6 47.117 m 65.321 46.575 l S 19.85 19.867 m 20.35 16.617 l S 21.85 21.867 m 25.35 22.617 l S 37.6 62.867 m 41.6 62.117 l S 38.323 42.1 m 38.823 38.6 l S 69.35 52.617 m 66.85 53.867 l S 14.85 62.117 m 18.1 59.367 l S 9.6 46.117 m 7.1 44.367 l S 20.6 51.617 m 18.6 50.117 l S 46.141 70.811 m 47.994 73.492 l S 69.391 40.561 m 71.244 43.242 l S 38.641 49.311 m 39.35 52.117 l S 25.141 16.811 m 25.85 19.617 l S 36.6 32.867 m 34.6 31.367 l S 6.1 68.617 m 2.85 67.867 l S 4.85 56.867 m 2.35 55.117 l S 7.6 51.617 m 4.6 51.617 l S 6.6 35.867 m 4.6 34.367 l S 6.1 12.867 m 1.85 13.617 l S 4.6 30.617 m 1.6 30.617 l S 72.814 74.769 m 73.928 77.729 l S 67.976 74.633 m 67.35 77.909 l S 52.762 73.779 m 52.876 76.776 l S 37.062 75.375 m 35.639 77.43 l S 20.795 75.242 m 22.12 77.193 l S 9.736 73.91 m 8.073 76.225 l S 10.1 23.617 m 6.35 24.367 l S 73.217 18.276 m 71.323 21.1 l S 28.823 39.6 m 29.505 42.389 l S 49.6 38.617 m 47.6 37.117 l S 60.323 73.6 m 62.323 76.6 l S 60.323 1.6 m 62.323 4.6 l S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Leaves - Fall ) (Leaves - Fall ) 0 0 64.0781 78.9336 [ %AI3_Tile (0 O 0 R 0.05 0.2 1 0 k 0.05 0.2 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 64.0781 78.9336 m 64.0781 0 L 0 0 L 0 78.9336 L 64.0781 78.9336 L f %AI6_EndPatternLayer ) & (0 O 0 R 0.83 0 1 0 k 0.83 0 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 1 D 0 XR 29.7578 0.9902 m 30.4346 1.1914 30.7246 1.3428 V 29.2559 4.0547 33.707 8.3359 34.627 9.0762 C 35.2275 8.8506 35.3477 6.3184 34.6699 4.9805 C 35.5137 5.1035 37.7031 3.7256 38.4609 2.4365 C 38.5254 3.125 40.0957 6.0664 40.9219 6.4434 C 40.002 6.8408 39.3359 8.3135 38.5742 9.7617 C 39.5957 9.9287 40.9961 9.0078 42.4668 8.1025 C 42.9814 8.9043 44.3555 9.875 45.6143 10.3916 C 44.5264 11.0781 44.0313 11.8203 43.5352 13.2793 C 42.4922 12.7139 40.3057 12.5645 39.7764 12.8516 C 40.291 13.9648 42.5371 14.5078 43.2676 14.4551 C 43.0137 15.3164 42.8652 17.4697 43.0391 20.0625 C 41.3789 18.7461 39.834 17.4297 38.1738 17.4883 C 38.4434 16.0664 37.8076 14.2607 37.4307 13.7676 C 36.8574 14.5117 36.4463 15.3389 36.8008 17.3164 C 35.3486 17.8008 34.1113 18.3467 32.7373 19.6045 C 32.7373 17.7734 32.166 16.5723 31.2969 15.2959 C 32.5576 14.8076 33.8301 13.6045 33.8252 12.5664 C 32.9775 12.7178 31.2852 13.4619 30.793 14.4551 C 30.0742 13.707 28.3906 12.3984 26.7871 12.3945 C 27.9746 11.5391 28.8945 10.5059 28.9893 8.5938 C 30.2422 9.5645 32.6953 10.1797 34.0752 9.582 C 29.2344 5.3457 29.7031 2.3125 29.7578 0.9902 C f 13.8525 29.9844 m 13.3281 29.5127 13.1309 29.25 V 15.623 27.4326 13.3691 21.6074 12.8555 20.5439 C 12.2168 20.4883 10.8096 23.2285 10.8457 24.7266 C 9.7129 23.9707 8.0488 24.0918 6.4463 24.3779 C 7.0186 23.2891 6.6172 21.3447 5.8164 20.5439 C 6.8184 20.5801 8.1699 19.8652 9.4785 18.8838 C 8.6436 18.0645 6.8164 18.2246 4.9004 18.8838 C 4.9004 17.5107 4.0781 15.7734 3.2412 14.5918 C 4.5576 14.6484 5.7031 13.9629 6.5605 12.9316 C 7.2256 14.5 9.2598 15.6133 10.166 15.5645 C 10.1826 14.1992 8.6094 12.1094 7.5879 11.7109 C 8.1875 11.041 9.207 9.5107 10.166 7.0947 C 10.9648 9.0205 12.1348 10.2627 13.3672 11.1953 C 12.2256 12.7578 12.3994 13.6289 12.7988 15.1074 C 13.541 14.5664 14.5723 14.1338 14.7441 12.1309 C 16.4609 12.416 17.5957 12.3447 19.0938 11.4434 C 18.6387 13.1055 18.6348 14.707 18.9551 16.4063 C 17.1055 16.2666 15.5449 16.4795 14.5156 17.9688 C 15.3457 18.1953 17.6055 18.2549 18.4795 17.3223 C 18.8066 18.3047 19.7012 19.7109 21.1475 20.4043 C 19.707 20.6641 18.7227 21.7637 17.8135 23.4492 C 17.1006 22.0332 14.873 20.3691 13.3711 20.3145 C 15.373 24.3779 15.373 27.2959 13.8525 29.9844 C f 41.2324 26.0742 m 41.5518 26.7021 41.7549 26.959 V 44.1523 25.0176 48.958 28.3262 49.8535 29.0957 C 49.7432 29.7266 47.6182 30.8643 45.9004 29.834 C 46.3408 31.123 45.4395 33.084 44.2402 34.126 C 45.9805 34.0254 48.126 35.3867 48.6484 36.1289 C 48.8701 35.1514 50.0527 33.8809 51.3379 32.8672 C 51.6895 33.8398 50.9941 35.958 50.0781 37.5605 C 51.3125 38.0605 52.4248 38.9912 52.8828 40.25 C 53.3398 38.9336 54.3428 38.2598 55.6875 37.5039 C 54.5273 36.0762 53.7471 33.9023 54.0273 33.0391 C 55.3496 33.374 56.9209 36.0918 57.0439 37.1816 C 57.9189 36.415 59.4727 35.7285 62.0537 35.4219 C 60.3535 34.3438 59.9902 32.3516 59.4063 30.9219 C 58.2588 31.3682 56.0898 31.4277 55.1152 30.8643 C 55.8281 30.2852 57.168 29.7344 59.1777 29.7207 C 59.1777 28.1758 59.6406 27.043 60.8945 25.8281 C 59.1719 25.8418 57.0723 25.3555 55.5762 24.9629 C 55.3281 26.292 54.4844 27.8887 53.3398 28.2891 C 53.334 27.4277 53.5996 25.1797 54.4844 24.5117 C 53.6201 23.9443 52.3672 22.5674 51.9102 20.8496 C 51.2881 22.1758 50.4268 23.4805 48.5645 23.9238 C 49.749 24.9766 50.584 26.9941 50.25 28.4609 C 45.1973 24.4785 42.5215 25.7773 41.2324 26.0742 C f 27.7578 38.7324 m 28.4346 38.9316 28.7246 39.084 V 27.2559 41.7969 31.707 46.0776 32.627 46.8169 C 33.2275 46.5918 33.3477 44.0586 32.6699 42.7227 C 33.5137 42.8457 35.7031 41.4678 36.4609 40.1787 C 36.5254 40.8652 38.0957 43.8066 38.9219 44.1846 C 38.002 44.582 37.3359 46.0547 36.5742 47.5039 C 37.5957 47.6709 38.9961 46.7485 40.4668 45.8438 C 40.9814 46.6445 42.3555 47.6177 43.6143 48.1328 C 42.5264 48.8198 42.0313 49.5615 41.5352 51.0205 C 40.4922 50.4556 38.3057 50.3057 37.7764 50.5938 C 38.291 51.7056 40.5371 52.2485 41.2676 52.1958 C 41.0137 53.0576 40.8652 55.2109 41.0391 57.8037 C 39.3789 56.4878 37.834 55.1719 36.1738 55.2285 C 36.4434 53.8076 35.8076 52.002 35.4307 51.5088 C 34.8574 52.2529 34.4463 53.0796 34.8008 55.0576 C 33.3486 55.5425 32.1113 56.0879 30.7373 57.3467 C 30.7373 55.5146 30.166 54.314 29.2969 53.0366 C 30.5576 52.5488 31.8301 51.3467 31.8252 50.3076 C 30.9775 50.46 29.2852 51.2036 28.793 52.1958 C 28.0742 51.4497 26.3906 50.1396 24.7871 50.1357 C 25.9746 49.2817 26.8945 48.2466 26.9893 46.335 C 28.2422 47.3057 30.6953 47.9209 32.0752 47.3237 C 27.2344 43.0869 27.7031 40.0547 27.7578 38.7324 C f 13.5195 70.3916 m 12.9941 69.9209 12.7988 69.6587 V 15.2891 67.8418 13.0352 62.0146 12.5225 60.9517 C 11.8828 60.8955 10.4766 63.6367 10.5117 65.1348 C 9.3809 64.3789 7.7148 64.4995 6.1133 64.7856 C 6.6855 63.6987 6.2842 61.7529 5.4834 60.9517 C 6.4854 60.9878 7.8359 60.2729 9.1455 59.2925 C 8.3105 58.4717 6.4834 58.6338 4.5674 59.2925 C 4.5674 57.9189 3.7461 56.1816 2.9082 54.9995 C 4.2246 55.0576 5.3691 54.3706 6.2275 53.3408 C 6.8926 54.9097 8.9258 56.0215 9.832 55.9727 C 9.8496 54.6079 8.2764 52.5176 7.2539 52.1187 C 7.8545 51.4497 8.873 49.9189 9.832 47.5039 C 10.6309 49.4297 11.8008 50.6719 13.0342 51.6045 C 11.8926 53.1655 12.0664 54.0366 12.4648 55.5146 C 13.209 54.9746 14.2393 54.5415 14.4102 52.5386 C 16.127 52.8247 17.2637 52.7529 18.7598 51.8525 C 18.3057 53.5137 18.3027 55.1147 18.623 56.8149 C 16.7725 56.6748 15.2129 56.8887 14.1826 58.377 C 15.0117 58.6035 17.2725 58.6626 18.1465 57.731 C 18.4736 58.7129 19.3691 60.1187 20.8145 60.8125 C 19.375 61.0728 18.3896 62.1719 17.4805 63.8579 C 16.7676 62.4429 14.541 60.7769 13.0371 60.7227 C 15.041 64.7856 15.041 67.7046 13.5195 70.3916 C f 41.2324 64.4824 m 41.5518 65.1113 41.7549 65.3682 V 44.1523 63.4272 48.958 66.7354 49.8535 67.5034 C 49.7432 68.1362 47.6182 69.2725 45.9004 68.2422 C 46.3408 69.5313 45.4395 71.4922 44.2402 72.5342 C 45.9805 72.4341 48.126 73.7954 48.6484 74.5371 C 48.8701 73.5601 50.0527 72.29 51.3379 71.2754 C 51.6895 72.249 50.9941 74.3662 50.0781 75.9683 C 51.3125 76.4692 52.4248 77.3994 52.8828 78.6582 C 53.3398 77.3423 54.3428 76.667 55.6875 75.9111 C 54.5273 74.4844 53.7471 72.3101 54.0273 71.4473 C 55.3496 71.7822 56.9209 74.5 57.0439 75.5903 C 57.9189 74.8232 59.4727 74.1372 62.0537 73.8311 C 60.3535 72.7534 59.9902 70.7612 59.4063 69.3301 C 58.2588 69.7773 56.0898 69.8364 55.1152 69.2725 C 55.8281 68.6934 57.168 68.1431 59.1777 68.1284 C 59.1777 66.583 59.6406 65.4512 60.8945 64.2373 C 59.1719 64.249 57.0723 63.7632 55.5762 63.3721 C 55.3281 64.7002 54.4844 66.2974 53.3398 66.6973 C 53.334 65.8364 53.5996 63.5874 54.4844 62.9214 C 53.6201 62.353 52.3672 60.9751 51.9102 59.2583 C 51.2881 60.583 50.4268 61.8882 48.5645 62.333 C 49.749 63.3862 50.584 65.4033 50.25 66.8691 C 45.1973 62.8872 42.5215 64.1851 41.2324 64.4824 C f %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Stripes) (Stripes) 8.45 4.6001 80.45 76.6001 [ %AI3_Tile (0 O 0 R 1 0.07 1 0 k 1 0.07 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 3.6 w 4 M []0 d %AI3_Note: 0 D 0 XR 8.2 8.2 m 80.7 8.2 L S 8.2 22.6001 m 80.7 22.6001 L S 8.2 37.0002 m 80.7 37.0002 L S 8.2 51.4 m 80.7 51.4 L S 8.2 65.8001 m 80.7 65.8001 L S 8.2 15.4 m 80.7 15.4 L S 8.2 29.8001 m 80.7 29.8001 L S 8.2 44.2 m 80.7 44.2 L S 8.2 58.6001 m 80.7 58.6001 L S 8.2 73.0002 m 80.7 73.0002 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_BeginBrushPattern (New Pattern 1) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7834.75 8587 m -7834.75 8563 L -7884.75 8563 L -7884.75 8587 L -7834.75 8587 L n u 0 Ap 0 O 1 g -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C F -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C F -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C F -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C F -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C F -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C F -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C F -7844.7817 8565.125 m -7850.9009 8563.6162 -7854.7817 8565.125 V -7858.877 8563.6484 -7864.7817 8565.125 V -7869.7446 8563.4492 -7874.7817 8565.125 V -7880.7969 8563.5742 -7884.7817 8565.125 V -7884.7817 8584.8096 L -7881.6958 8585.7842 -7878.2969 8585.9912 -7874.3799 8584.9082 C -7868.2134 8586.4912 -7864.4634 8584.9082 V -7859.4634 8586.4912 -7854.3799 8584.8242 V -7850.0474 8586.4082 -7844.3799 8584.9082 V -7838.8799 8586.3242 -7834.7817 8585.125 V -7834.7817 8565.4404 L -7837.5254 8564.4287 -7840.6514 8563.9287 -7844.7817 8565.125 C f 0 R 0 G 1 J 1 j 0.5 w -7864.75 8585 m -7872.54 8586.9473 -7878.813 8583.585 -7884.75 8579.0488 C S -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C S -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C S -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C S -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C S -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C S -7854.75 8565 m -7846.96 8563.0527 -7840.687 8566.415 -7834.75 8570.9512 C S -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C S -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C S U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 2) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7819.187 8586 L -7819.187 8521.9023 L -7884 8521.9023 L -7884 8586 L n u 0 O 0 g -7849.6978 8544.4297 m -7851.6094 8521.9023 L -7853.5215 8544.4297 L -7852.9033 8544.3066 -7852.2642 8544.2402 -7851.6094 8544.2402 c -7850.9551 8544.2402 -7850.3159 8544.3066 -7849.6978 8544.4297 C f -7861.2402 8552.3975 m -7884 8554.3301 L -7861.1138 8556.2734 L -7861.2856 8555.5469 -7861.3848 8554.793 -7861.3848 8554.0156 c -7861.3848 8553.4629 -7861.3281 8552.9248 -7861.2402 8552.3975 C f -7856.519 8545.5723 m -7870.1626 8536.8047 L -7860.2153 8549.377 L -7859.3574 8547.791 -7858.0718 8546.4766 -7856.519 8545.5723 C f -7853.481 8563.6074 m -7851.5786 8586 L -7849.6768 8563.5967 L -7850.3018 8563.7227 -7850.9473 8563.791 -7851.6094 8563.791 c -7852.25 8563.791 -7852.873 8563.7246 -7853.481 8563.6074 C f -7841.9609 8555.5068 m -7819.187 8553.5732 L -7842.083 8551.6289 L -7842.083 8551.8506 L -7841.9258 8552.5488 -7841.834 8553.2695 -7841.834 8554.0156 c -7841.834 8554.5234 -7841.8848 8555.0195 -7841.9609 8555.5068 C f -7860.1138 8558.8262 m -7870.1641 8571.5293 L -7856.2778 8562.6055 L -7857.8823 8561.7305 -7859.2114 8560.416 -7860.1138 8558.8262 C f -7842.9961 8549.3945 m -7832.875 8536.6055 L -7846.7666 8545.5313 L -7845.1768 8546.4414 -7843.8633 8547.7793 -7842.9961 8549.3945 C f -7846.6895 8562.4512 m -7832.873 8571.3281 L -7842.9658 8558.5732 L -7843.8198 8560.1895 -7845.1152 8561.5313 -7846.6895 8562.4512 C f -7842.8887 8558.6133 m -7842.3862 8557.6641 -7842.043 8556.6211 -7841.875 8555.5195 c -7841.7993 8555.0293 -7841.748 8554.5273 -7841.748 8554.0156 c -7841.748 8553.2637 -7841.8398 8552.5352 -7841.998 8551.8311 c -7842.1958 8550.957 -7842.5049 8550.124 -7842.918 8549.3545 c -7843.7954 8547.7246 -7845.1191 8546.374 -7846.7241 8545.4561 c -7847.6294 8544.9375 -7848.6226 8544.5537 -7849.6802 8544.3457 c -7850.3047 8544.2207 -7850.9497 8544.1523 -7851.6094 8544.1523 c -7852.2695 8544.1523 -7852.915 8544.2207 -7853.5391 8544.3457 c -7854.623 8544.5605 -7855.6382 8544.957 -7856.5625 8545.4961 c -7858.1313 8546.4102 -7859.4282 8547.7363 -7860.291 8549.335 c -7860.7969 8550.2695 -7861.145 8551.2969 -7861.3262 8552.3828 c -7861.415 8552.916 -7861.4727 8553.459 -7861.4727 8554.0156 c -7861.4727 8554.8008 -7861.3711 8555.5605 -7861.1978 8556.293 c -7860.981 8557.207 -7860.6406 8558.0732 -7860.187 8558.8701 c -7859.2793 8560.4727 -7857.939 8561.8008 -7856.3174 8562.6826 c -7855.4487 8563.1553 -7854.5 8563.498 -7853.4961 8563.6934 c -7852.8848 8563.8115 -7852.2554 8563.8779 -7851.6094 8563.8779 c -7850.9414 8563.8779 -7850.29 8563.8086 -7849.6602 8563.6826 c -7848.5786 8563.4668 -7847.5664 8563.0654 -7846.6455 8562.5273 c -7845.0566 8561.5977 -7843.751 8560.2441 -7842.8887 8558.6133 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 3) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7874.75 8587 m -7874.75 8563 L -7884.75 8563 L -7884.75 8587 L -7874.75 8587 L n u u 0 Ap 0 O 1 g -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 c -7877.897 8566.9736 -7881.0898 8565 -7884.75 8565 C -7884.75 8585 L -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 c -7881.9121 8584.7754 -7880.1807 8584.0645 -7878.7441 8582.9824 c -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 c f 0 R 0 G 1 J 1 j 0.5 w -7884.75 8565.3174 m -7881.7207 8566.2744 -7878.8926 8567.9326 -7876.1543 8569.9072 C S -7884.75 8570.9512 m -7881.5991 8573.3564 -7878.543 8576.0869 -7875.4058 8578.5361 C S -7878.7441 8582.9824 m -7880.8105 8581.8916 -7882.7993 8580.5342 -7884.75 8579.043 C S -7883.8018 8584.9521 m -7884.1191 8584.8682 -7884.4375 8584.7852 -7884.75 8584.6865 C S -7878.7441 8582.9824 m -7880.1807 8584.0645 -7881.9121 8584.7744 -7883.8018 8584.9521 C S -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 C S -7884.75 8585 m -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 C S -7878.7441 8582.9824 m -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 C S -7876.1543 8569.9072 m -7877.8975 8566.9736 -7881.0898 8565 -7884.75 8565 C S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 5) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7726.3994 8587 m -7726.3994 8573.4199 L -7885 8573.4199 L -7885 8587 L -7726.3994 8587 L n u u 0 O 0.285 0.228 0.171 0 k -7741.0786 8585.4844 m -7741.043 8586.6895 L -7727.5103 8587.5176 -7726.8418 8586.2822 v -7726.7441 8586.1016 -7726.647 8585.7148 -7726.561 8585.1934 C -7728.584 8585.8242 -7738.291 8585.5713 -7741.0786 8585.4844 C f 0.44 0.352 0.264 0 k -7741.4063 8574.0234 m -7741.3711 8575.2676 L -7738.4912 8575.0488 -7728.1914 8574.3164 -7726.543 8574.8652 C -7726.7031 8574.2188 -7726.9199 8573.7646 -7727.2046 8573.6152 c -7728.8306 8572.7656 -7741.4063 8574.0234 Y f 0.145 0.116 0.087 0 k -7741.3711 8575.2676 m -7741.0786 8585.4844 L -7738.291 8585.5713 -7728.584 8585.8242 -7726.561 8585.1934 C -7726.1519 8582.7773 -7725.9258 8577.3604 -7726.543 8574.8652 C -7728.1914 8574.3164 -7738.4912 8575.0488 -7741.3711 8575.2676 C f U u 0.155 0.124 0.093 0 k -7766.9375 8579.2734 m -7765.897 8579.6563 L -7747.0728 8575.1465 L -7747.481 8574.3145 L -7766.3633 8576.7246 L -7767.252 8577.0059 L -7767.6504 8576.8936 -7768.1934 8576.8242 V -7767.6094 8577.2373 -7767.1426 8578.1406 -7766.9375 8579.2734 C f u 0.085 0.068 0.051 0 k -7771.7993 8583.666 m -7772.5977 8583.7217 -7769.749 8583.6641 Y -7770.3481 8583.0176 -7770.771 8581.8203 -7770.8105 8580.4375 c -7770.8169 8580.2246 -7770.8105 8580.0176 -7770.7993 8579.8135 C -7771.041 8579.707 -7771.0918 8579.7734 -7771.6289 8579.5645 C -7771 8583.6113 -7771.7993 8583.666 v f 0.305 0.244 0.183 0 k -7770.3442 8576.8672 m -7770.5527 8576.8105 -7770.4937 8578.9307 Y -7769.4785 8579.7588 L -7767.8359 8578.9434 L -7766.9375 8579.2734 L -7767.1426 8578.1406 -7767.6094 8577.2373 -7768.1934 8576.8242 C -7768.6094 8576.7715 -7769.874 8576.7998 -7770.3442 8576.8672 C f U 0.115 0.092 0.069 0 k -7766.9375 8579.2734 m -7767.8359 8578.9434 L -7769.4785 8579.7588 L -7770.4937 8578.9307 L -7770.793 8579.708 -7770.7993 8579.8135 V -7769.5137 8580.3789 -7768.1831 8580.7402 -7766.8398 8580.9258 C -7766.79 8580.7275 -7766.7842 8580.543 -7766.79 8580.3369 c -7766.7998 8579.9717 -7766.8218 8579.6182 -7766.9375 8579.2734 C f 0.41 0.328 0.246 0 k -7747.4512 8575.3965 m -7749.377 8576.6426 -7758.3862 8582.0986 -7766.8398 8580.9258 C -7766.9038 8582.0928 -7767.248 8583.0908 -7767.75 8583.6631 C -7767.1895 8583.6621 L -7746.7402 8586.7559 L -7747.0366 8576.4258 L -7747.0728 8575.1465 L -7747.2046 8575.2373 -7747.4512 8575.3965 v f 0.395 0.316 0.237 0 k -7770.8105 8580.4375 m -7770.771 8581.8203 -7770.3481 8583.0176 -7769.749 8583.6641 C -7767.6807 8583.6631 L -7767.1782 8583.0908 -7766.8218 8582.0713 -7766.8398 8580.9258 C -7768.1831 8580.7402 -7769.5137 8580.3789 -7770.7993 8579.8135 C -7770.8105 8580.0176 -7770.8169 8580.2246 -7770.8105 8580.4375 c f U u 0 0 0 0.11 k -7741.2642 8574.2012 m -7740.2407 8574.0352 L -7741.2642 8574.2012 L -7741.2642 8574.2012 L f 0 0 0 0.34 k -7747.481 8574.3145 m -7747.0728 8575.1465 L -7745.6714 8574.918 L -7744.5234 8574.7314 L -7742.6758 8574.4307 L -7741.2642 8574.2012 L -7740.2407 8574.0352 L -7740.2954 8573.7168 -7740.3672 8573.498 -7740.4648 8573.4199 C -7747.481 8574.3145 L f 0 0 0 0.32 k -7745.8042 8579.207 m -7746.041 8586.8613 L -7740.7144 8587 L -7739.7266 8583.5146 -7740.1816 8579.1543 V -7745.8042 8579.207 L f U 0.025 0.02 0.015 0 k -7739.3223 8576.3848 m -7736.373 8576.9199 -7733.2402 8577.1602 -7730.3159 8576.3613 c -7730.2856 8576.3496 -7730.2754 8576.3184 -7730.2871 8576.2969 c -7730.2881 8576.2656 -7730.3198 8576.2559 -7730.3418 8576.2559 c -7733.2422 8577.0645 -7736.375 8576.8242 -7739.3042 8576.2783 c -7739.3262 8576.2793 -7739.3574 8576.291 -7739.3672 8576.3223 c -7739.3662 8576.3438 -7739.355 8576.375 -7739.3223 8576.3848 c -7739.3223 8576.3848 l f -7737.8374 8575.3076 m -7737.7295 8575.3789 -7737.6313 8575.4941 -7737.5234 8575.502 c -7733.7886 8575.832 -7730.1631 8575.7813 -7726.4746 8575.6641 c -7726.4526 8575.6641 -7726.4209 8575.6426 -7726.4214 8575.6211 c -7726.4214 8575.5879 -7726.4551 8575.5684 -7726.4766 8575.5684 c -7729.3223 8575.6816 -7732.1401 8575.6992 -7735.0039 8575.5352 c -7735.9336 8575.4766 -7736.9082 8575.7402 -7737.7778 8575.2207 c -7737.7993 8575.2109 -7737.8306 8575.2109 -7737.8506 8575.2334 c -7737.8618 8575.2559 -7737.8594 8575.2871 -7737.8374 8575.3076 c -7737.8374 8575.3076 l f -7733.373 8577.3672 m -7731.5098 8578.6797 -7729.3022 8579.374 -7727.1001 8579.8867 c -7727.0679 8579.8965 -7727.0474 8579.8848 -7727.0366 8579.8535 c -7727.0273 8579.8203 -7727.0488 8579.8008 -7727.0703 8579.79 c -7729.2617 8579.2656 -7731.459 8578.6035 -7733.3105 8577.2803 c -7733.3433 8577.2598 -7733.375 8577.2715 -7733.3848 8577.293 c -7733.4058 8577.3145 -7733.3945 8577.3457 -7733.373 8577.3672 c -7733.373 8577.3672 l f -7738.9321 8584.0566 m -7736.7295 8584.5703 -7734.5298 8585.0303 -7732.2798 8585.2754 c -7732.2598 8585.2852 -7732.229 8585.2637 -7732.229 8585.2422 c -7732.2183 8585.209 -7732.2407 8585.1777 -7732.2729 8585.1787 c -7734.5122 8584.8809 -7736.7305 8584.5176 -7738.9126 8583.9502 c -7738.9351 8583.9512 -7738.9673 8583.9629 -7738.9766 8583.9941 c -7738.9751 8584.0156 -7738.9648 8584.0479 -7738.9321 8584.0566 c -7738.9321 8584.0566 l f -7738.439 8583.3604 m -7736.3457 8584.1973 -7734.1016 8583.9297 -7731.9023 8583.9629 c -7731.8706 8583.9609 -7731.8496 8583.9395 -7731.8506 8583.9082 c -7731.8521 8583.875 -7731.873 8583.8555 -7731.8945 8583.8555 c -7734.0928 8583.8438 -7736.3374 8584.0996 -7738.4209 8583.2529 c -7738.4434 8583.2539 -7738.4746 8583.2656 -7738.4834 8583.2969 c -7738.4834 8583.3184 -7738.4722 8583.3506 -7738.439 8583.3604 c -7738.439 8583.3604 l f -7737.707 8584.7051 m -7736.3833 8584.752 -7735.1504 8584.5469 -7733.8271 8584.209 c -7733.3594 8584.0996 -7732.9199 8584.2266 -7732.4609 8584.2129 c -7731.897 8584.1973 l -7731.874 8584.1963 -7731.8633 8584.1855 -7731.8535 8584.1738 c -7731.834 8584.1523 -7731.8442 8584.1211 -7731.8662 8584.0996 c -7732.0625 8583.9453 l -7732.0742 8583.9453 -7732.085 8583.9355 -7732.0962 8583.9355 c -7732.5 8583.9473 l -7733.9551 8584.1914 -7735.457 8584.6719 -7736.8926 8584.0742 c -7736.9258 8584.0645 -7736.957 8584.0859 -7736.9673 8584.1074 c -7736.9673 8584.1396 -7736.9551 8584.1602 -7736.9336 8584.1709 c -7735.647 8584.6992 -7734.1714 8584.4756 -7732.8818 8584.0547 c -7732.0918 8584.043 L -7732.124 8584.0332 L -7731.9282 8584.1875 L -7731.8984 8584.0898 L -7732.4639 8584.1064 l -7732.9321 8584.1406 -7733.3848 8583.9834 -7733.8398 8584.1035 c -7735.1543 8584.4609 -7736.3975 8584.625 -7737.71 8584.5986 c -7737.7422 8584.5996 -7737.7642 8584.6211 -7737.7617 8584.6533 c -7737.7617 8584.6855 -7737.7402 8584.7061 -7737.707 8584.7051 c -7737.707 8584.7051 l f -7738.5718 8585.0605 m -7735.8711 8586.2207 -7732.9023 8585.5703 -7730.1279 8585.1816 c -7729.7832 8585.2891 l -7729.7617 8585.2988 -7729.7417 8585.2871 -7729.7207 8585.2656 c -7729.71 8585.2441 -7729.7217 8585.2129 -7729.7422 8585.2021 c -7730.0801 8585.0098 l -7732.7754 8584.3926 -7735.5391 8584.7813 -7738.271 8584.7852 c -7738.3022 8584.7871 -7738.3232 8584.8086 -7738.3223 8584.8398 c -7738.3198 8584.8721 -7738.2983 8584.8926 -7738.2681 8584.8926 c -7735.6738 8584.9355 -7733.0303 8584.4434 -7730.4727 8585.0742 c -7729.7954 8585.2891 L -7729.7534 8585.1914 L -7730.1406 8585.0859 l -7732.9058 8585.4424 -7735.8418 8586.1348 -7738.5313 8584.9746 c -7738.5537 8584.9648 -7738.585 8584.9648 -7738.5962 8584.998 c -7738.6055 8585.0195 -7738.605 8585.0508 -7738.5718 8585.0605 c -7738.5718 8585.0605 l f -7735.6895 8578.3945 m -7734.3945 8578.9004 -7732.9834 8578.6465 -7731.6802 8578.3438 c -7731.647 8578.3418 -7731.6367 8578.3203 -7731.6382 8578.2891 c -7731.6504 8578.2568 -7731.6714 8578.2461 -7731.7031 8578.248 c -7732.998 8578.5303 -7734.377 8578.8154 -7735.6504 8578.2969 c -7735.6826 8578.2871 -7735.7144 8578.2988 -7735.7246 8578.3311 c -7735.7222 8578.3525 -7735.7114 8578.3848 -7735.6895 8578.3945 c -7735.6895 8578.3945 l f -7736.1401 8580.2207 m -7734.2266 8580.6895 -7732.3145 8581.1035 -7730.355 8581.3242 c -7730.3242 8581.334 -7730.3022 8581.3125 -7730.293 8581.2803 c -7730.2954 8581.2598 -7730.3159 8581.2285 -7730.3374 8581.2285 c -7732.2959 8581.0078 -7734.209 8580.582 -7736.1206 8580.1133 c -7736.1426 8580.1152 -7736.1738 8580.126 -7736.1831 8580.1582 c -7736.1831 8580.1797 -7736.1719 8580.2109 -7736.1401 8580.2207 c -7736.1401 8580.2207 l f -7736.9336 8582.6348 m -7734.499 8583.4609 -7731.8647 8583.0547 -7729.3457 8583.0879 c -7729.313 8583.0879 -7729.293 8583.0664 -7729.293 8583.0332 c -7729.2954 8583.0117 -7729.3159 8582.9922 -7729.3481 8582.9922 c -7731.8574 8582.916 -7734.481 8583.3848 -7736.8945 8582.5264 c -7736.9282 8582.5273 -7736.959 8582.5391 -7736.9688 8582.5605 c -7736.9678 8582.5918 -7736.9561 8582.624 -7736.9336 8582.6348 c -7736.9336 8582.6348 l f -7732.0542 8583.8496 m -7730.6582 8584.5449 -7729.0503 8584.4033 -7727.5342 8584.4668 c -7727.502 8584.4648 -7727.4824 8584.4434 -7727.4824 8584.4121 c -7727.4834 8584.3906 -7727.5054 8584.3594 -7727.5366 8584.3594 c -7729.0137 8584.2207 -7730.6489 8584.5234 -7732.0039 8583.7617 c -7732.0366 8583.7529 -7732.0679 8583.7637 -7732.0786 8583.7861 c -7732.0879 8583.8076 -7732.0767 8583.8398 -7732.0542 8583.8496 c -7732.0542 8583.8496 l f -7731.3418 8580.4248 m -7730.3926 8580.3975 -7729.4336 8580.3701 -7728.4839 8580.3428 c -7728.4526 8580.3418 -7728.4312 8580.3203 -7728.4336 8580.2881 c -7728.4336 8580.2559 -7728.4551 8580.2354 -7728.4878 8580.2363 c -7729.437 8580.2637 -7730.397 8580.291 -7731.3457 8580.3184 c -7731.377 8580.3184 -7731.3975 8580.3418 -7731.3975 8580.373 c -7731.397 8580.4043 -7731.374 8580.4258 -7731.3418 8580.4248 c -7731.3418 8580.4248 l f -7729.1592 8578.0361 m -7728.6895 8578.0645 -7728.209 8578.0723 -7727.7383 8578.0918 c -7727.7168 8578.0908 -7727.6855 8578.0684 -7727.6865 8578.0371 c -7727.687 8578.0039 -7727.71 8577.9844 -7727.7417 8577.9844 c -7728.2114 8577.9873 -7728.6816 8577.9375 -7729.1514 8577.9395 c -7729.1831 8577.9297 -7729.2031 8577.9512 -7729.2134 8577.9844 c -7729.2129 8578.0156 -7729.1914 8578.0371 -7729.1592 8578.0361 c -7729.1592 8578.0361 l f -7736.9702 8580.2344 m -7736.5688 8580.5107 -7736.125 8580.6797 -7735.645 8580.751 c -7735.6113 8580.7607 -7735.5918 8580.7383 -7735.5806 8580.7168 c -7735.5703 8580.6855 -7735.5928 8580.6543 -7735.6152 8580.6543 c -7736.0854 8580.5723 -7736.5176 8580.4023 -7736.9209 8580.1475 c -7736.9521 8580.1377 -7736.9849 8580.1387 -7736.9946 8580.1709 c -7737.0039 8580.1934 -7736.9922 8580.2246 -7736.9702 8580.2344 c -7736.9702 8580.2344 l f -7738.1904 8586.085 m -7735.7344 8586.5273 -7733.2983 8587.001 -7730.7993 8586.7266 c -7730.7778 8586.7266 -7730.7568 8586.7041 -7730.7578 8586.6719 c -7730.7578 8586.6406 -7730.7798 8586.6191 -7730.8022 8586.6191 c -7733.291 8586.873 -7735.7344 8586.4844 -7738.1719 8585.9775 c -7738.1934 8585.9785 -7738.2256 8585.9902 -7738.2344 8586.0215 c -7738.2344 8586.043 -7738.2222 8586.0752 -7738.1904 8586.085 c -7738.1904 8586.085 l f 0.195 0.156 0.117 0 k -7738.166 8574.6445 m -7735.7969 8574.2676 -7733.4058 8574.3477 -7731.0298 8574.5898 c -7730.998 8574.5879 -7730.9766 8574.5664 -7730.9766 8574.5352 c -7730.9785 8574.5137 -7731 8574.4824 -7731.0215 8574.4824 c -7733.4082 8574.2422 -7735.791 8574.1602 -7738.1694 8574.5391 c -7738.2026 8574.5391 -7738.2222 8574.5605 -7738.2217 8574.5938 c -7738.2207 8574.625 -7738.1992 8574.6465 -7738.166 8574.6445 c -7738.166 8574.6445 l f 0.335 0.268 0.201 0 k -7737.4351 8574.1113 m -7734.9282 8574.1152 -7732.4146 8574.2773 -7729.918 8573.8965 c -7729.8862 8573.8945 -7729.8647 8573.873 -7729.8662 8573.8418 c -7729.8672 8573.8086 -7729.8896 8573.7891 -7729.9209 8573.7891 c -7732.418 8574.1699 -7734.9297 8574.0293 -7737.4375 8574.0059 c -7737.46 8574.0059 -7737.481 8574.0273 -7737.4785 8574.0596 c -7737.4785 8574.0918 -7737.457 8574.1123 -7737.4351 8574.1113 c -7737.4351 8574.1113 l f 0.205 0.164 0.123 0 k -7738.9766 8574.3262 m -7737.5039 8574.668 -7736.0078 8574.4023 -7734.5391 8574.2207 c -7734.5078 8574.2207 -7734.4873 8574.1973 -7734.499 8574.166 c -7734.5 8574.1348 -7734.5215 8574.1133 -7734.5537 8574.125 c -7736.0103 8574.2842 -7737.4961 8574.583 -7738.9473 8574.2188 c -7738.9785 8574.2207 -7739.0103 8574.2324 -7739.0098 8574.2637 c -7739.019 8574.2852 -7738.998 8574.3164 -7738.9766 8574.3262 c -7738.9766 8574.3262 l f -7732.3535 8573.7949 m -7731.1978 8573.9219 -7730.0273 8573.8145 -7728.8926 8573.5898 c -7728.8711 8573.5781 -7728.8506 8573.5566 -7728.8618 8573.5244 c -7728.8623 8573.5029 -7728.8945 8573.4824 -7728.916 8573.4941 c -7730.0503 8573.7402 -7731.1914 8573.7939 -7732.3462 8573.6885 c -7732.3794 8573.6895 -7732.3984 8573.7109 -7732.4087 8573.7324 c -7732.4082 8573.7646 -7732.3862 8573.7852 -7732.3535 8573.7949 c -7732.3535 8573.7949 l f 0.335 0.268 0.201 0 k -7739.2681 8576.4473 m -7737.9214 8577.1885 -7736.3066 8576.5977 -7734.855 8576.6416 c -7734.8223 8576.6406 -7734.8022 8576.6191 -7734.8022 8576.5859 c -7734.8042 8576.5654 -7734.8262 8576.5449 -7734.8574 8576.5449 c -7736.2886 8576.4902 -7737.8823 8577.0801 -7739.2168 8576.3506 c -7739.2383 8576.3398 -7739.2695 8576.3516 -7739.291 8576.374 c -7739.3008 8576.3955 -7739.2886 8576.4277 -7739.2681 8576.4473 c -7739.2681 8576.4473 l f -7737.8945 8578.5645 m -7735.6719 8579.0449 -7733.3896 8578.6162 -7731.1504 8578.5625 c -7731.1177 8578.5615 -7731.0977 8578.5391 -7731.0977 8578.5078 c -7731.1001 8578.4863 -7731.1318 8578.4668 -7731.1519 8578.4668 c -7733.3833 8578.4775 -7735.6519 8578.9805 -7737.875 8578.457 c -7737.8975 8578.457 -7737.9287 8578.4688 -7737.9375 8578.502 c -7737.9375 8578.5225 -7737.9258 8578.5547 -7737.8945 8578.5645 c -7737.8945 8578.5645 l f -7732.0273 8575.1406 m -7730.3496 8575.9688 -7728.499 8576.502 -7726.603 8576.3613 c -7726.5718 8576.3613 -7726.5513 8576.3389 -7726.5527 8576.3066 c -7726.5527 8576.2754 -7726.5742 8576.2539 -7726.6074 8576.2559 c -7728.481 8576.416 -7730.3198 8575.8604 -7731.9873 8575.0547 c -7732.0078 8575.0449 -7732.041 8575.0449 -7732.0503 8575.0781 c -7732.061 8575.0996 -7732.061 8575.1309 -7732.0273 8575.1406 c -7732.0273 8575.1406 l f u 0.5 0.85 1 0.45 k -7885 8581.9082 m -7885.0254 8582.4883 -7884.5664 8583.1875 -7883.167 8583.9902 C -7882.8521 8584.0029 -7881.3945 8584.0234 -7879.0889 8584.0488 C -7879.0889 8581.8223 L -7881.1382 8581.8457 -7883.1177 8581.8867 -7885 8581.9082 C f -7884.5088 8580.9688 m -7879.0889 8580.8447 L -7879.0889 8579.8145 L -7882.644 8579.959 L -7883.8145 8580.3301 -7884.5088 8580.9688 V f 0.5 0.85 1 0.32 k -7879.0889 8580.8252 m -7884.4746 8580.9434 L -7884.7695 8581.2148 -7884.9849 8581.5566 -7885 8581.9277 C -7883.1177 8581.9063 -7881.1382 8581.8848 -7879.0889 8581.8613 C -7879.0889 8580.8252 L f 0.5 0.85 1 0.45 k -7774.1504 8580.6172 m -7852.3584 8581.541 -7879.1079 8581.8418 V -7879.1079 8584.0488 L -7862.8145 8584.2324 -7803.9902 8584.707 Y -7769.749 8583.6641 L -7770.457 8580.5684 L -7774.1504 8580.6172 L f 0.5 0.85 1 0.12 k -7879.1079 8579.8145 m -7879.1079 8580.8447 L -7770.4258 8579 L -7770.3833 8576.8633 L -7803.6553 8576.7129 L -7879.1079 8579.8145 L f u 0.065 0.052 0.039 0 k -7747.0728 8575.1465 m -7747.0366 8576.4258 L -7747.2954 8575.1172 L -7765.897 8579.6563 L -7766.9375 8579.2734 L -7766.8794 8579.6055 -7766.8398 8579.957 -7766.8306 8580.3223 c -7766.8242 8580.5283 -7766.8281 8580.7285 -7766.8398 8580.9258 C -7758.3862 8582.0986 -7748.9634 8577.6719 -7747.0366 8576.4258 C -7746.7402 8586.7559 L -7746.041 8586.8613 L -7745.8042 8579.207 L -7740.1816 8579.1543 L -7740.0898 8577.0137 -7740.0718 8575.0215 -7740.2407 8574.0352 C -7747.0728 8575.1465 L f 0.4 0.7 1 0 k -7770.457 8580.5879 m -7770.4258 8578.9805 L -7879.1079 8580.8252 L -7879.1079 8581.8613 L -7852.3584 8581.5605 -7770.457 8580.5879 Y f U U 0.025 0.02 0.015 0 k -7734.7344 8583.0293 m -7734.7344 8583.0625 -7734.7129 8583.082 -7734.6802 8583.082 c -7731.6714 8583.1133 -7729.4214 8582.9453 -7726.415 8582.8594 C -7726.4087 8582.7656 L -7729.3262 8582.8701 -7731.7607 8583.0078 -7734.6841 8582.9746 C -7734.7168 8582.9766 -7734.7358 8582.998 -7734.7344 8583.0293 C f -7726.3994 8582.7656 m -7726.4082 8582.7441 L -7726.4087 8582.7656 L -7726.4063 8582.7656 -7726.4033 8582.7656 -7726.3994 8582.7656 C f -7730.4487 8581.4238 m -7731.4458 8581.292 -7732.3394 8581.7656 -7733.2114 8582.1973 C -7733.2441 8582.208 -7733.2534 8582.2402 -7733.2422 8582.2715 C -7733.2305 8582.293 -7733.1982 8582.3027 -7733.1777 8582.291 c -7732.3262 8581.8301 -7731.4312 8581.4199 -7730.4678 8581.5195 c -7729.1079 8581.6621 -7727.9038 8582.375 -7726.5254 8582.4531 C -7726.4463 8582.3594 L -7728.04 8582.2656 -7728.8647 8581.623 -7730.4487 8581.4238 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 6) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.75 8563 m -7884.75 8587 L -7874.75 8587 L -7874.75 8563 L -7884.75 8563 L n 0 Ap 0 O 1 g -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 c -7877.5879 8565.2256 -7879.3198 8565.9346 -7880.7559 8567.0176 c -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 c -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.2319 8578.5996 -7883.3457 8580.0918 c -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C -7874.75 8565 L f 0 R 0 G 1 J 1 j 0.5 w -7874.75 8584.6816 m -7877.7793 8583.7256 -7880.6074 8582.0674 -7883.3457 8580.0918 C S -7874.75 8579.0488 m -7877.8999 8576.6436 -7880.957 8573.9131 -7884.0942 8571.4639 C S -7880.7559 8567.0176 m -7878.6904 8568.1084 -7876.7017 8569.4668 -7874.75 8570.957 C S -7875.6982 8565.0479 m -7875.3809 8565.1309 -7875.063 8565.2148 -7874.75 8565.3145 C S -7880.7559 8567.0176 m -7879.3193 8565.9355 -7877.5879 8565.2256 -7875.6982 8565.0479 C S -7884.0942 8571.4639 m -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.231 8578.5996 -7883.3457 8580.0918 C S -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 C S -7880.7559 8567.0176 m -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 C S -7883.3457 8580.0918 m -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C S U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 8) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.9521 8584.3125 m -7776.7954 8584.3125 L -7776.7954 8570.1855 L -7883.9521 8570.1855 L -7883.9521 8584.3125 L n u 0 O 0 0 0 1 k -7882.2832 8583.623 m -7882.8535 8586 -7882.8184 8582.0039 V -7883.0479 8578.8027 L -7883.6167 8576.4551 L -7883.4502 8574.123 L -7881.9502 8573.4551 -7865.2832 8572.123 V -7858.6167 8570.7891 -7849.6167 8570.7891 V -7784.3936 8571.4766 -7779.4912 8572.8848 v -7820.3882 8570.875 -7822.9688 8571.5117 v -7783.8569 8573.1602 -7780.8545 8574.4316 v -7818.79 8572.5469 -7822.167 8574.1777 v -7787.249 8575.9102 -7783.021 8577.5313 v -7789.7217 8576.8828 -7791.5127 8577.082 v -7788.3896 8577.5703 l -7793.4194 8577.502 l -7796.3218 8577.1289 l -7788.4521 8578.2422 -7787.9033 8578.8086 v -7784.3154 8578.1309 -7798.5186 8578.3848 v -7832.1177 8574.4551 -7882.2832 8583.623 V f /BBAccumRotation (5.805971) XT 0 R 0 0 0 0.5 K 0.025 w -7883.9502 8573.123 m -7863.667 8571.2949 -7843.9727 8570.2207 v -7801.1514 8570.502 -7796.5737 8570.9004 v -7784.1631 8571.0313 -7776.7959 8572.0273 v S /BBAccumRotation (5.805971) XT 0 0 0 1 K -7821.8369 8570.4082 m -7825.2959 8570.0273 -7851.2607 8570.2793 Y -7861.627 8570.1602 -7883.9502 8573.123 Y S /BBAccumRotation (5.805971) XT -7820.9873 8573.6641 m -7790.3608 8574.582 -7783.6606 8575.2324 v S /BBAccumRotation (5.805971) XT 0 0 0 0.5 K -7829.6201 8578.2051 m -7794.3706 8579.6172 -7791.4058 8580.1406 v S /BBAccumRotation (5.805971) XT U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 10) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7833.8921 8586 L -7833.8921 8529.9756 L -7884 8529.9756 L -7884 8586 L n u 0 O 0.1 1 1 0 k -7846.9014 8551.5752 m -7848.7178 8545.0957 -7858.8247 8548.4658 Y -7858.791 8548.5303 L -7868.8999 8545.1611 -7870.7144 8551.6396 V -7876.6758 8569.0068 -7871.4922 8575.7451 V -7864.7529 8585.3369 -7860.6055 8585.3369 V -7857.0103 8585.2705 L -7852.8638 8585.2705 -7846.125 8575.6816 Y -7840.9409 8568.9424 -7846.9014 8551.5752 Y f u 0 0 0 1 k -7851.3926 8529.9756 m -7852.1167 8531.4199 -7852.9238 8532.4756 V -7852.4058 8532.0635 -7851.5151 8531.1924 -7851.3926 8529.9756 C f -7865.064 8532.4854 m -7865.8711 8531.4307 -7866.5942 8529.9863 Y -7866.4727 8531.2021 -7865.582 8532.0732 -7865.064 8532.4854 C f U 0 0.61 0.74 0 k -7850.5977 8554.4609 m -7851.9038 8549.7959 -7859.1816 8552.2217 Y -7859.1567 8552.2686 L -7866.436 8549.8428 -7867.7417 8554.5078 V -7872.0337 8567.0117 -7868.3018 8571.8633 V -7863.4487 8578.7686 -7860.4634 8578.7686 V -7857.875 8578.7227 L -7854.8887 8578.7227 -7850.0366 8571.8174 Y -7846.3042 8566.9639 -7850.5977 8554.4609 Y f u 1 Ap 0.73 0.43 1 0.22 k 0 R 0 0 0 1 K -7854.6226 8557.2754 m -7853.813 8557.2754 -7853.1558 8556.6182 -7853.1558 8555.8096 c -7853.1558 8555 -7853.813 8554.3428 -7854.6226 8554.3428 c -7855.4321 8554.3428 -7856.0889 8555 -7856.0889 8555.8096 c -7856.0889 8556.6182 -7855.4321 8557.2754 -7854.6226 8557.2754 c b -7854.3638 8568.9971 m -7853.0806 8568.9971 -7852.0415 8568.1201 -7852.0415 8567.042 c -7852.0415 8565.9619 -7853.0806 8565.0869 -7854.3638 8565.0869 c -7855.645 8565.0869 -7856.6846 8565.9619 -7856.6846 8567.042 c -7856.6846 8568.1201 -7855.645 8568.9971 -7854.3638 8568.9971 c b -7853.834 8580.7861 m -7852.2817 8580.7861 -7851.0239 8580.1299 -7851.0239 8579.3213 c -7851.0239 8578.5117 -7852.2817 8577.8545 -7853.834 8577.8545 c -7855.3862 8577.8545 -7856.645 8578.5117 -7856.645 8579.3213 c -7856.645 8580.1299 -7855.3862 8580.7861 -7853.834 8580.7861 c b -7849.6104 8552.5264 m -7848.8687 8552.5264 -7848.2671 8551.8154 -7848.2671 8550.9365 c -7848.2671 8550.0596 -7848.8687 8549.3477 -7849.6104 8549.3477 c -7850.353 8549.3477 -7850.9546 8550.0596 -7850.9546 8550.9365 c -7850.9546 8551.8154 -7850.353 8552.5264 -7849.6104 8552.5264 c b -7848.0034 8574.083 m -7848.8818 8573.7354 -7849.1494 8572.335 -7848.603 8570.9541 c -7848.0566 8569.5752 -7846.9014 8568.7363 -7846.0234 8569.085 c -7845.145 8569.4326 -7844.877 8570.833 -7845.4233 8572.2139 c -7845.9702 8573.5947 -7847.125 8574.4316 -7848.0034 8574.083 c b u -7863.0566 8557.1592 m -7863.8662 8557.1592 -7864.5239 8556.502 -7864.5239 8555.6934 c -7864.5239 8554.8828 -7863.8662 8554.2266 -7863.0566 8554.2266 c -7862.248 8554.2266 -7861.5913 8554.8828 -7861.5913 8555.6934 c -7861.5913 8556.502 -7862.248 8557.1592 -7863.0566 8557.1592 c b -7863.3159 8568.8799 m -7864.5991 8568.8799 -7865.6382 8568.0049 -7865.6382 8566.9248 c -7865.6382 8565.8447 -7864.5991 8564.9697 -7863.3159 8564.9697 c -7862.0342 8564.9697 -7860.9951 8565.8447 -7860.9951 8566.9248 c -7860.9951 8568.0049 -7862.0342 8568.8799 -7863.3159 8568.8799 c b -7863.8457 8580.6709 m -7865.3975 8580.6709 -7866.6558 8580.0146 -7866.6558 8579.2041 c -7866.6558 8578.3936 -7865.3975 8577.7383 -7863.8457 8577.7383 c -7862.293 8577.7383 -7861.0352 8578.3936 -7861.0352 8579.2041 c -7861.0352 8580.0146 -7862.293 8580.6709 -7863.8457 8580.6709 c b -7868.0679 8552.4092 m -7868.811 8552.4092 -7869.4121 8551.6982 -7869.4121 8550.8213 c -7869.4121 8549.9443 -7868.811 8549.2334 -7868.0679 8549.2334 c -7867.3262 8549.2334 -7866.7241 8549.9443 -7866.7241 8550.8213 c -7866.7241 8551.6982 -7867.3262 8552.4092 -7868.0679 8552.4092 c b -7869.6758 8573.9678 m -7868.7983 8573.6201 -7868.5298 8572.2188 -7869.0762 8570.8379 c -7869.6226 8569.457 -7870.7778 8568.6201 -7871.6558 8568.9678 c -7872.5342 8569.3164 -7872.8032 8570.7178 -7872.2568 8572.0967 c -7871.7104 8573.4775 -7870.5552 8574.3154 -7869.6758 8573.9678 c b U U 0 Ap 0 0 0 1 k -7859.1318 8552.6553 m -7859.1318 8585.3145 l F u -7843.3906 8538.5303 m -7844.0815 8537.8369 -7847.019 8538.7021 Y -7848.229 8538.874 -7848.0562 8541.2939 Y -7847.019 8543.3682 -7847.7104 8543.1943 Y -7848.2998 8543.1943 -7849.855 8543.1143 -7850.7822 8543.0635 C -7851.1226 8541.6689 -7852.6128 8540.4756 -7854.7217 8539.7695 C -7852.7578 8536.4775 -7854.5176 8535.7949 -7856.2935 8535.79 C -7856.3096 8535.7021 -7856.332 8535.6162 -7856.3599 8535.5332 C -7854.1089 8535.5791 -7853.6392 8533.2588 Y -7853.4048 8533.0635 -7853.1606 8532.7861 -7852.9238 8532.4756 C -7853.1416 8532.6475 -7853.2944 8532.7393 Y -7854.2583 8532.7393 -7855.8774 8534.4941 -7856.4966 8535.207 C -7856.9194 8534.4434 -7857.853 8533.9111 -7858.9434 8533.9111 c -7860.0698 8533.9111 -7861.0322 8534.4795 -7861.4312 8535.2852 C -7861.9985 8534.624 -7863.6968 8532.751 -7864.6943 8532.751 C -7864.8462 8532.6572 -7865.064 8532.4854 V -7864.8281 8532.7939 -7864.583 8533.0732 -7864.3481 8533.2686 C -7863.8638 8535.6563 -7861.5254 8535.5342 V -7861.5449 8535.5889 -7861.5674 8535.6436 -7861.5806 8535.7021 C -7864.9238 8535.6924 -7863.937 8538.3174 -7863.2104 8539.6602 C -7865.5918 8540.376 -7867.2646 8541.7012 -7867.5239 8543.25 C -7868.4473 8543.2998 -7869.6729 8543.3584 -7870.1802 8543.3584 C -7870.8726 8543.5313 -7869.835 8541.458 V -7869.6626 8539.0391 -7870.8726 8538.8662 V -7873.8096 8538.002 -7874.501 8538.6934 V -7875.1919 8539.5566 -7876.0562 8538.3467 V -7875.1919 8540.0752 -7873.291 8539.5566 V -7870.6982 8538.8662 -7871.3906 8540.5938 V -7871.9087 8544.0498 -7870.1802 8544.7402 V -7868.0342 8545.8545 -7866.2822 8546.0889 V -7865.9087 8546.4141 -7865.4639 8546.7109 -7864.958 8546.9766 C -7867.5562 8547.0469 -7870.2246 8547.9209 -7871.0752 8550.9561 C -7871.5151 8552.2432 -7872.0518 8554.2432 V -7873.1025 8554.8252 -7874.3022 8556.0078 -7875.541 8558.2627 C -7876.394 8561.4502 -7877.167 8556.7129 V -7878.3975 8553.6494 -7879.6504 8553.5381 V -7878.4702 8555.2871 -7878.9038 8556.416 V -7877.2998 8560.917 -7875.6138 8559.8994 V -7874.0986 8559.2197 -7872.688 8556.8154 V -7873.0698 8558.4971 -7873.4326 8560.417 -7873.6743 8562.3906 C -7874.4888 8562.3975 L -7876.3506 8561.4795 -7876.3262 8564.959 V -7877.1226 8568.9453 -7876.3594 8571.6826 V -7875.647 8574.1504 -7878.1274 8572.9307 V -7879.2842 8573.3242 -7879.9839 8572.7881 V -7882.3882 8571.4131 -7884 8573.124 V -7882.147 8572.8799 -7881.4482 8573.417 V -7879.9785 8573.5615 -7879.897 8574.1787 V -7876.9561 8574.8555 -7876.188 8574.0771 V -7874.417 8573.2139 -7875.1304 8570.3604 V -7875.8799 8562.4814 -7874.3198 8564.4053 V -7874.1182 8564.4219 -7873.8784 8564.5176 V -7874.1519 8568.4326 -7873.8018 8572.3252 -7871.9961 8574.8516 C -7875.4536 8567.333 -7870.2974 8552.3037 Y -7868.9609 8547.5303 -7863.127 8548.1016 -7860.145 8548.7344 C -7860.0718 8550.1299 -7859.8374 8551.9492 -7859.1318 8552.6553 C -7858.2134 8550.6963 -7858.2358 8549.0732 V -7857.0762 8548.7217 -7850.2817 8546.8447 -7847.4487 8550.3369 C -7848.4312 8547.8135 -7850.8262 8547.0186 -7853.2007 8546.9189 C -7852.667 8546.6318 -7852.2041 8546.3047 -7851.8257 8545.9502 C -7850.041 8545.7861 -7847.7104 8544.5771 Y -7845.9814 8543.8857 -7846.5015 8540.4307 Y -7847.1919 8538.7021 -7844.5991 8539.3936 Y -7842.7002 8539.9111 -7841.835 8538.1836 Y -7842.7002 8539.3936 -7843.3906 8538.5303 Y f -7837.9082 8572.9521 m -7838.6074 8573.4893 -7839.7632 8573.0938 Y -7842.2446 8574.3135 -7841.5327 8571.8467 Y -7840.769 8569.1104 -7841.564 8565.1221 Y -7841.541 8561.6445 -7843.4014 8562.5596 Y -7844.0342 8562.5557 L -7844.3198 8560.6123 -7844.7046 8558.7549 -7845.0898 8557.1699 C -7843.7129 8559.4199 -7842.2778 8560.0635 Y -7840.5913 8561.082 -7838.9878 8556.5791 Y -7839.4214 8555.4502 -7838.2417 8553.7021 Y -7839.4937 8553.8125 -7840.7246 8556.876 Y -7841.4976 8561.6152 -7842.3511 8558.4268 Y -7843.5776 8556.1904 -7844.769 8555.0098 -7845.814 8554.4229 C -7846.2026 8553.0635 -7846.4858 8552.2393 Y -7846.7002 8551.4727 -7847.0337 8550.8486 -7847.4487 8550.3369 C -7847.3799 8550.5127 -7847.3174 8550.6982 -7847.2632 8550.8916 C -7841.3022 8568.2588 -7846.4858 8574.9971 V -7853.2246 8584.5869 -7857.3721 8584.5869 V -7860.9663 8584.6514 L -7865.1138 8584.6514 -7871.853 8575.0615 Y -7871.9038 8574.9961 -7871.9463 8574.9219 -7871.9961 8574.8516 C -7871.7378 8575.4141 -7871.437 8575.9404 -7871.0752 8576.4092 C -7864.3359 8586 -7860.189 8586 V -7856.5942 8585.9346 L -7852.4482 8585.9346 -7845.709 8576.3447 Y -7843.5801 8573.5771 -7843.3306 8569.0176 -7843.7769 8564.6055 C -7843.6553 8564.5752 -7843.5698 8564.5684 Y -7842.0112 8562.6475 -7842.7598 8570.5244 Y -7843.4746 8573.3789 -7841.7026 8574.2402 Y -7840.9351 8575.0186 -7837.9946 8574.3428 Y -7837.9136 8573.7256 -7836.4434 8573.5811 Y -7835.7446 8573.0449 -7833.8921 8573.2881 Y -7835.5024 8571.5771 -7837.9082 8572.9521 Y f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 34) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.0254 8586.0264 m -7828.0542 8586.0264 L -7828.0542 8524.5342 L -7884.0254 8524.5342 L -7884.0254 8586.0264 L n u u 0 O 0.0745 0.9 0.9019 0.18 k 0 R 0 0 0 1 K 1 J 1 j 0.0518 w -7857.5991 8562.7217 m -7857.3594 8573.5215 -7862.8794 8583.8398 v -7862.4009 8586 -7860.959 8586 v -7861.2002 8582.6406 -7860.2393 8582.1611 v -7855.9199 8570.1602 -7856.6382 8562.2402 v -7857.5991 8562.7217 l b -7857.5991 8562.7217 m -7859.2793 8568 -7871.0391 8569.2012 v -7875.3594 8569.6807 -7875.5991 8571.1211 v -7869.1206 8561.5195 -7868.1602 8561.7607 v -7881.3594 8556.001 -7884 8550.7197 v -7878.959 8553.6006 -7875.5991 8551.4404 v -7867.6802 8551.2012 -7862.6406 8553.3613 v -7858.8008 8555.2813 -7866.7202 8539.2012 v -7862.8794 8550.9609 -7859.2793 8524.5605 v -7858.3198 8529.8408 -7856.8799 8531.2813 v -7850.8799 8538.9609 -7851.8398 8541.1211 v -7852.3198 8544.9609 -7847.7598 8538.7207 v -7848 8548.3213 -7850.4009 8551.6807 v -7852.5591 8555.2813 -7846.5591 8553.1211 v -7840.5591 8551.2012 -7835.2793 8552.8809 v -7829.7598 8554.3203 -7828.0801 8551.4404 v -7839.8398 8563.9209 -7845.5991 8563.6807 v -7843.9194 8567.2813 l -7841.519 8572.0811 -7842 8573.2813 v -7857.2681 8563.8828 -7857.5991 8562.7217 v b -7857.5991 8562.7217 m -7854.959 8544.2402 -7857.5991 8536.5605 v -7859.998 8526.001 -7859.2793 8524.5605 v S -7856.1602 8551.4404 m -7850.1602 8546.6406 -7848.959 8541.3604 v S -7856.1602 8550.7197 m -7865.0391 8543.041 -7866.7202 8539.2012 v S -7828.0801 8551.4404 m -7829.2793 8553.6006 -7857.3594 8561.7607 y -7862.4009 8556.2422 -7873.9199 8553.8408 v -7881.5986 8552.8809 -7884 8550.7197 v S -7874.6382 8569.6807 m -7863.1191 8560.5615 -7857.3594 8561.7607 y -7843.1992 8568 -7842 8573.2813 v S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 36) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.8496 8585.9961 m -7833.96 8585.9961 L -7833.96 8534.9258 L -7883.8496 8534.9258 L -7883.8496 8585.9961 L n u 0 O 0.025 0.1 0.475 0 k -7862.1504 8553.9043 m -7864.4766 8552.8125 -7866.6914 8552.4434 -7868.373 8552.9238 c -7869.0518 8553.1172 -7869.645 8553.4473 -7870.123 8553.9238 c -7870.6006 8554.4023 -7870.9297 8554.9951 -7871.123 8555.6729 c -7872.0088 8558.7715 -7870.0103 8563.6777 -7865.9233 8567.7666 c -7861.834 8571.8535 -7856.9297 8573.8516 -7853.8286 8572.9668 c -7853.1519 8572.7715 -7852.5586 8572.4424 -7852.0806 8571.9658 c -7851.603 8571.4883 -7851.2754 8570.8955 -7851.082 8570.2168 c -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.582 8561.21 -7854.791 8559.6133 -7856.2793 8558.123 c -7858.1504 8556.2539 -7860.1914 8554.8242 -7862.1504 8553.9043 c f u 0.0035 0.014 0.0665 0 k -7861.2183 8552.9727 m -7863.8306 8552.0215 -7866.3975 8551.9688 -7868.373 8552.9238 C -7866.6914 8552.4434 -7864.4766 8552.8125 -7862.1504 8553.9043 c -7861.6191 8554.1543 -7861.0806 8554.4434 -7860.543 8554.7676 C -7858.8984 8554.0537 L -7859.667 8553.6172 -7860.4434 8553.2539 -7861.2183 8552.9727 c f 0.015 0.06 0.285 0 k -7858.8984 8554.0537 m -7860.543 8554.7676 L -7859.0962 8555.6348 -7857.6426 8556.7607 -7856.2793 8558.123 c -7856.1538 8558.25 -7856.0327 8558.3779 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7856.3706 8555.7236 -7857.6191 8554.7813 -7858.8984 8554.0537 C f U u 0.039 0.156 0.741 0 k -7849.687 8541.4043 m -7849.9746 8541.6914 -7861.2183 8552.9727 Y -7860.4434 8553.2539 -7859.667 8553.6172 -7858.8984 8554.0537 C -7845.4146 8540.5703 L -7847.061 8540.0996 -7848.6406 8540.3555 -7849.687 8541.4043 c f 0.025 0.1 0.475 0 k -7845.4146 8540.5703 m -7858.8984 8554.0537 L -7857.584 8554.8027 -7856.2969 8555.7754 -7855.1143 8556.957 c -7855.084 8556.9863 -7855.0586 8557.0156 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7841.5264 8543.1328 -7841.7202 8542.9141 -7841.9302 8542.7012 c -7843.0103 8541.623 -7844.2305 8540.9082 -7845.4146 8540.5703 C f U u 0.0115 0.046 0.2185 0 k -7835.9346 8550.3926 m -7833.5337 8547.9893 -7833.335 8544.0898 -7835.1382 8540.6973 C -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f 0.015 0.06 0.285 0 k -7843.5337 8535.5957 m -7842.582 8534.9258 L -7845.2046 8534.3516 -7847.8306 8534.9141 -7849.6206 8536.7061 c -7848.1719 8535.2578 -7845.9082 8534.9307 -7843.5337 8535.5957 C f 0.0295 0.118 0.5605 0 k -7843.5337 8535.5957 m -7845.9082 8534.9307 -7848.1719 8535.2578 -7849.6206 8536.7061 c -7851.019 8538.1055 -7851.3706 8540.2637 -7850.7954 8542.5469 C -7848.8672 8539.5449 -7845.4082 8540.5537 V -7843.585 8535.6309 L -7843.5337 8535.5957 L f *u 0.048 0.192 0.912 0 k 1 D -7835.9346 8550.3926 m -7837.2817 8551.7383 -7839.332 8552.1133 -7841.5234 8551.627 C -7851.6714 8561.7734 L -7851.7695 8561.5684 -7851.7695 8561.5684 -7851.6714 8561.7734 c -7850.2246 8564.8145 -7849.9702 8567.916 -7851.082 8570.2168 C -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.5054 8561.3438 -7854.5918 8559.8848 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7855.1816 8556.8945 -7855.1465 8556.9238 -7855.1143 8556.957 c -7855.084 8556.9883 -7855.0566 8557.0176 -7855.0273 8557.0469 c -7855.0278 8557.0469 -7855.0278 8557.0469 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7836.3262 8541.1289 L -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f *U 0.0215 0.086 0.4085 0 k 0 D -7842.582 8534.9258 m -7843.5337 8535.5957 L -7841.6846 8536.1113 -7839.7656 8537.2285 -7838.1138 8538.8828 c -7837.4063 8539.5889 -7836.7998 8540.3418 -7836.2954 8541.1182 C -7835.1382 8540.6973 L -7835.6553 8539.7246 -7836.3374 8538.793 -7837.1802 8537.9512 c -7838.7695 8536.3594 -7840.6758 8535.3428 -7842.582 8534.9258 C f 0.0205 0.082 0.3895 0 k -7836.2954 8541.1182 m -7836.7998 8540.3418 -7837.4063 8539.5889 -7838.1138 8538.8828 c -7839.7656 8537.2285 -7841.6846 8536.1113 -7843.5337 8535.5957 C -7843.585 8535.6309 L -7845.4082 8540.5537 L -7844.2114 8540.9219 -7842.9878 8541.6436 -7841.9302 8542.7012 c -7841.7202 8542.9141 -7841.5264 8543.1328 -7841.3408 8543.3574 C -7836.3262 8541.1289 L -7836.2954 8541.1182 L f U u 0.445 0.356 0.267 0 k -7883.8496 8585.9961 m -7861.957 8562.9688 L -7862.2007 8562.6494 -7862.5752 8562.6133 -7862.8887 8562.6592 C -7867.1802 8567.2891 -7878.3145 8579.4561 -7882.7266 8584.2793 C -7883.5649 8585.3516 -7884 8585.9932 -7883.8496 8585.9961 C f 0.15 0.12 0.09 0 k -7883.834 8585.9961 m -7882.6606 8585.7031 -7861.6934 8564.0029 Y -7861.6934 8563.502 -7861.7993 8563.1758 -7861.957 8562.9688 C -7883.8496 8585.9961 L -7883.8442 8585.9961 -7883.8418 8586 -7883.834 8585.9961 c f 0.2 0.16 0.12 0 k -7882.7266 8584.2793 m -7878.3145 8579.4561 -7867.1802 8567.2891 -7862.8887 8562.6592 C -7863.2002 8562.7041 -7863.4526 8562.8301 Y -7864.603 8563.1328 -7878.5742 8578.9619 -7882.7266 8584.2793 C f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 37) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7882.9502 8585.2324 m -7833.0391 8585.2324 L -7833.0391 8521.1152 L -7882.9502 8521.1152 L -7882.9502 8585.2324 L n u 0 O 0 0 0 1 k 0 R 0 0 0 1 K 0 w -7833.2358 8521.1152 m -7833.6064 8521.248 -7833.9858 8521.2832 -7834.3833 8521.2031 c -7834.4863 8521.168 l -7834.5254 8521.1602 -7834.5703 8521.1787 -7834.6025 8521.1992 c -7834.9434 8521.3926 l -7838.7129 8523.2959 -7842.0962 8525.8965 -7844.5 8529.4473 c -7845.9634 8531.5918 -7847.123 8533.8789 -7848.7993 8535.8564 c -7849.1729 8536.209 -7849.1758 8536.7725 -7848.834 8537.1309 c -7848.4951 8537.501 -7847.918 8537.5078 -7847.561 8537.165 c -7847.4038 8537.21 l -7847.2642 8537.1289 -7847.0742 8537.0703 -7847.0234 8536.957 c -7845.853 8534.2031 -7845.1895 8531.5137 -7843.4336 8529.1387 c -7841.1719 8526.0947 -7838.1777 8523.9941 -7835.0298 8522.0234 c -7834.3672 8521.6055 L -7834.4966 8521.6348 L -7833.7695 8521.6426 l -7833.791 8521.6113 -7833.8008 8521.5957 -7833.8223 8521.5645 C -7833.6064 8521.5234 -7833.377 8521.4746 -7833.1626 8521.4336 c -7833.0762 8521.4238 -7833.0186 8521.3389 -7833.0391 8521.2383 c -7833.0503 8521.1523 -7833.1382 8521.1084 -7833.2358 8521.1152 c -7833.2358 8521.1152 l b -7849.2222 8534.9951 m -7849.5742 8534.8066 -7849.9658 8534.6719 -7850.248 8534.3887 c -7856.4521 8528.1719 -7866.6802 8527.2734 -7874.0488 8533.6855 C -7874.1582 8533.7813 -7874.1582 8533.957 -7874.063 8534.0645 C -7871.0527 8532.9434 -7862.8838 8534.375 -7859.3223 8537.4121 C -7859.2534 8537.4668 -7859.1465 8537.4531 -7859.1055 8537.3711 C -7859.0503 8537.3047 -7859.0664 8537.1953 -7859.1328 8537.1563 C -7862.5625 8534.0859 -7867.0674 8532.29 -7871.6729 8532.748 C -7868.8535 8531.1855 -7865.6313 8530.4941 -7862.3984 8530.6885 c -7857.7144 8530.9717 -7853.4634 8533.1191 -7849.3711 8535.2793 c -7849.291 8535.3193 -7849.1978 8535.293 -7849.1553 8535.2109 C -7849.1016 8535.1309 -7849.1426 8535.0352 -7849.2222 8534.9951 c b -7858.647 8536.3359 m -7860.2266 8540.3613 -7862.3911 8544.3203 -7865.8018 8547.0762 c -7865.9648 8547.2119 -7865.9946 8547.4492 -7865.8711 8547.6055 c -7865.7344 8547.7676 -7865.5049 8547.7793 -7865.3481 8547.6563 c -7861.123 8545.5967 -7858.1904 8541.1309 -7858.1626 8536.4014 c -7858.1626 8536.4014 l -7858.1328 8536.2676 -7858.2354 8536.1348 -7858.3633 8536.1221 c -7858.5039 8536.1055 -7858.6318 8536.1973 -7858.647 8536.3359 c -7858.647 8536.3359 l b -7852.9414 8541.0176 m -7853.042 8541.1816 -7853.1152 8541.3838 -7853.2617 8541.4824 c -7856.0806 8543.3906 -7858.9785 8544.6309 -7861.8848 8546.1328 c -7862.0503 8546.209 -7862.1118 8546.418 -7862.0313 8546.5703 c -7861.9512 8546.7227 -7861.7559 8546.7793 -7861.5898 8546.7041 c -7858.439 8545.3232 -7854.313 8544.5 -7852.6729 8541.1797 c -7852.6289 8541.1113 -7852.6455 8541.0146 -7852.7266 8540.9648 c -7852.7959 8540.9199 -7852.897 8540.9492 -7852.9414 8541.0176 c -7852.9414 8541.0176 l b -7852.6602 8541.918 m -7852.4438 8542.4297 -7852.1431 8542.8896 -7852.0503 8543.4355 c -7851.2183 8548.2773 -7851.1152 8553.042 -7852.248 8557.6875 c -7852.248 8557.6875 l -7852.3418 8557.9531 -7852.2114 8558.2441 -7851.9438 8558.3389 c -7851.6777 8558.4336 -7851.3882 8558.3125 -7851.2935 8558.0479 c -7849.293 8552.8115 -7849.897 8546.7373 -7852.3711 8541.7832 c -7852.4063 8541.7002 -7852.498 8541.6689 -7852.582 8541.6914 c -7852.6641 8541.7275 -7852.6978 8541.835 -7852.6602 8541.918 c -7852.6602 8541.918 l b -7851.5352 8557.5938 m -7848.8984 8555.2275 -7846.6816 8552.252 -7845.853 8548.7363 c -7845.853 8548.7363 l -7845.7246 8548.1816 -7846.0742 8547.623 -7846.6416 8547.4902 c -7847.1992 8547.375 -7847.7578 8547.7246 -7847.8862 8548.2793 c -7848.5649 8551.5313 -7849.8711 8554.6729 -7851.7954 8557.3867 c -7851.7954 8557.3867 l -7851.8462 8557.4551 -7851.834 8557.5576 -7851.7695 8557.6201 c -7851.6992 8557.6699 -7851.5977 8557.6582 -7851.5352 8557.5938 c -7851.5352 8557.5938 l b -7836.3711 8550.1826 m -7837.7114 8545.8301 -7840.2598 8542.0693 -7843.689 8539.1533 C -7843.729 8539.0723 -7843.8242 8539.0322 -7843.9038 8539.0859 C -7843.9863 8539.127 -7844.0122 8539.2207 -7843.9722 8539.3018 C -7843.957 8539.7891 -7843.7144 8540.2334 -7843.4458 8540.5313 c -7838.4063 8546.1621 -7834.9902 8554.7197 -7837.3433 8561.9551 C -7837.0762 8556.4512 -7838.7241 8550.3008 -7842.1362 8545.6738 c -7843.1606 8544.2695 -7844.7422 8544.1211 -7846.3081 8544.2031 C -7846.4023 8544.1895 -7846.4834 8544.2432 -7846.4961 8544.3369 c -7846.5098 8544.4189 -7846.4551 8544.5137 -7846.3623 8544.5254 C -7843.1479 8545.7695 -7841.4878 8549.2246 -7840.084 8552.1943 c -7838.415 8555.7441 -7837.7017 8559.6387 -7838.0054 8563.5 C -7838.0454 8563.6777 -7838.1138 8565.3975 -7837.9775 8565.4102 C -7837.8306 8565.4395 -7837.709 8565.3438 -7837.6802 8565.1943 C -7837.645 8565.0449 -7834.6426 8555.7988 -7836.3711 8550.1826 c b -7844.4863 8537.4912 m -7843.3945 8533.6211 -7841.1094 8530.251 -7838.4824 8527.2383 c -7838.3306 8527.1045 -7838.3145 8526.8867 -7838.4502 8526.7354 c -7838.5752 8526.6006 -7838.8047 8526.582 -7838.957 8526.7178 c -7842.3306 8529.332 -7843.4487 8533.541 -7844.7954 8537.375 c -7844.7954 8537.375 l -7844.8262 8537.4648 -7844.7754 8537.5586 -7844.6982 8537.5869 c -7844.6094 8537.6191 -7844.5166 8537.5684 -7844.4863 8537.4912 c -7844.4863 8537.4912 l b -7838.5313 8562.1094 m -7838.5991 8562.0566 -7838.707 8562.083 -7838.748 8562.1504 C -7838.9634 8562.4746 -7840.6914 8564.5195 -7841.3926 8565.1406 c -7846.1719 8569.3945 -7849.5137 8573.9609 -7857.5391 8577.7227 c -7864.4512 8580.9639 -7867.1113 8583.5957 -7874.3862 8581.8262 c -7877.687 8581.0293 -7879.0313 8580.5313 -7880.4351 8575.4551 C -7881.9473 8569.2988 -7880.8672 8571.7832 -7881.084 8564.4385 c -7881.2222 8559.6973 -7884 8548.4551 -7871.5254 8534.2598 C -7871.4199 8534.1484 -7871.4336 8533.9961 -7871.5337 8533.9072 C -7871.6328 8533.8027 -7871.7959 8533.8164 -7871.8862 8533.916 C -7877.5786 8538.7168 -7881.0234 8545.6582 -7882.3145 8552.9424 c -7883.2871 8558.4668 -7882.9199 8563.25 -7882.666 8569.6367 c -7882.5688 8572.0938 -7883.6855 8579.0723 -7878.9102 8583.0625 c -7875.3926 8586 -7870.3911 8585.5469 -7866.3545 8584.1563 c -7860.6992 8582.2119 -7855.9727 8579.1465 -7850.8711 8575.6094 c -7847.2656 8573.125 -7839.2881 8563.2852 -7838.4785 8562.3262 C -7838.4351 8562.2588 -7838.4502 8562.1504 -7838.5313 8562.1094 C b -7873.0503 8549.3057 m -7872.168 8548.5029 -7871.7017 8549.8457 -7871.4297 8550.6016 c -7871.1626 8551.3574 -7870.189 8551.25 -7870.5127 8551.5732 c -7870.8369 8551.8975 -7870.8369 8551.9521 -7871.3232 8551.5195 c -7871.8086 8551.0879 -7871.8086 8551.7363 -7872.5649 8551.25 c -7873.3198 8550.7627 -7873.645 8549.8457 -7873.0503 8549.3057 c b -7865.6519 8553.9492 m -7865.3657 8553.5918 -7864.6802 8553.5723 -7864.4648 8553.8945 c -7864.25 8554.2197 -7863.3306 8554.2734 -7863.4937 8554.5967 c -7863.6543 8554.9219 -7863.6016 8555.1387 -7864.0874 8554.9219 c -7864.5737 8554.7051 -7864.4121 8555.2998 -7864.897 8555.084 c -7865.3833 8554.8672 -7865.8687 8554.2197 -7865.6519 8553.9492 c b -7857.6074 8559.0791 m -7857.1206 8558.7559 -7855.8794 8559.5117 -7856.4727 8559.5117 c -7857.0674 8559.5117 -7856.311 8560.2676 -7856.8521 8560.4834 c -7857.3906 8560.6992 -7857.2832 8560.4297 -7857.6074 8560.6445 c -7857.9297 8560.8613 -7858.3633 8561.2393 -7858.5239 8560.4297 c -7858.6855 8559.6191 -7858.3633 8559.6191 -7857.9849 8559.3496 c -7857.6074 8559.0791 -7857.6074 8559.0791 y b -7872.2402 8559.3496 m -7871.1074 8559.2422 -7871.8633 8559.998 -7871.269 8560.4834 c -7870.6738 8560.9697 -7869.918 8561.6172 -7870.729 8561.4004 c -7871.5391 8561.1855 -7872.9961 8561.6719 -7872.9434 8560.5381 c -7872.8887 8559.4033 -7872.6328 8559.3867 -7872.2402 8559.3496 c b -7866.5703 8567.6113 m -7866.1016 8567.3438 -7866.6802 8567.7197 -7866.0303 8567.6113 c -7865.3833 8567.5039 -7864.7886 8567.6113 -7865.2207 8567.8281 c -7865.6519 8568.0439 -7866.3008 8568.1523 -7866.4634 8567.9893 c -7866.625 8567.8281 -7866.9473 8567.8281 -7866.5703 8567.6113 c b -7857.0674 8567.1797 m -7857.4785 8566.1797 -7856.0962 8566.4238 -7855.4473 8566.7461 c -7854.7998 8567.0723 -7853.8262 8566.4775 -7854.4209 8566.9102 c -7855.0137 8567.3418 -7854.7998 8566.9102 -7855.3926 8567.2334 c -7855.9873 8567.5566 -7856.6895 8568.0977 -7857.0674 8567.1797 c b -7872.6738 8573.0664 m -7872.7222 8572.0752 -7871.8086 8572.957 -7871.269 8573.0117 c -7870.729 8573.0664 -7870.0801 8573.0664 -7870.2432 8573.2813 c -7870.4038 8573.498 -7870.459 8573.498 -7871.1626 8573.7129 c -7871.8633 8573.9297 -7872.6191 8574.1445 -7872.6738 8573.0664 c b -7873.1582 8567.6113 m -7874.0664 8567.9746 -7874.293 8567.8809 -7874.5625 8568.2051 c -7874.834 8568.5293 -7875.1558 8569.2314 -7875.5352 8568.0977 c -7875.9121 8566.9629 -7875.4282 8565.7764 -7875.0479 8565.9375 c -7874.6714 8566.0996 -7874.293 8566.7461 -7873.8618 8566.9629 c -7873.4297 8567.1797 -7872.6191 8567.3945 -7873.1582 8567.6113 c b U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 41) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7803 8586 L -7803 8481 L -7884 8481 L -7884 8586 L n u u u 0 O 0 0 0 1 k -7865.8057 8498.4258 m -7866.0742 8496.6621 -7867.1602 8495.291 -7868.5239 8495.3965 c -7869.8862 8495.502 -7870.707 8497.0234 -7870.7432 8498.8066 c -7870.748 8499.0693 -7870.6743 8500.2441 -7870.6304 8500.4775 C -7870.6382 8500.582 -7870.6191 8500.6738 -7870.6104 8500.7803 c -7870.5142 8502.0254 -7869.3574 8503.3604 -7867.9414 8503.25 c -7866.5249 8503.1406 -7865.4897 8501.8613 -7865.6367 8500.4727 c -7865.644 8500.4072 -7865.6958 8499.626 -7865.707 8499.5625 C -7865.6816 8499.2852 -7865.7598 8498.7256 -7865.8057 8498.4258 c f -7876.2646 8507.7334 m -7876.9946 8515.916 -7871.5015 8515.1191 v -7868.3682 8514.0186 -7869.4414 8511.1211 v -7869.6426 8509.752 -7871.7847 8508.498 v -7872.146 8508.25 -7872.7632 8507.1016 v -7873.1294 8505.5977 -7874.5186 8505.2979 v -7876.0762 8505.251 -7876.2646 8507.7334 v f -7850.7646 8516.4971 m F -7850.0762 8514.3408 m -7850.7847 8513.1934 -7853.8848 8513.6279 Y -7854.811 8513.6885 -7855.3799 8513.1113 Y -7857.8394 8509.0918 -7861.0386 8509.8857 -7861.4082 8509.9932 C -7861.4097 8509.9863 L -7864.999 8510.6045 -7865.2666 8515.6035 V -7865.4912 8516.3828 -7866.335 8516.7695 V -7869.2695 8517.8613 -7869.3481 8519.208 V -7869.8999 8521.1152 -7867.6006 8521.7422 V -7865.6792 8522.2568 -7863.7886 8519.8945 V -7862.6113 8518.6797 -7859.5762 8517.9395 V -7859.5728 8517.9531 L -7856.3594 8517.0459 -7854.6392 8517.5889 Y -7851.8521 8518.7676 -7850.4063 8517.4014 Y -7848.6826 8515.7559 -7850.0762 8514.3408 Y f -7863.9834 8497.8789 m -7864.5854 8496.2002 -7864.2822 8494.4775 -7863.0327 8493.9229 c -7861.7842 8493.3672 -7860.3384 8494.3164 -7859.4585 8495.8672 c -7859.3286 8496.0957 -7858.8359 8497.165 -7858.7632 8497.3906 C -7858.7065 8497.4785 -7858.6792 8497.5684 -7858.6362 8497.667 c -7858.1289 8498.8086 -7858.5122 8500.5303 -7859.8105 8501.1074 c -7861.1089 8501.6855 -7862.6279 8501.0527 -7863.1582 8499.7617 c -7863.1831 8499.7002 -7863.5078 8498.9883 -7863.5298 8498.9268 C -7863.6831 8498.6963 -7863.8809 8498.166 -7863.9834 8497.8789 c f -7849.7129 8500.9316 m -7845.1802 8507.7822 -7850.3911 8509.6943 v -7853.6714 8510.2168 -7854.103 8507.1572 v -7854.5786 8505.8564 -7853.29 8503.7354 v -7853.0903 8503.3447 -7853.0938 8502.04 v -7853.4858 8500.5449 -7852.4082 8499.6182 v -7851.0591 8498.8359 -7849.7129 8500.9316 v f U u -7824.7358 8550.1074 m -7824.3687 8548.3623 -7824.9048 8546.6963 -7826.2183 8546.3164 c -7827.5322 8545.9375 -7828.8345 8547.0752 -7829.4937 8548.7324 c -7829.5903 8548.9775 -7829.9326 8550.1025 -7829.9746 8550.3369 C -7830.0176 8550.4326 -7830.0322 8550.5244 -7830.0625 8550.6279 c -7830.4087 8551.8271 -7829.7935 8553.4805 -7828.4282 8553.875 c -7827.063 8554.2695 -7825.645 8553.4365 -7825.2969 8552.085 c -7825.2793 8552.0205 -7825.0552 8551.2705 -7825.0425 8551.207 C -7824.9214 8550.9551 -7824.7983 8550.4053 -7824.7358 8550.1074 c f -7838.2705 8554.6172 m -7841.8242 8562.0244 -7836.3999 8563.2061 v -7833.0801 8563.2754 -7833.0688 8560.1846 v -7832.7778 8558.8311 -7834.3433 8556.9072 v -7834.5942 8556.5459 -7834.7695 8555.2539 v -7834.5854 8553.7188 -7835.7793 8552.9492 v -7837.2222 8552.3594 -7838.2705 8554.6172 v f -7817.4648 8571.7695 m F -7816.063 8569.9912 m -7816.3247 8568.6689 -7819.3799 8567.9883 Y -7820.27 8567.7197 -7820.5986 8566.9795 Y -7821.4922 8562.3535 -7824.7666 8561.9746 -7825.1494 8561.9453 C -7825.1494 8561.9395 L -7828.7271 8561.2588 -7830.731 8565.8467 V -7831.2153 8566.4961 -7832.1416 8566.5625 V -7835.272 8566.5557 -7835.8169 8567.7891 V -7837.0039 8569.3809 -7835.0713 8570.7764 V -7833.4526 8571.9316 -7830.853 8570.3818 V -7829.3242 8569.6582 -7826.2222 8570.0293 V -7826.2231 8570.042 L -7822.896 8570.3213 -7821.4766 8571.4326 Y -7819.2793 8573.5146 -7817.4463 8572.7432 Y -7815.2554 8571.8057 -7816.063 8569.9912 Y f -7822.8374 8550.2354 m -7822.813 8548.4512 -7821.9258 8546.9453 -7820.5601 8546.8633 c -7819.1943 8546.7803 -7818.1743 8548.1768 -7817.895 8549.9385 c -7817.854 8550.1973 -7817.7666 8551.3711 -7817.7778 8551.6094 C -7817.7559 8551.7109 -7817.7617 8551.8037 -7817.7559 8551.9121 c -7817.6807 8553.1592 -7818.644 8554.6367 -7820.0625 8554.7217 c -7821.4814 8554.8066 -7822.6826 8553.6826 -7822.7246 8552.2871 c -7822.7271 8552.2217 -7822.7822 8551.4404 -7822.7798 8551.375 C -7822.8433 8551.1045 -7822.8423 8550.54 -7822.8374 8550.2354 c f -7811.0186 8557.5625 m -7809.1777 8565.5684 -7814.7271 8565.5303 v -7817.9834 8564.8691 -7817.3154 8561.8516 v -7817.3032 8560.4668 -7815.353 8558.9326 v -7815.0278 8558.6377 -7814.5742 8557.415 v -7814.417 8555.876 -7813.083 8555.3877 v -7811.5454 8555.1279 -7811.0186 8557.5625 v f U U 1 Ap -7884 8586 m -7884 8481 L -7803 8481 L -7803 8586 L -7884 8586 L n U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 42) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 45) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8543.918 m -7885 8587 L -7798.2217 8587 L -7798.2217 8543.918 L -7885 8543.918 L n u u 0 O 0 0 0 1 k -7825.2217 8573.2363 m -7825.2217 8581.0742 L -7813.2217 8574.1445 L -7801.2217 8567.2168 L -7813.2217 8560.2891 L -7825.2217 8553.3613 L -7825.2217 8561.4824 L -7883.9351 8547.7168 L -7870.9878 8566.8027 L -7885 8587 L -7825.2217 8573.2363 L f 0 1 1 0.1 k 0 R 0 0 0 1 K -7823.2217 8570.2363 m -7823.2217 8578.0742 L -7811.2217 8571.1445 L -7799.2217 8564.2168 L -7811.2217 8557.2891 L -7823.2217 8550.3613 L -7823.2217 8558.4824 L -7881.9351 8544.7168 L -7867.2754 8564.3594 L -7881.9351 8584 L -7823.2217 8570.2363 L b U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 50) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7756.877 8586 L -7756.877 8538.415 L -7884 8538.415 L -7884 8586 L n u *u 0 O 0.9529 0.949 0.1961 0.0745 k -7857.793 8570.417 m -7857.8232 8570.2676 L -7859.9849 8564.3643 -7860.9438 8561.6377 -7861.2754 8560.2891 c -7861.3657 8560.2891 L -7861.6953 8561.6074 -7862.7754 8564.335 -7864.9673 8570.2676 c -7864.9966 8570.417 L -7857.793 8570.417 l f 1 D -7868.1182 8578.9678 m -7869.6191 8582.5371 -7870.3994 8584.709 -7868.1182 8584.917 c -7868.1182 8585.9678 L -7870.6992 8585.9375 -7873.5806 8585.917 -7876.3418 8585.917 c -7880.0649 8585.917 -7882.5273 8585.9375 -7884 8585.9678 c -7884 8584.917 L -7882.1064 8584.709 -7881.0542 8582.5674 -7873.5513 8565.5029 c -7861.6953 8538.415 L -7859.8638 8538.415 L -7848.1582 8565.5029 L -7840.8047 8582.5078 -7839.7246 8584.709 -7837.8887 8584.917 c -7837.8887 8585.9678 L -7839.5142 8585.9375 -7841.916 8585.917 -7845.5767 8585.917 c -7848.5488 8585.917 -7851.6694 8585.9375 -7854.7026 8585.9678 c -7854.7026 8584.917 L -7852.481 8584.709 -7853.3218 8582.5078 -7854.7617 8578.9678 C -7868.1182 8578.9678 l f *U *u 0 D -7813.0762 8554.0811 m -7813.0762 8550.4717 -7815.3535 8548.0947 -7819.1294 8548.0947 c -7820.2383 8548.0947 -7821.0767 8548.2158 -7821.5273 8548.2451 c -7821.5273 8560.5479 L -7820.8672 8560.6084 -7820.208 8560.6084 -7819.729 8560.6084 c -7818.2002 8560.6084 -7816.7026 8560.127 -7815.6841 8559.4053 c -7814.3945 8558.5332 -7813.0762 8556.7881 -7813.0762 8554.1416 C -7813.0762 8554.0811 l f 1 D -7832.0806 8558.3926 m -7832.0806 8542.6445 -7832.0806 8540.4287 -7834.542 8540.2783 c -7834.542 8539.3184 L -7833.042 8539.2588 -7830.3174 8539.1992 -7827.5664 8539.1689 c -7825.6538 8539.1084 -7822.3945 8539.0186 -7820.1479 8538.9775 c -7816.582 8538.9775 -7813.585 8539.4258 -7811.0049 8540.2627 c -7806.353 8541.8477 -7801.9702 8545.8525 -7801.9702 8553.6602 c -7801.9702 8558.7432 -7804.4014 8562.3193 -7806.5034 8564.0605 c -7807.583 8565.0215 -7808.8135 8565.832 -7809.7744 8566.3125 c -7809.7744 8566.4629 L -7807.5234 8569.4912 -7805.6025 8572.0625 -7799.3906 8580.6426 c -7797.5 8583.0645 -7795.9102 8584.7383 -7794.7402 8584.9775 c -7794.7402 8586 L -7796.6602 8586 -7799 8585.8848 -7801.1294 8585.8848 c -7803.3511 8585.8848 -7804.8521 8586 -7806.4424 8586 c -7807.6729 8586 -7808.7241 8585.9404 -7809.5039 8585.2725 c -7813.0151 8579.8477 -7816.9121 8573.7559 -7820.1182 8568.7139 c -7820.5078 8568.7139 -7820.957 8568.7139 -7821.5273 8568.7139 c -7821.5273 8571.2852 L -7821.5273 8582.5264 -7821.437 8584.7686 -7819.1895 8584.9775 c -7819.1895 8585.9697 L -7820.6279 8585.9404 -7823.9194 8585.915 -7826.6992 8585.915 c -7829.9287 8585.915 -7832.8921 8585.9404 -7834.5122 8585.9697 c -7834.5122 8584.9775 L -7832.0518 8584.7686 -7832.0806 8582.5264 -7832.0806 8565.5918 C -7832.0806 8558.3926 l f *U *u 0 D -7781.4561 8565.5928 m -7781.4561 8582.4941 -7781.4561 8584.6484 -7784.2832 8584.9775 C -7784.2832 8585.9697 l -7782.3887 8585.9404 -7779.0542 8585.915 -7775.7822 8585.915 c -7772.6294 8585.915 -7769.5688 8585.9404 -7767.2881 8585.9697 C -7767.2881 8584.9775 l -7770.2578 8584.9775 -7770.2881 8582.5244 -7770.2881 8565.5928 C -7770.2881 8548.1514 L -7762.8193 8548.1514 l -7759.999 8548.1514 -7758.5298 8548.96 -7757.8994 8551.2627 C -7756.9072 8551.2627 l -7756.9072 8546.4697 -7756.877 8542.415 -7756.877 8539.1709 c -7761.3486 8539.2012 -7766.748 8539.2314 -7772.0601 8539.2314 C -7779.7446 8539.2314 l -7784.5537 8539.2314 -7789.9966 8539.2012 -7794.9614 8539.1709 c -7794.9614 8542.3848 -7794.9326 8546.4697 -7794.9326 8551.2627 C -7793.9072 8551.2627 l -7793.3657 8549.1094 -7791.771 8548.1514 -7788.9438 8548.1514 C -7781.4561 8548.1514 l -7781.4561 8565.5928 L f *U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 62) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8569.9043 m -7846.7305 8561.3408 L -7885 8561.3408 L -7885 8569.9043 L -7846.7305 8569.9043 L f -7846.7305 8573.0967 m -7846.7305 8572.4229 L -7885 8572.4229 L -7885 8573.0967 L -7846.7305 8573.0967 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 63) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8565.8262 m -7846.7305 8574.3896 L -7859.3408 8574.3896 L -7859.3408 8587 L -7867.9038 8587 L -7867.9063 8565.8262 L -7867.9038 8565.8262 L -7867.9038 8565.8252 L -7846.7305 8565.8262 L f -7846.7305 8563.3076 m -7870.4233 8563.3076 L -7870.4233 8587 L -7871.0967 8587 L -7871.0977 8562.6328 L -7846.7305 8562.6328 L -7846.7305 8563.3076 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 64) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8586.999 m -7885 8548.7285 L -7846.7305 8548.7285 L -7846.7305 8586.999 L -7885 8586.999 L n 0 O 1 0.14 0.09 0 k -7846.7305 8561.3389 m -7872.3896 8561.3389 L -7872.3896 8586.999 L -7863.8262 8587 L -7863.8262 8569.9033 L -7846.7305 8569.9033 L -7846.7305 8561.3389 L f -7846.7305 8572.4219 m -7861.3081 8572.4219 L -7861.3081 8587 L -7860.6338 8587 L -7860.6338 8573.0957 L -7846.7305 8573.0957 L -7846.7305 8572.4219 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 65) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.0625 8559.4609 m -7884.6025 8559.4609 L -7884.6025 8587 L -7857.0625 8587 L -7857.0625 8559.4609 L n 0 O 0 0.55 1 0.12 k -7856.8418 8572.7002 m -7885 8572.7002 L -7885 8573.8252 L -7856.8418 8573.8252 L -7856.8418 8572.7002 L f u 0 0.55 1 0.3 k -7883.9814 8560.5215 m -7884.4102 8562.5254 -7883.1865 8566.1514 -7880.0874 8569.251 c -7876.9878 8572.3496 -7873.3457 8573.6602 -7871.3594 8573.1455 C -7871.3594 8573.1455 L -7870.875 8571.1895 -7872.1519 8567.5117 -7875.25 8564.4141 c -7878.3457 8561.3184 -7882.0122 8560.1064 -7883.9814 8560.5215 C f 0 0.39 0.7 0.12 k -7883.9814 8585.9912 m -7884.4102 8583.9883 -7883.1865 8580.3613 -7880.0874 8577.2617 c -7876.9878 8574.1641 -7873.3457 8572.8535 -7871.3594 8573.3672 C -7871.3594 8573.3672 L -7870.875 8575.3242 -7872.1519 8579.001 -7875.25 8582.0996 c -7878.3457 8585.1953 -7882.0122 8586.4063 -7883.9814 8585.9912 C f U u 0 0.55 1 0.3 k -7870.1782 8585.9912 m -7870.6074 8583.9883 -7869.3838 8580.3613 -7866.2842 8577.2617 c -7863.1855 8574.1641 -7859.543 8572.8535 -7857.5576 8573.3672 C -7857.5566 8573.3672 L -7857.0718 8575.3242 -7858.3496 8579.001 -7861.4473 8582.0996 c -7864.543 8585.1953 -7868.209 8586.4063 -7870.1782 8585.9912 C f 0 0.39 0.7 0.12 k -7870.1782 8560.5215 m -7870.6074 8562.5254 -7869.3838 8566.1514 -7866.2842 8569.251 c -7863.1855 8572.3496 -7859.543 8573.6602 -7857.5576 8573.1455 C -7857.5566 8573.1455 L -7857.0718 8571.1895 -7858.3496 8567.5117 -7861.4473 8564.4141 c -7864.543 8561.3184 -7868.209 8560.1064 -7870.1782 8560.5215 C f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 67) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 69) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.4609 m -7885 8559.4609 L -7885 8587 L -7857.4609 8587 L -7857.4609 8559.4609 L n 0 O 0 0.55 1 0.3 k -7875.4233 8573.252 m -7874.3096 8571.5313 -7870.8809 8569.833 -7866.4966 8569.833 c -7862.1152 8569.833 -7858.6138 8571.4824 -7857.5718 8573.25 C -7857.5718 8573.25 L -7858.6138 8574.9766 -7862.1152 8576.6738 -7866.4966 8576.6738 c -7870.875 8576.6738 -7874.3242 8574.9375 -7875.4233 8573.252 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 83) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8585.9355 m -7670.4009 8585.9355 L -7670.4009 8578.1348 L -7884 8578.1348 L -7884 8585.9355 L n 0 O 0 0 0 1 k -7884 8582.0352 m -7873.9858 8584.5273 -7867.187 8585.875 -7855.2007 8585.9355 c -7842.2183 8586 -7777.2002 8585.9355 y -7712.1816 8586 -7699.2002 8585.9355 v -7687.2129 8585.875 -7680.415 8584.5273 -7670.4009 8582.0352 C -7680.415 8579.543 -7687.2129 8578.1953 -7699.2002 8578.1348 c -7712.1816 8578.0693 -7777.2002 8578.1348 y -7842.2183 8578.0693 -7855.2007 8578.1348 v -7867.187 8578.1953 -7873.9858 8579.543 -7884 8582.0352 C f U %AI8_EndBrushPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np 4 Bn %AI5_BeginGradient: (Black, White) (Black, White) 0 2 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 %_Br [ 0 0 50 100 %_BS %_0 0 50 100 Bs 1 0 50 0 %_BS %_1 0 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Chrome) (Chrome) 0 6 Bd [ 0 < 464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B 3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272626262625 2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1B1B1B1B1A 1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F 0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 04040403030302020202010101010000 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A 1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 15151515151414141414141414131313131313131312121212121212121211111111111111111010 1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C 0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 07060606060606060606050505050505050504040404040404040303030303030303030202020202 02020201010101010101010000000000 > 1 %_Br 0 0.275 1 < 6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F > 1 %_Br 0 < 00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B 0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 161617171717181818181919191A1A1A1A1B1B1B1C1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C 2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 373738383838393939393A3A3A3B3B3B3B3C3C3C3D3D3D3D3E3E3E3E3F3F3F404040404141414142 42424343434344444444454545464646 > < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > < 00000101020203030304040505050606070708080809090A0A0B0B0B0C0C0D0D0D0E0E0F0F101010 1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5E5F5F606061616162626363646464 6565666666676768686969696A6A6B6B > 1 %_Br 1 0 %_Br < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 35343434333333323232323131313030302F2F2F2E2E2E2E2D2D2D2C2C2C2B2B2B2B2A2A2A292929 282828282727272626262525252524242423232322222222212121202020201F1F1F1E1E1E1D1D1D 1D1C1C1C1B1B1B1A1A1A1A1919191818181717171616161615151514141413131313121212111111 101010100F0F0F0E0E0E0D0D0D0D0C0C0C0B0B0B0A0A0A0A09090908080807070707060606050505 04040404030303020202010101010000 > 0 0 1 %_Br [ 1 0 50 92 %_BS %_1 0 50 92 Bs 0 0.275 1 0.12 1 50 59 %_BS %_0 0.275 1 0.12 1 50 59 Bs 0 0.275 1 0.42 1 50 50 %_BS %_0 0.275 1 0.42 1 50 50 Bs 1 0 50 49 %_BS %_1 0 50 49 Bs 1 0 50 41 %_BS %_1 0 50 41 Bs 1 0.3 0 0 1 50 0 %_BS %_1 0.3 0 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Rainbow) (Rainbow) 0 6 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 0 1 %_Br 1 < 0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E 2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E 7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 F7F8F9FAFBFCFDFEFF > 0 0 1 %_Br 1 < 00000000000000000000000000000000000001010101010101010101010101010101010101010101 01010101010101010101010101010202020202020202020202020202020202020202020202020202 02020202020202020202030303030303030303030303030303030303030303030303030303030303 03030303030304040404040404040404040404040404040404040404040404040404040404040404 04040505050505050505050505050505050505050505050505050505050505050505050505050606 06060606060606060606060606060606060606060606060606060606060606060607070707070707 07070707070707070707070707070707 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 1 %_Br < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > 0 1 0 1 %_Br 0 < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 1 %_Br [ 0 1 0 0 1 50 100 %_BS %_0 1 0 0 1 50 100 Bs 1 1 0 0 1 50 80 %_BS %_1 1 0 0 1 50 80 Bs 1 0.0279 0 0 1 50 60 %_BS %_1 0.0279 0 0 1 50 60 Bs 1 0 1 0 1 50 40 %_BS %_1 0 1 0 1 50 40 Bs 0 0 1 0 1 50 20 %_BS %_0 0 1 0 1 50 20 Bs 0 1 1 0 1 50 0 %_BS %_0 1 1 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Yellow & Orange Radial) (Yellow & Orange Radial) 1 2 Bd [ 0 < 0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F 707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C > < FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E6 > 0 1 %_Br [ 0 0 1 0 1 52 19 %_BS %_0 0 1 0 1 52 19 Bs 0 0.55 0.9 0 1 50 100 %_BS %_0 0.55 0.9 0 1 50 100 Bs BD %AI5_EndGradient %AI5_End_NonPrinting-- %AI5_BeginPalette 0 0 Pb 1 1 1 1 ([Registration]) 0 Xs ([Registration]) Pc 0 0 0 0 k (C=0 M=0 Y=0 K=0) Pc 0 0 0 1 k (C=0 M=0 Y=0 K=100) Pc 0 0.1 1 0 k (C=0 M=10 Y=100 K=0) Pc 0 0.5 0 0 k (C=0 M=50 Y=0 K=0) Pc 0 0.5 1 0 k (C=0 M=50 Y=100 K=0) Pc 1 0.55 1 0 k (C=100 M=55 Y=100 K=0) Pc 1 0.9 0.1 0 k (C=100 M=90 Y=10 K=0) Pc 0.15 1 1 0 k (C=15 M=100 Y=100 K=0) Pc 0.45 0.9 0 0 k (C=45 M=90 Y=0 K=0) Pc 0.5 0.4 0.3 0 k (C=50 M=40 Y=30 K=0) Pc 0.5 0.85 1 0 k (C=50 M=85 Y=100 K=0) Pc 0.75 0.05 1 0 k (C=75 M=5 Y=100 K=0) Pc 0.75 0.9 0 0 k (C=75 M=90 Y=0 K=0) Pc 0.8 0.05 0 0 k (C=80 M=5 Y=0 K=0) Pc Bb 2 (Black, White) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Black, White) Pc Bb 2 (Chrome) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Chrome) Pc Bb 2 (Rainbow) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Rainbow) Pc Bb 0 0 0 0 Bh 2 (Yellow & Orange Radial) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Yellow & Orange Radial) Pc (Brick) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Brick) Pc (Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Confetti) Pc (Leaves - Fall ) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Leaves - Fall ) Pc (Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Stripes) Pc PB %AI5_EndPalette %AI5_Begin_NonPrinting Np %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Dog Tracks) (1 /New Pattern 41/ 1 0 0 0 1 / 0 1 1 0 1 1 0 0 0 0 -90 -90 0 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Fall Leaf) (1 /New Pattern 34/ 1 0.0745 0.9 0.9019 0.18 / 0 0.602793 1 1 0.1 1 1 -) - (1 1 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Ladybug) (1 /New Pattern 10/ 5 0.898039 0 0 / 0 1 1 0 0.803911 1.2 1 -1.55 1.55 ) - (1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Push Pin) (1 /New Pattern 36/ 1 0.025 0.1 0.475 0 / 0 1 1 0 0.401676 1 1 -1.06145) - ( 1.06 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Strawberry) (1 /New Pattern 37/ 1 0 0 0 1 / 0 0.803911 1 1 0.803911 1 1 -0.5 0.5 1 ) - (-75 75.419 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Twinkle Star ) (1 /New Pattern 2/ 0 1 / 1 0.5 1 1 0.25 1 1 -0.5 0.5 1 0 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Double Lines) (1 / New Pattern 62/ New Pattern 63/ New Pattern 64/ / / 1 1 0.14 0.09 ) - (0 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Laurel) (1 / New Pattern 65/ New Pattern 42/ New Pattern 67/ / New Pattern 69/ ) - (1 0 0.55 1 0.3 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Rope ) (1 / New Pattern 1/ / / New Pattern 3/ New Pattern 6/ 5 0 0 0 / 1 0 1 ) - (0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Arrow) (1 / New Pattern 45/ / / / / 5 0.898039 0 0 / 2 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Marker) (1 / New Pattern 8/ / / / / 0 0 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Paintbrush) (1 / New Pattern 5/ / / / / 1 0.5 0.85 1 0.45 / 0 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Tapered Stroke) (1 / New Pattern 83/ / / / / 1 0 0 0 1 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Type) (1 / New Pattern 50/ / / / / 1 0.952941 0.94902 0.196078 0.0745098 / 1) - ( 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (6 pt Flat ) (1 4 8 10 10 90 90 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (10 pt Oval) (1 1 19 15 15 130 130 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (12 pt Oval ) (1 7 17 45 45 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (20 pt Oval) (1 20 20 20 100 40 80 0 2 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (25 pt Round ) (1 10 40 100 100 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (50 pt Flat) (1 40 60 0 0 44 44 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Brush Manager Order) (Adobe Brush Manager Order) ( Adobe Calligraphic Brush Tool/ 6 pt Flat / Adobe Calligraphic Brush T) - (ool/ 10 pt Oval/ Adobe Calligraphic Brush Tool/ 12 pt Oval / Adobe Cal) - (ligraphic Brush Tool/ 20 pt Oval/ Adobe Calligraphic Brush Tool/ 25 pt) - ( Round / Adobe Calligraphic Brush Tool/ 50 pt Flat/ Adobe Scatter Brus) - (h Tool/ Dog Tracks/ Adobe Scatter Brush Tool/ Fall Leaf/ Adobe Scatter) - ( Brush Tool/ Ladybug/ Adobe Scatter Brush Tool/ Push Pin/ Adobe Scatte) - (r Brush Tool/ Strawberry/ Adobe Scatter Brush Tool/ Twinkle Star / Ado) - (be ArtOnPath Brush Tool/ Marker/ Adobe ArtOnPath Brush Tool/ Tapered S) - (troke/ Adobe ArtOnPath Brush Tool/ Arrow/ Adobe ArtOnPath Brush Tool/ ) - (Paintbrush/ Adobe ArtOnPath Brush Tool/ Type/ Adobe PatternOnPath Brus) - (h Tool/ Double Lines/ Adobe PatternOnPath Brush Tool/ Laurel/ Adobe Pa) - (tternOnPath Brush Tool/ Rope /) . %AI8_EndPluginObject %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_PluginGroupInfo (Adobe Path Blends) (Adobe Blends Plugin) (Live Blends) %AI8_PluginGroupInfo (Adobe PatternOnPath Brush Tool) (Adobe Pattern Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe ArtOnPath Brush Tool) (Adobe Art Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe Calligraphic Brush Tool) (Undo New Calligraphic Brush) (Calligraphic Brush Tool) %AI8_PluginGroupInfo (Adobe Scatter Brush Tool) (Adobe Scatter Brush Plugin) (Scatter Brush Tool) %AI5_End_NonPrinting-- %AI5_BeginLayer 1 1 1 1 0 0 1 0 79 128 255 0 50 Lb (Layer 1) Ln 0 A 0 O 1 g 300 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 1 XR 72 433 m 464 433 l 464 242.0801 l 72 242.0801 l 72 433 l f /BBAccumRotation (0.000000) XT u 0 R 0 G 2 J 0.72 w 3.86 M 91 407.1201 m 145 407.1201 l 145 353.1201 l 91 353.1201 l 91 407.1201 l b /BBAccumRotation (0.000000) XT 172.1201 371.1201 m 225.8799 371.1201 l 225.8799 335.1201 l 172.1201 335.1201 l 172.1201 371.1201 l b /BBAccumRotation (0.000000) XT 0 XR 225.8799 353.1201 m 172.1201 353.1201 l S /BBAccumRotation (0.000000) XT 225.8799 362 m 172.1201 362 l S /BBAccumRotation (0.000000) XT 225.8799 344 m 172.1201 344 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 280.1201 416 m 334.1201 416 l 334.1201 362 l 280.1201 362 l 280.1201 416 l b /BBAccumRotation (0.000000) XT 280.1201 346.1602 m 334.1201 346.1602 l 334.1201 292.1602 l 280.1201 292.1602 l 280.1201 346.1602 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 114.7798 409.1699 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR %_ 0 50 XQ /_Times-Roman 10 8.9799 -2.18 Tf 0 Ts 100 100 Tz 0 Tt %_0 0 100 100 Xu %AI55J_GlyphSubst: GlyphSubstNone 1 TA %_ 0 XL 0 TY 0 TV 36 0 Xb XB 0 0 5 TC 100 100 200 TW 25 TG 0 0 0 Ti 0 Ta 0 1 2 2 3 Th 0 Tq 240 Tg 0 0 Tl 0 Tc 0 Tw (vfs) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 179.23 328.1699 0 Tp 0 Tv TP 0 Tr (bhv_desc) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 289 355.1699 0 Tp 0 Tv TP 0 Tr (xfs_mount) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 289 283.1699 0 Tp 0 Tv TP 0 Tr (xfs_vfsops) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 160.6001 372.0801 m 170.2002 371.5996 l 162.2798 377.1201 l 161.5601 374.4795 l 160.6001 372.0801 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 160.6001 372.0801 m 170.2002 371.5996 l 162.2798 377.1201 l 161.5601 374.4795 l 160.6001 372.0801 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 161.0801 374.7197 m 145 380 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 367.96 343.5195 m 377.0801 346.1602 l 367.96 348.7998 l 367.96 346.1602 l 367.96 343.5195 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 367.96 343.5195 m 377.0801 346.1602 l 367.96 348.7998 l 367.96 346.1602 l 367.96 343.5195 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 367.4795 346.1602 m 307 346.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 274.1201 406.4004 m 278.6802 414.7998 l 270.2798 410 l 272.2002 408.3203 l 274.1201 406.4004 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 274.1201 406.4004 m 278.6802 414.7998 l 270.2798 410 l 272.2002 408.3203 l 274.1201 406.4004 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 271.7202 407.8398 m 225.8799 362 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 268.8398 341.3604 m 278.2002 344 l 268.8398 346.6396 l 268.8398 344 l 268.8398 341.3604 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 268.8398 341.3604 m 278.2002 344 l 268.8398 346.6396 l 268.8398 344 l 268.8398 341.3604 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 268.3599 344 m 225.8799 344 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 85.48 398.2402 m 89.7998 405.6797 l 82.1201 401.5996 l 83.7998 399.9199 l 85.48 398.2402 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 85.48 398.2402 m 89.7998 405.6797 l 82.1201 401.5996 l 83.7998 399.9199 l 85.48 398.2402 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 83.5601 399.4404 m 81.8799 398 l 81.8799 335.1201 l 109 326 l 172.1201 353.1201 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 229 317.5996 m 234.52 309.6797 l 234.04 319.2803 l 231.3999 318.5596 l 229 317.5996 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 229 317.5996 m 234.52 309.6797 l 234.04 319.2803 l 231.3999 318.5596 l 229 317.5996 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 231.3999 319.04 m 225.8799 335.1201 l S /BBAccumRotation (0.000000) XT 244.1201 299.1201 m 225.8799 299.1201 l S /BBAccumRotation (0.000000) XT 244.1201 290 m 225.8799 290 l S /BBAccumRotation (0.000000) XT 244.1201 280.8799 m 225.8799 280.8799 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 226 272 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (NULL) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 388 344 0 Tp 0 Tv TP 0 Tr (xfs_vfsmount\(\)) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 367.96 332.2402 m 377.0801 335.1201 l 367.96 337.7598 l 367.96 335.1201 l 367.96 332.2402 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 367.96 332.2402 m 377.0801 335.1201 l 367.96 337.7598 l 367.96 335.1201 l 367.96 332.2402 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 367.4795 335.1201 m 334.1201 335.1201 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 388 337.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_unmount\(\)) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 415 326 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 415 317 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 415 308 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT U /BBAccumRotation (0.000000) XT LB %AI5_EndLayer-- gsave annotatepage grestore showpage Adobe_Illustrator_AI5 /terminate get exec Adobe_shading_AI8 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_cshow /terminate get exec Adobe_level2_AI5 /terminate get exec %%EndDocument @endspecial 1063 2529 a Fe(Figure)20 b(1:)25 b(vfs,)20 b(bhv)p 1665 2529 25 4 v 28 w(desc,)g(and)g(XFS)h(mount)e (relationship.)0 4759 y(centerline)p @beginspecial 134 @llx 233 @lly 486 @urx 383 @ury 3520 @rwi @setspecial %%BeginDocument: fig2.eps %AI5_FileFormat 4.0 %AI3_ColorUsage: Black&White %AI3_IncludePlacedImages %AI7_ImageSettings: 1 %AI3_TemplateBox: 306.5 395.5 306.5 395.5 %AI3_TileBox: 31 31 583 761 %AI3_DocumentPreview: Header %AI5_ArtSize: 612 792 %AI5_RulerUnits: 2 %AI5_ArtFlags: 1 0 0 1 0 0 1 0 0 %AI5_TargetResolution: 800 %AI5_NumLayers: 1 %AI8_OpenToView: -181 787 1 1137 822 18 0 1 7 40 0 0 %AI5_OpenViewLayers: 7 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 userdict /Adobe_level2_AI5 26 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { (AI8_CMYK_CustomColor) 6 packedarray } bind def /findrgbcustomcolor { (AI8_RGB_CustomColor) 5 packedarray } bind def /setcustomcolor { exch aload pop dup (AI8_CMYK_CustomColor) eq { pop pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { dup (AI8_RGB_CustomColor) eq { pop pop 3 { 1 exch sub 3 index mul 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } ifelse } ifelse } def } if /setAIseparationgray { false setoverprint 0 setgray /setseparationgray where{ pop setseparationgray }{ /setcolorspace where{ pop [/Separation (All) /DeviceCMYK {dup dup dup}] setcolorspace 1 exch sub setcolor }{ setgray }ifelse }ifelse } def /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking currentpacking true setpacking userdict /Adobe_typography_AI5 68 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /havefont { systemdict /languagelevel known { /Font resourcestatus dup { exch pop exch pop } if } { systemdict /FontDirectory get 1 index known { pop true } { systemdict /fileposition known { dup length 6 add exch Ss 6 250 getinterval cvs pop Ss exch 0 exch getinterval status { pop pop pop pop true } { false } ifelse } { pop false } ifelse } ifelse } ifelse } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def /subststring { exch 2 index exch search { exch pop exch dup () eq { pop exch concatstring } { 3 -1 roll exch concatstring concatstring } ifelse exch pop true } { pop pop false } ifelse } def /concatstring { 1 index length 1 index length 1 index add string dup 0 5 index putinterval dup 2 index 4 index putinterval 4 1 roll pop pop pop } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def 2 index havefont { 3 index 255 string cvs dup (_Symbol_) eq { pop 2 index findfont } { 1 index 0 eq { dup length 1 sub 1 exch getinterval cvn findfont } { pop 2 index findfont } ifelse } ifelse } { dup 1 eq { 2 index 64 string cvs dup (-90pv-RKSJ-) (-83pv-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop dup (-90ms-RKSJ-) (-Ext-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop pop true } ifelse } ifelse { 1 index 1 eq { /Ryumin-Light-Ext-RKSJ-V havefont {/Ryumin-Light-Ext-RKSJ-V} {/Courier} ifelse } { /Ryumin-Light-83pv-RKSJ-H havefont {/Ryumin-Light-83pv-RKSJ-H} {/Courier} ifelse } ifelse findfont [1 0 0.5 1 0 0] makefont } if } { /Courier findfont } ifelse } ifelse _wv type /arraytype eq { _wv makeblendedfont } if dup length 10 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontScript exch def /FontDirection exch def /FontRequest exch def /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { W B } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { W F } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { W S } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat _shift aload pop _lineorientation 1 eq { exch } if translate _scale aload pop _lineorientation 1 eq _yokoorientation 1 eq or { exch } if scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { 1 index type /nametype eq { dup 0.75 mul 1 index 0.25 mul neg } if /_fontDescent exch ddef /_fontAscent exch ddef /_fontSize exch ddef /_fontRotateAdjust _fontAscent _fontDescent add 2 div neg ddef /_fontHeight _fontSize ddef findfont _fontSize scalefont setfont } def /Tl { pop neg 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { 0 exch _shift astore pop currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { count 1 eq { 100 } if 100 div exch 100 div exch _scale astore pop iTm } def /TA { pop } def /Tq { pop } def /Tg { pop } def /TG { pop } def /Tv { /_lineorientation exch ddef } def /TV { /_charorientation exch ddef } def /Ty { dup /_yokoorientation exch ddef 1 sub neg Tv } def /TY { pop } def /T~ { Tx } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { _fontSize mul 1000 div _lineorientation 0 eq { neg 0 } { 0 exch } ifelse rmoveto pop } def /TK { 2 npop } def /T* { _leading aload pop _lineorientation 0 ne { exch } if Td } def /T*- { _leading aload pop _lineorientation 0 ne { exch } if exch neg exch neg Td } def /T- { _ax neg 0 rmoveto _lineorientation 1 eq _charorientation 0 eq and { 1 TV _hyphen Tx 0 TV } { _hyphen Tx } ifelse } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ findfont _fontSize scalefont setfont 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking % /X^ { currentfont 5 1 roll dup havefont { findfont _fontSize scalefont setfont } { pop exch } ifelse 2 index 0 eq { Tx } { Tj } ifelse pop pop setfont } def /T^ /X^ load def userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 53 dict put } if userdict /Adobe_ColorImage_AI6 get begin /initialize { Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 41 dict def } if Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /_newproc null def /_proc1 null def /_proc2 null def /sourcearray 4 array def /_ptispace null def /_ptiname null def /_pti0 0 def /_pti1 0 def /_ptiproc null def /_ptiscale 0 def /_pticomps 0 def /_ptibuf 0 string def /_gtigray 0 def /_cticmyk null def /_rtirgb null def /XIEnable true def /XIType 0 def /XIEncoding 0 def /XICompression 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIRowBytes 0 def /XIFile null def /XIBuffer1 null def /XIBuffer2 null def /XIBuffer3 null def /XIDataProc null def /XIColorSpace /DeviceGray def /XIColorValues 0 def /XIPlateList false def end /ci6colorimage /colorimage where {/colorimage get}{null} ifelse def /ci6image systemdict /image get def /ci6curtransfer systemdict /currenttransfer get def /ci6curoverprint /currentoverprint where {/currentoverprint get}{{_of}} ifelse def /ci6foureq { 4 index ne { pop pop pop false }{ 4 index ne { pop pop false }{ 4 index ne { pop false }{ 4 index eq } ifelse } ifelse } ifelse } def /ci6testplate { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 ci6foureq { /plateindex 0 def }{ 0 1 0 0 ci6foureq { /plateindex 1 def }{ 0 0 1 0 ci6foureq { /plateindex 2 def }{ 0 0 0 1 ci6foureq { /plateindex 3 def }{ 0 0 0 0 ci6foureq { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /ci6concatprocs { /packedarray where { pop dup type /packedarraytype eq 2 index type /packedarraytype eq or }{ false } ifelse { /_proc2 exch cvlit def /_proc1 exch cvlit def _proc1 aload pop _proc2 aload pop _proc1 length _proc2 length add packedarray cvx }{ /_proc2 exch cvlit def /_proc1 exch cvlit def /_newproc _proc1 length _proc2 length add array def _newproc 0 _proc1 putinterval _newproc _proc1 length _proc2 putinterval _newproc cvx } ifelse } def /ci6istint { type /arraytype eq } def /ci6isspot { dup type /arraytype eq { dup length 1 sub get /Separation eq }{ pop false } ifelse } def /ci6spotname { dup ci6isspot {dup length 2 sub get}{pop ()} ifelse } def /ci6altspace { aload pop pop pop ci6colormake } def /ci6numcomps { dup /DeviceGray eq { pop 1 }{ dup /DeviceRGB eq { pop 3 }{ /DeviceCMYK eq { 4 }{ 1 } ifelse } ifelse } ifelse } def /ci6marksplate { dup /DeviceGray eq { pop plateindex 3 eq }{ dup /DeviceRGB eq { pop plateindex 5 ne }{ dup /DeviceCMYK eq { pop plateindex 5 ne }{ dup ci6isspot { /findcmykcustomcolor where { pop dup length 2 sub get 0.1 0.1 0.1 0.1 5 -1 roll findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop plateindex 5 ne } ifelse }{ pop plateindex 5 ne } ifelse } ifelse } ifelse } ifelse } def /ci6colormake { dup ci6numcomps exch 1 index 2 add 1 roll dup 1 eq {pop}{array astore} ifelse exch } def /ci6colorexpand { dup ci6spotname exch dup ci6istint { ci6altspace exch 4 1 roll }{ 1 3 1 roll } ifelse } def /ci6colortint { dup /DeviceGray eq { 3 1 roll 1 exch sub mul 1 exch sub exch }{ dup /DeviceRGB eq { 3 1 roll {1 exch sub 1 index mul 1 exch sub exch} forall pop 3 array astore exch }{ dup /DeviceCMYK eq { 3 1 roll {1 index mul exch} forall pop 4 array astore exch }{ 3 1 roll mul exch } ifelse } ifelse } ifelse } def /ci6colortocmyk { dup /DeviceGray eq { pop 1 exch sub 0 0 0 4 -1 roll 4 array astore }{ dup /DeviceRGB eq { pop aload pop _rgbtocmyk 4 array astore }{ dup /DeviceCMYK eq { pop }{ ci6altspace ci6colortint ci6colortocmyk } ifelse } ifelse } ifelse } def /ci6makeimagedict { 7 dict begin /ImageType 1 def /Decode exch def /DataSource exch def /ImageMatrix exch def /BitsPerComponent exch def /Height exch def /Width exch def currentdict end } def /ci6stringinvert { 0 1 2 index length 1 sub { dup 2 index exch get 255 exch sub 2 index 3 1 roll put } for } def /ci6stringknockout { 0 1 2 index length 1 sub { 255 2 index 3 1 roll put } for } def /ci6stringapply { 0 1 4 index length 1 sub { dup 4 index exch get 3 index 3 1 roll 3 index exec } for pop exch pop } def /ci6walkrgbstring { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval {} forall 5 index exec 3 index } for 5 {pop} repeat } def /ci6walkcmykstring { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval {} forall 6 index exec 3 index } for 5 { pop } repeat } def /ci6putrgbtograystr { .11 mul exch .59 mul add exch .3 mul add cvi 3 copy put pop 1 add } def /ci6putcmyktograystr { exch .11 mul add exch .59 mul add exch .3 mul add dup 255 gt { pop 255 } if 255 exch sub cvi 3 copy put pop 1 add } def /ci6rgbtograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putrgbtograystr load exch ci6walkrgbstring end } def /ci6cmyktograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putcmyktograystr load exch ci6walkcmykstring end } def /ci6separatecmykproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 0 2 index plateindex 4 2 index length 1 sub { get 255 exch sub 3 copy put pop 1 add 2 index } for pop pop exch pop end } def /ci6compositeimage { dup 1 eq { pop pop image }{ /ci6colorimage load null ne { ci6colorimage }{ 3 1 roll pop sourcearray 0 3 -1 roll put 3 eq {/ci6rgbtograyproc}{/ci6cmyktograyproc} ifelse load image } ifelse } ifelse } def /ci6knockoutimage { gsave 0 ci6curtransfer exec 1 ci6curtransfer exec eq { 0 ci6curtransfer exec 0.5 lt }{ 0 ci6curtransfer exec 1 ci6curtransfer exec gt } ifelse {{pop 0}}{{pop 1}} ifelse systemdict /settransfer get exec ci6compositeimage grestore } def /ci6drawimage { ci6testplate -1 eq { pop ci6compositeimage }{ dup type /arraytype eq { dup length plateindex gt {plateindex get}{pop false} ifelse }{ { true }{ dup 1 eq {plateindex 3 eq}{plateindex 3 le} ifelse } ifelse } ifelse { dup 1 eq { pop pop ci6image }{ dup 3 eq { ci6compositeimage }{ pop pop sourcearray 0 3 -1 roll put /ci6separatecmykproc load ci6image } ifelse } ifelse }{ ci6curoverprint { 7 {pop} repeat }{ ci6knockoutimage } ifelse } ifelse } ifelse } def /ci6proctintimage { /_ptispace exch store /_ptiname exch store /_pti1 exch store /_pti0 exch store /_ptiproc exch store /_pticomps _ptispace ci6numcomps store /_ptiscale _pti1 _pti0 sub store level2? { _ptiname length 0 gt version cvr 2012 ge and { [/Separation _ptiname _ptispace {_ptiproc}] setcolorspace [_pti0 _pti1] ci6makeimagedict ci6image }{ [/Indexed _ptispace 255 {255 div _ptiscale mul _pti0 add _ptiproc}] setcolorspace [0 255] ci6makeimagedict ci6image } ifelse }{ _pticomps 1 eq { { dup { 255 div _ptiscale mul _pti0 add _ptiproc 255 mul cvi put } ci6stringapply } ci6concatprocs ci6image }{ { dup length _pticomps mul dup _ptibuf length ne {/_ptibuf exch string store}{pop} ifelse _ptibuf { exch _pticomps mul exch 255 div _ptiscale mul _pti0 add _ptiproc _pticomps 2 add -2 roll _pticomps 1 sub -1 0 { 1 index add 2 index exch 5 -1 roll 255 mul cvi put } for pop pop } ci6stringapply } ci6concatprocs false _pticomps /ci6colorimage load null eq {7 {pop} repeat}{ci6colorimage} ifelse } ifelse } ifelse } def /ci6graytintimage { /_gtigray 5 -1 roll store {1 _gtigray sub mul 1 exch sub} 4 1 roll /DeviceGray ci6proctintimage } def /ci6cmyktintimage { /_cticmyk 5 -1 roll store {_cticmyk {1 index mul exch} forall pop} 4 1 roll /DeviceCMYK ci6proctintimage } def /ci6rgbtintimage { /_rtirgb 5 -1 roll store {_rtirgb {1 exch sub 1 index mul 1 exch sub exch} forall pop} 4 1 roll /DeviceRGB ci6proctintimage } def /ci6tintimage { ci6testplate -1 eq { ci6colorexpand 3 -1 roll 5 -1 roll {0}{0 exch} ifelse 4 2 roll dup /DeviceGray eq { pop ci6graytintimage }{ dup /DeviceRGB eq { pop ci6rgbtintimage }{ pop ci6cmyktintimage } ifelse } ifelse }{ dup ci6marksplate { plateindex 5 lt { ci6colortocmyk plateindex get dup 0 eq ci6curoverprint and { 7 {pop} repeat }{ 1 exch sub exch {1 0}{0 1} ifelse () ci6graytintimage } ifelse }{ pop exch {0}{0 exch} ifelse 0 3 1 roll () ci6graytintimage } ifelse }{ ci6curoverprint { 8 {pop} repeat }{ pop pop pop {pop 1} 0 1 () /DeviceGray ci6proctintimage } ifelse } ifelse } ifelse } def /XINullImage { } def /XIImageMask { XIImageWidth XIImageHeight false [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load imagemask } def /XIImageTint { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load XIType 3 eq XIColorValues XIColorSpace ci6tintimage } def /XIImage { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load false XIChannelCount XIPlateList ci6drawimage } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale /_lp /null ddef _fc /_lp /imagemask ddef end } def /XH { Adobe_ColorImage_AI6_Vars begin grestore end } def /XIEnable { Adobe_ColorImage_AI6_Vars /XIEnable 3 -1 roll put } def /XC { Adobe_ColorImage_AI6_Vars begin ci6colormake /XIColorSpace exch def /XIColorValues exch def end } def /XIPlates { Adobe_ColorImage_AI6_Vars begin /XIPlateList exch def end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def cvi dup 256 idiv /XICompression exch store 256 mod /XIEncoding exch store pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi }{ XIImageWidth XIChannelCount mul } ifelse /XIRowBytes exch def XIEnable { /XIBuffer3 XIImageWidth string def XICompression 0 eq { /XIBuffer1 XIRowBytes string def XIEncoding 0 eq { {currentfile XIBuffer1 readhexstring pop} }{ {currentfile XIBuffer1 readstring pop} } ifelse }{ /XIBuffer1 256 string def /XIBuffer2 XIRowBytes string def {currentfile XIBuffer1 readline pop (%) anchorsearch {pop} if} /ASCII85Decode filter /DCTDecode filter /XIFile exch def {XIFile XIBuffer2 readstring pop} } ifelse /XIDataProc exch def XIType 1 ne { 0 setgray } if XIType 1 eq { XIImageMask }{ XIType 2 eq XIType 3 eq or { XIImageTint }{ XIImage } ifelse } ifelse }{ XINullImage } ifelse /XIPlateList false def grestore end } def end currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 112 dict dup begin put /_?cmyk false def /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_lineorientation 0 def /_charorientation 0 def /_yokoorientation 0 def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_shift [0 0] def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fontSize 0 def /_fontAscent 0 def /_fontDescent 0 def /_fontHeight 0 def /_fontRotateAdjust 0 def /Ss 256 string def Ss 0 (fonts/) putinterval /_cnt 0 def /_scale [1 1] def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_hfname 100 string def /_hffound false def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_rgbf 3 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_rgbs 3 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /_lobyte 0 def /_hibyte 0 def /_cproc null def /_cscript 0 def /_hvax 0 def /_hvay 0 def /_hvwb 0 def /_hvcx 0 def /_hvcy 0 def /_bitfont null def /_bitlobyte 0 def /_bithibyte 0 def /_bitkey null def /_bitdata null def /_bitindex 0 def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 100 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin /_aicmykps where {pop /_?cmyk _aicmykps def}if discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /hswj { dup stringwidth 3 2 roll { _hvwb eq { exch _hvcx add exch _hvcy add } if exch _hvax add exch _hvay add } cforall } def /vswj { 0 0 3 -1 roll { dup 255 le _charorientation 1 eq and { dup cstring stringwidth 5 2 roll _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub 4 -1 roll sub exch 3 -1 roll sub exch } { _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub _fontHeight sub } ifelse } cforall } def /swj { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hswj } { vswj } ifelse } def /sw { 0 0 0 6 3 roll swj } def /vjss { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index setmatrix stroke grestore _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index setmatrix stroke grestore moveto pop pop } ifelse } cforall 6 npop } def /hjss { 4 1 roll { dup cstring gsave false charpath currentpoint 5 index setmatrix stroke grestore moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jss { _lineorientation 0 eq { hjss } { vjss } ifelse } def /ss { 0 0 0 7 3 roll jss } def /vjsp { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto false charpath currentpoint _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto 2 index false charpath moveto pop pop } ifelse } cforall 6 npop } def /hjsp { 4 1 roll { dup cstring false charpath _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jsp { matrix currentmatrix _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /sp { matrix currentmatrix 0 0 0 7 3 roll _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /_rgbtocmyk { 3 { 1 exch sub 3 1 roll } repeat 3 copy 1 4 1 roll 3 { 3 index 2 copy gt { exch } if pop 4 1 roll } repeat pop pop pop 4 1 roll 3 { 3 index sub 3 1 roll } repeat 4 -1 roll } def /setrgbfill { _rgbf astore pop /_fc { _lp /fill ne { _of setoverprint _rgbf aload pop setrgbcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /setrgbstroke { _rgbs astore pop /_sc { _lp /stroke ne { _os setoverprint _rgbs aload pop setrgbcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xa { _?cmyk { 3 npop k }{ setrgbfill 4 npop } ifelse } def /XA { _?cmyk { 3 npop K }{ setrgbstroke 4 npop } ifelse } def /Xs { /_gf exch ddef 5 npop /_fc { _lp /fill ne { _of setoverprint _gf setAIseparationgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XS { /_gs exch ddef 5 npop /_sc { _lp /stroke ne { _os setoverprint _gs setAIseparationgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xx { exch /_gf exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XX { exch /_gs exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /XK { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll K } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop XA } ifelse } def /Xk { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll k } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop Xa } ifelse } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /Xt { pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if endString eq { cleartomark stop } if }ifelse } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse }ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 6 npop 7 2 roll 5 npop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { /clipForward? true def /Tx /pop load def /Tj /pop load def currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 4 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setrgbcolor { 3 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end /XP { 4 npop } bind def /XD { pop } bind def end setpacking currentpacking true setpacking userdict /Adobe_cshow 14 dict dup begin put /initialize { Adobe_cshow begin Adobe_cshow { dup xcheck { bind } if pop pop } forall end Adobe_cshow begin } def /terminate { currentdict Adobe_cshow eq { end } if } def /cforall { /_lobyte 0 ddef /_hibyte 0 ddef /_cproc exch ddef /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef { /_lobyte exch ddef _hibyte 0 eq _cscript 1 eq _lobyte 129 ge _lobyte 159 le and _lobyte 224 ge _lobyte 252 le and or and _cscript 2 eq _lobyte 161 ge _lobyte 254 le and and _cscript 3 eq _lobyte 161 ge _lobyte 254 le and and _cscript 25 eq _lobyte 161 ge _lobyte 254 le and and _cscript -1 eq or or or or and { /_hibyte _lobyte ddef } { _hibyte 256 mul _lobyte add _cproc /_hibyte 0 ddef } ifelse } forall } def /cstring { dup 256 lt { (s) dup 0 4 3 roll put } { dup 256 idiv exch 256 mod (hl) dup dup 0 6 5 roll put 1 4 3 roll put } ifelse } def /clength { 0 exch { 256 lt { 1 } { 2 } ifelse add } cforall } def /hawidthshow { { dup cstring show _hvax _hvay rmoveto _hvwb eq { _hvcx _hvcy rmoveto } if } cforall } def /vawidthshow { { dup 255 le _charorientation 1 eq and { -90 rotate 0 _fontRotateAdjust rmoveto cstring _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow 0 _fontRotateAdjust neg rmoveto 90 rotate } { currentpoint _fontHeight sub exch _hvay sub exch _hvax sub 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if 3 2 roll cstring dup stringwidth pop 2 div neg _fontAscent neg rmoveto show moveto } ifelse } cforall } def /hvawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse } def /hvwidthshow { 0 0 3 -1 roll hvawidthshow } def /hvashow { 0 0 0 6 -3 roll hvawidthshow } def /hvshow { 0 0 0 0 0 6 -1 roll hvawidthshow } def currentdict readonly pop end setpacking userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_shading_AI8 10 dict dup begin put /initialize { Adobe_shading_AI8 begin Adobe_shading_AI8 bdprocs Mesh /initialize get exec } def /terminate { currentdict Adobe_shading_AI8 eq { end } if } def /bdprocs { { dup xcheck 1 index type /arraytype eq and { bind } if pop pop } forall } def /X! {pop} def /X# {pop pop} def /Mesh 40 dict def Mesh begin /initialize { Mesh bdprocs Mesh begin /emulate? /AI8MeshEmulation where { pop AI8MeshEmulation }{ systemdict /shfill known not } ifelse def end } def /bd { shadingdict begin } def /paint { emulate? { end }{ /_lp /none ddef _fc /_lp /none ddef /AIColorSpace AIColorSpace tocolorspace store /ColorSpace AIColorSpace topsspace store version_ge_3010.106 not systemdict /setsmoothness known and { 0.0001 setsmoothness } if composite? { /DataSource getdatasrc def Matrix concat currentdict end shfill }{ AIColorSpace makesmarks AIPlateList markingplate and not isoverprint and { end }{ /ColorSpace /DeviceGray store /Decode [0 1 0 1 0 1] store /DataSource getplatesrc def Matrix concat currentdict end shfill } ifelse } ifelse } ifelse } def /shadingdict 12 dict def shadingdict begin /ShadingType 6 def /BitsPerCoordinate 16 def /BitsPerComponent 8 def /BitsPerFlag 8 def end /datafile null def /databuf 256 string def /dataptr 0 def /srcspace null def /srcchannels 0 def /dstchannels 0 def /dstplate 0 def /srctodstcolor null def /getplatesrc { /srcspace AIColorSpace store /srcchannels AIColorSpace getnchannels store /dstchannels 1 store /dstplate getplateindex store /srctodstcolor srcspace makesmarks { dstplate 4 eq { {1 exch sub} }{ {srcspace tocmyk 3 dstplate sub index 1 exch sub 5 1 roll 4 {pop} repeat} } ifelse }{ {srcchannels {pop} repeat 1} } ifelse store /datafile getdatasrc store /rdpatch168 load DataLength () /SubFileDecode filter } def /getdatasrc { /rdcmntline load /ASCII85Decode filter } def /rdpatch168 { /dataptr 0 store 49 rdcount 4 { dup {pop srcchannels getint8} if dup {pop srctodstcolor dstchannels putint8 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdpatch3216 { /dataptr 0 store 97 rdcount 4 { dup {pop srcchannels getint16} if dup {pop srctodstcolor dstchannels putint16 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdcount { dup 0 gt { datafile databuf dataptr 4 -1 roll getinterval readstring exch length dataptr add /dataptr exch store }{ true } ifelse } def /getint8 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 255 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint8 { dup dataptr add /dataptr exch store dataptr exch { 1 sub exch 255 mul cvi databuf 2 index 3 -1 roll put } repeat pop } def /getint16 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 256 mul datafile read} if dup {pop add 65535 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint16 { dup 2 mul dataptr add /dataptr exch store dataptr exch { 2 sub exch 65535 mul cvi dup 256 idiv databuf 3 index 3 -1 roll put 256 mod databuf 2 index 1 add 3 -1 roll put } repeat pop } def /srcbuf 256 string def /rdcmntline { currentfile srcbuf readline pop (%) anchorsearch {pop} if } def /getplateindex { 0 [cyan? magenta? yellow? black? customColor?] {{exit} if 1 add} forall } def /aicsarray 4 array def /aicsaltvals 4 array def /aicsaltcolr aicsaltvals def /tocolorspace { dup type /arraytype eq { mark exch aload pop aicsarray 0 3 -1 roll put aicsarray 1 3 -1 roll put dup aicsarray 2 3 -1 roll put gettintxform aicsarray 3 3 -1 roll put counttomark aicsaltvals 0 3 -1 roll getinterval /aicsaltcolr exch store aicsaltcolr astore pop pop aicsarray } if } def /subtintxform {aicsaltcolr {1 index mul exch} forall pop} def /addtintxform {aicsaltcolr {1 sub 1 index mul 1 add exch} forall pop} def /gettintxform { /DeviceRGB eq {/addtintxform}{/subtintxform} ifelse load } def /getnchannels { dup type /arraytype eq {0 get} if colorspacedict exch get begin Channels end } def /makesmarks { composite? { pop true }{ dup dup type /arraytype eq {0 get} if colorspacedict exch get begin MarksPlate end } ifelse } def /markingplate { composite? { pop true }{ dup type /arraytype eq { dup length getplateindex gt {getplateindex get}{pop false} ifelse } if } ifelse } def /tocmyk { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToCMYK end } def /topsspace { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToPSSpace end } def /colorspacedict 5 dict dup begin /DeviceGray 4 dict dup begin /Channels 1 def /MarksPlate {pop black?} def /ToCMYK {pop 1 exch sub 0 0 0 4 -1 roll} def /ToPSSpace {} def end def /DeviceRGB 4 dict dup begin /Channels 3 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop _rgbtocmyk} def /ToPSSpace {} def end def /DeviceCMYK 4 dict dup begin /Channels 4 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop} def /ToPSSpace {} def end def /Separation 4 dict dup begin /Channels 1 def /MarksPlate { /findcmykcustomcolor where { pop dup 1 exch ToCMYK 5 -1 roll 1 get findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace {} def end def /Process 4 dict dup begin /Channels 1 def /MarksPlate { isCMYKSep? { 1 exch ToCMYK 4 array astore getplateindex get 0 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace { 4 array copy dup 0 /Separation put } def end def end def /isoverprint { /currentoverprint where {pop currentoverprint}{_of} ifelse } def /version_ge_3010.106 { version {cvr} stopped { pop false }{ 3010.106 ge } ifelse } def end end defaultpacking setpacking userdict /_useSmoothShade false put userdict /_aicmykps false put userdict /_forceToCMYK false put Adobe_level2_AI5 /initialize get exec Adobe_cshow /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_shading_AI8 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla /hungarumlaut/ogonek/caron TE %AI55J_Tsume: None %AI3_BeginEncoding: _Times-Roman Times-Roman [/_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType [161/degree 173/notequal 176/infinity/plusminus/lessequal/greaterequal 181/mu/partialdiff/summation/product/pi/integral 189/Omega 195/radical 197/approxequal 198/Delta 214/divide/lozenge 240/apple /_Symbol_/Symbol 0 0 0 TZ %AI5_Begin_NonPrinting Np %AI3_BeginPattern: (Brick) (Brick) 0 0 72 72 [ %AI3_Tile (0 O 0 R 0.3 0.85 0.85 0 k 0.3 0.85 0.85 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 0 m 0 72 L 72 72 L 72 0 L 0 0 L f %AI6_EndPatternLayer ) & (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 68.4097 m 72 68.4097 l S 0 61.209 m 72 61.209 L S 0 54.0088 m 72 54.0088 L S 0 46.8076 m 72 46.8076 L S 0 39.6084 m 72 39.6084 L S 0 32.4072 m 72 32.4072 L S 0 25.207 m 72 25.207 L S 0 18.0059 m 72 18.0059 L S 0 10.8057 m 72 10.8057 L S 0 3.6064 m 72 3.6064 L S 68.4102 68.4097 m 68.4102 61.2217 l S 54.0098 68.4097 m 54.0098 61.2217 L S 39.6094 68.4097 m 39.6094 61.2217 L S 25.21 68.4097 m 25.21 61.2217 L S 10.8105 68.4097 m 10.8105 61.2217 L S 68.4102 53.9717 m 68.4102 46.7842 l S 54.0098 53.9717 m 54.0098 46.7842 L S 39.6094 53.9717 m 39.6094 46.7842 L S 25.21 53.9717 m 25.21 46.7842 L S 10.8105 53.9717 m 10.8105 46.7842 L S 68.4102 39.5967 m 68.4102 32.4092 l S 54.0098 39.5967 m 54.0098 32.4092 L S 39.6094 39.5967 m 39.6094 32.4092 L S 25.21 39.5967 m 25.21 32.4092 L S 10.8105 39.5967 m 10.8105 32.4092 L S 68.4102 25.2217 m 68.4102 18.0342 l S 54.0098 25.2217 m 54.0098 18.0342 L S 39.6094 25.2217 m 39.6094 18.0342 L S 25.21 25.2217 m 25.21 18.0342 L S 10.8105 25.2217 m 10.8105 18.0342 L S 68.4102 10.7842 m 68.4102 3.5967 l S 54.0098 10.7842 m 54.0098 3.5967 L S 39.6094 10.7842 m 39.6094 3.5967 L S 25.21 10.7842 m 25.21 3.5967 L S 10.8105 10.7842 m 10.8105 3.5967 L S 61.1973 3.5967 m 61.1973 0 L S 46.7969 3.5967 m 46.7969 0 L S 32.3965 3.5967 m 32.3965 0 L S 17.9971 3.5967 m 17.9971 0 L S 3.5967 3.5967 m 3.5967 0 l S 61.1973 18.0342 m 61.1973 10.8467 L S 46.7969 18.0342 m 46.7969 10.8467 L S 32.3965 18.0342 m 32.3965 10.8467 L S 17.9971 18.0342 m 17.9971 10.8467 L S 3.5967 18.0342 m 3.5967 10.8467 l S 61.1973 32.4092 m 61.1973 25.2217 L S 46.7969 32.4092 m 46.7969 25.2217 L S 17.9971 32.4092 m 17.9971 25.2217 L S 3.5967 32.4092 m 3.5967 25.2217 l S 61.1973 46.7842 m 61.1973 39.5967 L S 46.7969 46.7842 m 46.7969 39.5967 L S 32.3965 46.7842 m 32.3965 39.5967 L S 17.9971 46.7842 m 17.9971 39.5967 L S 3.5967 46.7842 m 3.5967 39.5967 l S 61.1973 61.2217 m 61.1973 54.0347 L S 46.7969 61.2217 m 46.7969 54.0347 L S 32.3965 61.2217 m 32.3965 54.0347 L S 17.9971 61.2217 m 17.9971 54.0347 L S 3.5967 61.2217 m 3.5967 54.0347 l S 61.1973 71.959 m 61.1973 68.4717 L S 46.7969 71.959 m 46.7969 68.4717 L S 32.3965 71.959 m 32.3965 68.4717 L S 17.9971 71.959 m 17.9971 68.4717 L S 3.5967 71.959 m 3.5967 68.4717 l S 32.3965 32.4092 m 32.3965 25.2217 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Confetti) (Confetti) 4.85 3.617 76.85 75.617 [ %AI3_Tile (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 4.85 3.617 m 4.85 75.617 L 76.85 75.617 L 76.85 3.617 L 4.85 3.617 L f %AI6_EndPatternLayer ) & (0 O 0 R 0 g 0 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 10.6 64.867 m 7.85 62.867 l S 9.1 8.617 m 6.85 6.867 l S 78.1 68.617 m 74.85 67.867 l S 76.85 56.867 m 74.35 55.117 l S 79.6 51.617 m 76.6 51.617 l S 76.35 44.117 m 73.6 45.867 l S 78.6 35.867 m 76.6 34.367 l S 76.1 23.867 m 73.35 26.117 l S 78.1 12.867 m 73.85 13.617 l S 68.35 14.617 m 66.1 12.867 l S 76.6 30.617 m 73.6 30.617 l S 62.85 58.117 m 60.956 60.941 l S 32.85 59.617 m 31.196 62.181 l S 47.891 64.061 m 49.744 66.742 l S 72.814 2.769 m 73.928 5.729 l S 67.976 2.633 m 67.35 5.909 l S 61.85 27.617 m 59.956 30.441 l S 53.504 56.053 m 51.85 58.617 l S 52.762 1.779 m 52.876 4.776 l S 45.391 5.311 m 47.244 7.992 l S 37.062 3.375 m 35.639 5.43 l S 55.165 34.828 m 57.518 37.491 l S 20.795 3.242 m 22.12 5.193 l S 14.097 4.747 m 15.008 8.965 l S 9.736 1.91 m 8.073 4.225 l S 31.891 5.573 m 32.005 8.571 l S 12.1 70.367 m 15.6 68.867 l S 9.35 54.867 m 9.6 58.117 l S 12.85 31.867 m 14.35 28.117 l S 10.1 37.367 m 12.35 41.117 l S 34.1 71.117 m 31.85 68.617 l S 38.35 71.117 m 41.6 68.367 l S 55.1 71.117 m 58.35 69.117 l S 57.35 65.117 m 55.35 61.867 l S 64.35 66.367 m 69.35 68.617 l S 71.85 62.867 m 69.35 61.117 l S 23.6 70.867 m 23.6 67.867 l S 20.6 65.867 m 17.35 65.367 l S 24.85 61.367 m 25.35 58.117 l S 25.85 65.867 m 29.35 66.617 l S 14.1 54.117 m 16.85 56.117 l S 12.35 11.617 m 12.6 15.617 l S 12.1 19.867 m 14.35 22.367 l S 26.1 9.867 m 23.6 13.367 l S 34.6 47.117 m 32.1 45.367 l S 62.6 41.867 m 59.85 43.367 l S 31.6 35.617 m 27.85 36.367 l S 36.35 26.117 m 34.35 24.617 l S 33.85 14.117 m 31.1 16.367 l S 37.1 9.867 m 35.1 11.117 l S 34.35 20.867 m 31.35 20.867 l S 44.6 56.617 m 42.1 54.867 l S 47.35 51.367 m 44.35 51.367 l S 44.1 43.867 m 41.35 45.617 l S 43.35 33.117 m 42.6 30.617 l S 43.85 23.617 m 41.1 25.867 l S 44.35 15.617 m 42.35 16.867 l S 67.823 31.1 m 64.823 31.1 l S 27.1 32.617 m 29.6 30.867 l S 31.85 55.117 m 34.85 55.117 l S 19.6 40.867 m 22.1 39.117 l S 16.85 35.617 m 19.85 35.617 l S 20.1 28.117 m 22.85 29.867 l S 52.1 42.617 m 54.484 44.178 l S 52.437 50.146 m 54.821 48.325 l S 59.572 54.133 m 59.35 51.117 l S 50.185 10.055 m 53.234 9.928 l S 51.187 15.896 m 53.571 14.075 l S 58.322 19.883 m 59.445 16.823 l S 53.1 32.117 m 50.6 30.367 l S 52.85 24.617 m 49.6 25.617 l S 61.85 9.117 m 59.1 10.867 l S 69.35 34.617 m 66.6 36.367 l S 67.1 23.617 m 65.1 22.117 l S 24.435 46.055 m 27.484 45.928 l S 25.437 51.896 m 27.821 50.075 l S 62.6 47.117 m 65.321 46.575 l S 19.85 19.867 m 20.35 16.617 l S 21.85 21.867 m 25.35 22.617 l S 37.6 62.867 m 41.6 62.117 l S 38.323 42.1 m 38.823 38.6 l S 69.35 52.617 m 66.85 53.867 l S 14.85 62.117 m 18.1 59.367 l S 9.6 46.117 m 7.1 44.367 l S 20.6 51.617 m 18.6 50.117 l S 46.141 70.811 m 47.994 73.492 l S 69.391 40.561 m 71.244 43.242 l S 38.641 49.311 m 39.35 52.117 l S 25.141 16.811 m 25.85 19.617 l S 36.6 32.867 m 34.6 31.367 l S 6.1 68.617 m 2.85 67.867 l S 4.85 56.867 m 2.35 55.117 l S 7.6 51.617 m 4.6 51.617 l S 6.6 35.867 m 4.6 34.367 l S 6.1 12.867 m 1.85 13.617 l S 4.6 30.617 m 1.6 30.617 l S 72.814 74.769 m 73.928 77.729 l S 67.976 74.633 m 67.35 77.909 l S 52.762 73.779 m 52.876 76.776 l S 37.062 75.375 m 35.639 77.43 l S 20.795 75.242 m 22.12 77.193 l S 9.736 73.91 m 8.073 76.225 l S 10.1 23.617 m 6.35 24.367 l S 73.217 18.276 m 71.323 21.1 l S 28.823 39.6 m 29.505 42.389 l S 49.6 38.617 m 47.6 37.117 l S 60.323 73.6 m 62.323 76.6 l S 60.323 1.6 m 62.323 4.6 l S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Leaves - Fall ) (Leaves - Fall ) 0 0 64.0781 78.9336 [ %AI3_Tile (0 O 0 R 0.05 0.2 1 0 k 0.05 0.2 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 64.0781 78.9336 m 64.0781 0 L 0 0 L 0 78.9336 L 64.0781 78.9336 L f %AI6_EndPatternLayer ) & (0 O 0 R 0.83 0 1 0 k 0.83 0 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 1 D 0 XR 29.7578 0.9902 m 30.4346 1.1914 30.7246 1.3428 V 29.2559 4.0547 33.707 8.3359 34.627 9.0762 C 35.2275 8.8506 35.3477 6.3184 34.6699 4.9805 C 35.5137 5.1035 37.7031 3.7256 38.4609 2.4365 C 38.5254 3.125 40.0957 6.0664 40.9219 6.4434 C 40.002 6.8408 39.3359 8.3135 38.5742 9.7617 C 39.5957 9.9287 40.9961 9.0078 42.4668 8.1025 C 42.9814 8.9043 44.3555 9.875 45.6143 10.3916 C 44.5264 11.0781 44.0313 11.8203 43.5352 13.2793 C 42.4922 12.7139 40.3057 12.5645 39.7764 12.8516 C 40.291 13.9648 42.5371 14.5078 43.2676 14.4551 C 43.0137 15.3164 42.8652 17.4697 43.0391 20.0625 C 41.3789 18.7461 39.834 17.4297 38.1738 17.4883 C 38.4434 16.0664 37.8076 14.2607 37.4307 13.7676 C 36.8574 14.5117 36.4463 15.3389 36.8008 17.3164 C 35.3486 17.8008 34.1113 18.3467 32.7373 19.6045 C 32.7373 17.7734 32.166 16.5723 31.2969 15.2959 C 32.5576 14.8076 33.8301 13.6045 33.8252 12.5664 C 32.9775 12.7178 31.2852 13.4619 30.793 14.4551 C 30.0742 13.707 28.3906 12.3984 26.7871 12.3945 C 27.9746 11.5391 28.8945 10.5059 28.9893 8.5938 C 30.2422 9.5645 32.6953 10.1797 34.0752 9.582 C 29.2344 5.3457 29.7031 2.3125 29.7578 0.9902 C f 13.8525 29.9844 m 13.3281 29.5127 13.1309 29.25 V 15.623 27.4326 13.3691 21.6074 12.8555 20.5439 C 12.2168 20.4883 10.8096 23.2285 10.8457 24.7266 C 9.7129 23.9707 8.0488 24.0918 6.4463 24.3779 C 7.0186 23.2891 6.6172 21.3447 5.8164 20.5439 C 6.8184 20.5801 8.1699 19.8652 9.4785 18.8838 C 8.6436 18.0645 6.8164 18.2246 4.9004 18.8838 C 4.9004 17.5107 4.0781 15.7734 3.2412 14.5918 C 4.5576 14.6484 5.7031 13.9629 6.5605 12.9316 C 7.2256 14.5 9.2598 15.6133 10.166 15.5645 C 10.1826 14.1992 8.6094 12.1094 7.5879 11.7109 C 8.1875 11.041 9.207 9.5107 10.166 7.0947 C 10.9648 9.0205 12.1348 10.2627 13.3672 11.1953 C 12.2256 12.7578 12.3994 13.6289 12.7988 15.1074 C 13.541 14.5664 14.5723 14.1338 14.7441 12.1309 C 16.4609 12.416 17.5957 12.3447 19.0938 11.4434 C 18.6387 13.1055 18.6348 14.707 18.9551 16.4063 C 17.1055 16.2666 15.5449 16.4795 14.5156 17.9688 C 15.3457 18.1953 17.6055 18.2549 18.4795 17.3223 C 18.8066 18.3047 19.7012 19.7109 21.1475 20.4043 C 19.707 20.6641 18.7227 21.7637 17.8135 23.4492 C 17.1006 22.0332 14.873 20.3691 13.3711 20.3145 C 15.373 24.3779 15.373 27.2959 13.8525 29.9844 C f 41.2324 26.0742 m 41.5518 26.7021 41.7549 26.959 V 44.1523 25.0176 48.958 28.3262 49.8535 29.0957 C 49.7432 29.7266 47.6182 30.8643 45.9004 29.834 C 46.3408 31.123 45.4395 33.084 44.2402 34.126 C 45.9805 34.0254 48.126 35.3867 48.6484 36.1289 C 48.8701 35.1514 50.0527 33.8809 51.3379 32.8672 C 51.6895 33.8398 50.9941 35.958 50.0781 37.5605 C 51.3125 38.0605 52.4248 38.9912 52.8828 40.25 C 53.3398 38.9336 54.3428 38.2598 55.6875 37.5039 C 54.5273 36.0762 53.7471 33.9023 54.0273 33.0391 C 55.3496 33.374 56.9209 36.0918 57.0439 37.1816 C 57.9189 36.415 59.4727 35.7285 62.0537 35.4219 C 60.3535 34.3438 59.9902 32.3516 59.4063 30.9219 C 58.2588 31.3682 56.0898 31.4277 55.1152 30.8643 C 55.8281 30.2852 57.168 29.7344 59.1777 29.7207 C 59.1777 28.1758 59.6406 27.043 60.8945 25.8281 C 59.1719 25.8418 57.0723 25.3555 55.5762 24.9629 C 55.3281 26.292 54.4844 27.8887 53.3398 28.2891 C 53.334 27.4277 53.5996 25.1797 54.4844 24.5117 C 53.6201 23.9443 52.3672 22.5674 51.9102 20.8496 C 51.2881 22.1758 50.4268 23.4805 48.5645 23.9238 C 49.749 24.9766 50.584 26.9941 50.25 28.4609 C 45.1973 24.4785 42.5215 25.7773 41.2324 26.0742 C f 27.7578 38.7324 m 28.4346 38.9316 28.7246 39.084 V 27.2559 41.7969 31.707 46.0776 32.627 46.8169 C 33.2275 46.5918 33.3477 44.0586 32.6699 42.7227 C 33.5137 42.8457 35.7031 41.4678 36.4609 40.1787 C 36.5254 40.8652 38.0957 43.8066 38.9219 44.1846 C 38.002 44.582 37.3359 46.0547 36.5742 47.5039 C 37.5957 47.6709 38.9961 46.7485 40.4668 45.8438 C 40.9814 46.6445 42.3555 47.6177 43.6143 48.1328 C 42.5264 48.8198 42.0313 49.5615 41.5352 51.0205 C 40.4922 50.4556 38.3057 50.3057 37.7764 50.5938 C 38.291 51.7056 40.5371 52.2485 41.2676 52.1958 C 41.0137 53.0576 40.8652 55.2109 41.0391 57.8037 C 39.3789 56.4878 37.834 55.1719 36.1738 55.2285 C 36.4434 53.8076 35.8076 52.002 35.4307 51.5088 C 34.8574 52.2529 34.4463 53.0796 34.8008 55.0576 C 33.3486 55.5425 32.1113 56.0879 30.7373 57.3467 C 30.7373 55.5146 30.166 54.314 29.2969 53.0366 C 30.5576 52.5488 31.8301 51.3467 31.8252 50.3076 C 30.9775 50.46 29.2852 51.2036 28.793 52.1958 C 28.0742 51.4497 26.3906 50.1396 24.7871 50.1357 C 25.9746 49.2817 26.8945 48.2466 26.9893 46.335 C 28.2422 47.3057 30.6953 47.9209 32.0752 47.3237 C 27.2344 43.0869 27.7031 40.0547 27.7578 38.7324 C f 13.5195 70.3916 m 12.9941 69.9209 12.7988 69.6587 V 15.2891 67.8418 13.0352 62.0146 12.5225 60.9517 C 11.8828 60.8955 10.4766 63.6367 10.5117 65.1348 C 9.3809 64.3789 7.7148 64.4995 6.1133 64.7856 C 6.6855 63.6987 6.2842 61.7529 5.4834 60.9517 C 6.4854 60.9878 7.8359 60.2729 9.1455 59.2925 C 8.3105 58.4717 6.4834 58.6338 4.5674 59.2925 C 4.5674 57.9189 3.7461 56.1816 2.9082 54.9995 C 4.2246 55.0576 5.3691 54.3706 6.2275 53.3408 C 6.8926 54.9097 8.9258 56.0215 9.832 55.9727 C 9.8496 54.6079 8.2764 52.5176 7.2539 52.1187 C 7.8545 51.4497 8.873 49.9189 9.832 47.5039 C 10.6309 49.4297 11.8008 50.6719 13.0342 51.6045 C 11.8926 53.1655 12.0664 54.0366 12.4648 55.5146 C 13.209 54.9746 14.2393 54.5415 14.4102 52.5386 C 16.127 52.8247 17.2637 52.7529 18.7598 51.8525 C 18.3057 53.5137 18.3027 55.1147 18.623 56.8149 C 16.7725 56.6748 15.2129 56.8887 14.1826 58.377 C 15.0117 58.6035 17.2725 58.6626 18.1465 57.731 C 18.4736 58.7129 19.3691 60.1187 20.8145 60.8125 C 19.375 61.0728 18.3896 62.1719 17.4805 63.8579 C 16.7676 62.4429 14.541 60.7769 13.0371 60.7227 C 15.041 64.7856 15.041 67.7046 13.5195 70.3916 C f 41.2324 64.4824 m 41.5518 65.1113 41.7549 65.3682 V 44.1523 63.4272 48.958 66.7354 49.8535 67.5034 C 49.7432 68.1362 47.6182 69.2725 45.9004 68.2422 C 46.3408 69.5313 45.4395 71.4922 44.2402 72.5342 C 45.9805 72.4341 48.126 73.7954 48.6484 74.5371 C 48.8701 73.5601 50.0527 72.29 51.3379 71.2754 C 51.6895 72.249 50.9941 74.3662 50.0781 75.9683 C 51.3125 76.4692 52.4248 77.3994 52.8828 78.6582 C 53.3398 77.3423 54.3428 76.667 55.6875 75.9111 C 54.5273 74.4844 53.7471 72.3101 54.0273 71.4473 C 55.3496 71.7822 56.9209 74.5 57.0439 75.5903 C 57.9189 74.8232 59.4727 74.1372 62.0537 73.8311 C 60.3535 72.7534 59.9902 70.7612 59.4063 69.3301 C 58.2588 69.7773 56.0898 69.8364 55.1152 69.2725 C 55.8281 68.6934 57.168 68.1431 59.1777 68.1284 C 59.1777 66.583 59.6406 65.4512 60.8945 64.2373 C 59.1719 64.249 57.0723 63.7632 55.5762 63.3721 C 55.3281 64.7002 54.4844 66.2974 53.3398 66.6973 C 53.334 65.8364 53.5996 63.5874 54.4844 62.9214 C 53.6201 62.353 52.3672 60.9751 51.9102 59.2583 C 51.2881 60.583 50.4268 61.8882 48.5645 62.333 C 49.749 63.3862 50.584 65.4033 50.25 66.8691 C 45.1973 62.8872 42.5215 64.1851 41.2324 64.4824 C f %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Stripes) (Stripes) 8.45 4.6001 80.45 76.6001 [ %AI3_Tile (0 O 0 R 1 0.07 1 0 k 1 0.07 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 3.6 w 4 M []0 d %AI3_Note: 0 D 0 XR 8.2 8.2 m 80.7 8.2 L S 8.2 22.6001 m 80.7 22.6001 L S 8.2 37.0002 m 80.7 37.0002 L S 8.2 51.4 m 80.7 51.4 L S 8.2 65.8001 m 80.7 65.8001 L S 8.2 15.4 m 80.7 15.4 L S 8.2 29.8001 m 80.7 29.8001 L S 8.2 44.2 m 80.7 44.2 L S 8.2 58.6001 m 80.7 58.6001 L S 8.2 73.0002 m 80.7 73.0002 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_BeginBrushPattern (New Pattern 1) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7834.75 8587 m -7834.75 8563 L -7884.75 8563 L -7884.75 8587 L -7834.75 8587 L n u 0 Ap 0 O 1 g -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C F -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C F -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C F -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C F -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C F -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C F -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C F -7844.7817 8565.125 m -7850.9009 8563.6162 -7854.7817 8565.125 V -7858.877 8563.6484 -7864.7817 8565.125 V -7869.7446 8563.4492 -7874.7817 8565.125 V -7880.7969 8563.5742 -7884.7817 8565.125 V -7884.7817 8584.8096 L -7881.6958 8585.7842 -7878.2969 8585.9912 -7874.3799 8584.9082 C -7868.2134 8586.4912 -7864.4634 8584.9082 V -7859.4634 8586.4912 -7854.3799 8584.8242 V -7850.0474 8586.4082 -7844.3799 8584.9082 V -7838.8799 8586.3242 -7834.7817 8585.125 V -7834.7817 8565.4404 L -7837.5254 8564.4287 -7840.6514 8563.9287 -7844.7817 8565.125 C f 0 R 0 G 1 J 1 j 0.5 w -7864.75 8585 m -7872.54 8586.9473 -7878.813 8583.585 -7884.75 8579.0488 C S -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C S -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C S -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C S -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C S -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C S -7854.75 8565 m -7846.96 8563.0527 -7840.687 8566.415 -7834.75 8570.9512 C S -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C S -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C S U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 2) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7819.187 8586 L -7819.187 8521.9023 L -7884 8521.9023 L -7884 8586 L n u 0 O 0 g -7849.6978 8544.4297 m -7851.6094 8521.9023 L -7853.5215 8544.4297 L -7852.9033 8544.3066 -7852.2642 8544.2402 -7851.6094 8544.2402 c -7850.9551 8544.2402 -7850.3159 8544.3066 -7849.6978 8544.4297 C f -7861.2402 8552.3975 m -7884 8554.3301 L -7861.1138 8556.2734 L -7861.2856 8555.5469 -7861.3848 8554.793 -7861.3848 8554.0156 c -7861.3848 8553.4629 -7861.3281 8552.9248 -7861.2402 8552.3975 C f -7856.519 8545.5723 m -7870.1626 8536.8047 L -7860.2153 8549.377 L -7859.3574 8547.791 -7858.0718 8546.4766 -7856.519 8545.5723 C f -7853.481 8563.6074 m -7851.5786 8586 L -7849.6768 8563.5967 L -7850.3018 8563.7227 -7850.9473 8563.791 -7851.6094 8563.791 c -7852.25 8563.791 -7852.873 8563.7246 -7853.481 8563.6074 C f -7841.9609 8555.5068 m -7819.187 8553.5732 L -7842.083 8551.6289 L -7842.083 8551.8506 L -7841.9258 8552.5488 -7841.834 8553.2695 -7841.834 8554.0156 c -7841.834 8554.5234 -7841.8848 8555.0195 -7841.9609 8555.5068 C f -7860.1138 8558.8262 m -7870.1641 8571.5293 L -7856.2778 8562.6055 L -7857.8823 8561.7305 -7859.2114 8560.416 -7860.1138 8558.8262 C f -7842.9961 8549.3945 m -7832.875 8536.6055 L -7846.7666 8545.5313 L -7845.1768 8546.4414 -7843.8633 8547.7793 -7842.9961 8549.3945 C f -7846.6895 8562.4512 m -7832.873 8571.3281 L -7842.9658 8558.5732 L -7843.8198 8560.1895 -7845.1152 8561.5313 -7846.6895 8562.4512 C f -7842.8887 8558.6133 m -7842.3862 8557.6641 -7842.043 8556.6211 -7841.875 8555.5195 c -7841.7993 8555.0293 -7841.748 8554.5273 -7841.748 8554.0156 c -7841.748 8553.2637 -7841.8398 8552.5352 -7841.998 8551.8311 c -7842.1958 8550.957 -7842.5049 8550.124 -7842.918 8549.3545 c -7843.7954 8547.7246 -7845.1191 8546.374 -7846.7241 8545.4561 c -7847.6294 8544.9375 -7848.6226 8544.5537 -7849.6802 8544.3457 c -7850.3047 8544.2207 -7850.9497 8544.1523 -7851.6094 8544.1523 c -7852.2695 8544.1523 -7852.915 8544.2207 -7853.5391 8544.3457 c -7854.623 8544.5605 -7855.6382 8544.957 -7856.5625 8545.4961 c -7858.1313 8546.4102 -7859.4282 8547.7363 -7860.291 8549.335 c -7860.7969 8550.2695 -7861.145 8551.2969 -7861.3262 8552.3828 c -7861.415 8552.916 -7861.4727 8553.459 -7861.4727 8554.0156 c -7861.4727 8554.8008 -7861.3711 8555.5605 -7861.1978 8556.293 c -7860.981 8557.207 -7860.6406 8558.0732 -7860.187 8558.8701 c -7859.2793 8560.4727 -7857.939 8561.8008 -7856.3174 8562.6826 c -7855.4487 8563.1553 -7854.5 8563.498 -7853.4961 8563.6934 c -7852.8848 8563.8115 -7852.2554 8563.8779 -7851.6094 8563.8779 c -7850.9414 8563.8779 -7850.29 8563.8086 -7849.6602 8563.6826 c -7848.5786 8563.4668 -7847.5664 8563.0654 -7846.6455 8562.5273 c -7845.0566 8561.5977 -7843.751 8560.2441 -7842.8887 8558.6133 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 3) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7874.75 8587 m -7874.75 8563 L -7884.75 8563 L -7884.75 8587 L -7874.75 8587 L n u u 0 Ap 0 O 1 g -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 c -7877.897 8566.9736 -7881.0898 8565 -7884.75 8565 C -7884.75 8585 L -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 c -7881.9121 8584.7754 -7880.1807 8584.0645 -7878.7441 8582.9824 c -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 c f 0 R 0 G 1 J 1 j 0.5 w -7884.75 8565.3174 m -7881.7207 8566.2744 -7878.8926 8567.9326 -7876.1543 8569.9072 C S -7884.75 8570.9512 m -7881.5991 8573.3564 -7878.543 8576.0869 -7875.4058 8578.5361 C S -7878.7441 8582.9824 m -7880.8105 8581.8916 -7882.7993 8580.5342 -7884.75 8579.043 C S -7883.8018 8584.9521 m -7884.1191 8584.8682 -7884.4375 8584.7852 -7884.75 8584.6865 C S -7878.7441 8582.9824 m -7880.1807 8584.0645 -7881.9121 8584.7744 -7883.8018 8584.9521 C S -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 C S -7884.75 8585 m -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 C S -7878.7441 8582.9824 m -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 C S -7876.1543 8569.9072 m -7877.8975 8566.9736 -7881.0898 8565 -7884.75 8565 C S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 5) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7726.3994 8587 m -7726.3994 8573.4199 L -7885 8573.4199 L -7885 8587 L -7726.3994 8587 L n u u 0 O 0.285 0.228 0.171 0 k -7741.0786 8585.4844 m -7741.043 8586.6895 L -7727.5103 8587.5176 -7726.8418 8586.2822 v -7726.7441 8586.1016 -7726.647 8585.7148 -7726.561 8585.1934 C -7728.584 8585.8242 -7738.291 8585.5713 -7741.0786 8585.4844 C f 0.44 0.352 0.264 0 k -7741.4063 8574.0234 m -7741.3711 8575.2676 L -7738.4912 8575.0488 -7728.1914 8574.3164 -7726.543 8574.8652 C -7726.7031 8574.2188 -7726.9199 8573.7646 -7727.2046 8573.6152 c -7728.8306 8572.7656 -7741.4063 8574.0234 Y f 0.145 0.116 0.087 0 k -7741.3711 8575.2676 m -7741.0786 8585.4844 L -7738.291 8585.5713 -7728.584 8585.8242 -7726.561 8585.1934 C -7726.1519 8582.7773 -7725.9258 8577.3604 -7726.543 8574.8652 C -7728.1914 8574.3164 -7738.4912 8575.0488 -7741.3711 8575.2676 C f U u 0.155 0.124 0.093 0 k -7766.9375 8579.2734 m -7765.897 8579.6563 L -7747.0728 8575.1465 L -7747.481 8574.3145 L -7766.3633 8576.7246 L -7767.252 8577.0059 L -7767.6504 8576.8936 -7768.1934 8576.8242 V -7767.6094 8577.2373 -7767.1426 8578.1406 -7766.9375 8579.2734 C f u 0.085 0.068 0.051 0 k -7771.7993 8583.666 m -7772.5977 8583.7217 -7769.749 8583.6641 Y -7770.3481 8583.0176 -7770.771 8581.8203 -7770.8105 8580.4375 c -7770.8169 8580.2246 -7770.8105 8580.0176 -7770.7993 8579.8135 C -7771.041 8579.707 -7771.0918 8579.7734 -7771.6289 8579.5645 C -7771 8583.6113 -7771.7993 8583.666 v f 0.305 0.244 0.183 0 k -7770.3442 8576.8672 m -7770.5527 8576.8105 -7770.4937 8578.9307 Y -7769.4785 8579.7588 L -7767.8359 8578.9434 L -7766.9375 8579.2734 L -7767.1426 8578.1406 -7767.6094 8577.2373 -7768.1934 8576.8242 C -7768.6094 8576.7715 -7769.874 8576.7998 -7770.3442 8576.8672 C f U 0.115 0.092 0.069 0 k -7766.9375 8579.2734 m -7767.8359 8578.9434 L -7769.4785 8579.7588 L -7770.4937 8578.9307 L -7770.793 8579.708 -7770.7993 8579.8135 V -7769.5137 8580.3789 -7768.1831 8580.7402 -7766.8398 8580.9258 C -7766.79 8580.7275 -7766.7842 8580.543 -7766.79 8580.3369 c -7766.7998 8579.9717 -7766.8218 8579.6182 -7766.9375 8579.2734 C f 0.41 0.328 0.246 0 k -7747.4512 8575.3965 m -7749.377 8576.6426 -7758.3862 8582.0986 -7766.8398 8580.9258 C -7766.9038 8582.0928 -7767.248 8583.0908 -7767.75 8583.6631 C -7767.1895 8583.6621 L -7746.7402 8586.7559 L -7747.0366 8576.4258 L -7747.0728 8575.1465 L -7747.2046 8575.2373 -7747.4512 8575.3965 v f 0.395 0.316 0.237 0 k -7770.8105 8580.4375 m -7770.771 8581.8203 -7770.3481 8583.0176 -7769.749 8583.6641 C -7767.6807 8583.6631 L -7767.1782 8583.0908 -7766.8218 8582.0713 -7766.8398 8580.9258 C -7768.1831 8580.7402 -7769.5137 8580.3789 -7770.7993 8579.8135 C -7770.8105 8580.0176 -7770.8169 8580.2246 -7770.8105 8580.4375 c f U u 0 0 0 0.11 k -7741.2642 8574.2012 m -7740.2407 8574.0352 L -7741.2642 8574.2012 L -7741.2642 8574.2012 L f 0 0 0 0.34 k -7747.481 8574.3145 m -7747.0728 8575.1465 L -7745.6714 8574.918 L -7744.5234 8574.7314 L -7742.6758 8574.4307 L -7741.2642 8574.2012 L -7740.2407 8574.0352 L -7740.2954 8573.7168 -7740.3672 8573.498 -7740.4648 8573.4199 C -7747.481 8574.3145 L f 0 0 0 0.32 k -7745.8042 8579.207 m -7746.041 8586.8613 L -7740.7144 8587 L -7739.7266 8583.5146 -7740.1816 8579.1543 V -7745.8042 8579.207 L f U 0.025 0.02 0.015 0 k -7739.3223 8576.3848 m -7736.373 8576.9199 -7733.2402 8577.1602 -7730.3159 8576.3613 c -7730.2856 8576.3496 -7730.2754 8576.3184 -7730.2871 8576.2969 c -7730.2881 8576.2656 -7730.3198 8576.2559 -7730.3418 8576.2559 c -7733.2422 8577.0645 -7736.375 8576.8242 -7739.3042 8576.2783 c -7739.3262 8576.2793 -7739.3574 8576.291 -7739.3672 8576.3223 c -7739.3662 8576.3438 -7739.355 8576.375 -7739.3223 8576.3848 c -7739.3223 8576.3848 l f -7737.8374 8575.3076 m -7737.7295 8575.3789 -7737.6313 8575.4941 -7737.5234 8575.502 c -7733.7886 8575.832 -7730.1631 8575.7813 -7726.4746 8575.6641 c -7726.4526 8575.6641 -7726.4209 8575.6426 -7726.4214 8575.6211 c -7726.4214 8575.5879 -7726.4551 8575.5684 -7726.4766 8575.5684 c -7729.3223 8575.6816 -7732.1401 8575.6992 -7735.0039 8575.5352 c -7735.9336 8575.4766 -7736.9082 8575.7402 -7737.7778 8575.2207 c -7737.7993 8575.2109 -7737.8306 8575.2109 -7737.8506 8575.2334 c -7737.8618 8575.2559 -7737.8594 8575.2871 -7737.8374 8575.3076 c -7737.8374 8575.3076 l f -7733.373 8577.3672 m -7731.5098 8578.6797 -7729.3022 8579.374 -7727.1001 8579.8867 c -7727.0679 8579.8965 -7727.0474 8579.8848 -7727.0366 8579.8535 c -7727.0273 8579.8203 -7727.0488 8579.8008 -7727.0703 8579.79 c -7729.2617 8579.2656 -7731.459 8578.6035 -7733.3105 8577.2803 c -7733.3433 8577.2598 -7733.375 8577.2715 -7733.3848 8577.293 c -7733.4058 8577.3145 -7733.3945 8577.3457 -7733.373 8577.3672 c -7733.373 8577.3672 l f -7738.9321 8584.0566 m -7736.7295 8584.5703 -7734.5298 8585.0303 -7732.2798 8585.2754 c -7732.2598 8585.2852 -7732.229 8585.2637 -7732.229 8585.2422 c -7732.2183 8585.209 -7732.2407 8585.1777 -7732.2729 8585.1787 c -7734.5122 8584.8809 -7736.7305 8584.5176 -7738.9126 8583.9502 c -7738.9351 8583.9512 -7738.9673 8583.9629 -7738.9766 8583.9941 c -7738.9751 8584.0156 -7738.9648 8584.0479 -7738.9321 8584.0566 c -7738.9321 8584.0566 l f -7738.439 8583.3604 m -7736.3457 8584.1973 -7734.1016 8583.9297 -7731.9023 8583.9629 c -7731.8706 8583.9609 -7731.8496 8583.9395 -7731.8506 8583.9082 c -7731.8521 8583.875 -7731.873 8583.8555 -7731.8945 8583.8555 c -7734.0928 8583.8438 -7736.3374 8584.0996 -7738.4209 8583.2529 c -7738.4434 8583.2539 -7738.4746 8583.2656 -7738.4834 8583.2969 c -7738.4834 8583.3184 -7738.4722 8583.3506 -7738.439 8583.3604 c -7738.439 8583.3604 l f -7737.707 8584.7051 m -7736.3833 8584.752 -7735.1504 8584.5469 -7733.8271 8584.209 c -7733.3594 8584.0996 -7732.9199 8584.2266 -7732.4609 8584.2129 c -7731.897 8584.1973 l -7731.874 8584.1963 -7731.8633 8584.1855 -7731.8535 8584.1738 c -7731.834 8584.1523 -7731.8442 8584.1211 -7731.8662 8584.0996 c -7732.0625 8583.9453 l -7732.0742 8583.9453 -7732.085 8583.9355 -7732.0962 8583.9355 c -7732.5 8583.9473 l -7733.9551 8584.1914 -7735.457 8584.6719 -7736.8926 8584.0742 c -7736.9258 8584.0645 -7736.957 8584.0859 -7736.9673 8584.1074 c -7736.9673 8584.1396 -7736.9551 8584.1602 -7736.9336 8584.1709 c -7735.647 8584.6992 -7734.1714 8584.4756 -7732.8818 8584.0547 c -7732.0918 8584.043 L -7732.124 8584.0332 L -7731.9282 8584.1875 L -7731.8984 8584.0898 L -7732.4639 8584.1064 l -7732.9321 8584.1406 -7733.3848 8583.9834 -7733.8398 8584.1035 c -7735.1543 8584.4609 -7736.3975 8584.625 -7737.71 8584.5986 c -7737.7422 8584.5996 -7737.7642 8584.6211 -7737.7617 8584.6533 c -7737.7617 8584.6855 -7737.7402 8584.7061 -7737.707 8584.7051 c -7737.707 8584.7051 l f -7738.5718 8585.0605 m -7735.8711 8586.2207 -7732.9023 8585.5703 -7730.1279 8585.1816 c -7729.7832 8585.2891 l -7729.7617 8585.2988 -7729.7417 8585.2871 -7729.7207 8585.2656 c -7729.71 8585.2441 -7729.7217 8585.2129 -7729.7422 8585.2021 c -7730.0801 8585.0098 l -7732.7754 8584.3926 -7735.5391 8584.7813 -7738.271 8584.7852 c -7738.3022 8584.7871 -7738.3232 8584.8086 -7738.3223 8584.8398 c -7738.3198 8584.8721 -7738.2983 8584.8926 -7738.2681 8584.8926 c -7735.6738 8584.9355 -7733.0303 8584.4434 -7730.4727 8585.0742 c -7729.7954 8585.2891 L -7729.7534 8585.1914 L -7730.1406 8585.0859 l -7732.9058 8585.4424 -7735.8418 8586.1348 -7738.5313 8584.9746 c -7738.5537 8584.9648 -7738.585 8584.9648 -7738.5962 8584.998 c -7738.6055 8585.0195 -7738.605 8585.0508 -7738.5718 8585.0605 c -7738.5718 8585.0605 l f -7735.6895 8578.3945 m -7734.3945 8578.9004 -7732.9834 8578.6465 -7731.6802 8578.3438 c -7731.647 8578.3418 -7731.6367 8578.3203 -7731.6382 8578.2891 c -7731.6504 8578.2568 -7731.6714 8578.2461 -7731.7031 8578.248 c -7732.998 8578.5303 -7734.377 8578.8154 -7735.6504 8578.2969 c -7735.6826 8578.2871 -7735.7144 8578.2988 -7735.7246 8578.3311 c -7735.7222 8578.3525 -7735.7114 8578.3848 -7735.6895 8578.3945 c -7735.6895 8578.3945 l f -7736.1401 8580.2207 m -7734.2266 8580.6895 -7732.3145 8581.1035 -7730.355 8581.3242 c -7730.3242 8581.334 -7730.3022 8581.3125 -7730.293 8581.2803 c -7730.2954 8581.2598 -7730.3159 8581.2285 -7730.3374 8581.2285 c -7732.2959 8581.0078 -7734.209 8580.582 -7736.1206 8580.1133 c -7736.1426 8580.1152 -7736.1738 8580.126 -7736.1831 8580.1582 c -7736.1831 8580.1797 -7736.1719 8580.2109 -7736.1401 8580.2207 c -7736.1401 8580.2207 l f -7736.9336 8582.6348 m -7734.499 8583.4609 -7731.8647 8583.0547 -7729.3457 8583.0879 c -7729.313 8583.0879 -7729.293 8583.0664 -7729.293 8583.0332 c -7729.2954 8583.0117 -7729.3159 8582.9922 -7729.3481 8582.9922 c -7731.8574 8582.916 -7734.481 8583.3848 -7736.8945 8582.5264 c -7736.9282 8582.5273 -7736.959 8582.5391 -7736.9688 8582.5605 c -7736.9678 8582.5918 -7736.9561 8582.624 -7736.9336 8582.6348 c -7736.9336 8582.6348 l f -7732.0542 8583.8496 m -7730.6582 8584.5449 -7729.0503 8584.4033 -7727.5342 8584.4668 c -7727.502 8584.4648 -7727.4824 8584.4434 -7727.4824 8584.4121 c -7727.4834 8584.3906 -7727.5054 8584.3594 -7727.5366 8584.3594 c -7729.0137 8584.2207 -7730.6489 8584.5234 -7732.0039 8583.7617 c -7732.0366 8583.7529 -7732.0679 8583.7637 -7732.0786 8583.7861 c -7732.0879 8583.8076 -7732.0767 8583.8398 -7732.0542 8583.8496 c -7732.0542 8583.8496 l f -7731.3418 8580.4248 m -7730.3926 8580.3975 -7729.4336 8580.3701 -7728.4839 8580.3428 c -7728.4526 8580.3418 -7728.4312 8580.3203 -7728.4336 8580.2881 c -7728.4336 8580.2559 -7728.4551 8580.2354 -7728.4878 8580.2363 c -7729.437 8580.2637 -7730.397 8580.291 -7731.3457 8580.3184 c -7731.377 8580.3184 -7731.3975 8580.3418 -7731.3975 8580.373 c -7731.397 8580.4043 -7731.374 8580.4258 -7731.3418 8580.4248 c -7731.3418 8580.4248 l f -7729.1592 8578.0361 m -7728.6895 8578.0645 -7728.209 8578.0723 -7727.7383 8578.0918 c -7727.7168 8578.0908 -7727.6855 8578.0684 -7727.6865 8578.0371 c -7727.687 8578.0039 -7727.71 8577.9844 -7727.7417 8577.9844 c -7728.2114 8577.9873 -7728.6816 8577.9375 -7729.1514 8577.9395 c -7729.1831 8577.9297 -7729.2031 8577.9512 -7729.2134 8577.9844 c -7729.2129 8578.0156 -7729.1914 8578.0371 -7729.1592 8578.0361 c -7729.1592 8578.0361 l f -7736.9702 8580.2344 m -7736.5688 8580.5107 -7736.125 8580.6797 -7735.645 8580.751 c -7735.6113 8580.7607 -7735.5918 8580.7383 -7735.5806 8580.7168 c -7735.5703 8580.6855 -7735.5928 8580.6543 -7735.6152 8580.6543 c -7736.0854 8580.5723 -7736.5176 8580.4023 -7736.9209 8580.1475 c -7736.9521 8580.1377 -7736.9849 8580.1387 -7736.9946 8580.1709 c -7737.0039 8580.1934 -7736.9922 8580.2246 -7736.9702 8580.2344 c -7736.9702 8580.2344 l f -7738.1904 8586.085 m -7735.7344 8586.5273 -7733.2983 8587.001 -7730.7993 8586.7266 c -7730.7778 8586.7266 -7730.7568 8586.7041 -7730.7578 8586.6719 c -7730.7578 8586.6406 -7730.7798 8586.6191 -7730.8022 8586.6191 c -7733.291 8586.873 -7735.7344 8586.4844 -7738.1719 8585.9775 c -7738.1934 8585.9785 -7738.2256 8585.9902 -7738.2344 8586.0215 c -7738.2344 8586.043 -7738.2222 8586.0752 -7738.1904 8586.085 c -7738.1904 8586.085 l f 0.195 0.156 0.117 0 k -7738.166 8574.6445 m -7735.7969 8574.2676 -7733.4058 8574.3477 -7731.0298 8574.5898 c -7730.998 8574.5879 -7730.9766 8574.5664 -7730.9766 8574.5352 c -7730.9785 8574.5137 -7731 8574.4824 -7731.0215 8574.4824 c -7733.4082 8574.2422 -7735.791 8574.1602 -7738.1694 8574.5391 c -7738.2026 8574.5391 -7738.2222 8574.5605 -7738.2217 8574.5938 c -7738.2207 8574.625 -7738.1992 8574.6465 -7738.166 8574.6445 c -7738.166 8574.6445 l f 0.335 0.268 0.201 0 k -7737.4351 8574.1113 m -7734.9282 8574.1152 -7732.4146 8574.2773 -7729.918 8573.8965 c -7729.8862 8573.8945 -7729.8647 8573.873 -7729.8662 8573.8418 c -7729.8672 8573.8086 -7729.8896 8573.7891 -7729.9209 8573.7891 c -7732.418 8574.1699 -7734.9297 8574.0293 -7737.4375 8574.0059 c -7737.46 8574.0059 -7737.481 8574.0273 -7737.4785 8574.0596 c -7737.4785 8574.0918 -7737.457 8574.1123 -7737.4351 8574.1113 c -7737.4351 8574.1113 l f 0.205 0.164 0.123 0 k -7738.9766 8574.3262 m -7737.5039 8574.668 -7736.0078 8574.4023 -7734.5391 8574.2207 c -7734.5078 8574.2207 -7734.4873 8574.1973 -7734.499 8574.166 c -7734.5 8574.1348 -7734.5215 8574.1133 -7734.5537 8574.125 c -7736.0103 8574.2842 -7737.4961 8574.583 -7738.9473 8574.2188 c -7738.9785 8574.2207 -7739.0103 8574.2324 -7739.0098 8574.2637 c -7739.019 8574.2852 -7738.998 8574.3164 -7738.9766 8574.3262 c -7738.9766 8574.3262 l f -7732.3535 8573.7949 m -7731.1978 8573.9219 -7730.0273 8573.8145 -7728.8926 8573.5898 c -7728.8711 8573.5781 -7728.8506 8573.5566 -7728.8618 8573.5244 c -7728.8623 8573.5029 -7728.8945 8573.4824 -7728.916 8573.4941 c -7730.0503 8573.7402 -7731.1914 8573.7939 -7732.3462 8573.6885 c -7732.3794 8573.6895 -7732.3984 8573.7109 -7732.4087 8573.7324 c -7732.4082 8573.7646 -7732.3862 8573.7852 -7732.3535 8573.7949 c -7732.3535 8573.7949 l f 0.335 0.268 0.201 0 k -7739.2681 8576.4473 m -7737.9214 8577.1885 -7736.3066 8576.5977 -7734.855 8576.6416 c -7734.8223 8576.6406 -7734.8022 8576.6191 -7734.8022 8576.5859 c -7734.8042 8576.5654 -7734.8262 8576.5449 -7734.8574 8576.5449 c -7736.2886 8576.4902 -7737.8823 8577.0801 -7739.2168 8576.3506 c -7739.2383 8576.3398 -7739.2695 8576.3516 -7739.291 8576.374 c -7739.3008 8576.3955 -7739.2886 8576.4277 -7739.2681 8576.4473 c -7739.2681 8576.4473 l f -7737.8945 8578.5645 m -7735.6719 8579.0449 -7733.3896 8578.6162 -7731.1504 8578.5625 c -7731.1177 8578.5615 -7731.0977 8578.5391 -7731.0977 8578.5078 c -7731.1001 8578.4863 -7731.1318 8578.4668 -7731.1519 8578.4668 c -7733.3833 8578.4775 -7735.6519 8578.9805 -7737.875 8578.457 c -7737.8975 8578.457 -7737.9287 8578.4688 -7737.9375 8578.502 c -7737.9375 8578.5225 -7737.9258 8578.5547 -7737.8945 8578.5645 c -7737.8945 8578.5645 l f -7732.0273 8575.1406 m -7730.3496 8575.9688 -7728.499 8576.502 -7726.603 8576.3613 c -7726.5718 8576.3613 -7726.5513 8576.3389 -7726.5527 8576.3066 c -7726.5527 8576.2754 -7726.5742 8576.2539 -7726.6074 8576.2559 c -7728.481 8576.416 -7730.3198 8575.8604 -7731.9873 8575.0547 c -7732.0078 8575.0449 -7732.041 8575.0449 -7732.0503 8575.0781 c -7732.061 8575.0996 -7732.061 8575.1309 -7732.0273 8575.1406 c -7732.0273 8575.1406 l f u 0.5 0.85 1 0.45 k -7885 8581.9082 m -7885.0254 8582.4883 -7884.5664 8583.1875 -7883.167 8583.9902 C -7882.8521 8584.0029 -7881.3945 8584.0234 -7879.0889 8584.0488 C -7879.0889 8581.8223 L -7881.1382 8581.8457 -7883.1177 8581.8867 -7885 8581.9082 C f -7884.5088 8580.9688 m -7879.0889 8580.8447 L -7879.0889 8579.8145 L -7882.644 8579.959 L -7883.8145 8580.3301 -7884.5088 8580.9688 V f 0.5 0.85 1 0.32 k -7879.0889 8580.8252 m -7884.4746 8580.9434 L -7884.7695 8581.2148 -7884.9849 8581.5566 -7885 8581.9277 C -7883.1177 8581.9063 -7881.1382 8581.8848 -7879.0889 8581.8613 C -7879.0889 8580.8252 L f 0.5 0.85 1 0.45 k -7774.1504 8580.6172 m -7852.3584 8581.541 -7879.1079 8581.8418 V -7879.1079 8584.0488 L -7862.8145 8584.2324 -7803.9902 8584.707 Y -7769.749 8583.6641 L -7770.457 8580.5684 L -7774.1504 8580.6172 L f 0.5 0.85 1 0.12 k -7879.1079 8579.8145 m -7879.1079 8580.8447 L -7770.4258 8579 L -7770.3833 8576.8633 L -7803.6553 8576.7129 L -7879.1079 8579.8145 L f u 0.065 0.052 0.039 0 k -7747.0728 8575.1465 m -7747.0366 8576.4258 L -7747.2954 8575.1172 L -7765.897 8579.6563 L -7766.9375 8579.2734 L -7766.8794 8579.6055 -7766.8398 8579.957 -7766.8306 8580.3223 c -7766.8242 8580.5283 -7766.8281 8580.7285 -7766.8398 8580.9258 C -7758.3862 8582.0986 -7748.9634 8577.6719 -7747.0366 8576.4258 C -7746.7402 8586.7559 L -7746.041 8586.8613 L -7745.8042 8579.207 L -7740.1816 8579.1543 L -7740.0898 8577.0137 -7740.0718 8575.0215 -7740.2407 8574.0352 C -7747.0728 8575.1465 L f 0.4 0.7 1 0 k -7770.457 8580.5879 m -7770.4258 8578.9805 L -7879.1079 8580.8252 L -7879.1079 8581.8613 L -7852.3584 8581.5605 -7770.457 8580.5879 Y f U U 0.025 0.02 0.015 0 k -7734.7344 8583.0293 m -7734.7344 8583.0625 -7734.7129 8583.082 -7734.6802 8583.082 c -7731.6714 8583.1133 -7729.4214 8582.9453 -7726.415 8582.8594 C -7726.4087 8582.7656 L -7729.3262 8582.8701 -7731.7607 8583.0078 -7734.6841 8582.9746 C -7734.7168 8582.9766 -7734.7358 8582.998 -7734.7344 8583.0293 C f -7726.3994 8582.7656 m -7726.4082 8582.7441 L -7726.4087 8582.7656 L -7726.4063 8582.7656 -7726.4033 8582.7656 -7726.3994 8582.7656 C f -7730.4487 8581.4238 m -7731.4458 8581.292 -7732.3394 8581.7656 -7733.2114 8582.1973 C -7733.2441 8582.208 -7733.2534 8582.2402 -7733.2422 8582.2715 C -7733.2305 8582.293 -7733.1982 8582.3027 -7733.1777 8582.291 c -7732.3262 8581.8301 -7731.4312 8581.4199 -7730.4678 8581.5195 c -7729.1079 8581.6621 -7727.9038 8582.375 -7726.5254 8582.4531 C -7726.4463 8582.3594 L -7728.04 8582.2656 -7728.8647 8581.623 -7730.4487 8581.4238 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 6) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.75 8563 m -7884.75 8587 L -7874.75 8587 L -7874.75 8563 L -7884.75 8563 L n 0 Ap 0 O 1 g -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 c -7877.5879 8565.2256 -7879.3198 8565.9346 -7880.7559 8567.0176 c -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 c -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.2319 8578.5996 -7883.3457 8580.0918 c -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C -7874.75 8565 L f 0 R 0 G 1 J 1 j 0.5 w -7874.75 8584.6816 m -7877.7793 8583.7256 -7880.6074 8582.0674 -7883.3457 8580.0918 C S -7874.75 8579.0488 m -7877.8999 8576.6436 -7880.957 8573.9131 -7884.0942 8571.4639 C S -7880.7559 8567.0176 m -7878.6904 8568.1084 -7876.7017 8569.4668 -7874.75 8570.957 C S -7875.6982 8565.0479 m -7875.3809 8565.1309 -7875.063 8565.2148 -7874.75 8565.3145 C S -7880.7559 8567.0176 m -7879.3193 8565.9355 -7877.5879 8565.2256 -7875.6982 8565.0479 C S -7884.0942 8571.4639 m -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.231 8578.5996 -7883.3457 8580.0918 C S -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 C S -7880.7559 8567.0176 m -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 C S -7883.3457 8580.0918 m -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C S U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 8) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.9521 8584.3125 m -7776.7954 8584.3125 L -7776.7954 8570.1855 L -7883.9521 8570.1855 L -7883.9521 8584.3125 L n u 0 O 0 0 0 1 k -7882.2832 8583.623 m -7882.8535 8586 -7882.8184 8582.0039 V -7883.0479 8578.8027 L -7883.6167 8576.4551 L -7883.4502 8574.123 L -7881.9502 8573.4551 -7865.2832 8572.123 V -7858.6167 8570.7891 -7849.6167 8570.7891 V -7784.3936 8571.4766 -7779.4912 8572.8848 v -7820.3882 8570.875 -7822.9688 8571.5117 v -7783.8569 8573.1602 -7780.8545 8574.4316 v -7818.79 8572.5469 -7822.167 8574.1777 v -7787.249 8575.9102 -7783.021 8577.5313 v -7789.7217 8576.8828 -7791.5127 8577.082 v -7788.3896 8577.5703 l -7793.4194 8577.502 l -7796.3218 8577.1289 l -7788.4521 8578.2422 -7787.9033 8578.8086 v -7784.3154 8578.1309 -7798.5186 8578.3848 v -7832.1177 8574.4551 -7882.2832 8583.623 V f /BBAccumRotation (5.805971) XT 0 R 0 0 0 0.5 K 0.025 w -7883.9502 8573.123 m -7863.667 8571.2949 -7843.9727 8570.2207 v -7801.1514 8570.502 -7796.5737 8570.9004 v -7784.1631 8571.0313 -7776.7959 8572.0273 v S /BBAccumRotation (5.805971) XT 0 0 0 1 K -7821.8369 8570.4082 m -7825.2959 8570.0273 -7851.2607 8570.2793 Y -7861.627 8570.1602 -7883.9502 8573.123 Y S /BBAccumRotation (5.805971) XT -7820.9873 8573.6641 m -7790.3608 8574.582 -7783.6606 8575.2324 v S /BBAccumRotation (5.805971) XT 0 0 0 0.5 K -7829.6201 8578.2051 m -7794.3706 8579.6172 -7791.4058 8580.1406 v S /BBAccumRotation (5.805971) XT U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 10) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7833.8921 8586 L -7833.8921 8529.9756 L -7884 8529.9756 L -7884 8586 L n u 0 O 0.1 1 1 0 k -7846.9014 8551.5752 m -7848.7178 8545.0957 -7858.8247 8548.4658 Y -7858.791 8548.5303 L -7868.8999 8545.1611 -7870.7144 8551.6396 V -7876.6758 8569.0068 -7871.4922 8575.7451 V -7864.7529 8585.3369 -7860.6055 8585.3369 V -7857.0103 8585.2705 L -7852.8638 8585.2705 -7846.125 8575.6816 Y -7840.9409 8568.9424 -7846.9014 8551.5752 Y f u 0 0 0 1 k -7851.3926 8529.9756 m -7852.1167 8531.4199 -7852.9238 8532.4756 V -7852.4058 8532.0635 -7851.5151 8531.1924 -7851.3926 8529.9756 C f -7865.064 8532.4854 m -7865.8711 8531.4307 -7866.5942 8529.9863 Y -7866.4727 8531.2021 -7865.582 8532.0732 -7865.064 8532.4854 C f U 0 0.61 0.74 0 k -7850.5977 8554.4609 m -7851.9038 8549.7959 -7859.1816 8552.2217 Y -7859.1567 8552.2686 L -7866.436 8549.8428 -7867.7417 8554.5078 V -7872.0337 8567.0117 -7868.3018 8571.8633 V -7863.4487 8578.7686 -7860.4634 8578.7686 V -7857.875 8578.7227 L -7854.8887 8578.7227 -7850.0366 8571.8174 Y -7846.3042 8566.9639 -7850.5977 8554.4609 Y f u 1 Ap 0.73 0.43 1 0.22 k 0 R 0 0 0 1 K -7854.6226 8557.2754 m -7853.813 8557.2754 -7853.1558 8556.6182 -7853.1558 8555.8096 c -7853.1558 8555 -7853.813 8554.3428 -7854.6226 8554.3428 c -7855.4321 8554.3428 -7856.0889 8555 -7856.0889 8555.8096 c -7856.0889 8556.6182 -7855.4321 8557.2754 -7854.6226 8557.2754 c b -7854.3638 8568.9971 m -7853.0806 8568.9971 -7852.0415 8568.1201 -7852.0415 8567.042 c -7852.0415 8565.9619 -7853.0806 8565.0869 -7854.3638 8565.0869 c -7855.645 8565.0869 -7856.6846 8565.9619 -7856.6846 8567.042 c -7856.6846 8568.1201 -7855.645 8568.9971 -7854.3638 8568.9971 c b -7853.834 8580.7861 m -7852.2817 8580.7861 -7851.0239 8580.1299 -7851.0239 8579.3213 c -7851.0239 8578.5117 -7852.2817 8577.8545 -7853.834 8577.8545 c -7855.3862 8577.8545 -7856.645 8578.5117 -7856.645 8579.3213 c -7856.645 8580.1299 -7855.3862 8580.7861 -7853.834 8580.7861 c b -7849.6104 8552.5264 m -7848.8687 8552.5264 -7848.2671 8551.8154 -7848.2671 8550.9365 c -7848.2671 8550.0596 -7848.8687 8549.3477 -7849.6104 8549.3477 c -7850.353 8549.3477 -7850.9546 8550.0596 -7850.9546 8550.9365 c -7850.9546 8551.8154 -7850.353 8552.5264 -7849.6104 8552.5264 c b -7848.0034 8574.083 m -7848.8818 8573.7354 -7849.1494 8572.335 -7848.603 8570.9541 c -7848.0566 8569.5752 -7846.9014 8568.7363 -7846.0234 8569.085 c -7845.145 8569.4326 -7844.877 8570.833 -7845.4233 8572.2139 c -7845.9702 8573.5947 -7847.125 8574.4316 -7848.0034 8574.083 c b u -7863.0566 8557.1592 m -7863.8662 8557.1592 -7864.5239 8556.502 -7864.5239 8555.6934 c -7864.5239 8554.8828 -7863.8662 8554.2266 -7863.0566 8554.2266 c -7862.248 8554.2266 -7861.5913 8554.8828 -7861.5913 8555.6934 c -7861.5913 8556.502 -7862.248 8557.1592 -7863.0566 8557.1592 c b -7863.3159 8568.8799 m -7864.5991 8568.8799 -7865.6382 8568.0049 -7865.6382 8566.9248 c -7865.6382 8565.8447 -7864.5991 8564.9697 -7863.3159 8564.9697 c -7862.0342 8564.9697 -7860.9951 8565.8447 -7860.9951 8566.9248 c -7860.9951 8568.0049 -7862.0342 8568.8799 -7863.3159 8568.8799 c b -7863.8457 8580.6709 m -7865.3975 8580.6709 -7866.6558 8580.0146 -7866.6558 8579.2041 c -7866.6558 8578.3936 -7865.3975 8577.7383 -7863.8457 8577.7383 c -7862.293 8577.7383 -7861.0352 8578.3936 -7861.0352 8579.2041 c -7861.0352 8580.0146 -7862.293 8580.6709 -7863.8457 8580.6709 c b -7868.0679 8552.4092 m -7868.811 8552.4092 -7869.4121 8551.6982 -7869.4121 8550.8213 c -7869.4121 8549.9443 -7868.811 8549.2334 -7868.0679 8549.2334 c -7867.3262 8549.2334 -7866.7241 8549.9443 -7866.7241 8550.8213 c -7866.7241 8551.6982 -7867.3262 8552.4092 -7868.0679 8552.4092 c b -7869.6758 8573.9678 m -7868.7983 8573.6201 -7868.5298 8572.2188 -7869.0762 8570.8379 c -7869.6226 8569.457 -7870.7778 8568.6201 -7871.6558 8568.9678 c -7872.5342 8569.3164 -7872.8032 8570.7178 -7872.2568 8572.0967 c -7871.7104 8573.4775 -7870.5552 8574.3154 -7869.6758 8573.9678 c b U U 0 Ap 0 0 0 1 k -7859.1318 8552.6553 m -7859.1318 8585.3145 l F u -7843.3906 8538.5303 m -7844.0815 8537.8369 -7847.019 8538.7021 Y -7848.229 8538.874 -7848.0562 8541.2939 Y -7847.019 8543.3682 -7847.7104 8543.1943 Y -7848.2998 8543.1943 -7849.855 8543.1143 -7850.7822 8543.0635 C -7851.1226 8541.6689 -7852.6128 8540.4756 -7854.7217 8539.7695 C -7852.7578 8536.4775 -7854.5176 8535.7949 -7856.2935 8535.79 C -7856.3096 8535.7021 -7856.332 8535.6162 -7856.3599 8535.5332 C -7854.1089 8535.5791 -7853.6392 8533.2588 Y -7853.4048 8533.0635 -7853.1606 8532.7861 -7852.9238 8532.4756 C -7853.1416 8532.6475 -7853.2944 8532.7393 Y -7854.2583 8532.7393 -7855.8774 8534.4941 -7856.4966 8535.207 C -7856.9194 8534.4434 -7857.853 8533.9111 -7858.9434 8533.9111 c -7860.0698 8533.9111 -7861.0322 8534.4795 -7861.4312 8535.2852 C -7861.9985 8534.624 -7863.6968 8532.751 -7864.6943 8532.751 C -7864.8462 8532.6572 -7865.064 8532.4854 V -7864.8281 8532.7939 -7864.583 8533.0732 -7864.3481 8533.2686 C -7863.8638 8535.6563 -7861.5254 8535.5342 V -7861.5449 8535.5889 -7861.5674 8535.6436 -7861.5806 8535.7021 C -7864.9238 8535.6924 -7863.937 8538.3174 -7863.2104 8539.6602 C -7865.5918 8540.376 -7867.2646 8541.7012 -7867.5239 8543.25 C -7868.4473 8543.2998 -7869.6729 8543.3584 -7870.1802 8543.3584 C -7870.8726 8543.5313 -7869.835 8541.458 V -7869.6626 8539.0391 -7870.8726 8538.8662 V -7873.8096 8538.002 -7874.501 8538.6934 V -7875.1919 8539.5566 -7876.0562 8538.3467 V -7875.1919 8540.0752 -7873.291 8539.5566 V -7870.6982 8538.8662 -7871.3906 8540.5938 V -7871.9087 8544.0498 -7870.1802 8544.7402 V -7868.0342 8545.8545 -7866.2822 8546.0889 V -7865.9087 8546.4141 -7865.4639 8546.7109 -7864.958 8546.9766 C -7867.5562 8547.0469 -7870.2246 8547.9209 -7871.0752 8550.9561 C -7871.5151 8552.2432 -7872.0518 8554.2432 V -7873.1025 8554.8252 -7874.3022 8556.0078 -7875.541 8558.2627 C -7876.394 8561.4502 -7877.167 8556.7129 V -7878.3975 8553.6494 -7879.6504 8553.5381 V -7878.4702 8555.2871 -7878.9038 8556.416 V -7877.2998 8560.917 -7875.6138 8559.8994 V -7874.0986 8559.2197 -7872.688 8556.8154 V -7873.0698 8558.4971 -7873.4326 8560.417 -7873.6743 8562.3906 C -7874.4888 8562.3975 L -7876.3506 8561.4795 -7876.3262 8564.959 V -7877.1226 8568.9453 -7876.3594 8571.6826 V -7875.647 8574.1504 -7878.1274 8572.9307 V -7879.2842 8573.3242 -7879.9839 8572.7881 V -7882.3882 8571.4131 -7884 8573.124 V -7882.147 8572.8799 -7881.4482 8573.417 V -7879.9785 8573.5615 -7879.897 8574.1787 V -7876.9561 8574.8555 -7876.188 8574.0771 V -7874.417 8573.2139 -7875.1304 8570.3604 V -7875.8799 8562.4814 -7874.3198 8564.4053 V -7874.1182 8564.4219 -7873.8784 8564.5176 V -7874.1519 8568.4326 -7873.8018 8572.3252 -7871.9961 8574.8516 C -7875.4536 8567.333 -7870.2974 8552.3037 Y -7868.9609 8547.5303 -7863.127 8548.1016 -7860.145 8548.7344 C -7860.0718 8550.1299 -7859.8374 8551.9492 -7859.1318 8552.6553 C -7858.2134 8550.6963 -7858.2358 8549.0732 V -7857.0762 8548.7217 -7850.2817 8546.8447 -7847.4487 8550.3369 C -7848.4312 8547.8135 -7850.8262 8547.0186 -7853.2007 8546.9189 C -7852.667 8546.6318 -7852.2041 8546.3047 -7851.8257 8545.9502 C -7850.041 8545.7861 -7847.7104 8544.5771 Y -7845.9814 8543.8857 -7846.5015 8540.4307 Y -7847.1919 8538.7021 -7844.5991 8539.3936 Y -7842.7002 8539.9111 -7841.835 8538.1836 Y -7842.7002 8539.3936 -7843.3906 8538.5303 Y f -7837.9082 8572.9521 m -7838.6074 8573.4893 -7839.7632 8573.0938 Y -7842.2446 8574.3135 -7841.5327 8571.8467 Y -7840.769 8569.1104 -7841.564 8565.1221 Y -7841.541 8561.6445 -7843.4014 8562.5596 Y -7844.0342 8562.5557 L -7844.3198 8560.6123 -7844.7046 8558.7549 -7845.0898 8557.1699 C -7843.7129 8559.4199 -7842.2778 8560.0635 Y -7840.5913 8561.082 -7838.9878 8556.5791 Y -7839.4214 8555.4502 -7838.2417 8553.7021 Y -7839.4937 8553.8125 -7840.7246 8556.876 Y -7841.4976 8561.6152 -7842.3511 8558.4268 Y -7843.5776 8556.1904 -7844.769 8555.0098 -7845.814 8554.4229 C -7846.2026 8553.0635 -7846.4858 8552.2393 Y -7846.7002 8551.4727 -7847.0337 8550.8486 -7847.4487 8550.3369 C -7847.3799 8550.5127 -7847.3174 8550.6982 -7847.2632 8550.8916 C -7841.3022 8568.2588 -7846.4858 8574.9971 V -7853.2246 8584.5869 -7857.3721 8584.5869 V -7860.9663 8584.6514 L -7865.1138 8584.6514 -7871.853 8575.0615 Y -7871.9038 8574.9961 -7871.9463 8574.9219 -7871.9961 8574.8516 C -7871.7378 8575.4141 -7871.437 8575.9404 -7871.0752 8576.4092 C -7864.3359 8586 -7860.189 8586 V -7856.5942 8585.9346 L -7852.4482 8585.9346 -7845.709 8576.3447 Y -7843.5801 8573.5771 -7843.3306 8569.0176 -7843.7769 8564.6055 C -7843.6553 8564.5752 -7843.5698 8564.5684 Y -7842.0112 8562.6475 -7842.7598 8570.5244 Y -7843.4746 8573.3789 -7841.7026 8574.2402 Y -7840.9351 8575.0186 -7837.9946 8574.3428 Y -7837.9136 8573.7256 -7836.4434 8573.5811 Y -7835.7446 8573.0449 -7833.8921 8573.2881 Y -7835.5024 8571.5771 -7837.9082 8572.9521 Y f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 34) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.0254 8586.0264 m -7828.0542 8586.0264 L -7828.0542 8524.5342 L -7884.0254 8524.5342 L -7884.0254 8586.0264 L n u u 0 O 0.0745 0.9 0.9019 0.18 k 0 R 0 0 0 1 K 1 J 1 j 0.0518 w -7857.5991 8562.7217 m -7857.3594 8573.5215 -7862.8794 8583.8398 v -7862.4009 8586 -7860.959 8586 v -7861.2002 8582.6406 -7860.2393 8582.1611 v -7855.9199 8570.1602 -7856.6382 8562.2402 v -7857.5991 8562.7217 l b -7857.5991 8562.7217 m -7859.2793 8568 -7871.0391 8569.2012 v -7875.3594 8569.6807 -7875.5991 8571.1211 v -7869.1206 8561.5195 -7868.1602 8561.7607 v -7881.3594 8556.001 -7884 8550.7197 v -7878.959 8553.6006 -7875.5991 8551.4404 v -7867.6802 8551.2012 -7862.6406 8553.3613 v -7858.8008 8555.2813 -7866.7202 8539.2012 v -7862.8794 8550.9609 -7859.2793 8524.5605 v -7858.3198 8529.8408 -7856.8799 8531.2813 v -7850.8799 8538.9609 -7851.8398 8541.1211 v -7852.3198 8544.9609 -7847.7598 8538.7207 v -7848 8548.3213 -7850.4009 8551.6807 v -7852.5591 8555.2813 -7846.5591 8553.1211 v -7840.5591 8551.2012 -7835.2793 8552.8809 v -7829.7598 8554.3203 -7828.0801 8551.4404 v -7839.8398 8563.9209 -7845.5991 8563.6807 v -7843.9194 8567.2813 l -7841.519 8572.0811 -7842 8573.2813 v -7857.2681 8563.8828 -7857.5991 8562.7217 v b -7857.5991 8562.7217 m -7854.959 8544.2402 -7857.5991 8536.5605 v -7859.998 8526.001 -7859.2793 8524.5605 v S -7856.1602 8551.4404 m -7850.1602 8546.6406 -7848.959 8541.3604 v S -7856.1602 8550.7197 m -7865.0391 8543.041 -7866.7202 8539.2012 v S -7828.0801 8551.4404 m -7829.2793 8553.6006 -7857.3594 8561.7607 y -7862.4009 8556.2422 -7873.9199 8553.8408 v -7881.5986 8552.8809 -7884 8550.7197 v S -7874.6382 8569.6807 m -7863.1191 8560.5615 -7857.3594 8561.7607 y -7843.1992 8568 -7842 8573.2813 v S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 36) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.8496 8585.9961 m -7833.96 8585.9961 L -7833.96 8534.9258 L -7883.8496 8534.9258 L -7883.8496 8585.9961 L n u 0 O 0.025 0.1 0.475 0 k -7862.1504 8553.9043 m -7864.4766 8552.8125 -7866.6914 8552.4434 -7868.373 8552.9238 c -7869.0518 8553.1172 -7869.645 8553.4473 -7870.123 8553.9238 c -7870.6006 8554.4023 -7870.9297 8554.9951 -7871.123 8555.6729 c -7872.0088 8558.7715 -7870.0103 8563.6777 -7865.9233 8567.7666 c -7861.834 8571.8535 -7856.9297 8573.8516 -7853.8286 8572.9668 c -7853.1519 8572.7715 -7852.5586 8572.4424 -7852.0806 8571.9658 c -7851.603 8571.4883 -7851.2754 8570.8955 -7851.082 8570.2168 c -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.582 8561.21 -7854.791 8559.6133 -7856.2793 8558.123 c -7858.1504 8556.2539 -7860.1914 8554.8242 -7862.1504 8553.9043 c f u 0.0035 0.014 0.0665 0 k -7861.2183 8552.9727 m -7863.8306 8552.0215 -7866.3975 8551.9688 -7868.373 8552.9238 C -7866.6914 8552.4434 -7864.4766 8552.8125 -7862.1504 8553.9043 c -7861.6191 8554.1543 -7861.0806 8554.4434 -7860.543 8554.7676 C -7858.8984 8554.0537 L -7859.667 8553.6172 -7860.4434 8553.2539 -7861.2183 8552.9727 c f 0.015 0.06 0.285 0 k -7858.8984 8554.0537 m -7860.543 8554.7676 L -7859.0962 8555.6348 -7857.6426 8556.7607 -7856.2793 8558.123 c -7856.1538 8558.25 -7856.0327 8558.3779 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7856.3706 8555.7236 -7857.6191 8554.7813 -7858.8984 8554.0537 C f U u 0.039 0.156 0.741 0 k -7849.687 8541.4043 m -7849.9746 8541.6914 -7861.2183 8552.9727 Y -7860.4434 8553.2539 -7859.667 8553.6172 -7858.8984 8554.0537 C -7845.4146 8540.5703 L -7847.061 8540.0996 -7848.6406 8540.3555 -7849.687 8541.4043 c f 0.025 0.1 0.475 0 k -7845.4146 8540.5703 m -7858.8984 8554.0537 L -7857.584 8554.8027 -7856.2969 8555.7754 -7855.1143 8556.957 c -7855.084 8556.9863 -7855.0586 8557.0156 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7841.5264 8543.1328 -7841.7202 8542.9141 -7841.9302 8542.7012 c -7843.0103 8541.623 -7844.2305 8540.9082 -7845.4146 8540.5703 C f U u 0.0115 0.046 0.2185 0 k -7835.9346 8550.3926 m -7833.5337 8547.9893 -7833.335 8544.0898 -7835.1382 8540.6973 C -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f 0.015 0.06 0.285 0 k -7843.5337 8535.5957 m -7842.582 8534.9258 L -7845.2046 8534.3516 -7847.8306 8534.9141 -7849.6206 8536.7061 c -7848.1719 8535.2578 -7845.9082 8534.9307 -7843.5337 8535.5957 C f 0.0295 0.118 0.5605 0 k -7843.5337 8535.5957 m -7845.9082 8534.9307 -7848.1719 8535.2578 -7849.6206 8536.7061 c -7851.019 8538.1055 -7851.3706 8540.2637 -7850.7954 8542.5469 C -7848.8672 8539.5449 -7845.4082 8540.5537 V -7843.585 8535.6309 L -7843.5337 8535.5957 L f *u 0.048 0.192 0.912 0 k 1 D -7835.9346 8550.3926 m -7837.2817 8551.7383 -7839.332 8552.1133 -7841.5234 8551.627 C -7851.6714 8561.7734 L -7851.7695 8561.5684 -7851.7695 8561.5684 -7851.6714 8561.7734 c -7850.2246 8564.8145 -7849.9702 8567.916 -7851.082 8570.2168 C -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.5054 8561.3438 -7854.5918 8559.8848 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7855.1816 8556.8945 -7855.1465 8556.9238 -7855.1143 8556.957 c -7855.084 8556.9883 -7855.0566 8557.0176 -7855.0273 8557.0469 c -7855.0278 8557.0469 -7855.0278 8557.0469 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7836.3262 8541.1289 L -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f *U 0.0215 0.086 0.4085 0 k 0 D -7842.582 8534.9258 m -7843.5337 8535.5957 L -7841.6846 8536.1113 -7839.7656 8537.2285 -7838.1138 8538.8828 c -7837.4063 8539.5889 -7836.7998 8540.3418 -7836.2954 8541.1182 C -7835.1382 8540.6973 L -7835.6553 8539.7246 -7836.3374 8538.793 -7837.1802 8537.9512 c -7838.7695 8536.3594 -7840.6758 8535.3428 -7842.582 8534.9258 C f 0.0205 0.082 0.3895 0 k -7836.2954 8541.1182 m -7836.7998 8540.3418 -7837.4063 8539.5889 -7838.1138 8538.8828 c -7839.7656 8537.2285 -7841.6846 8536.1113 -7843.5337 8535.5957 C -7843.585 8535.6309 L -7845.4082 8540.5537 L -7844.2114 8540.9219 -7842.9878 8541.6436 -7841.9302 8542.7012 c -7841.7202 8542.9141 -7841.5264 8543.1328 -7841.3408 8543.3574 C -7836.3262 8541.1289 L -7836.2954 8541.1182 L f U u 0.445 0.356 0.267 0 k -7883.8496 8585.9961 m -7861.957 8562.9688 L -7862.2007 8562.6494 -7862.5752 8562.6133 -7862.8887 8562.6592 C -7867.1802 8567.2891 -7878.3145 8579.4561 -7882.7266 8584.2793 C -7883.5649 8585.3516 -7884 8585.9932 -7883.8496 8585.9961 C f 0.15 0.12 0.09 0 k -7883.834 8585.9961 m -7882.6606 8585.7031 -7861.6934 8564.0029 Y -7861.6934 8563.502 -7861.7993 8563.1758 -7861.957 8562.9688 C -7883.8496 8585.9961 L -7883.8442 8585.9961 -7883.8418 8586 -7883.834 8585.9961 c f 0.2 0.16 0.12 0 k -7882.7266 8584.2793 m -7878.3145 8579.4561 -7867.1802 8567.2891 -7862.8887 8562.6592 C -7863.2002 8562.7041 -7863.4526 8562.8301 Y -7864.603 8563.1328 -7878.5742 8578.9619 -7882.7266 8584.2793 C f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 37) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7882.9502 8585.2324 m -7833.0391 8585.2324 L -7833.0391 8521.1152 L -7882.9502 8521.1152 L -7882.9502 8585.2324 L n u 0 O 0 0 0 1 k 0 R 0 0 0 1 K 0 w -7833.2358 8521.1152 m -7833.6064 8521.248 -7833.9858 8521.2832 -7834.3833 8521.2031 c -7834.4863 8521.168 l -7834.5254 8521.1602 -7834.5703 8521.1787 -7834.6025 8521.1992 c -7834.9434 8521.3926 l -7838.7129 8523.2959 -7842.0962 8525.8965 -7844.5 8529.4473 c -7845.9634 8531.5918 -7847.123 8533.8789 -7848.7993 8535.8564 c -7849.1729 8536.209 -7849.1758 8536.7725 -7848.834 8537.1309 c -7848.4951 8537.501 -7847.918 8537.5078 -7847.561 8537.165 c -7847.4038 8537.21 l -7847.2642 8537.1289 -7847.0742 8537.0703 -7847.0234 8536.957 c -7845.853 8534.2031 -7845.1895 8531.5137 -7843.4336 8529.1387 c -7841.1719 8526.0947 -7838.1777 8523.9941 -7835.0298 8522.0234 c -7834.3672 8521.6055 L -7834.4966 8521.6348 L -7833.7695 8521.6426 l -7833.791 8521.6113 -7833.8008 8521.5957 -7833.8223 8521.5645 C -7833.6064 8521.5234 -7833.377 8521.4746 -7833.1626 8521.4336 c -7833.0762 8521.4238 -7833.0186 8521.3389 -7833.0391 8521.2383 c -7833.0503 8521.1523 -7833.1382 8521.1084 -7833.2358 8521.1152 c -7833.2358 8521.1152 l b -7849.2222 8534.9951 m -7849.5742 8534.8066 -7849.9658 8534.6719 -7850.248 8534.3887 c -7856.4521 8528.1719 -7866.6802 8527.2734 -7874.0488 8533.6855 C -7874.1582 8533.7813 -7874.1582 8533.957 -7874.063 8534.0645 C -7871.0527 8532.9434 -7862.8838 8534.375 -7859.3223 8537.4121 C -7859.2534 8537.4668 -7859.1465 8537.4531 -7859.1055 8537.3711 C -7859.0503 8537.3047 -7859.0664 8537.1953 -7859.1328 8537.1563 C -7862.5625 8534.0859 -7867.0674 8532.29 -7871.6729 8532.748 C -7868.8535 8531.1855 -7865.6313 8530.4941 -7862.3984 8530.6885 c -7857.7144 8530.9717 -7853.4634 8533.1191 -7849.3711 8535.2793 c -7849.291 8535.3193 -7849.1978 8535.293 -7849.1553 8535.2109 C -7849.1016 8535.1309 -7849.1426 8535.0352 -7849.2222 8534.9951 c b -7858.647 8536.3359 m -7860.2266 8540.3613 -7862.3911 8544.3203 -7865.8018 8547.0762 c -7865.9648 8547.2119 -7865.9946 8547.4492 -7865.8711 8547.6055 c -7865.7344 8547.7676 -7865.5049 8547.7793 -7865.3481 8547.6563 c -7861.123 8545.5967 -7858.1904 8541.1309 -7858.1626 8536.4014 c -7858.1626 8536.4014 l -7858.1328 8536.2676 -7858.2354 8536.1348 -7858.3633 8536.1221 c -7858.5039 8536.1055 -7858.6318 8536.1973 -7858.647 8536.3359 c -7858.647 8536.3359 l b -7852.9414 8541.0176 m -7853.042 8541.1816 -7853.1152 8541.3838 -7853.2617 8541.4824 c -7856.0806 8543.3906 -7858.9785 8544.6309 -7861.8848 8546.1328 c -7862.0503 8546.209 -7862.1118 8546.418 -7862.0313 8546.5703 c -7861.9512 8546.7227 -7861.7559 8546.7793 -7861.5898 8546.7041 c -7858.439 8545.3232 -7854.313 8544.5 -7852.6729 8541.1797 c -7852.6289 8541.1113 -7852.6455 8541.0146 -7852.7266 8540.9648 c -7852.7959 8540.9199 -7852.897 8540.9492 -7852.9414 8541.0176 c -7852.9414 8541.0176 l b -7852.6602 8541.918 m -7852.4438 8542.4297 -7852.1431 8542.8896 -7852.0503 8543.4355 c -7851.2183 8548.2773 -7851.1152 8553.042 -7852.248 8557.6875 c -7852.248 8557.6875 l -7852.3418 8557.9531 -7852.2114 8558.2441 -7851.9438 8558.3389 c -7851.6777 8558.4336 -7851.3882 8558.3125 -7851.2935 8558.0479 c -7849.293 8552.8115 -7849.897 8546.7373 -7852.3711 8541.7832 c -7852.4063 8541.7002 -7852.498 8541.6689 -7852.582 8541.6914 c -7852.6641 8541.7275 -7852.6978 8541.835 -7852.6602 8541.918 c -7852.6602 8541.918 l b -7851.5352 8557.5938 m -7848.8984 8555.2275 -7846.6816 8552.252 -7845.853 8548.7363 c -7845.853 8548.7363 l -7845.7246 8548.1816 -7846.0742 8547.623 -7846.6416 8547.4902 c -7847.1992 8547.375 -7847.7578 8547.7246 -7847.8862 8548.2793 c -7848.5649 8551.5313 -7849.8711 8554.6729 -7851.7954 8557.3867 c -7851.7954 8557.3867 l -7851.8462 8557.4551 -7851.834 8557.5576 -7851.7695 8557.6201 c -7851.6992 8557.6699 -7851.5977 8557.6582 -7851.5352 8557.5938 c -7851.5352 8557.5938 l b -7836.3711 8550.1826 m -7837.7114 8545.8301 -7840.2598 8542.0693 -7843.689 8539.1533 C -7843.729 8539.0723 -7843.8242 8539.0322 -7843.9038 8539.0859 C -7843.9863 8539.127 -7844.0122 8539.2207 -7843.9722 8539.3018 C -7843.957 8539.7891 -7843.7144 8540.2334 -7843.4458 8540.5313 c -7838.4063 8546.1621 -7834.9902 8554.7197 -7837.3433 8561.9551 C -7837.0762 8556.4512 -7838.7241 8550.3008 -7842.1362 8545.6738 c -7843.1606 8544.2695 -7844.7422 8544.1211 -7846.3081 8544.2031 C -7846.4023 8544.1895 -7846.4834 8544.2432 -7846.4961 8544.3369 c -7846.5098 8544.4189 -7846.4551 8544.5137 -7846.3623 8544.5254 C -7843.1479 8545.7695 -7841.4878 8549.2246 -7840.084 8552.1943 c -7838.415 8555.7441 -7837.7017 8559.6387 -7838.0054 8563.5 C -7838.0454 8563.6777 -7838.1138 8565.3975 -7837.9775 8565.4102 C -7837.8306 8565.4395 -7837.709 8565.3438 -7837.6802 8565.1943 C -7837.645 8565.0449 -7834.6426 8555.7988 -7836.3711 8550.1826 c b -7844.4863 8537.4912 m -7843.3945 8533.6211 -7841.1094 8530.251 -7838.4824 8527.2383 c -7838.3306 8527.1045 -7838.3145 8526.8867 -7838.4502 8526.7354 c -7838.5752 8526.6006 -7838.8047 8526.582 -7838.957 8526.7178 c -7842.3306 8529.332 -7843.4487 8533.541 -7844.7954 8537.375 c -7844.7954 8537.375 l -7844.8262 8537.4648 -7844.7754 8537.5586 -7844.6982 8537.5869 c -7844.6094 8537.6191 -7844.5166 8537.5684 -7844.4863 8537.4912 c -7844.4863 8537.4912 l b -7838.5313 8562.1094 m -7838.5991 8562.0566 -7838.707 8562.083 -7838.748 8562.1504 C -7838.9634 8562.4746 -7840.6914 8564.5195 -7841.3926 8565.1406 c -7846.1719 8569.3945 -7849.5137 8573.9609 -7857.5391 8577.7227 c -7864.4512 8580.9639 -7867.1113 8583.5957 -7874.3862 8581.8262 c -7877.687 8581.0293 -7879.0313 8580.5313 -7880.4351 8575.4551 C -7881.9473 8569.2988 -7880.8672 8571.7832 -7881.084 8564.4385 c -7881.2222 8559.6973 -7884 8548.4551 -7871.5254 8534.2598 C -7871.4199 8534.1484 -7871.4336 8533.9961 -7871.5337 8533.9072 C -7871.6328 8533.8027 -7871.7959 8533.8164 -7871.8862 8533.916 C -7877.5786 8538.7168 -7881.0234 8545.6582 -7882.3145 8552.9424 c -7883.2871 8558.4668 -7882.9199 8563.25 -7882.666 8569.6367 c -7882.5688 8572.0938 -7883.6855 8579.0723 -7878.9102 8583.0625 c -7875.3926 8586 -7870.3911 8585.5469 -7866.3545 8584.1563 c -7860.6992 8582.2119 -7855.9727 8579.1465 -7850.8711 8575.6094 c -7847.2656 8573.125 -7839.2881 8563.2852 -7838.4785 8562.3262 C -7838.4351 8562.2588 -7838.4502 8562.1504 -7838.5313 8562.1094 C b -7873.0503 8549.3057 m -7872.168 8548.5029 -7871.7017 8549.8457 -7871.4297 8550.6016 c -7871.1626 8551.3574 -7870.189 8551.25 -7870.5127 8551.5732 c -7870.8369 8551.8975 -7870.8369 8551.9521 -7871.3232 8551.5195 c -7871.8086 8551.0879 -7871.8086 8551.7363 -7872.5649 8551.25 c -7873.3198 8550.7627 -7873.645 8549.8457 -7873.0503 8549.3057 c b -7865.6519 8553.9492 m -7865.3657 8553.5918 -7864.6802 8553.5723 -7864.4648 8553.8945 c -7864.25 8554.2197 -7863.3306 8554.2734 -7863.4937 8554.5967 c -7863.6543 8554.9219 -7863.6016 8555.1387 -7864.0874 8554.9219 c -7864.5737 8554.7051 -7864.4121 8555.2998 -7864.897 8555.084 c -7865.3833 8554.8672 -7865.8687 8554.2197 -7865.6519 8553.9492 c b -7857.6074 8559.0791 m -7857.1206 8558.7559 -7855.8794 8559.5117 -7856.4727 8559.5117 c -7857.0674 8559.5117 -7856.311 8560.2676 -7856.8521 8560.4834 c -7857.3906 8560.6992 -7857.2832 8560.4297 -7857.6074 8560.6445 c -7857.9297 8560.8613 -7858.3633 8561.2393 -7858.5239 8560.4297 c -7858.6855 8559.6191 -7858.3633 8559.6191 -7857.9849 8559.3496 c -7857.6074 8559.0791 -7857.6074 8559.0791 y b -7872.2402 8559.3496 m -7871.1074 8559.2422 -7871.8633 8559.998 -7871.269 8560.4834 c -7870.6738 8560.9697 -7869.918 8561.6172 -7870.729 8561.4004 c -7871.5391 8561.1855 -7872.9961 8561.6719 -7872.9434 8560.5381 c -7872.8887 8559.4033 -7872.6328 8559.3867 -7872.2402 8559.3496 c b -7866.5703 8567.6113 m -7866.1016 8567.3438 -7866.6802 8567.7197 -7866.0303 8567.6113 c -7865.3833 8567.5039 -7864.7886 8567.6113 -7865.2207 8567.8281 c -7865.6519 8568.0439 -7866.3008 8568.1523 -7866.4634 8567.9893 c -7866.625 8567.8281 -7866.9473 8567.8281 -7866.5703 8567.6113 c b -7857.0674 8567.1797 m -7857.4785 8566.1797 -7856.0962 8566.4238 -7855.4473 8566.7461 c -7854.7998 8567.0723 -7853.8262 8566.4775 -7854.4209 8566.9102 c -7855.0137 8567.3418 -7854.7998 8566.9102 -7855.3926 8567.2334 c -7855.9873 8567.5566 -7856.6895 8568.0977 -7857.0674 8567.1797 c b -7872.6738 8573.0664 m -7872.7222 8572.0752 -7871.8086 8572.957 -7871.269 8573.0117 c -7870.729 8573.0664 -7870.0801 8573.0664 -7870.2432 8573.2813 c -7870.4038 8573.498 -7870.459 8573.498 -7871.1626 8573.7129 c -7871.8633 8573.9297 -7872.6191 8574.1445 -7872.6738 8573.0664 c b -7873.1582 8567.6113 m -7874.0664 8567.9746 -7874.293 8567.8809 -7874.5625 8568.2051 c -7874.834 8568.5293 -7875.1558 8569.2314 -7875.5352 8568.0977 c -7875.9121 8566.9629 -7875.4282 8565.7764 -7875.0479 8565.9375 c -7874.6714 8566.0996 -7874.293 8566.7461 -7873.8618 8566.9629 c -7873.4297 8567.1797 -7872.6191 8567.3945 -7873.1582 8567.6113 c b U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 41) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7803 8586 L -7803 8481 L -7884 8481 L -7884 8586 L n u u u 0 O 0 0 0 1 k -7865.8057 8498.4258 m -7866.0742 8496.6621 -7867.1602 8495.291 -7868.5239 8495.3965 c -7869.8862 8495.502 -7870.707 8497.0234 -7870.7432 8498.8066 c -7870.748 8499.0693 -7870.6743 8500.2441 -7870.6304 8500.4775 C -7870.6382 8500.582 -7870.6191 8500.6738 -7870.6104 8500.7803 c -7870.5142 8502.0254 -7869.3574 8503.3604 -7867.9414 8503.25 c -7866.5249 8503.1406 -7865.4897 8501.8613 -7865.6367 8500.4727 c -7865.644 8500.4072 -7865.6958 8499.626 -7865.707 8499.5625 C -7865.6816 8499.2852 -7865.7598 8498.7256 -7865.8057 8498.4258 c f -7876.2646 8507.7334 m -7876.9946 8515.916 -7871.5015 8515.1191 v -7868.3682 8514.0186 -7869.4414 8511.1211 v -7869.6426 8509.752 -7871.7847 8508.498 v -7872.146 8508.25 -7872.7632 8507.1016 v -7873.1294 8505.5977 -7874.5186 8505.2979 v -7876.0762 8505.251 -7876.2646 8507.7334 v f -7850.7646 8516.4971 m F -7850.0762 8514.3408 m -7850.7847 8513.1934 -7853.8848 8513.6279 Y -7854.811 8513.6885 -7855.3799 8513.1113 Y -7857.8394 8509.0918 -7861.0386 8509.8857 -7861.4082 8509.9932 C -7861.4097 8509.9863 L -7864.999 8510.6045 -7865.2666 8515.6035 V -7865.4912 8516.3828 -7866.335 8516.7695 V -7869.2695 8517.8613 -7869.3481 8519.208 V -7869.8999 8521.1152 -7867.6006 8521.7422 V -7865.6792 8522.2568 -7863.7886 8519.8945 V -7862.6113 8518.6797 -7859.5762 8517.9395 V -7859.5728 8517.9531 L -7856.3594 8517.0459 -7854.6392 8517.5889 Y -7851.8521 8518.7676 -7850.4063 8517.4014 Y -7848.6826 8515.7559 -7850.0762 8514.3408 Y f -7863.9834 8497.8789 m -7864.5854 8496.2002 -7864.2822 8494.4775 -7863.0327 8493.9229 c -7861.7842 8493.3672 -7860.3384 8494.3164 -7859.4585 8495.8672 c -7859.3286 8496.0957 -7858.8359 8497.165 -7858.7632 8497.3906 C -7858.7065 8497.4785 -7858.6792 8497.5684 -7858.6362 8497.667 c -7858.1289 8498.8086 -7858.5122 8500.5303 -7859.8105 8501.1074 c -7861.1089 8501.6855 -7862.6279 8501.0527 -7863.1582 8499.7617 c -7863.1831 8499.7002 -7863.5078 8498.9883 -7863.5298 8498.9268 C -7863.6831 8498.6963 -7863.8809 8498.166 -7863.9834 8497.8789 c f -7849.7129 8500.9316 m -7845.1802 8507.7822 -7850.3911 8509.6943 v -7853.6714 8510.2168 -7854.103 8507.1572 v -7854.5786 8505.8564 -7853.29 8503.7354 v -7853.0903 8503.3447 -7853.0938 8502.04 v -7853.4858 8500.5449 -7852.4082 8499.6182 v -7851.0591 8498.8359 -7849.7129 8500.9316 v f U u -7824.7358 8550.1074 m -7824.3687 8548.3623 -7824.9048 8546.6963 -7826.2183 8546.3164 c -7827.5322 8545.9375 -7828.8345 8547.0752 -7829.4937 8548.7324 c -7829.5903 8548.9775 -7829.9326 8550.1025 -7829.9746 8550.3369 C -7830.0176 8550.4326 -7830.0322 8550.5244 -7830.0625 8550.6279 c -7830.4087 8551.8271 -7829.7935 8553.4805 -7828.4282 8553.875 c -7827.063 8554.2695 -7825.645 8553.4365 -7825.2969 8552.085 c -7825.2793 8552.0205 -7825.0552 8551.2705 -7825.0425 8551.207 C -7824.9214 8550.9551 -7824.7983 8550.4053 -7824.7358 8550.1074 c f -7838.2705 8554.6172 m -7841.8242 8562.0244 -7836.3999 8563.2061 v -7833.0801 8563.2754 -7833.0688 8560.1846 v -7832.7778 8558.8311 -7834.3433 8556.9072 v -7834.5942 8556.5459 -7834.7695 8555.2539 v -7834.5854 8553.7188 -7835.7793 8552.9492 v -7837.2222 8552.3594 -7838.2705 8554.6172 v f -7817.4648 8571.7695 m F -7816.063 8569.9912 m -7816.3247 8568.6689 -7819.3799 8567.9883 Y -7820.27 8567.7197 -7820.5986 8566.9795 Y -7821.4922 8562.3535 -7824.7666 8561.9746 -7825.1494 8561.9453 C -7825.1494 8561.9395 L -7828.7271 8561.2588 -7830.731 8565.8467 V -7831.2153 8566.4961 -7832.1416 8566.5625 V -7835.272 8566.5557 -7835.8169 8567.7891 V -7837.0039 8569.3809 -7835.0713 8570.7764 V -7833.4526 8571.9316 -7830.853 8570.3818 V -7829.3242 8569.6582 -7826.2222 8570.0293 V -7826.2231 8570.042 L -7822.896 8570.3213 -7821.4766 8571.4326 Y -7819.2793 8573.5146 -7817.4463 8572.7432 Y -7815.2554 8571.8057 -7816.063 8569.9912 Y f -7822.8374 8550.2354 m -7822.813 8548.4512 -7821.9258 8546.9453 -7820.5601 8546.8633 c -7819.1943 8546.7803 -7818.1743 8548.1768 -7817.895 8549.9385 c -7817.854 8550.1973 -7817.7666 8551.3711 -7817.7778 8551.6094 C -7817.7559 8551.7109 -7817.7617 8551.8037 -7817.7559 8551.9121 c -7817.6807 8553.1592 -7818.644 8554.6367 -7820.0625 8554.7217 c -7821.4814 8554.8066 -7822.6826 8553.6826 -7822.7246 8552.2871 c -7822.7271 8552.2217 -7822.7822 8551.4404 -7822.7798 8551.375 C -7822.8433 8551.1045 -7822.8423 8550.54 -7822.8374 8550.2354 c f -7811.0186 8557.5625 m -7809.1777 8565.5684 -7814.7271 8565.5303 v -7817.9834 8564.8691 -7817.3154 8561.8516 v -7817.3032 8560.4668 -7815.353 8558.9326 v -7815.0278 8558.6377 -7814.5742 8557.415 v -7814.417 8555.876 -7813.083 8555.3877 v -7811.5454 8555.1279 -7811.0186 8557.5625 v f U U 1 Ap -7884 8586 m -7884 8481 L -7803 8481 L -7803 8586 L -7884 8586 L n U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 42) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 45) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8543.918 m -7885 8587 L -7798.2217 8587 L -7798.2217 8543.918 L -7885 8543.918 L n u u 0 O 0 0 0 1 k -7825.2217 8573.2363 m -7825.2217 8581.0742 L -7813.2217 8574.1445 L -7801.2217 8567.2168 L -7813.2217 8560.2891 L -7825.2217 8553.3613 L -7825.2217 8561.4824 L -7883.9351 8547.7168 L -7870.9878 8566.8027 L -7885 8587 L -7825.2217 8573.2363 L f 0 1 1 0.1 k 0 R 0 0 0 1 K -7823.2217 8570.2363 m -7823.2217 8578.0742 L -7811.2217 8571.1445 L -7799.2217 8564.2168 L -7811.2217 8557.2891 L -7823.2217 8550.3613 L -7823.2217 8558.4824 L -7881.9351 8544.7168 L -7867.2754 8564.3594 L -7881.9351 8584 L -7823.2217 8570.2363 L b U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 50) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7756.877 8586 L -7756.877 8538.415 L -7884 8538.415 L -7884 8586 L n u *u 0 O 0.9529 0.949 0.1961 0.0745 k -7857.793 8570.417 m -7857.8232 8570.2676 L -7859.9849 8564.3643 -7860.9438 8561.6377 -7861.2754 8560.2891 c -7861.3657 8560.2891 L -7861.6953 8561.6074 -7862.7754 8564.335 -7864.9673 8570.2676 c -7864.9966 8570.417 L -7857.793 8570.417 l f 1 D -7868.1182 8578.9678 m -7869.6191 8582.5371 -7870.3994 8584.709 -7868.1182 8584.917 c -7868.1182 8585.9678 L -7870.6992 8585.9375 -7873.5806 8585.917 -7876.3418 8585.917 c -7880.0649 8585.917 -7882.5273 8585.9375 -7884 8585.9678 c -7884 8584.917 L -7882.1064 8584.709 -7881.0542 8582.5674 -7873.5513 8565.5029 c -7861.6953 8538.415 L -7859.8638 8538.415 L -7848.1582 8565.5029 L -7840.8047 8582.5078 -7839.7246 8584.709 -7837.8887 8584.917 c -7837.8887 8585.9678 L -7839.5142 8585.9375 -7841.916 8585.917 -7845.5767 8585.917 c -7848.5488 8585.917 -7851.6694 8585.9375 -7854.7026 8585.9678 c -7854.7026 8584.917 L -7852.481 8584.709 -7853.3218 8582.5078 -7854.7617 8578.9678 C -7868.1182 8578.9678 l f *U *u 0 D -7813.0762 8554.0811 m -7813.0762 8550.4717 -7815.3535 8548.0947 -7819.1294 8548.0947 c -7820.2383 8548.0947 -7821.0767 8548.2158 -7821.5273 8548.2451 c -7821.5273 8560.5479 L -7820.8672 8560.6084 -7820.208 8560.6084 -7819.729 8560.6084 c -7818.2002 8560.6084 -7816.7026 8560.127 -7815.6841 8559.4053 c -7814.3945 8558.5332 -7813.0762 8556.7881 -7813.0762 8554.1416 C -7813.0762 8554.0811 l f 1 D -7832.0806 8558.3926 m -7832.0806 8542.6445 -7832.0806 8540.4287 -7834.542 8540.2783 c -7834.542 8539.3184 L -7833.042 8539.2588 -7830.3174 8539.1992 -7827.5664 8539.1689 c -7825.6538 8539.1084 -7822.3945 8539.0186 -7820.1479 8538.9775 c -7816.582 8538.9775 -7813.585 8539.4258 -7811.0049 8540.2627 c -7806.353 8541.8477 -7801.9702 8545.8525 -7801.9702 8553.6602 c -7801.9702 8558.7432 -7804.4014 8562.3193 -7806.5034 8564.0605 c -7807.583 8565.0215 -7808.8135 8565.832 -7809.7744 8566.3125 c -7809.7744 8566.4629 L -7807.5234 8569.4912 -7805.6025 8572.0625 -7799.3906 8580.6426 c -7797.5 8583.0645 -7795.9102 8584.7383 -7794.7402 8584.9775 c -7794.7402 8586 L -7796.6602 8586 -7799 8585.8848 -7801.1294 8585.8848 c -7803.3511 8585.8848 -7804.8521 8586 -7806.4424 8586 c -7807.6729 8586 -7808.7241 8585.9404 -7809.5039 8585.2725 c -7813.0151 8579.8477 -7816.9121 8573.7559 -7820.1182 8568.7139 c -7820.5078 8568.7139 -7820.957 8568.7139 -7821.5273 8568.7139 c -7821.5273 8571.2852 L -7821.5273 8582.5264 -7821.437 8584.7686 -7819.1895 8584.9775 c -7819.1895 8585.9697 L -7820.6279 8585.9404 -7823.9194 8585.915 -7826.6992 8585.915 c -7829.9287 8585.915 -7832.8921 8585.9404 -7834.5122 8585.9697 c -7834.5122 8584.9775 L -7832.0518 8584.7686 -7832.0806 8582.5264 -7832.0806 8565.5918 C -7832.0806 8558.3926 l f *U *u 0 D -7781.4561 8565.5928 m -7781.4561 8582.4941 -7781.4561 8584.6484 -7784.2832 8584.9775 C -7784.2832 8585.9697 l -7782.3887 8585.9404 -7779.0542 8585.915 -7775.7822 8585.915 c -7772.6294 8585.915 -7769.5688 8585.9404 -7767.2881 8585.9697 C -7767.2881 8584.9775 l -7770.2578 8584.9775 -7770.2881 8582.5244 -7770.2881 8565.5928 C -7770.2881 8548.1514 L -7762.8193 8548.1514 l -7759.999 8548.1514 -7758.5298 8548.96 -7757.8994 8551.2627 C -7756.9072 8551.2627 l -7756.9072 8546.4697 -7756.877 8542.415 -7756.877 8539.1709 c -7761.3486 8539.2012 -7766.748 8539.2314 -7772.0601 8539.2314 C -7779.7446 8539.2314 l -7784.5537 8539.2314 -7789.9966 8539.2012 -7794.9614 8539.1709 c -7794.9614 8542.3848 -7794.9326 8546.4697 -7794.9326 8551.2627 C -7793.9072 8551.2627 l -7793.3657 8549.1094 -7791.771 8548.1514 -7788.9438 8548.1514 C -7781.4561 8548.1514 l -7781.4561 8565.5928 L f *U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 62) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8569.9043 m -7846.7305 8561.3408 L -7885 8561.3408 L -7885 8569.9043 L -7846.7305 8569.9043 L f -7846.7305 8573.0967 m -7846.7305 8572.4229 L -7885 8572.4229 L -7885 8573.0967 L -7846.7305 8573.0967 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 63) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8565.8262 m -7846.7305 8574.3896 L -7859.3408 8574.3896 L -7859.3408 8587 L -7867.9038 8587 L -7867.9063 8565.8262 L -7867.9038 8565.8262 L -7867.9038 8565.8252 L -7846.7305 8565.8262 L f -7846.7305 8563.3076 m -7870.4233 8563.3076 L -7870.4233 8587 L -7871.0967 8587 L -7871.0977 8562.6328 L -7846.7305 8562.6328 L -7846.7305 8563.3076 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 64) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8586.999 m -7885 8548.7285 L -7846.7305 8548.7285 L -7846.7305 8586.999 L -7885 8586.999 L n 0 O 1 0.14 0.09 0 k -7846.7305 8561.3389 m -7872.3896 8561.3389 L -7872.3896 8586.999 L -7863.8262 8587 L -7863.8262 8569.9033 L -7846.7305 8569.9033 L -7846.7305 8561.3389 L f -7846.7305 8572.4219 m -7861.3081 8572.4219 L -7861.3081 8587 L -7860.6338 8587 L -7860.6338 8573.0957 L -7846.7305 8573.0957 L -7846.7305 8572.4219 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 65) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.0625 8559.4609 m -7884.6025 8559.4609 L -7884.6025 8587 L -7857.0625 8587 L -7857.0625 8559.4609 L n 0 O 0 0.55 1 0.12 k -7856.8418 8572.7002 m -7885 8572.7002 L -7885 8573.8252 L -7856.8418 8573.8252 L -7856.8418 8572.7002 L f u 0 0.55 1 0.3 k -7883.9814 8560.5215 m -7884.4102 8562.5254 -7883.1865 8566.1514 -7880.0874 8569.251 c -7876.9878 8572.3496 -7873.3457 8573.6602 -7871.3594 8573.1455 C -7871.3594 8573.1455 L -7870.875 8571.1895 -7872.1519 8567.5117 -7875.25 8564.4141 c -7878.3457 8561.3184 -7882.0122 8560.1064 -7883.9814 8560.5215 C f 0 0.39 0.7 0.12 k -7883.9814 8585.9912 m -7884.4102 8583.9883 -7883.1865 8580.3613 -7880.0874 8577.2617 c -7876.9878 8574.1641 -7873.3457 8572.8535 -7871.3594 8573.3672 C -7871.3594 8573.3672 L -7870.875 8575.3242 -7872.1519 8579.001 -7875.25 8582.0996 c -7878.3457 8585.1953 -7882.0122 8586.4063 -7883.9814 8585.9912 C f U u 0 0.55 1 0.3 k -7870.1782 8585.9912 m -7870.6074 8583.9883 -7869.3838 8580.3613 -7866.2842 8577.2617 c -7863.1855 8574.1641 -7859.543 8572.8535 -7857.5576 8573.3672 C -7857.5566 8573.3672 L -7857.0718 8575.3242 -7858.3496 8579.001 -7861.4473 8582.0996 c -7864.543 8585.1953 -7868.209 8586.4063 -7870.1782 8585.9912 C f 0 0.39 0.7 0.12 k -7870.1782 8560.5215 m -7870.6074 8562.5254 -7869.3838 8566.1514 -7866.2842 8569.251 c -7863.1855 8572.3496 -7859.543 8573.6602 -7857.5576 8573.1455 C -7857.5566 8573.1455 L -7857.0718 8571.1895 -7858.3496 8567.5117 -7861.4473 8564.4141 c -7864.543 8561.3184 -7868.209 8560.1064 -7870.1782 8560.5215 C f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 67) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 69) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.4609 m -7885 8559.4609 L -7885 8587 L -7857.4609 8587 L -7857.4609 8559.4609 L n 0 O 0 0.55 1 0.3 k -7875.4233 8573.252 m -7874.3096 8571.5313 -7870.8809 8569.833 -7866.4966 8569.833 c -7862.1152 8569.833 -7858.6138 8571.4824 -7857.5718 8573.25 C -7857.5718 8573.25 L -7858.6138 8574.9766 -7862.1152 8576.6738 -7866.4966 8576.6738 c -7870.875 8576.6738 -7874.3242 8574.9375 -7875.4233 8573.252 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 83) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8585.9355 m -7670.4009 8585.9355 L -7670.4009 8578.1348 L -7884 8578.1348 L -7884 8585.9355 L n 0 O 0 0 0 1 k -7884 8582.0352 m -7873.9858 8584.5273 -7867.187 8585.875 -7855.2007 8585.9355 c -7842.2183 8586 -7777.2002 8585.9355 y -7712.1816 8586 -7699.2002 8585.9355 v -7687.2129 8585.875 -7680.415 8584.5273 -7670.4009 8582.0352 C -7680.415 8579.543 -7687.2129 8578.1953 -7699.2002 8578.1348 c -7712.1816 8578.0693 -7777.2002 8578.1348 y -7842.2183 8578.0693 -7855.2007 8578.1348 v -7867.187 8578.1953 -7873.9858 8579.543 -7884 8582.0352 C f U %AI8_EndBrushPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np 4 Bn %AI5_BeginGradient: (Black, White) (Black, White) 0 2 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 %_Br [ 0 0 50 100 %_BS %_0 0 50 100 Bs 1 0 50 0 %_BS %_1 0 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Chrome) (Chrome) 0 6 Bd [ 0 < 464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B 3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272626262625 2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1B1B1B1B1A 1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F 0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 04040403030302020202010101010000 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A 1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 15151515151414141414141414131313131313131312121212121212121211111111111111111010 1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C 0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 07060606060606060606050505050505050504040404040404040303030303030303030202020202 02020201010101010101010000000000 > 1 %_Br 0 0.275 1 < 6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F > 1 %_Br 0 < 00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B 0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 161617171717181818181919191A1A1A1A1B1B1B1C1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C 2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 373738383838393939393A3A3A3B3B3B3B3C3C3C3D3D3D3D3E3E3E3E3F3F3F404040404141414142 42424343434344444444454545464646 > < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > < 00000101020203030304040505050606070708080809090A0A0B0B0B0C0C0D0D0D0E0E0F0F101010 1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5E5F5F606061616162626363646464 6565666666676768686969696A6A6B6B > 1 %_Br 1 0 %_Br < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 35343434333333323232323131313030302F2F2F2E2E2E2E2D2D2D2C2C2C2B2B2B2B2A2A2A292929 282828282727272626262525252524242423232322222222212121202020201F1F1F1E1E1E1D1D1D 1D1C1C1C1B1B1B1A1A1A1A1919191818181717171616161615151514141413131313121212111111 101010100F0F0F0E0E0E0D0D0D0D0C0C0C0B0B0B0A0A0A0A09090908080807070707060606050505 04040404030303020202010101010000 > 0 0 1 %_Br [ 1 0 50 92 %_BS %_1 0 50 92 Bs 0 0.275 1 0.12 1 50 59 %_BS %_0 0.275 1 0.12 1 50 59 Bs 0 0.275 1 0.42 1 50 50 %_BS %_0 0.275 1 0.42 1 50 50 Bs 1 0 50 49 %_BS %_1 0 50 49 Bs 1 0 50 41 %_BS %_1 0 50 41 Bs 1 0.3 0 0 1 50 0 %_BS %_1 0.3 0 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Rainbow) (Rainbow) 0 6 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 0 1 %_Br 1 < 0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E 2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E 7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 F7F8F9FAFBFCFDFEFF > 0 0 1 %_Br 1 < 00000000000000000000000000000000000001010101010101010101010101010101010101010101 01010101010101010101010101010202020202020202020202020202020202020202020202020202 02020202020202020202030303030303030303030303030303030303030303030303030303030303 03030303030304040404040404040404040404040404040404040404040404040404040404040404 04040505050505050505050505050505050505050505050505050505050505050505050505050606 06060606060606060606060606060606060606060606060606060606060606060607070707070707 07070707070707070707070707070707 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 1 %_Br < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > 0 1 0 1 %_Br 0 < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 1 %_Br [ 0 1 0 0 1 50 100 %_BS %_0 1 0 0 1 50 100 Bs 1 1 0 0 1 50 80 %_BS %_1 1 0 0 1 50 80 Bs 1 0.0279 0 0 1 50 60 %_BS %_1 0.0279 0 0 1 50 60 Bs 1 0 1 0 1 50 40 %_BS %_1 0 1 0 1 50 40 Bs 0 0 1 0 1 50 20 %_BS %_0 0 1 0 1 50 20 Bs 0 1 1 0 1 50 0 %_BS %_0 1 1 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Yellow & Orange Radial) (Yellow & Orange Radial) 1 2 Bd [ 0 < 0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F 707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C > < FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E6 > 0 1 %_Br [ 0 0 1 0 1 52 19 %_BS %_0 0 1 0 1 52 19 Bs 0 0.55 0.9 0 1 50 100 %_BS %_0 0.55 0.9 0 1 50 100 Bs BD %AI5_EndGradient %AI5_End_NonPrinting-- %AI5_BeginPalette 0 0 Pb 1 1 1 1 ([Registration]) 0 Xs ([Registration]) Pc 0 0 0 0 k (C=0 M=0 Y=0 K=0) Pc 0 0 0 1 k (C=0 M=0 Y=0 K=100) Pc 0 0.1 1 0 k (C=0 M=10 Y=100 K=0) Pc 0 0.5 0 0 k (C=0 M=50 Y=0 K=0) Pc 0 0.5 1 0 k (C=0 M=50 Y=100 K=0) Pc 1 0.55 1 0 k (C=100 M=55 Y=100 K=0) Pc 1 0.9 0.1 0 k (C=100 M=90 Y=10 K=0) Pc 0.15 1 1 0 k (C=15 M=100 Y=100 K=0) Pc 0.45 0.9 0 0 k (C=45 M=90 Y=0 K=0) Pc 0.5 0.4 0.3 0 k (C=50 M=40 Y=30 K=0) Pc 0.5 0.85 1 0 k (C=50 M=85 Y=100 K=0) Pc 0.75 0.05 1 0 k (C=75 M=5 Y=100 K=0) Pc 0.75 0.9 0 0 k (C=75 M=90 Y=0 K=0) Pc 0.8 0.05 0 0 k (C=80 M=5 Y=0 K=0) Pc Bb 2 (Black, White) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Black, White) Pc Bb 2 (Chrome) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Chrome) Pc Bb 2 (Rainbow) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Rainbow) Pc Bb 0 0 0 0 Bh 2 (Yellow & Orange Radial) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Yellow & Orange Radial) Pc (Brick) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Brick) Pc (Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Confetti) Pc (Leaves - Fall ) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Leaves - Fall ) Pc (Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Stripes) Pc PB %AI5_EndPalette %AI5_Begin_NonPrinting Np %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Dog Tracks) (1 /New Pattern 41/ 1 0 0 0 1 / 0 1 1 0 1 1 0 0 0 0 -90 -90 0 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Fall Leaf) (1 /New Pattern 34/ 1 0.0745 0.9 0.9019 0.18 / 0 0.602793 1 1 0.1 1 1 -) - (1 1 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Ladybug) (1 /New Pattern 10/ 5 0.898039 0 0 / 0 1 1 0 0.803911 1.2 1 -1.55 1.55 ) - (1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Push Pin) (1 /New Pattern 36/ 1 0.025 0.1 0.475 0 / 0 1 1 0 0.401676 1 1 -1.06145) - ( 1.06 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Strawberry) (1 /New Pattern 37/ 1 0 0 0 1 / 0 0.803911 1 1 0.803911 1 1 -0.5 0.5 1 ) - (-75 75.419 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Twinkle Star ) (1 /New Pattern 2/ 0 1 / 1 0.5 1 1 0.25 1 1 -0.5 0.5 1 0 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Double Lines) (1 / New Pattern 62/ New Pattern 63/ New Pattern 64/ / / 1 1 0.14 0.09 ) - (0 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Laurel) (1 / New Pattern 65/ New Pattern 42/ New Pattern 67/ / New Pattern 69/ ) - (1 0 0.55 1 0.3 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Rope ) (1 / New Pattern 1/ / / New Pattern 3/ New Pattern 6/ 5 0 0 0 / 1 0 1 ) - (0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Arrow) (1 / New Pattern 45/ / / / / 5 0.898039 0 0 / 2 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Marker) (1 / New Pattern 8/ / / / / 0 0 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Paintbrush) (1 / New Pattern 5/ / / / / 1 0.5 0.85 1 0.45 / 0 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Tapered Stroke) (1 / New Pattern 83/ / / / / 1 0 0 0 1 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Type) (1 / New Pattern 50/ / / / / 1 0.952941 0.94902 0.196078 0.0745098 / 1) - ( 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (6 pt Flat ) (1 4 8 10 10 90 90 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (10 pt Oval) (1 1 19 15 15 130 130 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (12 pt Oval ) (1 7 17 45 45 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (20 pt Oval) (1 20 20 20 100 40 80 0 2 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (25 pt Round ) (1 10 40 100 100 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (50 pt Flat) (1 40 60 0 0 44 44 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Brush Manager Order) (Adobe Brush Manager Order) ( Adobe Calligraphic Brush Tool/ 6 pt Flat / Adobe Calligraphic Brush T) - (ool/ 10 pt Oval/ Adobe Calligraphic Brush Tool/ 12 pt Oval / Adobe Cal) - (ligraphic Brush Tool/ 20 pt Oval/ Adobe Calligraphic Brush Tool/ 25 pt) - ( Round / Adobe Calligraphic Brush Tool/ 50 pt Flat/ Adobe Scatter Brus) - (h Tool/ Dog Tracks/ Adobe Scatter Brush Tool/ Fall Leaf/ Adobe Scatter) - ( Brush Tool/ Ladybug/ Adobe Scatter Brush Tool/ Push Pin/ Adobe Scatte) - (r Brush Tool/ Strawberry/ Adobe Scatter Brush Tool/ Twinkle Star / Ado) - (be ArtOnPath Brush Tool/ Marker/ Adobe ArtOnPath Brush Tool/ Tapered S) - (troke/ Adobe ArtOnPath Brush Tool/ Arrow/ Adobe ArtOnPath Brush Tool/ ) - (Paintbrush/ Adobe ArtOnPath Brush Tool/ Type/ Adobe PatternOnPath Brus) - (h Tool/ Double Lines/ Adobe PatternOnPath Brush Tool/ Laurel/ Adobe Pa) - (tternOnPath Brush Tool/ Rope /) . %AI8_EndPluginObject %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_PluginGroupInfo (Adobe Path Blends) (Adobe Blends Plugin) (Live Blends) %AI8_PluginGroupInfo (Adobe PatternOnPath Brush Tool) (Adobe Pattern Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe ArtOnPath Brush Tool) (Adobe Art Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe Calligraphic Brush Tool) (Undo New Calligraphic Brush) (Calligraphic Brush Tool) %AI8_PluginGroupInfo (Adobe Scatter Brush Tool) (Adobe Scatter Brush Plugin) (Scatter Brush Tool) %AI5_End_NonPrinting-- %AI5_BeginLayer 1 1 1 1 0 0 1 0 79 128 255 0 50 Lb (Layer 1) Ln 0 A u 0 O 1 g 0 R 0 G 300 Ar 2 J 0 j 0.72 w 3.86 M []0 d %AI3_Note: 0 D 1 XR 144.48 371.2803 m 198.48 371.2803 l 198.48 317.2803 l 144.48 317.2803 l 144.48 371.2803 l b /BBAccumRotation (0.000000) XT 225.6001 335.2803 m 279.6001 335.2803 l 279.6001 299.2803 l 225.6001 299.2803 l 225.6001 335.2803 l b /BBAccumRotation (0.000000) XT 0 XR 279.6001 317.2803 m 225.6001 317.2803 l S /BBAccumRotation (0.000000) XT 279.6001 326.1602 m 225.6001 326.1602 l S /BBAccumRotation (0.000000) XT 279.6001 308.1602 m 225.6001 308.1602 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 333.5996 380.1602 m 387.5996 380.1602 l 387.5996 326.1602 l 333.5996 326.1602 l 333.5996 380.1602 l b /BBAccumRotation (0.000000) XT 333.5996 310.3203 m 387.5996 310.3203 l 387.5996 256.3203 l 333.5996 256.3203 l 333.5996 310.3203 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 168.3501 373.3398 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR %_ 0 50 XQ /_Times-Roman 10 8.9799 -2.18 Tf 0 Ts 100 100 Tz 0 Tt %_0 0 100 100 Xu %AI55J_GlyphSubst: GlyphSubstNone 1 TA %_ 0 XL 0 TY 0 TV 36 0 Xb XB 0 0 5 TC 100 100 200 TW 25 TG 0 0 0 Ti 0 Ta 0 1 2 2 3 Th 0 Tq 240 Tg 0 0 Tl 0 Tc 0 Tw (vnode) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 232.7998 292.3398 0 Tp 0 Tv TP 0 Tr (bhv_desc) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 342.5703 319.3398 0 Tp 0 Tv TP 0 Tr (xfs_inode) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 342.5703 247.3398 0 Tp 0 Tv TP 0 Tr (xfs_vnodeops) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 214.3198 336.2402 m 223.9199 335.7598 l 216 341.2803 l 215.04 338.6396 l 214.3198 336.2402 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 214.3198 336.2402 m 223.9199 335.7598 l 216 341.2803 l 215.04 338.6396 l 214.3198 336.2402 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 214.5601 338.8799 m 198.48 344.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 421.4404 307.6797 m 430.7998 310.3203 l 421.4404 312.96 l 421.4404 310.3203 l 421.4404 307.6797 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 421.4404 307.6797 m 430.7998 310.3203 l 421.4404 312.96 l 421.4404 310.3203 l 421.4404 307.6797 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 420.96 310.3203 m 360.4795 310.3203 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 327.5996 370.5596 m 332.4004 378.96 l 324 374.1602 l 325.6797 372.4795 l 327.5996 370.5596 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 327.5996 370.5596 m 332.4004 378.96 l 324 374.1602 l 325.6797 372.4795 l 327.5996 370.5596 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 325.4404 372 m 279.6001 326.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 322.5596 305.5195 m 331.6797 308.1602 l 322.5596 310.7998 l 322.5596 308.1602 l 322.5596 305.5195 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 322.5596 305.5195 m 331.6797 308.1602 l 322.5596 310.7998 l 322.5596 308.1602 l 322.5596 305.5195 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 322.0801 308.1602 m 279.6001 308.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 139.2002 362.4004 m 143.2798 369.8398 l 135.8398 365.7598 l 137.52 364.0801 l 139.2002 362.4004 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 139.2002 362.4004 m 143.2798 369.8398 l 135.8398 365.7598 l 137.52 364.0801 l 139.2002 362.4004 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 137.04 363.5996 m 135.6001 362.1602 l 135.6001 299.2803 l 162.48 290.1602 l 225.6001 317.2803 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 282.48 281.7598 m 288 273.8398 l 287.52 283.4404 l 285.1201 282.7197 l 282.48 281.7598 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 282.48 281.7598 m 288 273.8398 l 287.52 283.4404 l 285.1201 282.7197 l 282.48 281.7598 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 284.8799 283.2002 m 279.6001 299.2803 l S /BBAccumRotation (0.000000) XT 297.6001 263.2803 m 279.6001 263.2803 l S /BBAccumRotation (0.000000) XT 297.6001 254.1602 m 279.6001 254.1602 l S /BBAccumRotation (0.000000) XT 297.6001 245.2803 m 279.6001 245.2803 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 279.5698 236.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (NULL) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 441.5703 308.1699 0 Tp 0 Tv TP 0 Tr (xfs_open\(\)) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 421.4404 296.6396 m 430.7998 299.2803 l 421.4404 301.9199 l 421.4404 299.2803 l 421.4404 296.6396 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 421.4404 296.6396 m 430.7998 299.2803 l 421.4404 301.9199 l 421.4404 299.2803 l 421.4404 296.6396 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 420.96 299.2803 m 387.5996 299.2803 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 441.5703 301.3398 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_close\(\)) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 468.5703 290.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 468.5703 281.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 468.5703 272.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT U /BBAccumRotation (0.000000) XT LB %AI5_EndLayer-- gsave annotatepage grestore showpage Adobe_Illustrator_AI5 /terminate get exec Adobe_shading_AI8 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_cshow /terminate get exec Adobe_level2_AI5 /terminate get exec %%EndDocument @endspecial 1026 4942 a(Figure)h(2:)25 b(vnode,)19 b(bhv)p 1730 4942 V 28 w(desc,)h(and)g(XFS)h(inode)e(relationship.)1929 5656 y(4)p eop %%Page: 5 5 5 4 bop 329 2141 a @beginspecial 107 @llx 206 @lly 496 @urx 426 @ury 3890 @rwi @setspecial %%BeginDocument: fig3.eps %AI5_FileFormat 4.0 %AI3_ColorUsage: Black&White %AI3_IncludePlacedImages %AI7_ImageSettings: 1 %AI3_TemplateBox: 306.5 395.5 306.5 395.5 %AI3_TileBox: 31 31 583 761 %AI3_DocumentPreview: Header %AI5_ArtSize: 612 792 %AI5_RulerUnits: 2 %AI5_ArtFlags: 1 0 0 1 0 0 1 0 0 %AI5_TargetResolution: 800 %AI5_NumLayers: 1 %AI8_OpenToView: -39.6226 620.6138 1.19 1137 822 18 0 1 7 40 0 0 %AI5_OpenViewLayers: 7 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 userdict /Adobe_level2_AI5 26 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { (AI8_CMYK_CustomColor) 6 packedarray } bind def /findrgbcustomcolor { (AI8_RGB_CustomColor) 5 packedarray } bind def /setcustomcolor { exch aload pop dup (AI8_CMYK_CustomColor) eq { pop pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { dup (AI8_RGB_CustomColor) eq { pop pop 3 { 1 exch sub 3 index mul 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } ifelse } ifelse } def } if /setAIseparationgray { false setoverprint 0 setgray /setseparationgray where{ pop setseparationgray }{ /setcolorspace where{ pop [/Separation (All) /DeviceCMYK {dup dup dup}] setcolorspace 1 exch sub setcolor }{ setgray }ifelse }ifelse } def /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking currentpacking true setpacking userdict /Adobe_typography_AI5 68 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /havefont { systemdict /languagelevel known { /Font resourcestatus dup { exch pop exch pop } if } { systemdict /FontDirectory get 1 index known { pop true } { systemdict /fileposition known { dup length 6 add exch Ss 6 250 getinterval cvs pop Ss exch 0 exch getinterval status { pop pop pop pop true } { false } ifelse } { pop false } ifelse } ifelse } ifelse } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def /subststring { exch 2 index exch search { exch pop exch dup () eq { pop exch concatstring } { 3 -1 roll exch concatstring concatstring } ifelse exch pop true } { pop pop false } ifelse } def /concatstring { 1 index length 1 index length 1 index add string dup 0 5 index putinterval dup 2 index 4 index putinterval 4 1 roll pop pop pop } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def 2 index havefont { 3 index 255 string cvs dup (_Symbol_) eq { pop 2 index findfont } { 1 index 0 eq { dup length 1 sub 1 exch getinterval cvn findfont } { pop 2 index findfont } ifelse } ifelse } { dup 1 eq { 2 index 64 string cvs dup (-90pv-RKSJ-) (-83pv-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop dup (-90ms-RKSJ-) (-Ext-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop pop true } ifelse } ifelse { 1 index 1 eq { /Ryumin-Light-Ext-RKSJ-V havefont {/Ryumin-Light-Ext-RKSJ-V} {/Courier} ifelse } { /Ryumin-Light-83pv-RKSJ-H havefont {/Ryumin-Light-83pv-RKSJ-H} {/Courier} ifelse } ifelse findfont [1 0 0.5 1 0 0] makefont } if } { /Courier findfont } ifelse } ifelse _wv type /arraytype eq { _wv makeblendedfont } if dup length 10 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontScript exch def /FontDirection exch def /FontRequest exch def /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { W B } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { W F } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { W S } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat _shift aload pop _lineorientation 1 eq { exch } if translate _scale aload pop _lineorientation 1 eq _yokoorientation 1 eq or { exch } if scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { 1 index type /nametype eq { dup 0.75 mul 1 index 0.25 mul neg } if /_fontDescent exch ddef /_fontAscent exch ddef /_fontSize exch ddef /_fontRotateAdjust _fontAscent _fontDescent add 2 div neg ddef /_fontHeight _fontSize ddef findfont _fontSize scalefont setfont } def /Tl { pop neg 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { 0 exch _shift astore pop currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { count 1 eq { 100 } if 100 div exch 100 div exch _scale astore pop iTm } def /TA { pop } def /Tq { pop } def /Tg { pop } def /TG { pop } def /Tv { /_lineorientation exch ddef } def /TV { /_charorientation exch ddef } def /Ty { dup /_yokoorientation exch ddef 1 sub neg Tv } def /TY { pop } def /T~ { Tx } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { _fontSize mul 1000 div _lineorientation 0 eq { neg 0 } { 0 exch } ifelse rmoveto pop } def /TK { 2 npop } def /T* { _leading aload pop _lineorientation 0 ne { exch } if Td } def /T*- { _leading aload pop _lineorientation 0 ne { exch } if exch neg exch neg Td } def /T- { _ax neg 0 rmoveto _lineorientation 1 eq _charorientation 0 eq and { 1 TV _hyphen Tx 0 TV } { _hyphen Tx } ifelse } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ findfont _fontSize scalefont setfont 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking % /X^ { currentfont 5 1 roll dup havefont { findfont _fontSize scalefont setfont } { pop exch } ifelse 2 index 0 eq { Tx } { Tj } ifelse pop pop setfont } def /T^ /X^ load def userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 53 dict put } if userdict /Adobe_ColorImage_AI6 get begin /initialize { Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 41 dict def } if Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /_newproc null def /_proc1 null def /_proc2 null def /sourcearray 4 array def /_ptispace null def /_ptiname null def /_pti0 0 def /_pti1 0 def /_ptiproc null def /_ptiscale 0 def /_pticomps 0 def /_ptibuf 0 string def /_gtigray 0 def /_cticmyk null def /_rtirgb null def /XIEnable true def /XIType 0 def /XIEncoding 0 def /XICompression 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIRowBytes 0 def /XIFile null def /XIBuffer1 null def /XIBuffer2 null def /XIBuffer3 null def /XIDataProc null def /XIColorSpace /DeviceGray def /XIColorValues 0 def /XIPlateList false def end /ci6colorimage /colorimage where {/colorimage get}{null} ifelse def /ci6image systemdict /image get def /ci6curtransfer systemdict /currenttransfer get def /ci6curoverprint /currentoverprint where {/currentoverprint get}{{_of}} ifelse def /ci6foureq { 4 index ne { pop pop pop false }{ 4 index ne { pop pop false }{ 4 index ne { pop false }{ 4 index eq } ifelse } ifelse } ifelse } def /ci6testplate { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 ci6foureq { /plateindex 0 def }{ 0 1 0 0 ci6foureq { /plateindex 1 def }{ 0 0 1 0 ci6foureq { /plateindex 2 def }{ 0 0 0 1 ci6foureq { /plateindex 3 def }{ 0 0 0 0 ci6foureq { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /ci6concatprocs { /packedarray where { pop dup type /packedarraytype eq 2 index type /packedarraytype eq or }{ false } ifelse { /_proc2 exch cvlit def /_proc1 exch cvlit def _proc1 aload pop _proc2 aload pop _proc1 length _proc2 length add packedarray cvx }{ /_proc2 exch cvlit def /_proc1 exch cvlit def /_newproc _proc1 length _proc2 length add array def _newproc 0 _proc1 putinterval _newproc _proc1 length _proc2 putinterval _newproc cvx } ifelse } def /ci6istint { type /arraytype eq } def /ci6isspot { dup type /arraytype eq { dup length 1 sub get /Separation eq }{ pop false } ifelse } def /ci6spotname { dup ci6isspot {dup length 2 sub get}{pop ()} ifelse } def /ci6altspace { aload pop pop pop ci6colormake } def /ci6numcomps { dup /DeviceGray eq { pop 1 }{ dup /DeviceRGB eq { pop 3 }{ /DeviceCMYK eq { 4 }{ 1 } ifelse } ifelse } ifelse } def /ci6marksplate { dup /DeviceGray eq { pop plateindex 3 eq }{ dup /DeviceRGB eq { pop plateindex 5 ne }{ dup /DeviceCMYK eq { pop plateindex 5 ne }{ dup ci6isspot { /findcmykcustomcolor where { pop dup length 2 sub get 0.1 0.1 0.1 0.1 5 -1 roll findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop plateindex 5 ne } ifelse }{ pop plateindex 5 ne } ifelse } ifelse } ifelse } ifelse } def /ci6colormake { dup ci6numcomps exch 1 index 2 add 1 roll dup 1 eq {pop}{array astore} ifelse exch } def /ci6colorexpand { dup ci6spotname exch dup ci6istint { ci6altspace exch 4 1 roll }{ 1 3 1 roll } ifelse } def /ci6colortint { dup /DeviceGray eq { 3 1 roll 1 exch sub mul 1 exch sub exch }{ dup /DeviceRGB eq { 3 1 roll {1 exch sub 1 index mul 1 exch sub exch} forall pop 3 array astore exch }{ dup /DeviceCMYK eq { 3 1 roll {1 index mul exch} forall pop 4 array astore exch }{ 3 1 roll mul exch } ifelse } ifelse } ifelse } def /ci6colortocmyk { dup /DeviceGray eq { pop 1 exch sub 0 0 0 4 -1 roll 4 array astore }{ dup /DeviceRGB eq { pop aload pop _rgbtocmyk 4 array astore }{ dup /DeviceCMYK eq { pop }{ ci6altspace ci6colortint ci6colortocmyk } ifelse } ifelse } ifelse } def /ci6makeimagedict { 7 dict begin /ImageType 1 def /Decode exch def /DataSource exch def /ImageMatrix exch def /BitsPerComponent exch def /Height exch def /Width exch def currentdict end } def /ci6stringinvert { 0 1 2 index length 1 sub { dup 2 index exch get 255 exch sub 2 index 3 1 roll put } for } def /ci6stringknockout { 0 1 2 index length 1 sub { 255 2 index 3 1 roll put } for } def /ci6stringapply { 0 1 4 index length 1 sub { dup 4 index exch get 3 index 3 1 roll 3 index exec } for pop exch pop } def /ci6walkrgbstring { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval {} forall 5 index exec 3 index } for 5 {pop} repeat } def /ci6walkcmykstring { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval {} forall 6 index exec 3 index } for 5 { pop } repeat } def /ci6putrgbtograystr { .11 mul exch .59 mul add exch .3 mul add cvi 3 copy put pop 1 add } def /ci6putcmyktograystr { exch .11 mul add exch .59 mul add exch .3 mul add dup 255 gt { pop 255 } if 255 exch sub cvi 3 copy put pop 1 add } def /ci6rgbtograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putrgbtograystr load exch ci6walkrgbstring end } def /ci6cmyktograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putcmyktograystr load exch ci6walkcmykstring end } def /ci6separatecmykproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 0 2 index plateindex 4 2 index length 1 sub { get 255 exch sub 3 copy put pop 1 add 2 index } for pop pop exch pop end } def /ci6compositeimage { dup 1 eq { pop pop image }{ /ci6colorimage load null ne { ci6colorimage }{ 3 1 roll pop sourcearray 0 3 -1 roll put 3 eq {/ci6rgbtograyproc}{/ci6cmyktograyproc} ifelse load image } ifelse } ifelse } def /ci6knockoutimage { gsave 0 ci6curtransfer exec 1 ci6curtransfer exec eq { 0 ci6curtransfer exec 0.5 lt }{ 0 ci6curtransfer exec 1 ci6curtransfer exec gt } ifelse {{pop 0}}{{pop 1}} ifelse systemdict /settransfer get exec ci6compositeimage grestore } def /ci6drawimage { ci6testplate -1 eq { pop ci6compositeimage }{ dup type /arraytype eq { dup length plateindex gt {plateindex get}{pop false} ifelse }{ { true }{ dup 1 eq {plateindex 3 eq}{plateindex 3 le} ifelse } ifelse } ifelse { dup 1 eq { pop pop ci6image }{ dup 3 eq { ci6compositeimage }{ pop pop sourcearray 0 3 -1 roll put /ci6separatecmykproc load ci6image } ifelse } ifelse }{ ci6curoverprint { 7 {pop} repeat }{ ci6knockoutimage } ifelse } ifelse } ifelse } def /ci6proctintimage { /_ptispace exch store /_ptiname exch store /_pti1 exch store /_pti0 exch store /_ptiproc exch store /_pticomps _ptispace ci6numcomps store /_ptiscale _pti1 _pti0 sub store level2? { _ptiname length 0 gt version cvr 2012 ge and { [/Separation _ptiname _ptispace {_ptiproc}] setcolorspace [_pti0 _pti1] ci6makeimagedict ci6image }{ [/Indexed _ptispace 255 {255 div _ptiscale mul _pti0 add _ptiproc}] setcolorspace [0 255] ci6makeimagedict ci6image } ifelse }{ _pticomps 1 eq { { dup { 255 div _ptiscale mul _pti0 add _ptiproc 255 mul cvi put } ci6stringapply } ci6concatprocs ci6image }{ { dup length _pticomps mul dup _ptibuf length ne {/_ptibuf exch string store}{pop} ifelse _ptibuf { exch _pticomps mul exch 255 div _ptiscale mul _pti0 add _ptiproc _pticomps 2 add -2 roll _pticomps 1 sub -1 0 { 1 index add 2 index exch 5 -1 roll 255 mul cvi put } for pop pop } ci6stringapply } ci6concatprocs false _pticomps /ci6colorimage load null eq {7 {pop} repeat}{ci6colorimage} ifelse } ifelse } ifelse } def /ci6graytintimage { /_gtigray 5 -1 roll store {1 _gtigray sub mul 1 exch sub} 4 1 roll /DeviceGray ci6proctintimage } def /ci6cmyktintimage { /_cticmyk 5 -1 roll store {_cticmyk {1 index mul exch} forall pop} 4 1 roll /DeviceCMYK ci6proctintimage } def /ci6rgbtintimage { /_rtirgb 5 -1 roll store {_rtirgb {1 exch sub 1 index mul 1 exch sub exch} forall pop} 4 1 roll /DeviceRGB ci6proctintimage } def /ci6tintimage { ci6testplate -1 eq { ci6colorexpand 3 -1 roll 5 -1 roll {0}{0 exch} ifelse 4 2 roll dup /DeviceGray eq { pop ci6graytintimage }{ dup /DeviceRGB eq { pop ci6rgbtintimage }{ pop ci6cmyktintimage } ifelse } ifelse }{ dup ci6marksplate { plateindex 5 lt { ci6colortocmyk plateindex get dup 0 eq ci6curoverprint and { 7 {pop} repeat }{ 1 exch sub exch {1 0}{0 1} ifelse () ci6graytintimage } ifelse }{ pop exch {0}{0 exch} ifelse 0 3 1 roll () ci6graytintimage } ifelse }{ ci6curoverprint { 8 {pop} repeat }{ pop pop pop {pop 1} 0 1 () /DeviceGray ci6proctintimage } ifelse } ifelse } ifelse } def /XINullImage { } def /XIImageMask { XIImageWidth XIImageHeight false [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load imagemask } def /XIImageTint { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load XIType 3 eq XIColorValues XIColorSpace ci6tintimage } def /XIImage { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load false XIChannelCount XIPlateList ci6drawimage } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale /_lp /null ddef _fc /_lp /imagemask ddef end } def /XH { Adobe_ColorImage_AI6_Vars begin grestore end } def /XIEnable { Adobe_ColorImage_AI6_Vars /XIEnable 3 -1 roll put } def /XC { Adobe_ColorImage_AI6_Vars begin ci6colormake /XIColorSpace exch def /XIColorValues exch def end } def /XIPlates { Adobe_ColorImage_AI6_Vars begin /XIPlateList exch def end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def cvi dup 256 idiv /XICompression exch store 256 mod /XIEncoding exch store pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi }{ XIImageWidth XIChannelCount mul } ifelse /XIRowBytes exch def XIEnable { /XIBuffer3 XIImageWidth string def XICompression 0 eq { /XIBuffer1 XIRowBytes string def XIEncoding 0 eq { {currentfile XIBuffer1 readhexstring pop} }{ {currentfile XIBuffer1 readstring pop} } ifelse }{ /XIBuffer1 256 string def /XIBuffer2 XIRowBytes string def {currentfile XIBuffer1 readline pop (%) anchorsearch {pop} if} /ASCII85Decode filter /DCTDecode filter /XIFile exch def {XIFile XIBuffer2 readstring pop} } ifelse /XIDataProc exch def XIType 1 ne { 0 setgray } if XIType 1 eq { XIImageMask }{ XIType 2 eq XIType 3 eq or { XIImageTint }{ XIImage } ifelse } ifelse }{ XINullImage } ifelse /XIPlateList false def grestore end } def end currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 112 dict dup begin put /_?cmyk false def /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_lineorientation 0 def /_charorientation 0 def /_yokoorientation 0 def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_shift [0 0] def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fontSize 0 def /_fontAscent 0 def /_fontDescent 0 def /_fontHeight 0 def /_fontRotateAdjust 0 def /Ss 256 string def Ss 0 (fonts/) putinterval /_cnt 0 def /_scale [1 1] def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_hfname 100 string def /_hffound false def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_rgbf 3 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_rgbs 3 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /_lobyte 0 def /_hibyte 0 def /_cproc null def /_cscript 0 def /_hvax 0 def /_hvay 0 def /_hvwb 0 def /_hvcx 0 def /_hvcy 0 def /_bitfont null def /_bitlobyte 0 def /_bithibyte 0 def /_bitkey null def /_bitdata null def /_bitindex 0 def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 100 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin /_aicmykps where {pop /_?cmyk _aicmykps def}if discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /hswj { dup stringwidth 3 2 roll { _hvwb eq { exch _hvcx add exch _hvcy add } if exch _hvax add exch _hvay add } cforall } def /vswj { 0 0 3 -1 roll { dup 255 le _charorientation 1 eq and { dup cstring stringwidth 5 2 roll _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub 4 -1 roll sub exch 3 -1 roll sub exch } { _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub _fontHeight sub } ifelse } cforall } def /swj { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hswj } { vswj } ifelse } def /sw { 0 0 0 6 3 roll swj } def /vjss { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index setmatrix stroke grestore _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index setmatrix stroke grestore moveto pop pop } ifelse } cforall 6 npop } def /hjss { 4 1 roll { dup cstring gsave false charpath currentpoint 5 index setmatrix stroke grestore moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jss { _lineorientation 0 eq { hjss } { vjss } ifelse } def /ss { 0 0 0 7 3 roll jss } def /vjsp { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto false charpath currentpoint _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto 2 index false charpath moveto pop pop } ifelse } cforall 6 npop } def /hjsp { 4 1 roll { dup cstring false charpath _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jsp { matrix currentmatrix _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /sp { matrix currentmatrix 0 0 0 7 3 roll _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /_rgbtocmyk { 3 { 1 exch sub 3 1 roll } repeat 3 copy 1 4 1 roll 3 { 3 index 2 copy gt { exch } if pop 4 1 roll } repeat pop pop pop 4 1 roll 3 { 3 index sub 3 1 roll } repeat 4 -1 roll } def /setrgbfill { _rgbf astore pop /_fc { _lp /fill ne { _of setoverprint _rgbf aload pop setrgbcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /setrgbstroke { _rgbs astore pop /_sc { _lp /stroke ne { _os setoverprint _rgbs aload pop setrgbcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xa { _?cmyk { 3 npop k }{ setrgbfill 4 npop } ifelse } def /XA { _?cmyk { 3 npop K }{ setrgbstroke 4 npop } ifelse } def /Xs { /_gf exch ddef 5 npop /_fc { _lp /fill ne { _of setoverprint _gf setAIseparationgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XS { /_gs exch ddef 5 npop /_sc { _lp /stroke ne { _os setoverprint _gs setAIseparationgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xx { exch /_gf exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XX { exch /_gs exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /XK { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll K } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop XA } ifelse } def /Xk { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll k } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop Xa } ifelse } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /Xt { pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if endString eq { cleartomark stop } if }ifelse } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse }ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 6 npop 7 2 roll 5 npop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { /clipForward? true def /Tx /pop load def /Tj /pop load def currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 4 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setrgbcolor { 3 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end /XP { 4 npop } bind def /XD { pop } bind def end setpacking currentpacking true setpacking userdict /Adobe_cshow 14 dict dup begin put /initialize { Adobe_cshow begin Adobe_cshow { dup xcheck { bind } if pop pop } forall end Adobe_cshow begin } def /terminate { currentdict Adobe_cshow eq { end } if } def /cforall { /_lobyte 0 ddef /_hibyte 0 ddef /_cproc exch ddef /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef { /_lobyte exch ddef _hibyte 0 eq _cscript 1 eq _lobyte 129 ge _lobyte 159 le and _lobyte 224 ge _lobyte 252 le and or and _cscript 2 eq _lobyte 161 ge _lobyte 254 le and and _cscript 3 eq _lobyte 161 ge _lobyte 254 le and and _cscript 25 eq _lobyte 161 ge _lobyte 254 le and and _cscript -1 eq or or or or and { /_hibyte _lobyte ddef } { _hibyte 256 mul _lobyte add _cproc /_hibyte 0 ddef } ifelse } forall } def /cstring { dup 256 lt { (s) dup 0 4 3 roll put } { dup 256 idiv exch 256 mod (hl) dup dup 0 6 5 roll put 1 4 3 roll put } ifelse } def /clength { 0 exch { 256 lt { 1 } { 2 } ifelse add } cforall } def /hawidthshow { { dup cstring show _hvax _hvay rmoveto _hvwb eq { _hvcx _hvcy rmoveto } if } cforall } def /vawidthshow { { dup 255 le _charorientation 1 eq and { -90 rotate 0 _fontRotateAdjust rmoveto cstring _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow 0 _fontRotateAdjust neg rmoveto 90 rotate } { currentpoint _fontHeight sub exch _hvay sub exch _hvax sub 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if 3 2 roll cstring dup stringwidth pop 2 div neg _fontAscent neg rmoveto show moveto } ifelse } cforall } def /hvawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse } def /hvwidthshow { 0 0 3 -1 roll hvawidthshow } def /hvashow { 0 0 0 6 -3 roll hvawidthshow } def /hvshow { 0 0 0 0 0 6 -1 roll hvawidthshow } def currentdict readonly pop end setpacking userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_shading_AI8 10 dict dup begin put /initialize { Adobe_shading_AI8 begin Adobe_shading_AI8 bdprocs Mesh /initialize get exec } def /terminate { currentdict Adobe_shading_AI8 eq { end } if } def /bdprocs { { dup xcheck 1 index type /arraytype eq and { bind } if pop pop } forall } def /X! {pop} def /X# {pop pop} def /Mesh 40 dict def Mesh begin /initialize { Mesh bdprocs Mesh begin /emulate? /AI8MeshEmulation where { pop AI8MeshEmulation }{ systemdict /shfill known not } ifelse def end } def /bd { shadingdict begin } def /paint { emulate? { end }{ /_lp /none ddef _fc /_lp /none ddef /AIColorSpace AIColorSpace tocolorspace store /ColorSpace AIColorSpace topsspace store version_ge_3010.106 not systemdict /setsmoothness known and { 0.0001 setsmoothness } if composite? { /DataSource getdatasrc def Matrix concat currentdict end shfill }{ AIColorSpace makesmarks AIPlateList markingplate and not isoverprint and { end }{ /ColorSpace /DeviceGray store /Decode [0 1 0 1 0 1] store /DataSource getplatesrc def Matrix concat currentdict end shfill } ifelse } ifelse } ifelse } def /shadingdict 12 dict def shadingdict begin /ShadingType 6 def /BitsPerCoordinate 16 def /BitsPerComponent 8 def /BitsPerFlag 8 def end /datafile null def /databuf 256 string def /dataptr 0 def /srcspace null def /srcchannels 0 def /dstchannels 0 def /dstplate 0 def /srctodstcolor null def /getplatesrc { /srcspace AIColorSpace store /srcchannels AIColorSpace getnchannels store /dstchannels 1 store /dstplate getplateindex store /srctodstcolor srcspace makesmarks { dstplate 4 eq { {1 exch sub} }{ {srcspace tocmyk 3 dstplate sub index 1 exch sub 5 1 roll 4 {pop} repeat} } ifelse }{ {srcchannels {pop} repeat 1} } ifelse store /datafile getdatasrc store /rdpatch168 load DataLength () /SubFileDecode filter } def /getdatasrc { /rdcmntline load /ASCII85Decode filter } def /rdpatch168 { /dataptr 0 store 49 rdcount 4 { dup {pop srcchannels getint8} if dup {pop srctodstcolor dstchannels putint8 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdpatch3216 { /dataptr 0 store 97 rdcount 4 { dup {pop srcchannels getint16} if dup {pop srctodstcolor dstchannels putint16 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdcount { dup 0 gt { datafile databuf dataptr 4 -1 roll getinterval readstring exch length dataptr add /dataptr exch store }{ true } ifelse } def /getint8 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 255 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint8 { dup dataptr add /dataptr exch store dataptr exch { 1 sub exch 255 mul cvi databuf 2 index 3 -1 roll put } repeat pop } def /getint16 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 256 mul datafile read} if dup {pop add 65535 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint16 { dup 2 mul dataptr add /dataptr exch store dataptr exch { 2 sub exch 65535 mul cvi dup 256 idiv databuf 3 index 3 -1 roll put 256 mod databuf 2 index 1 add 3 -1 roll put } repeat pop } def /srcbuf 256 string def /rdcmntline { currentfile srcbuf readline pop (%) anchorsearch {pop} if } def /getplateindex { 0 [cyan? magenta? yellow? black? customColor?] {{exit} if 1 add} forall } def /aicsarray 4 array def /aicsaltvals 4 array def /aicsaltcolr aicsaltvals def /tocolorspace { dup type /arraytype eq { mark exch aload pop aicsarray 0 3 -1 roll put aicsarray 1 3 -1 roll put dup aicsarray 2 3 -1 roll put gettintxform aicsarray 3 3 -1 roll put counttomark aicsaltvals 0 3 -1 roll getinterval /aicsaltcolr exch store aicsaltcolr astore pop pop aicsarray } if } def /subtintxform {aicsaltcolr {1 index mul exch} forall pop} def /addtintxform {aicsaltcolr {1 sub 1 index mul 1 add exch} forall pop} def /gettintxform { /DeviceRGB eq {/addtintxform}{/subtintxform} ifelse load } def /getnchannels { dup type /arraytype eq {0 get} if colorspacedict exch get begin Channels end } def /makesmarks { composite? { pop true }{ dup dup type /arraytype eq {0 get} if colorspacedict exch get begin MarksPlate end } ifelse } def /markingplate { composite? { pop true }{ dup type /arraytype eq { dup length getplateindex gt {getplateindex get}{pop false} ifelse } if } ifelse } def /tocmyk { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToCMYK end } def /topsspace { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToPSSpace end } def /colorspacedict 5 dict dup begin /DeviceGray 4 dict dup begin /Channels 1 def /MarksPlate {pop black?} def /ToCMYK {pop 1 exch sub 0 0 0 4 -1 roll} def /ToPSSpace {} def end def /DeviceRGB 4 dict dup begin /Channels 3 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop _rgbtocmyk} def /ToPSSpace {} def end def /DeviceCMYK 4 dict dup begin /Channels 4 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop} def /ToPSSpace {} def end def /Separation 4 dict dup begin /Channels 1 def /MarksPlate { /findcmykcustomcolor where { pop dup 1 exch ToCMYK 5 -1 roll 1 get findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace {} def end def /Process 4 dict dup begin /Channels 1 def /MarksPlate { isCMYKSep? { 1 exch ToCMYK 4 array astore getplateindex get 0 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace { 4 array copy dup 0 /Separation put } def end def end def /isoverprint { /currentoverprint where {pop currentoverprint}{_of} ifelse } def /version_ge_3010.106 { version {cvr} stopped { pop false }{ 3010.106 ge } ifelse } def end end defaultpacking setpacking userdict /_useSmoothShade false put userdict /_aicmykps false put userdict /_forceToCMYK false put Adobe_level2_AI5 /initialize get exec Adobe_cshow /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_shading_AI8 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla /hungarumlaut/ogonek/caron TE %AI55J_Tsume: None %AI3_BeginEncoding: _Times-Roman Times-Roman [/_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType [161/degree 173/notequal 176/infinity/plusminus/lessequal/greaterequal 181/mu/partialdiff/summation/product/pi/integral 189/Omega 195/radical 197/approxequal 198/Delta 214/divide/lozenge 240/apple /_Symbol_/Symbol 0 0 0 TZ %AI5_Begin_NonPrinting Np %AI3_BeginPattern: (Brick) (Brick) 0 0 72 72 [ %AI3_Tile (0 O 0 R 0.3 0.85 0.85 0 k 0.3 0.85 0.85 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 0 m 0 72 L 72 72 L 72 0 L 0 0 L f %AI6_EndPatternLayer ) & (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 68.4097 m 72 68.4097 l S 0 61.209 m 72 61.209 L S 0 54.0088 m 72 54.0088 L S 0 46.8076 m 72 46.8076 L S 0 39.6084 m 72 39.6084 L S 0 32.4072 m 72 32.4072 L S 0 25.207 m 72 25.207 L S 0 18.0059 m 72 18.0059 L S 0 10.8057 m 72 10.8057 L S 0 3.6064 m 72 3.6064 L S 68.4102 68.4097 m 68.4102 61.2217 l S 54.0098 68.4097 m 54.0098 61.2217 L S 39.6094 68.4097 m 39.6094 61.2217 L S 25.21 68.4097 m 25.21 61.2217 L S 10.8105 68.4097 m 10.8105 61.2217 L S 68.4102 53.9717 m 68.4102 46.7842 l S 54.0098 53.9717 m 54.0098 46.7842 L S 39.6094 53.9717 m 39.6094 46.7842 L S 25.21 53.9717 m 25.21 46.7842 L S 10.8105 53.9717 m 10.8105 46.7842 L S 68.4102 39.5967 m 68.4102 32.4092 l S 54.0098 39.5967 m 54.0098 32.4092 L S 39.6094 39.5967 m 39.6094 32.4092 L S 25.21 39.5967 m 25.21 32.4092 L S 10.8105 39.5967 m 10.8105 32.4092 L S 68.4102 25.2217 m 68.4102 18.0342 l S 54.0098 25.2217 m 54.0098 18.0342 L S 39.6094 25.2217 m 39.6094 18.0342 L S 25.21 25.2217 m 25.21 18.0342 L S 10.8105 25.2217 m 10.8105 18.0342 L S 68.4102 10.7842 m 68.4102 3.5967 l S 54.0098 10.7842 m 54.0098 3.5967 L S 39.6094 10.7842 m 39.6094 3.5967 L S 25.21 10.7842 m 25.21 3.5967 L S 10.8105 10.7842 m 10.8105 3.5967 L S 61.1973 3.5967 m 61.1973 0 L S 46.7969 3.5967 m 46.7969 0 L S 32.3965 3.5967 m 32.3965 0 L S 17.9971 3.5967 m 17.9971 0 L S 3.5967 3.5967 m 3.5967 0 l S 61.1973 18.0342 m 61.1973 10.8467 L S 46.7969 18.0342 m 46.7969 10.8467 L S 32.3965 18.0342 m 32.3965 10.8467 L S 17.9971 18.0342 m 17.9971 10.8467 L S 3.5967 18.0342 m 3.5967 10.8467 l S 61.1973 32.4092 m 61.1973 25.2217 L S 46.7969 32.4092 m 46.7969 25.2217 L S 17.9971 32.4092 m 17.9971 25.2217 L S 3.5967 32.4092 m 3.5967 25.2217 l S 61.1973 46.7842 m 61.1973 39.5967 L S 46.7969 46.7842 m 46.7969 39.5967 L S 32.3965 46.7842 m 32.3965 39.5967 L S 17.9971 46.7842 m 17.9971 39.5967 L S 3.5967 46.7842 m 3.5967 39.5967 l S 61.1973 61.2217 m 61.1973 54.0347 L S 46.7969 61.2217 m 46.7969 54.0347 L S 32.3965 61.2217 m 32.3965 54.0347 L S 17.9971 61.2217 m 17.9971 54.0347 L S 3.5967 61.2217 m 3.5967 54.0347 l S 61.1973 71.959 m 61.1973 68.4717 L S 46.7969 71.959 m 46.7969 68.4717 L S 32.3965 71.959 m 32.3965 68.4717 L S 17.9971 71.959 m 17.9971 68.4717 L S 3.5967 71.959 m 3.5967 68.4717 l S 32.3965 32.4092 m 32.3965 25.2217 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Confetti) (Confetti) 4.85 3.617 76.85 75.617 [ %AI3_Tile (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 4.85 3.617 m 4.85 75.617 L 76.85 75.617 L 76.85 3.617 L 4.85 3.617 L f %AI6_EndPatternLayer ) & (0 O 0 R 0 g 0 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 10.6 64.867 m 7.85 62.867 l S 9.1 8.617 m 6.85 6.867 l S 78.1 68.617 m 74.85 67.867 l S 76.85 56.867 m 74.35 55.117 l S 79.6 51.617 m 76.6 51.617 l S 76.35 44.117 m 73.6 45.867 l S 78.6 35.867 m 76.6 34.367 l S 76.1 23.867 m 73.35 26.117 l S 78.1 12.867 m 73.85 13.617 l S 68.35 14.617 m 66.1 12.867 l S 76.6 30.617 m 73.6 30.617 l S 62.85 58.117 m 60.956 60.941 l S 32.85 59.617 m 31.196 62.181 l S 47.891 64.061 m 49.744 66.742 l S 72.814 2.769 m 73.928 5.729 l S 67.976 2.633 m 67.35 5.909 l S 61.85 27.617 m 59.956 30.441 l S 53.504 56.053 m 51.85 58.617 l S 52.762 1.779 m 52.876 4.776 l S 45.391 5.311 m 47.244 7.992 l S 37.062 3.375 m 35.639 5.43 l S 55.165 34.828 m 57.518 37.491 l S 20.795 3.242 m 22.12 5.193 l S 14.097 4.747 m 15.008 8.965 l S 9.736 1.91 m 8.073 4.225 l S 31.891 5.573 m 32.005 8.571 l S 12.1 70.367 m 15.6 68.867 l S 9.35 54.867 m 9.6 58.117 l S 12.85 31.867 m 14.35 28.117 l S 10.1 37.367 m 12.35 41.117 l S 34.1 71.117 m 31.85 68.617 l S 38.35 71.117 m 41.6 68.367 l S 55.1 71.117 m 58.35 69.117 l S 57.35 65.117 m 55.35 61.867 l S 64.35 66.367 m 69.35 68.617 l S 71.85 62.867 m 69.35 61.117 l S 23.6 70.867 m 23.6 67.867 l S 20.6 65.867 m 17.35 65.367 l S 24.85 61.367 m 25.35 58.117 l S 25.85 65.867 m 29.35 66.617 l S 14.1 54.117 m 16.85 56.117 l S 12.35 11.617 m 12.6 15.617 l S 12.1 19.867 m 14.35 22.367 l S 26.1 9.867 m 23.6 13.367 l S 34.6 47.117 m 32.1 45.367 l S 62.6 41.867 m 59.85 43.367 l S 31.6 35.617 m 27.85 36.367 l S 36.35 26.117 m 34.35 24.617 l S 33.85 14.117 m 31.1 16.367 l S 37.1 9.867 m 35.1 11.117 l S 34.35 20.867 m 31.35 20.867 l S 44.6 56.617 m 42.1 54.867 l S 47.35 51.367 m 44.35 51.367 l S 44.1 43.867 m 41.35 45.617 l S 43.35 33.117 m 42.6 30.617 l S 43.85 23.617 m 41.1 25.867 l S 44.35 15.617 m 42.35 16.867 l S 67.823 31.1 m 64.823 31.1 l S 27.1 32.617 m 29.6 30.867 l S 31.85 55.117 m 34.85 55.117 l S 19.6 40.867 m 22.1 39.117 l S 16.85 35.617 m 19.85 35.617 l S 20.1 28.117 m 22.85 29.867 l S 52.1 42.617 m 54.484 44.178 l S 52.437 50.146 m 54.821 48.325 l S 59.572 54.133 m 59.35 51.117 l S 50.185 10.055 m 53.234 9.928 l S 51.187 15.896 m 53.571 14.075 l S 58.322 19.883 m 59.445 16.823 l S 53.1 32.117 m 50.6 30.367 l S 52.85 24.617 m 49.6 25.617 l S 61.85 9.117 m 59.1 10.867 l S 69.35 34.617 m 66.6 36.367 l S 67.1 23.617 m 65.1 22.117 l S 24.435 46.055 m 27.484 45.928 l S 25.437 51.896 m 27.821 50.075 l S 62.6 47.117 m 65.321 46.575 l S 19.85 19.867 m 20.35 16.617 l S 21.85 21.867 m 25.35 22.617 l S 37.6 62.867 m 41.6 62.117 l S 38.323 42.1 m 38.823 38.6 l S 69.35 52.617 m 66.85 53.867 l S 14.85 62.117 m 18.1 59.367 l S 9.6 46.117 m 7.1 44.367 l S 20.6 51.617 m 18.6 50.117 l S 46.141 70.811 m 47.994 73.492 l S 69.391 40.561 m 71.244 43.242 l S 38.641 49.311 m 39.35 52.117 l S 25.141 16.811 m 25.85 19.617 l S 36.6 32.867 m 34.6 31.367 l S 6.1 68.617 m 2.85 67.867 l S 4.85 56.867 m 2.35 55.117 l S 7.6 51.617 m 4.6 51.617 l S 6.6 35.867 m 4.6 34.367 l S 6.1 12.867 m 1.85 13.617 l S 4.6 30.617 m 1.6 30.617 l S 72.814 74.769 m 73.928 77.729 l S 67.976 74.633 m 67.35 77.909 l S 52.762 73.779 m 52.876 76.776 l S 37.062 75.375 m 35.639 77.43 l S 20.795 75.242 m 22.12 77.193 l S 9.736 73.91 m 8.073 76.225 l S 10.1 23.617 m 6.35 24.367 l S 73.217 18.276 m 71.323 21.1 l S 28.823 39.6 m 29.505 42.389 l S 49.6 38.617 m 47.6 37.117 l S 60.323 73.6 m 62.323 76.6 l S 60.323 1.6 m 62.323 4.6 l S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Leaves - Fall ) (Leaves - Fall ) 0 0 64.0781 78.9336 [ %AI3_Tile (0 O 0 R 0.05 0.2 1 0 k 0.05 0.2 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 64.0781 78.9336 m 64.0781 0 L 0 0 L 0 78.9336 L 64.0781 78.9336 L f %AI6_EndPatternLayer ) & (0 O 0 R 0.83 0 1 0 k 0.83 0 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 1 D 0 XR 29.7578 0.9902 m 30.4346 1.1914 30.7246 1.3428 V 29.2559 4.0547 33.707 8.3359 34.627 9.0762 C 35.2275 8.8506 35.3477 6.3184 34.6699 4.9805 C 35.5137 5.1035 37.7031 3.7256 38.4609 2.4365 C 38.5254 3.125 40.0957 6.0664 40.9219 6.4434 C 40.002 6.8408 39.3359 8.3135 38.5742 9.7617 C 39.5957 9.9287 40.9961 9.0078 42.4668 8.1025 C 42.9814 8.9043 44.3555 9.875 45.6143 10.3916 C 44.5264 11.0781 44.0313 11.8203 43.5352 13.2793 C 42.4922 12.7139 40.3057 12.5645 39.7764 12.8516 C 40.291 13.9648 42.5371 14.5078 43.2676 14.4551 C 43.0137 15.3164 42.8652 17.4697 43.0391 20.0625 C 41.3789 18.7461 39.834 17.4297 38.1738 17.4883 C 38.4434 16.0664 37.8076 14.2607 37.4307 13.7676 C 36.8574 14.5117 36.4463 15.3389 36.8008 17.3164 C 35.3486 17.8008 34.1113 18.3467 32.7373 19.6045 C 32.7373 17.7734 32.166 16.5723 31.2969 15.2959 C 32.5576 14.8076 33.8301 13.6045 33.8252 12.5664 C 32.9775 12.7178 31.2852 13.4619 30.793 14.4551 C 30.0742 13.707 28.3906 12.3984 26.7871 12.3945 C 27.9746 11.5391 28.8945 10.5059 28.9893 8.5938 C 30.2422 9.5645 32.6953 10.1797 34.0752 9.582 C 29.2344 5.3457 29.7031 2.3125 29.7578 0.9902 C f 13.8525 29.9844 m 13.3281 29.5127 13.1309 29.25 V 15.623 27.4326 13.3691 21.6074 12.8555 20.5439 C 12.2168 20.4883 10.8096 23.2285 10.8457 24.7266 C 9.7129 23.9707 8.0488 24.0918 6.4463 24.3779 C 7.0186 23.2891 6.6172 21.3447 5.8164 20.5439 C 6.8184 20.5801 8.1699 19.8652 9.4785 18.8838 C 8.6436 18.0645 6.8164 18.2246 4.9004 18.8838 C 4.9004 17.5107 4.0781 15.7734 3.2412 14.5918 C 4.5576 14.6484 5.7031 13.9629 6.5605 12.9316 C 7.2256 14.5 9.2598 15.6133 10.166 15.5645 C 10.1826 14.1992 8.6094 12.1094 7.5879 11.7109 C 8.1875 11.041 9.207 9.5107 10.166 7.0947 C 10.9648 9.0205 12.1348 10.2627 13.3672 11.1953 C 12.2256 12.7578 12.3994 13.6289 12.7988 15.1074 C 13.541 14.5664 14.5723 14.1338 14.7441 12.1309 C 16.4609 12.416 17.5957 12.3447 19.0938 11.4434 C 18.6387 13.1055 18.6348 14.707 18.9551 16.4063 C 17.1055 16.2666 15.5449 16.4795 14.5156 17.9688 C 15.3457 18.1953 17.6055 18.2549 18.4795 17.3223 C 18.8066 18.3047 19.7012 19.7109 21.1475 20.4043 C 19.707 20.6641 18.7227 21.7637 17.8135 23.4492 C 17.1006 22.0332 14.873 20.3691 13.3711 20.3145 C 15.373 24.3779 15.373 27.2959 13.8525 29.9844 C f 41.2324 26.0742 m 41.5518 26.7021 41.7549 26.959 V 44.1523 25.0176 48.958 28.3262 49.8535 29.0957 C 49.7432 29.7266 47.6182 30.8643 45.9004 29.834 C 46.3408 31.123 45.4395 33.084 44.2402 34.126 C 45.9805 34.0254 48.126 35.3867 48.6484 36.1289 C 48.8701 35.1514 50.0527 33.8809 51.3379 32.8672 C 51.6895 33.8398 50.9941 35.958 50.0781 37.5605 C 51.3125 38.0605 52.4248 38.9912 52.8828 40.25 C 53.3398 38.9336 54.3428 38.2598 55.6875 37.5039 C 54.5273 36.0762 53.7471 33.9023 54.0273 33.0391 C 55.3496 33.374 56.9209 36.0918 57.0439 37.1816 C 57.9189 36.415 59.4727 35.7285 62.0537 35.4219 C 60.3535 34.3438 59.9902 32.3516 59.4063 30.9219 C 58.2588 31.3682 56.0898 31.4277 55.1152 30.8643 C 55.8281 30.2852 57.168 29.7344 59.1777 29.7207 C 59.1777 28.1758 59.6406 27.043 60.8945 25.8281 C 59.1719 25.8418 57.0723 25.3555 55.5762 24.9629 C 55.3281 26.292 54.4844 27.8887 53.3398 28.2891 C 53.334 27.4277 53.5996 25.1797 54.4844 24.5117 C 53.6201 23.9443 52.3672 22.5674 51.9102 20.8496 C 51.2881 22.1758 50.4268 23.4805 48.5645 23.9238 C 49.749 24.9766 50.584 26.9941 50.25 28.4609 C 45.1973 24.4785 42.5215 25.7773 41.2324 26.0742 C f 27.7578 38.7324 m 28.4346 38.9316 28.7246 39.084 V 27.2559 41.7969 31.707 46.0776 32.627 46.8169 C 33.2275 46.5918 33.3477 44.0586 32.6699 42.7227 C 33.5137 42.8457 35.7031 41.4678 36.4609 40.1787 C 36.5254 40.8652 38.0957 43.8066 38.9219 44.1846 C 38.002 44.582 37.3359 46.0547 36.5742 47.5039 C 37.5957 47.6709 38.9961 46.7485 40.4668 45.8438 C 40.9814 46.6445 42.3555 47.6177 43.6143 48.1328 C 42.5264 48.8198 42.0313 49.5615 41.5352 51.0205 C 40.4922 50.4556 38.3057 50.3057 37.7764 50.5938 C 38.291 51.7056 40.5371 52.2485 41.2676 52.1958 C 41.0137 53.0576 40.8652 55.2109 41.0391 57.8037 C 39.3789 56.4878 37.834 55.1719 36.1738 55.2285 C 36.4434 53.8076 35.8076 52.002 35.4307 51.5088 C 34.8574 52.2529 34.4463 53.0796 34.8008 55.0576 C 33.3486 55.5425 32.1113 56.0879 30.7373 57.3467 C 30.7373 55.5146 30.166 54.314 29.2969 53.0366 C 30.5576 52.5488 31.8301 51.3467 31.8252 50.3076 C 30.9775 50.46 29.2852 51.2036 28.793 52.1958 C 28.0742 51.4497 26.3906 50.1396 24.7871 50.1357 C 25.9746 49.2817 26.8945 48.2466 26.9893 46.335 C 28.2422 47.3057 30.6953 47.9209 32.0752 47.3237 C 27.2344 43.0869 27.7031 40.0547 27.7578 38.7324 C f 13.5195 70.3916 m 12.9941 69.9209 12.7988 69.6587 V 15.2891 67.8418 13.0352 62.0146 12.5225 60.9517 C 11.8828 60.8955 10.4766 63.6367 10.5117 65.1348 C 9.3809 64.3789 7.7148 64.4995 6.1133 64.7856 C 6.6855 63.6987 6.2842 61.7529 5.4834 60.9517 C 6.4854 60.9878 7.8359 60.2729 9.1455 59.2925 C 8.3105 58.4717 6.4834 58.6338 4.5674 59.2925 C 4.5674 57.9189 3.7461 56.1816 2.9082 54.9995 C 4.2246 55.0576 5.3691 54.3706 6.2275 53.3408 C 6.8926 54.9097 8.9258 56.0215 9.832 55.9727 C 9.8496 54.6079 8.2764 52.5176 7.2539 52.1187 C 7.8545 51.4497 8.873 49.9189 9.832 47.5039 C 10.6309 49.4297 11.8008 50.6719 13.0342 51.6045 C 11.8926 53.1655 12.0664 54.0366 12.4648 55.5146 C 13.209 54.9746 14.2393 54.5415 14.4102 52.5386 C 16.127 52.8247 17.2637 52.7529 18.7598 51.8525 C 18.3057 53.5137 18.3027 55.1147 18.623 56.8149 C 16.7725 56.6748 15.2129 56.8887 14.1826 58.377 C 15.0117 58.6035 17.2725 58.6626 18.1465 57.731 C 18.4736 58.7129 19.3691 60.1187 20.8145 60.8125 C 19.375 61.0728 18.3896 62.1719 17.4805 63.8579 C 16.7676 62.4429 14.541 60.7769 13.0371 60.7227 C 15.041 64.7856 15.041 67.7046 13.5195 70.3916 C f 41.2324 64.4824 m 41.5518 65.1113 41.7549 65.3682 V 44.1523 63.4272 48.958 66.7354 49.8535 67.5034 C 49.7432 68.1362 47.6182 69.2725 45.9004 68.2422 C 46.3408 69.5313 45.4395 71.4922 44.2402 72.5342 C 45.9805 72.4341 48.126 73.7954 48.6484 74.5371 C 48.8701 73.5601 50.0527 72.29 51.3379 71.2754 C 51.6895 72.249 50.9941 74.3662 50.0781 75.9683 C 51.3125 76.4692 52.4248 77.3994 52.8828 78.6582 C 53.3398 77.3423 54.3428 76.667 55.6875 75.9111 C 54.5273 74.4844 53.7471 72.3101 54.0273 71.4473 C 55.3496 71.7822 56.9209 74.5 57.0439 75.5903 C 57.9189 74.8232 59.4727 74.1372 62.0537 73.8311 C 60.3535 72.7534 59.9902 70.7612 59.4063 69.3301 C 58.2588 69.7773 56.0898 69.8364 55.1152 69.2725 C 55.8281 68.6934 57.168 68.1431 59.1777 68.1284 C 59.1777 66.583 59.6406 65.4512 60.8945 64.2373 C 59.1719 64.249 57.0723 63.7632 55.5762 63.3721 C 55.3281 64.7002 54.4844 66.2974 53.3398 66.6973 C 53.334 65.8364 53.5996 63.5874 54.4844 62.9214 C 53.6201 62.353 52.3672 60.9751 51.9102 59.2583 C 51.2881 60.583 50.4268 61.8882 48.5645 62.333 C 49.749 63.3862 50.584 65.4033 50.25 66.8691 C 45.1973 62.8872 42.5215 64.1851 41.2324 64.4824 C f %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Stripes) (Stripes) 8.45 4.6001 80.45 76.6001 [ %AI3_Tile (0 O 0 R 1 0.07 1 0 k 1 0.07 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 3.6 w 4 M []0 d %AI3_Note: 0 D 0 XR 8.2 8.2 m 80.7 8.2 L S 8.2 22.6001 m 80.7 22.6001 L S 8.2 37.0002 m 80.7 37.0002 L S 8.2 51.4 m 80.7 51.4 L S 8.2 65.8001 m 80.7 65.8001 L S 8.2 15.4 m 80.7 15.4 L S 8.2 29.8001 m 80.7 29.8001 L S 8.2 44.2 m 80.7 44.2 L S 8.2 58.6001 m 80.7 58.6001 L S 8.2 73.0002 m 80.7 73.0002 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_BeginBrushPattern (New Pattern 1) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7834.75 8587 m -7834.75 8563 L -7884.75 8563 L -7884.75 8587 L -7834.75 8587 L n u 0 Ap 0 O 1 g -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C F -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C F -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C F -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C F -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C F -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C F -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C F -7844.7817 8565.125 m -7850.9009 8563.6162 -7854.7817 8565.125 V -7858.877 8563.6484 -7864.7817 8565.125 V -7869.7446 8563.4492 -7874.7817 8565.125 V -7880.7969 8563.5742 -7884.7817 8565.125 V -7884.7817 8584.8096 L -7881.6958 8585.7842 -7878.2969 8585.9912 -7874.3799 8584.9082 C -7868.2134 8586.4912 -7864.4634 8584.9082 V -7859.4634 8586.4912 -7854.3799 8584.8242 V -7850.0474 8586.4082 -7844.3799 8584.9082 V -7838.8799 8586.3242 -7834.7817 8585.125 V -7834.7817 8565.4404 L -7837.5254 8564.4287 -7840.6514 8563.9287 -7844.7817 8565.125 C f 0 R 0 G 1 J 1 j 0.5 w -7864.75 8585 m -7872.54 8586.9473 -7878.813 8583.585 -7884.75 8579.0488 C S -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C S -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C S -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C S -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C S -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C S -7854.75 8565 m -7846.96 8563.0527 -7840.687 8566.415 -7834.75 8570.9512 C S -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C S -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C S U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 2) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7819.187 8586 L -7819.187 8521.9023 L -7884 8521.9023 L -7884 8586 L n u 0 O 0 g -7849.6978 8544.4297 m -7851.6094 8521.9023 L -7853.5215 8544.4297 L -7852.9033 8544.3066 -7852.2642 8544.2402 -7851.6094 8544.2402 c -7850.9551 8544.2402 -7850.3159 8544.3066 -7849.6978 8544.4297 C f -7861.2402 8552.3975 m -7884 8554.3301 L -7861.1138 8556.2734 L -7861.2856 8555.5469 -7861.3848 8554.793 -7861.3848 8554.0156 c -7861.3848 8553.4629 -7861.3281 8552.9248 -7861.2402 8552.3975 C f -7856.519 8545.5723 m -7870.1626 8536.8047 L -7860.2153 8549.377 L -7859.3574 8547.791 -7858.0718 8546.4766 -7856.519 8545.5723 C f -7853.481 8563.6074 m -7851.5786 8586 L -7849.6768 8563.5967 L -7850.3018 8563.7227 -7850.9473 8563.791 -7851.6094 8563.791 c -7852.25 8563.791 -7852.873 8563.7246 -7853.481 8563.6074 C f -7841.9609 8555.5068 m -7819.187 8553.5732 L -7842.083 8551.6289 L -7842.083 8551.8506 L -7841.9258 8552.5488 -7841.834 8553.2695 -7841.834 8554.0156 c -7841.834 8554.5234 -7841.8848 8555.0195 -7841.9609 8555.5068 C f -7860.1138 8558.8262 m -7870.1641 8571.5293 L -7856.2778 8562.6055 L -7857.8823 8561.7305 -7859.2114 8560.416 -7860.1138 8558.8262 C f -7842.9961 8549.3945 m -7832.875 8536.6055 L -7846.7666 8545.5313 L -7845.1768 8546.4414 -7843.8633 8547.7793 -7842.9961 8549.3945 C f -7846.6895 8562.4512 m -7832.873 8571.3281 L -7842.9658 8558.5732 L -7843.8198 8560.1895 -7845.1152 8561.5313 -7846.6895 8562.4512 C f -7842.8887 8558.6133 m -7842.3862 8557.6641 -7842.043 8556.6211 -7841.875 8555.5195 c -7841.7993 8555.0293 -7841.748 8554.5273 -7841.748 8554.0156 c -7841.748 8553.2637 -7841.8398 8552.5352 -7841.998 8551.8311 c -7842.1958 8550.957 -7842.5049 8550.124 -7842.918 8549.3545 c -7843.7954 8547.7246 -7845.1191 8546.374 -7846.7241 8545.4561 c -7847.6294 8544.9375 -7848.6226 8544.5537 -7849.6802 8544.3457 c -7850.3047 8544.2207 -7850.9497 8544.1523 -7851.6094 8544.1523 c -7852.2695 8544.1523 -7852.915 8544.2207 -7853.5391 8544.3457 c -7854.623 8544.5605 -7855.6382 8544.957 -7856.5625 8545.4961 c -7858.1313 8546.4102 -7859.4282 8547.7363 -7860.291 8549.335 c -7860.7969 8550.2695 -7861.145 8551.2969 -7861.3262 8552.3828 c -7861.415 8552.916 -7861.4727 8553.459 -7861.4727 8554.0156 c -7861.4727 8554.8008 -7861.3711 8555.5605 -7861.1978 8556.293 c -7860.981 8557.207 -7860.6406 8558.0732 -7860.187 8558.8701 c -7859.2793 8560.4727 -7857.939 8561.8008 -7856.3174 8562.6826 c -7855.4487 8563.1553 -7854.5 8563.498 -7853.4961 8563.6934 c -7852.8848 8563.8115 -7852.2554 8563.8779 -7851.6094 8563.8779 c -7850.9414 8563.8779 -7850.29 8563.8086 -7849.6602 8563.6826 c -7848.5786 8563.4668 -7847.5664 8563.0654 -7846.6455 8562.5273 c -7845.0566 8561.5977 -7843.751 8560.2441 -7842.8887 8558.6133 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 3) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7874.75 8587 m -7874.75 8563 L -7884.75 8563 L -7884.75 8587 L -7874.75 8587 L n u u 0 Ap 0 O 1 g -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 c -7877.897 8566.9736 -7881.0898 8565 -7884.75 8565 C -7884.75 8585 L -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 c -7881.9121 8584.7754 -7880.1807 8584.0645 -7878.7441 8582.9824 c -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 c f 0 R 0 G 1 J 1 j 0.5 w -7884.75 8565.3174 m -7881.7207 8566.2744 -7878.8926 8567.9326 -7876.1543 8569.9072 C S -7884.75 8570.9512 m -7881.5991 8573.3564 -7878.543 8576.0869 -7875.4058 8578.5361 C S -7878.7441 8582.9824 m -7880.8105 8581.8916 -7882.7993 8580.5342 -7884.75 8579.043 C S -7883.8018 8584.9521 m -7884.1191 8584.8682 -7884.4375 8584.7852 -7884.75 8584.6865 C S -7878.7441 8582.9824 m -7880.1807 8584.0645 -7881.9121 8584.7744 -7883.8018 8584.9521 C S -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 C S -7884.75 8585 m -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 C S -7878.7441 8582.9824 m -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 C S -7876.1543 8569.9072 m -7877.8975 8566.9736 -7881.0898 8565 -7884.75 8565 C S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 5) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7726.3994 8587 m -7726.3994 8573.4199 L -7885 8573.4199 L -7885 8587 L -7726.3994 8587 L n u u 0 O 0.285 0.228 0.171 0 k -7741.0786 8585.4844 m -7741.043 8586.6895 L -7727.5103 8587.5176 -7726.8418 8586.2822 v -7726.7441 8586.1016 -7726.647 8585.7148 -7726.561 8585.1934 C -7728.584 8585.8242 -7738.291 8585.5713 -7741.0786 8585.4844 C f 0.44 0.352 0.264 0 k -7741.4063 8574.0234 m -7741.3711 8575.2676 L -7738.4912 8575.0488 -7728.1914 8574.3164 -7726.543 8574.8652 C -7726.7031 8574.2188 -7726.9199 8573.7646 -7727.2046 8573.6152 c -7728.8306 8572.7656 -7741.4063 8574.0234 Y f 0.145 0.116 0.087 0 k -7741.3711 8575.2676 m -7741.0786 8585.4844 L -7738.291 8585.5713 -7728.584 8585.8242 -7726.561 8585.1934 C -7726.1519 8582.7773 -7725.9258 8577.3604 -7726.543 8574.8652 C -7728.1914 8574.3164 -7738.4912 8575.0488 -7741.3711 8575.2676 C f U u 0.155 0.124 0.093 0 k -7766.9375 8579.2734 m -7765.897 8579.6563 L -7747.0728 8575.1465 L -7747.481 8574.3145 L -7766.3633 8576.7246 L -7767.252 8577.0059 L -7767.6504 8576.8936 -7768.1934 8576.8242 V -7767.6094 8577.2373 -7767.1426 8578.1406 -7766.9375 8579.2734 C f u 0.085 0.068 0.051 0 k -7771.7993 8583.666 m -7772.5977 8583.7217 -7769.749 8583.6641 Y -7770.3481 8583.0176 -7770.771 8581.8203 -7770.8105 8580.4375 c -7770.8169 8580.2246 -7770.8105 8580.0176 -7770.7993 8579.8135 C -7771.041 8579.707 -7771.0918 8579.7734 -7771.6289 8579.5645 C -7771 8583.6113 -7771.7993 8583.666 v f 0.305 0.244 0.183 0 k -7770.3442 8576.8672 m -7770.5527 8576.8105 -7770.4937 8578.9307 Y -7769.4785 8579.7588 L -7767.8359 8578.9434 L -7766.9375 8579.2734 L -7767.1426 8578.1406 -7767.6094 8577.2373 -7768.1934 8576.8242 C -7768.6094 8576.7715 -7769.874 8576.7998 -7770.3442 8576.8672 C f U 0.115 0.092 0.069 0 k -7766.9375 8579.2734 m -7767.8359 8578.9434 L -7769.4785 8579.7588 L -7770.4937 8578.9307 L -7770.793 8579.708 -7770.7993 8579.8135 V -7769.5137 8580.3789 -7768.1831 8580.7402 -7766.8398 8580.9258 C -7766.79 8580.7275 -7766.7842 8580.543 -7766.79 8580.3369 c -7766.7998 8579.9717 -7766.8218 8579.6182 -7766.9375 8579.2734 C f 0.41 0.328 0.246 0 k -7747.4512 8575.3965 m -7749.377 8576.6426 -7758.3862 8582.0986 -7766.8398 8580.9258 C -7766.9038 8582.0928 -7767.248 8583.0908 -7767.75 8583.6631 C -7767.1895 8583.6621 L -7746.7402 8586.7559 L -7747.0366 8576.4258 L -7747.0728 8575.1465 L -7747.2046 8575.2373 -7747.4512 8575.3965 v f 0.395 0.316 0.237 0 k -7770.8105 8580.4375 m -7770.771 8581.8203 -7770.3481 8583.0176 -7769.749 8583.6641 C -7767.6807 8583.6631 L -7767.1782 8583.0908 -7766.8218 8582.0713 -7766.8398 8580.9258 C -7768.1831 8580.7402 -7769.5137 8580.3789 -7770.7993 8579.8135 C -7770.8105 8580.0176 -7770.8169 8580.2246 -7770.8105 8580.4375 c f U u 0 0 0 0.11 k -7741.2642 8574.2012 m -7740.2407 8574.0352 L -7741.2642 8574.2012 L -7741.2642 8574.2012 L f 0 0 0 0.34 k -7747.481 8574.3145 m -7747.0728 8575.1465 L -7745.6714 8574.918 L -7744.5234 8574.7314 L -7742.6758 8574.4307 L -7741.2642 8574.2012 L -7740.2407 8574.0352 L -7740.2954 8573.7168 -7740.3672 8573.498 -7740.4648 8573.4199 C -7747.481 8574.3145 L f 0 0 0 0.32 k -7745.8042 8579.207 m -7746.041 8586.8613 L -7740.7144 8587 L -7739.7266 8583.5146 -7740.1816 8579.1543 V -7745.8042 8579.207 L f U 0.025 0.02 0.015 0 k -7739.3223 8576.3848 m -7736.373 8576.9199 -7733.2402 8577.1602 -7730.3159 8576.3613 c -7730.2856 8576.3496 -7730.2754 8576.3184 -7730.2871 8576.2969 c -7730.2881 8576.2656 -7730.3198 8576.2559 -7730.3418 8576.2559 c -7733.2422 8577.0645 -7736.375 8576.8242 -7739.3042 8576.2783 c -7739.3262 8576.2793 -7739.3574 8576.291 -7739.3672 8576.3223 c -7739.3662 8576.3438 -7739.355 8576.375 -7739.3223 8576.3848 c -7739.3223 8576.3848 l f -7737.8374 8575.3076 m -7737.7295 8575.3789 -7737.6313 8575.4941 -7737.5234 8575.502 c -7733.7886 8575.832 -7730.1631 8575.7813 -7726.4746 8575.6641 c -7726.4526 8575.6641 -7726.4209 8575.6426 -7726.4214 8575.6211 c -7726.4214 8575.5879 -7726.4551 8575.5684 -7726.4766 8575.5684 c -7729.3223 8575.6816 -7732.1401 8575.6992 -7735.0039 8575.5352 c -7735.9336 8575.4766 -7736.9082 8575.7402 -7737.7778 8575.2207 c -7737.7993 8575.2109 -7737.8306 8575.2109 -7737.8506 8575.2334 c -7737.8618 8575.2559 -7737.8594 8575.2871 -7737.8374 8575.3076 c -7737.8374 8575.3076 l f -7733.373 8577.3672 m -7731.5098 8578.6797 -7729.3022 8579.374 -7727.1001 8579.8867 c -7727.0679 8579.8965 -7727.0474 8579.8848 -7727.0366 8579.8535 c -7727.0273 8579.8203 -7727.0488 8579.8008 -7727.0703 8579.79 c -7729.2617 8579.2656 -7731.459 8578.6035 -7733.3105 8577.2803 c -7733.3433 8577.2598 -7733.375 8577.2715 -7733.3848 8577.293 c -7733.4058 8577.3145 -7733.3945 8577.3457 -7733.373 8577.3672 c -7733.373 8577.3672 l f -7738.9321 8584.0566 m -7736.7295 8584.5703 -7734.5298 8585.0303 -7732.2798 8585.2754 c -7732.2598 8585.2852 -7732.229 8585.2637 -7732.229 8585.2422 c -7732.2183 8585.209 -7732.2407 8585.1777 -7732.2729 8585.1787 c -7734.5122 8584.8809 -7736.7305 8584.5176 -7738.9126 8583.9502 c -7738.9351 8583.9512 -7738.9673 8583.9629 -7738.9766 8583.9941 c -7738.9751 8584.0156 -7738.9648 8584.0479 -7738.9321 8584.0566 c -7738.9321 8584.0566 l f -7738.439 8583.3604 m -7736.3457 8584.1973 -7734.1016 8583.9297 -7731.9023 8583.9629 c -7731.8706 8583.9609 -7731.8496 8583.9395 -7731.8506 8583.9082 c -7731.8521 8583.875 -7731.873 8583.8555 -7731.8945 8583.8555 c -7734.0928 8583.8438 -7736.3374 8584.0996 -7738.4209 8583.2529 c -7738.4434 8583.2539 -7738.4746 8583.2656 -7738.4834 8583.2969 c -7738.4834 8583.3184 -7738.4722 8583.3506 -7738.439 8583.3604 c -7738.439 8583.3604 l f -7737.707 8584.7051 m -7736.3833 8584.752 -7735.1504 8584.5469 -7733.8271 8584.209 c -7733.3594 8584.0996 -7732.9199 8584.2266 -7732.4609 8584.2129 c -7731.897 8584.1973 l -7731.874 8584.1963 -7731.8633 8584.1855 -7731.8535 8584.1738 c -7731.834 8584.1523 -7731.8442 8584.1211 -7731.8662 8584.0996 c -7732.0625 8583.9453 l -7732.0742 8583.9453 -7732.085 8583.9355 -7732.0962 8583.9355 c -7732.5 8583.9473 l -7733.9551 8584.1914 -7735.457 8584.6719 -7736.8926 8584.0742 c -7736.9258 8584.0645 -7736.957 8584.0859 -7736.9673 8584.1074 c -7736.9673 8584.1396 -7736.9551 8584.1602 -7736.9336 8584.1709 c -7735.647 8584.6992 -7734.1714 8584.4756 -7732.8818 8584.0547 c -7732.0918 8584.043 L -7732.124 8584.0332 L -7731.9282 8584.1875 L -7731.8984 8584.0898 L -7732.4639 8584.1064 l -7732.9321 8584.1406 -7733.3848 8583.9834 -7733.8398 8584.1035 c -7735.1543 8584.4609 -7736.3975 8584.625 -7737.71 8584.5986 c -7737.7422 8584.5996 -7737.7642 8584.6211 -7737.7617 8584.6533 c -7737.7617 8584.6855 -7737.7402 8584.7061 -7737.707 8584.7051 c -7737.707 8584.7051 l f -7738.5718 8585.0605 m -7735.8711 8586.2207 -7732.9023 8585.5703 -7730.1279 8585.1816 c -7729.7832 8585.2891 l -7729.7617 8585.2988 -7729.7417 8585.2871 -7729.7207 8585.2656 c -7729.71 8585.2441 -7729.7217 8585.2129 -7729.7422 8585.2021 c -7730.0801 8585.0098 l -7732.7754 8584.3926 -7735.5391 8584.7813 -7738.271 8584.7852 c -7738.3022 8584.7871 -7738.3232 8584.8086 -7738.3223 8584.8398 c -7738.3198 8584.8721 -7738.2983 8584.8926 -7738.2681 8584.8926 c -7735.6738 8584.9355 -7733.0303 8584.4434 -7730.4727 8585.0742 c -7729.7954 8585.2891 L -7729.7534 8585.1914 L -7730.1406 8585.0859 l -7732.9058 8585.4424 -7735.8418 8586.1348 -7738.5313 8584.9746 c -7738.5537 8584.9648 -7738.585 8584.9648 -7738.5962 8584.998 c -7738.6055 8585.0195 -7738.605 8585.0508 -7738.5718 8585.0605 c -7738.5718 8585.0605 l f -7735.6895 8578.3945 m -7734.3945 8578.9004 -7732.9834 8578.6465 -7731.6802 8578.3438 c -7731.647 8578.3418 -7731.6367 8578.3203 -7731.6382 8578.2891 c -7731.6504 8578.2568 -7731.6714 8578.2461 -7731.7031 8578.248 c -7732.998 8578.5303 -7734.377 8578.8154 -7735.6504 8578.2969 c -7735.6826 8578.2871 -7735.7144 8578.2988 -7735.7246 8578.3311 c -7735.7222 8578.3525 -7735.7114 8578.3848 -7735.6895 8578.3945 c -7735.6895 8578.3945 l f -7736.1401 8580.2207 m -7734.2266 8580.6895 -7732.3145 8581.1035 -7730.355 8581.3242 c -7730.3242 8581.334 -7730.3022 8581.3125 -7730.293 8581.2803 c -7730.2954 8581.2598 -7730.3159 8581.2285 -7730.3374 8581.2285 c -7732.2959 8581.0078 -7734.209 8580.582 -7736.1206 8580.1133 c -7736.1426 8580.1152 -7736.1738 8580.126 -7736.1831 8580.1582 c -7736.1831 8580.1797 -7736.1719 8580.2109 -7736.1401 8580.2207 c -7736.1401 8580.2207 l f -7736.9336 8582.6348 m -7734.499 8583.4609 -7731.8647 8583.0547 -7729.3457 8583.0879 c -7729.313 8583.0879 -7729.293 8583.0664 -7729.293 8583.0332 c -7729.2954 8583.0117 -7729.3159 8582.9922 -7729.3481 8582.9922 c -7731.8574 8582.916 -7734.481 8583.3848 -7736.8945 8582.5264 c -7736.9282 8582.5273 -7736.959 8582.5391 -7736.9688 8582.5605 c -7736.9678 8582.5918 -7736.9561 8582.624 -7736.9336 8582.6348 c -7736.9336 8582.6348 l f -7732.0542 8583.8496 m -7730.6582 8584.5449 -7729.0503 8584.4033 -7727.5342 8584.4668 c -7727.502 8584.4648 -7727.4824 8584.4434 -7727.4824 8584.4121 c -7727.4834 8584.3906 -7727.5054 8584.3594 -7727.5366 8584.3594 c -7729.0137 8584.2207 -7730.6489 8584.5234 -7732.0039 8583.7617 c -7732.0366 8583.7529 -7732.0679 8583.7637 -7732.0786 8583.7861 c -7732.0879 8583.8076 -7732.0767 8583.8398 -7732.0542 8583.8496 c -7732.0542 8583.8496 l f -7731.3418 8580.4248 m -7730.3926 8580.3975 -7729.4336 8580.3701 -7728.4839 8580.3428 c -7728.4526 8580.3418 -7728.4312 8580.3203 -7728.4336 8580.2881 c -7728.4336 8580.2559 -7728.4551 8580.2354 -7728.4878 8580.2363 c -7729.437 8580.2637 -7730.397 8580.291 -7731.3457 8580.3184 c -7731.377 8580.3184 -7731.3975 8580.3418 -7731.3975 8580.373 c -7731.397 8580.4043 -7731.374 8580.4258 -7731.3418 8580.4248 c -7731.3418 8580.4248 l f -7729.1592 8578.0361 m -7728.6895 8578.0645 -7728.209 8578.0723 -7727.7383 8578.0918 c -7727.7168 8578.0908 -7727.6855 8578.0684 -7727.6865 8578.0371 c -7727.687 8578.0039 -7727.71 8577.9844 -7727.7417 8577.9844 c -7728.2114 8577.9873 -7728.6816 8577.9375 -7729.1514 8577.9395 c -7729.1831 8577.9297 -7729.2031 8577.9512 -7729.2134 8577.9844 c -7729.2129 8578.0156 -7729.1914 8578.0371 -7729.1592 8578.0361 c -7729.1592 8578.0361 l f -7736.9702 8580.2344 m -7736.5688 8580.5107 -7736.125 8580.6797 -7735.645 8580.751 c -7735.6113 8580.7607 -7735.5918 8580.7383 -7735.5806 8580.7168 c -7735.5703 8580.6855 -7735.5928 8580.6543 -7735.6152 8580.6543 c -7736.0854 8580.5723 -7736.5176 8580.4023 -7736.9209 8580.1475 c -7736.9521 8580.1377 -7736.9849 8580.1387 -7736.9946 8580.1709 c -7737.0039 8580.1934 -7736.9922 8580.2246 -7736.9702 8580.2344 c -7736.9702 8580.2344 l f -7738.1904 8586.085 m -7735.7344 8586.5273 -7733.2983 8587.001 -7730.7993 8586.7266 c -7730.7778 8586.7266 -7730.7568 8586.7041 -7730.7578 8586.6719 c -7730.7578 8586.6406 -7730.7798 8586.6191 -7730.8022 8586.6191 c -7733.291 8586.873 -7735.7344 8586.4844 -7738.1719 8585.9775 c -7738.1934 8585.9785 -7738.2256 8585.9902 -7738.2344 8586.0215 c -7738.2344 8586.043 -7738.2222 8586.0752 -7738.1904 8586.085 c -7738.1904 8586.085 l f 0.195 0.156 0.117 0 k -7738.166 8574.6445 m -7735.7969 8574.2676 -7733.4058 8574.3477 -7731.0298 8574.5898 c -7730.998 8574.5879 -7730.9766 8574.5664 -7730.9766 8574.5352 c -7730.9785 8574.5137 -7731 8574.4824 -7731.0215 8574.4824 c -7733.4082 8574.2422 -7735.791 8574.1602 -7738.1694 8574.5391 c -7738.2026 8574.5391 -7738.2222 8574.5605 -7738.2217 8574.5938 c -7738.2207 8574.625 -7738.1992 8574.6465 -7738.166 8574.6445 c -7738.166 8574.6445 l f 0.335 0.268 0.201 0 k -7737.4351 8574.1113 m -7734.9282 8574.1152 -7732.4146 8574.2773 -7729.918 8573.8965 c -7729.8862 8573.8945 -7729.8647 8573.873 -7729.8662 8573.8418 c -7729.8672 8573.8086 -7729.8896 8573.7891 -7729.9209 8573.7891 c -7732.418 8574.1699 -7734.9297 8574.0293 -7737.4375 8574.0059 c -7737.46 8574.0059 -7737.481 8574.0273 -7737.4785 8574.0596 c -7737.4785 8574.0918 -7737.457 8574.1123 -7737.4351 8574.1113 c -7737.4351 8574.1113 l f 0.205 0.164 0.123 0 k -7738.9766 8574.3262 m -7737.5039 8574.668 -7736.0078 8574.4023 -7734.5391 8574.2207 c -7734.5078 8574.2207 -7734.4873 8574.1973 -7734.499 8574.166 c -7734.5 8574.1348 -7734.5215 8574.1133 -7734.5537 8574.125 c -7736.0103 8574.2842 -7737.4961 8574.583 -7738.9473 8574.2188 c -7738.9785 8574.2207 -7739.0103 8574.2324 -7739.0098 8574.2637 c -7739.019 8574.2852 -7738.998 8574.3164 -7738.9766 8574.3262 c -7738.9766 8574.3262 l f -7732.3535 8573.7949 m -7731.1978 8573.9219 -7730.0273 8573.8145 -7728.8926 8573.5898 c -7728.8711 8573.5781 -7728.8506 8573.5566 -7728.8618 8573.5244 c -7728.8623 8573.5029 -7728.8945 8573.4824 -7728.916 8573.4941 c -7730.0503 8573.7402 -7731.1914 8573.7939 -7732.3462 8573.6885 c -7732.3794 8573.6895 -7732.3984 8573.7109 -7732.4087 8573.7324 c -7732.4082 8573.7646 -7732.3862 8573.7852 -7732.3535 8573.7949 c -7732.3535 8573.7949 l f 0.335 0.268 0.201 0 k -7739.2681 8576.4473 m -7737.9214 8577.1885 -7736.3066 8576.5977 -7734.855 8576.6416 c -7734.8223 8576.6406 -7734.8022 8576.6191 -7734.8022 8576.5859 c -7734.8042 8576.5654 -7734.8262 8576.5449 -7734.8574 8576.5449 c -7736.2886 8576.4902 -7737.8823 8577.0801 -7739.2168 8576.3506 c -7739.2383 8576.3398 -7739.2695 8576.3516 -7739.291 8576.374 c -7739.3008 8576.3955 -7739.2886 8576.4277 -7739.2681 8576.4473 c -7739.2681 8576.4473 l f -7737.8945 8578.5645 m -7735.6719 8579.0449 -7733.3896 8578.6162 -7731.1504 8578.5625 c -7731.1177 8578.5615 -7731.0977 8578.5391 -7731.0977 8578.5078 c -7731.1001 8578.4863 -7731.1318 8578.4668 -7731.1519 8578.4668 c -7733.3833 8578.4775 -7735.6519 8578.9805 -7737.875 8578.457 c -7737.8975 8578.457 -7737.9287 8578.4688 -7737.9375 8578.502 c -7737.9375 8578.5225 -7737.9258 8578.5547 -7737.8945 8578.5645 c -7737.8945 8578.5645 l f -7732.0273 8575.1406 m -7730.3496 8575.9688 -7728.499 8576.502 -7726.603 8576.3613 c -7726.5718 8576.3613 -7726.5513 8576.3389 -7726.5527 8576.3066 c -7726.5527 8576.2754 -7726.5742 8576.2539 -7726.6074 8576.2559 c -7728.481 8576.416 -7730.3198 8575.8604 -7731.9873 8575.0547 c -7732.0078 8575.0449 -7732.041 8575.0449 -7732.0503 8575.0781 c -7732.061 8575.0996 -7732.061 8575.1309 -7732.0273 8575.1406 c -7732.0273 8575.1406 l f u 0.5 0.85 1 0.45 k -7885 8581.9082 m -7885.0254 8582.4883 -7884.5664 8583.1875 -7883.167 8583.9902 C -7882.8521 8584.0029 -7881.3945 8584.0234 -7879.0889 8584.0488 C -7879.0889 8581.8223 L -7881.1382 8581.8457 -7883.1177 8581.8867 -7885 8581.9082 C f -7884.5088 8580.9688 m -7879.0889 8580.8447 L -7879.0889 8579.8145 L -7882.644 8579.959 L -7883.8145 8580.3301 -7884.5088 8580.9688 V f 0.5 0.85 1 0.32 k -7879.0889 8580.8252 m -7884.4746 8580.9434 L -7884.7695 8581.2148 -7884.9849 8581.5566 -7885 8581.9277 C -7883.1177 8581.9063 -7881.1382 8581.8848 -7879.0889 8581.8613 C -7879.0889 8580.8252 L f 0.5 0.85 1 0.45 k -7774.1504 8580.6172 m -7852.3584 8581.541 -7879.1079 8581.8418 V -7879.1079 8584.0488 L -7862.8145 8584.2324 -7803.9902 8584.707 Y -7769.749 8583.6641 L -7770.457 8580.5684 L -7774.1504 8580.6172 L f 0.5 0.85 1 0.12 k -7879.1079 8579.8145 m -7879.1079 8580.8447 L -7770.4258 8579 L -7770.3833 8576.8633 L -7803.6553 8576.7129 L -7879.1079 8579.8145 L f u 0.065 0.052 0.039 0 k -7747.0728 8575.1465 m -7747.0366 8576.4258 L -7747.2954 8575.1172 L -7765.897 8579.6563 L -7766.9375 8579.2734 L -7766.8794 8579.6055 -7766.8398 8579.957 -7766.8306 8580.3223 c -7766.8242 8580.5283 -7766.8281 8580.7285 -7766.8398 8580.9258 C -7758.3862 8582.0986 -7748.9634 8577.6719 -7747.0366 8576.4258 C -7746.7402 8586.7559 L -7746.041 8586.8613 L -7745.8042 8579.207 L -7740.1816 8579.1543 L -7740.0898 8577.0137 -7740.0718 8575.0215 -7740.2407 8574.0352 C -7747.0728 8575.1465 L f 0.4 0.7 1 0 k -7770.457 8580.5879 m -7770.4258 8578.9805 L -7879.1079 8580.8252 L -7879.1079 8581.8613 L -7852.3584 8581.5605 -7770.457 8580.5879 Y f U U 0.025 0.02 0.015 0 k -7734.7344 8583.0293 m -7734.7344 8583.0625 -7734.7129 8583.082 -7734.6802 8583.082 c -7731.6714 8583.1133 -7729.4214 8582.9453 -7726.415 8582.8594 C -7726.4087 8582.7656 L -7729.3262 8582.8701 -7731.7607 8583.0078 -7734.6841 8582.9746 C -7734.7168 8582.9766 -7734.7358 8582.998 -7734.7344 8583.0293 C f -7726.3994 8582.7656 m -7726.4082 8582.7441 L -7726.4087 8582.7656 L -7726.4063 8582.7656 -7726.4033 8582.7656 -7726.3994 8582.7656 C f -7730.4487 8581.4238 m -7731.4458 8581.292 -7732.3394 8581.7656 -7733.2114 8582.1973 C -7733.2441 8582.208 -7733.2534 8582.2402 -7733.2422 8582.2715 C -7733.2305 8582.293 -7733.1982 8582.3027 -7733.1777 8582.291 c -7732.3262 8581.8301 -7731.4312 8581.4199 -7730.4678 8581.5195 c -7729.1079 8581.6621 -7727.9038 8582.375 -7726.5254 8582.4531 C -7726.4463 8582.3594 L -7728.04 8582.2656 -7728.8647 8581.623 -7730.4487 8581.4238 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 6) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.75 8563 m -7884.75 8587 L -7874.75 8587 L -7874.75 8563 L -7884.75 8563 L n 0 Ap 0 O 1 g -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 c -7877.5879 8565.2256 -7879.3198 8565.9346 -7880.7559 8567.0176 c -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 c -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.2319 8578.5996 -7883.3457 8580.0918 c -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C -7874.75 8565 L f 0 R 0 G 1 J 1 j 0.5 w -7874.75 8584.6816 m -7877.7793 8583.7256 -7880.6074 8582.0674 -7883.3457 8580.0918 C S -7874.75 8579.0488 m -7877.8999 8576.6436 -7880.957 8573.9131 -7884.0942 8571.4639 C S -7880.7559 8567.0176 m -7878.6904 8568.1084 -7876.7017 8569.4668 -7874.75 8570.957 C S -7875.6982 8565.0479 m -7875.3809 8565.1309 -7875.063 8565.2148 -7874.75 8565.3145 C S -7880.7559 8567.0176 m -7879.3193 8565.9355 -7877.5879 8565.2256 -7875.6982 8565.0479 C S -7884.0942 8571.4639 m -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.231 8578.5996 -7883.3457 8580.0918 C S -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 C S -7880.7559 8567.0176 m -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 C S -7883.3457 8580.0918 m -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C S U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 8) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.9521 8584.3125 m -7776.7954 8584.3125 L -7776.7954 8570.1855 L -7883.9521 8570.1855 L -7883.9521 8584.3125 L n u 0 O 0 0 0 1 k -7882.2832 8583.623 m -7882.8535 8586 -7882.8184 8582.0039 V -7883.0479 8578.8027 L -7883.6167 8576.4551 L -7883.4502 8574.123 L -7881.9502 8573.4551 -7865.2832 8572.123 V -7858.6167 8570.7891 -7849.6167 8570.7891 V -7784.3936 8571.4766 -7779.4912 8572.8848 v -7820.3882 8570.875 -7822.9688 8571.5117 v -7783.8569 8573.1602 -7780.8545 8574.4316 v -7818.79 8572.5469 -7822.167 8574.1777 v -7787.249 8575.9102 -7783.021 8577.5313 v -7789.7217 8576.8828 -7791.5127 8577.082 v -7788.3896 8577.5703 l -7793.4194 8577.502 l -7796.3218 8577.1289 l -7788.4521 8578.2422 -7787.9033 8578.8086 v -7784.3154 8578.1309 -7798.5186 8578.3848 v -7832.1177 8574.4551 -7882.2832 8583.623 V f /BBAccumRotation (5.805971) XT 0 R 0 0 0 0.5 K 0.025 w -7883.9502 8573.123 m -7863.667 8571.2949 -7843.9727 8570.2207 v -7801.1514 8570.502 -7796.5737 8570.9004 v -7784.1631 8571.0313 -7776.7959 8572.0273 v S /BBAccumRotation (5.805971) XT 0 0 0 1 K -7821.8369 8570.4082 m -7825.2959 8570.0273 -7851.2607 8570.2793 Y -7861.627 8570.1602 -7883.9502 8573.123 Y S /BBAccumRotation (5.805971) XT -7820.9873 8573.6641 m -7790.3608 8574.582 -7783.6606 8575.2324 v S /BBAccumRotation (5.805971) XT 0 0 0 0.5 K -7829.6201 8578.2051 m -7794.3706 8579.6172 -7791.4058 8580.1406 v S /BBAccumRotation (5.805971) XT U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 10) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7833.8921 8586 L -7833.8921 8529.9756 L -7884 8529.9756 L -7884 8586 L n u 0 O 0.1 1 1 0 k -7846.9014 8551.5752 m -7848.7178 8545.0957 -7858.8247 8548.4658 Y -7858.791 8548.5303 L -7868.8999 8545.1611 -7870.7144 8551.6396 V -7876.6758 8569.0068 -7871.4922 8575.7451 V -7864.7529 8585.3369 -7860.6055 8585.3369 V -7857.0103 8585.2705 L -7852.8638 8585.2705 -7846.125 8575.6816 Y -7840.9409 8568.9424 -7846.9014 8551.5752 Y f u 0 0 0 1 k -7851.3926 8529.9756 m -7852.1167 8531.4199 -7852.9238 8532.4756 V -7852.4058 8532.0635 -7851.5151 8531.1924 -7851.3926 8529.9756 C f -7865.064 8532.4854 m -7865.8711 8531.4307 -7866.5942 8529.9863 Y -7866.4727 8531.2021 -7865.582 8532.0732 -7865.064 8532.4854 C f U 0 0.61 0.74 0 k -7850.5977 8554.4609 m -7851.9038 8549.7959 -7859.1816 8552.2217 Y -7859.1567 8552.2686 L -7866.436 8549.8428 -7867.7417 8554.5078 V -7872.0337 8567.0117 -7868.3018 8571.8633 V -7863.4487 8578.7686 -7860.4634 8578.7686 V -7857.875 8578.7227 L -7854.8887 8578.7227 -7850.0366 8571.8174 Y -7846.3042 8566.9639 -7850.5977 8554.4609 Y f u 1 Ap 0.73 0.43 1 0.22 k 0 R 0 0 0 1 K -7854.6226 8557.2754 m -7853.813 8557.2754 -7853.1558 8556.6182 -7853.1558 8555.8096 c -7853.1558 8555 -7853.813 8554.3428 -7854.6226 8554.3428 c -7855.4321 8554.3428 -7856.0889 8555 -7856.0889 8555.8096 c -7856.0889 8556.6182 -7855.4321 8557.2754 -7854.6226 8557.2754 c b -7854.3638 8568.9971 m -7853.0806 8568.9971 -7852.0415 8568.1201 -7852.0415 8567.042 c -7852.0415 8565.9619 -7853.0806 8565.0869 -7854.3638 8565.0869 c -7855.645 8565.0869 -7856.6846 8565.9619 -7856.6846 8567.042 c -7856.6846 8568.1201 -7855.645 8568.9971 -7854.3638 8568.9971 c b -7853.834 8580.7861 m -7852.2817 8580.7861 -7851.0239 8580.1299 -7851.0239 8579.3213 c -7851.0239 8578.5117 -7852.2817 8577.8545 -7853.834 8577.8545 c -7855.3862 8577.8545 -7856.645 8578.5117 -7856.645 8579.3213 c -7856.645 8580.1299 -7855.3862 8580.7861 -7853.834 8580.7861 c b -7849.6104 8552.5264 m -7848.8687 8552.5264 -7848.2671 8551.8154 -7848.2671 8550.9365 c -7848.2671 8550.0596 -7848.8687 8549.3477 -7849.6104 8549.3477 c -7850.353 8549.3477 -7850.9546 8550.0596 -7850.9546 8550.9365 c -7850.9546 8551.8154 -7850.353 8552.5264 -7849.6104 8552.5264 c b -7848.0034 8574.083 m -7848.8818 8573.7354 -7849.1494 8572.335 -7848.603 8570.9541 c -7848.0566 8569.5752 -7846.9014 8568.7363 -7846.0234 8569.085 c -7845.145 8569.4326 -7844.877 8570.833 -7845.4233 8572.2139 c -7845.9702 8573.5947 -7847.125 8574.4316 -7848.0034 8574.083 c b u -7863.0566 8557.1592 m -7863.8662 8557.1592 -7864.5239 8556.502 -7864.5239 8555.6934 c -7864.5239 8554.8828 -7863.8662 8554.2266 -7863.0566 8554.2266 c -7862.248 8554.2266 -7861.5913 8554.8828 -7861.5913 8555.6934 c -7861.5913 8556.502 -7862.248 8557.1592 -7863.0566 8557.1592 c b -7863.3159 8568.8799 m -7864.5991 8568.8799 -7865.6382 8568.0049 -7865.6382 8566.9248 c -7865.6382 8565.8447 -7864.5991 8564.9697 -7863.3159 8564.9697 c -7862.0342 8564.9697 -7860.9951 8565.8447 -7860.9951 8566.9248 c -7860.9951 8568.0049 -7862.0342 8568.8799 -7863.3159 8568.8799 c b -7863.8457 8580.6709 m -7865.3975 8580.6709 -7866.6558 8580.0146 -7866.6558 8579.2041 c -7866.6558 8578.3936 -7865.3975 8577.7383 -7863.8457 8577.7383 c -7862.293 8577.7383 -7861.0352 8578.3936 -7861.0352 8579.2041 c -7861.0352 8580.0146 -7862.293 8580.6709 -7863.8457 8580.6709 c b -7868.0679 8552.4092 m -7868.811 8552.4092 -7869.4121 8551.6982 -7869.4121 8550.8213 c -7869.4121 8549.9443 -7868.811 8549.2334 -7868.0679 8549.2334 c -7867.3262 8549.2334 -7866.7241 8549.9443 -7866.7241 8550.8213 c -7866.7241 8551.6982 -7867.3262 8552.4092 -7868.0679 8552.4092 c b -7869.6758 8573.9678 m -7868.7983 8573.6201 -7868.5298 8572.2188 -7869.0762 8570.8379 c -7869.6226 8569.457 -7870.7778 8568.6201 -7871.6558 8568.9678 c -7872.5342 8569.3164 -7872.8032 8570.7178 -7872.2568 8572.0967 c -7871.7104 8573.4775 -7870.5552 8574.3154 -7869.6758 8573.9678 c b U U 0 Ap 0 0 0 1 k -7859.1318 8552.6553 m -7859.1318 8585.3145 l F u -7843.3906 8538.5303 m -7844.0815 8537.8369 -7847.019 8538.7021 Y -7848.229 8538.874 -7848.0562 8541.2939 Y -7847.019 8543.3682 -7847.7104 8543.1943 Y -7848.2998 8543.1943 -7849.855 8543.1143 -7850.7822 8543.0635 C -7851.1226 8541.6689 -7852.6128 8540.4756 -7854.7217 8539.7695 C -7852.7578 8536.4775 -7854.5176 8535.7949 -7856.2935 8535.79 C -7856.3096 8535.7021 -7856.332 8535.6162 -7856.3599 8535.5332 C -7854.1089 8535.5791 -7853.6392 8533.2588 Y -7853.4048 8533.0635 -7853.1606 8532.7861 -7852.9238 8532.4756 C -7853.1416 8532.6475 -7853.2944 8532.7393 Y -7854.2583 8532.7393 -7855.8774 8534.4941 -7856.4966 8535.207 C -7856.9194 8534.4434 -7857.853 8533.9111 -7858.9434 8533.9111 c -7860.0698 8533.9111 -7861.0322 8534.4795 -7861.4312 8535.2852 C -7861.9985 8534.624 -7863.6968 8532.751 -7864.6943 8532.751 C -7864.8462 8532.6572 -7865.064 8532.4854 V -7864.8281 8532.7939 -7864.583 8533.0732 -7864.3481 8533.2686 C -7863.8638 8535.6563 -7861.5254 8535.5342 V -7861.5449 8535.5889 -7861.5674 8535.6436 -7861.5806 8535.7021 C -7864.9238 8535.6924 -7863.937 8538.3174 -7863.2104 8539.6602 C -7865.5918 8540.376 -7867.2646 8541.7012 -7867.5239 8543.25 C -7868.4473 8543.2998 -7869.6729 8543.3584 -7870.1802 8543.3584 C -7870.8726 8543.5313 -7869.835 8541.458 V -7869.6626 8539.0391 -7870.8726 8538.8662 V -7873.8096 8538.002 -7874.501 8538.6934 V -7875.1919 8539.5566 -7876.0562 8538.3467 V -7875.1919 8540.0752 -7873.291 8539.5566 V -7870.6982 8538.8662 -7871.3906 8540.5938 V -7871.9087 8544.0498 -7870.1802 8544.7402 V -7868.0342 8545.8545 -7866.2822 8546.0889 V -7865.9087 8546.4141 -7865.4639 8546.7109 -7864.958 8546.9766 C -7867.5562 8547.0469 -7870.2246 8547.9209 -7871.0752 8550.9561 C -7871.5151 8552.2432 -7872.0518 8554.2432 V -7873.1025 8554.8252 -7874.3022 8556.0078 -7875.541 8558.2627 C -7876.394 8561.4502 -7877.167 8556.7129 V -7878.3975 8553.6494 -7879.6504 8553.5381 V -7878.4702 8555.2871 -7878.9038 8556.416 V -7877.2998 8560.917 -7875.6138 8559.8994 V -7874.0986 8559.2197 -7872.688 8556.8154 V -7873.0698 8558.4971 -7873.4326 8560.417 -7873.6743 8562.3906 C -7874.4888 8562.3975 L -7876.3506 8561.4795 -7876.3262 8564.959 V -7877.1226 8568.9453 -7876.3594 8571.6826 V -7875.647 8574.1504 -7878.1274 8572.9307 V -7879.2842 8573.3242 -7879.9839 8572.7881 V -7882.3882 8571.4131 -7884 8573.124 V -7882.147 8572.8799 -7881.4482 8573.417 V -7879.9785 8573.5615 -7879.897 8574.1787 V -7876.9561 8574.8555 -7876.188 8574.0771 V -7874.417 8573.2139 -7875.1304 8570.3604 V -7875.8799 8562.4814 -7874.3198 8564.4053 V -7874.1182 8564.4219 -7873.8784 8564.5176 V -7874.1519 8568.4326 -7873.8018 8572.3252 -7871.9961 8574.8516 C -7875.4536 8567.333 -7870.2974 8552.3037 Y -7868.9609 8547.5303 -7863.127 8548.1016 -7860.145 8548.7344 C -7860.0718 8550.1299 -7859.8374 8551.9492 -7859.1318 8552.6553 C -7858.2134 8550.6963 -7858.2358 8549.0732 V -7857.0762 8548.7217 -7850.2817 8546.8447 -7847.4487 8550.3369 C -7848.4312 8547.8135 -7850.8262 8547.0186 -7853.2007 8546.9189 C -7852.667 8546.6318 -7852.2041 8546.3047 -7851.8257 8545.9502 C -7850.041 8545.7861 -7847.7104 8544.5771 Y -7845.9814 8543.8857 -7846.5015 8540.4307 Y -7847.1919 8538.7021 -7844.5991 8539.3936 Y -7842.7002 8539.9111 -7841.835 8538.1836 Y -7842.7002 8539.3936 -7843.3906 8538.5303 Y f -7837.9082 8572.9521 m -7838.6074 8573.4893 -7839.7632 8573.0938 Y -7842.2446 8574.3135 -7841.5327 8571.8467 Y -7840.769 8569.1104 -7841.564 8565.1221 Y -7841.541 8561.6445 -7843.4014 8562.5596 Y -7844.0342 8562.5557 L -7844.3198 8560.6123 -7844.7046 8558.7549 -7845.0898 8557.1699 C -7843.7129 8559.4199 -7842.2778 8560.0635 Y -7840.5913 8561.082 -7838.9878 8556.5791 Y -7839.4214 8555.4502 -7838.2417 8553.7021 Y -7839.4937 8553.8125 -7840.7246 8556.876 Y -7841.4976 8561.6152 -7842.3511 8558.4268 Y -7843.5776 8556.1904 -7844.769 8555.0098 -7845.814 8554.4229 C -7846.2026 8553.0635 -7846.4858 8552.2393 Y -7846.7002 8551.4727 -7847.0337 8550.8486 -7847.4487 8550.3369 C -7847.3799 8550.5127 -7847.3174 8550.6982 -7847.2632 8550.8916 C -7841.3022 8568.2588 -7846.4858 8574.9971 V -7853.2246 8584.5869 -7857.3721 8584.5869 V -7860.9663 8584.6514 L -7865.1138 8584.6514 -7871.853 8575.0615 Y -7871.9038 8574.9961 -7871.9463 8574.9219 -7871.9961 8574.8516 C -7871.7378 8575.4141 -7871.437 8575.9404 -7871.0752 8576.4092 C -7864.3359 8586 -7860.189 8586 V -7856.5942 8585.9346 L -7852.4482 8585.9346 -7845.709 8576.3447 Y -7843.5801 8573.5771 -7843.3306 8569.0176 -7843.7769 8564.6055 C -7843.6553 8564.5752 -7843.5698 8564.5684 Y -7842.0112 8562.6475 -7842.7598 8570.5244 Y -7843.4746 8573.3789 -7841.7026 8574.2402 Y -7840.9351 8575.0186 -7837.9946 8574.3428 Y -7837.9136 8573.7256 -7836.4434 8573.5811 Y -7835.7446 8573.0449 -7833.8921 8573.2881 Y -7835.5024 8571.5771 -7837.9082 8572.9521 Y f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 34) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.0254 8586.0264 m -7828.0542 8586.0264 L -7828.0542 8524.5342 L -7884.0254 8524.5342 L -7884.0254 8586.0264 L n u u 0 O 0.0745 0.9 0.9019 0.18 k 0 R 0 0 0 1 K 1 J 1 j 0.0518 w -7857.5991 8562.7217 m -7857.3594 8573.5215 -7862.8794 8583.8398 v -7862.4009 8586 -7860.959 8586 v -7861.2002 8582.6406 -7860.2393 8582.1611 v -7855.9199 8570.1602 -7856.6382 8562.2402 v -7857.5991 8562.7217 l b -7857.5991 8562.7217 m -7859.2793 8568 -7871.0391 8569.2012 v -7875.3594 8569.6807 -7875.5991 8571.1211 v -7869.1206 8561.5195 -7868.1602 8561.7607 v -7881.3594 8556.001 -7884 8550.7197 v -7878.959 8553.6006 -7875.5991 8551.4404 v -7867.6802 8551.2012 -7862.6406 8553.3613 v -7858.8008 8555.2813 -7866.7202 8539.2012 v -7862.8794 8550.9609 -7859.2793 8524.5605 v -7858.3198 8529.8408 -7856.8799 8531.2813 v -7850.8799 8538.9609 -7851.8398 8541.1211 v -7852.3198 8544.9609 -7847.7598 8538.7207 v -7848 8548.3213 -7850.4009 8551.6807 v -7852.5591 8555.2813 -7846.5591 8553.1211 v -7840.5591 8551.2012 -7835.2793 8552.8809 v -7829.7598 8554.3203 -7828.0801 8551.4404 v -7839.8398 8563.9209 -7845.5991 8563.6807 v -7843.9194 8567.2813 l -7841.519 8572.0811 -7842 8573.2813 v -7857.2681 8563.8828 -7857.5991 8562.7217 v b -7857.5991 8562.7217 m -7854.959 8544.2402 -7857.5991 8536.5605 v -7859.998 8526.001 -7859.2793 8524.5605 v S -7856.1602 8551.4404 m -7850.1602 8546.6406 -7848.959 8541.3604 v S -7856.1602 8550.7197 m -7865.0391 8543.041 -7866.7202 8539.2012 v S -7828.0801 8551.4404 m -7829.2793 8553.6006 -7857.3594 8561.7607 y -7862.4009 8556.2422 -7873.9199 8553.8408 v -7881.5986 8552.8809 -7884 8550.7197 v S -7874.6382 8569.6807 m -7863.1191 8560.5615 -7857.3594 8561.7607 y -7843.1992 8568 -7842 8573.2813 v S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 36) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.8496 8585.9961 m -7833.96 8585.9961 L -7833.96 8534.9258 L -7883.8496 8534.9258 L -7883.8496 8585.9961 L n u 0 O 0.025 0.1 0.475 0 k -7862.1504 8553.9043 m -7864.4766 8552.8125 -7866.6914 8552.4434 -7868.373 8552.9238 c -7869.0518 8553.1172 -7869.645 8553.4473 -7870.123 8553.9238 c -7870.6006 8554.4023 -7870.9297 8554.9951 -7871.123 8555.6729 c -7872.0088 8558.7715 -7870.0103 8563.6777 -7865.9233 8567.7666 c -7861.834 8571.8535 -7856.9297 8573.8516 -7853.8286 8572.9668 c -7853.1519 8572.7715 -7852.5586 8572.4424 -7852.0806 8571.9658 c -7851.603 8571.4883 -7851.2754 8570.8955 -7851.082 8570.2168 c -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.582 8561.21 -7854.791 8559.6133 -7856.2793 8558.123 c -7858.1504 8556.2539 -7860.1914 8554.8242 -7862.1504 8553.9043 c f u 0.0035 0.014 0.0665 0 k -7861.2183 8552.9727 m -7863.8306 8552.0215 -7866.3975 8551.9688 -7868.373 8552.9238 C -7866.6914 8552.4434 -7864.4766 8552.8125 -7862.1504 8553.9043 c -7861.6191 8554.1543 -7861.0806 8554.4434 -7860.543 8554.7676 C -7858.8984 8554.0537 L -7859.667 8553.6172 -7860.4434 8553.2539 -7861.2183 8552.9727 c f 0.015 0.06 0.285 0 k -7858.8984 8554.0537 m -7860.543 8554.7676 L -7859.0962 8555.6348 -7857.6426 8556.7607 -7856.2793 8558.123 c -7856.1538 8558.25 -7856.0327 8558.3779 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7856.3706 8555.7236 -7857.6191 8554.7813 -7858.8984 8554.0537 C f U u 0.039 0.156 0.741 0 k -7849.687 8541.4043 m -7849.9746 8541.6914 -7861.2183 8552.9727 Y -7860.4434 8553.2539 -7859.667 8553.6172 -7858.8984 8554.0537 C -7845.4146 8540.5703 L -7847.061 8540.0996 -7848.6406 8540.3555 -7849.687 8541.4043 c f 0.025 0.1 0.475 0 k -7845.4146 8540.5703 m -7858.8984 8554.0537 L -7857.584 8554.8027 -7856.2969 8555.7754 -7855.1143 8556.957 c -7855.084 8556.9863 -7855.0586 8557.0156 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7841.5264 8543.1328 -7841.7202 8542.9141 -7841.9302 8542.7012 c -7843.0103 8541.623 -7844.2305 8540.9082 -7845.4146 8540.5703 C f U u 0.0115 0.046 0.2185 0 k -7835.9346 8550.3926 m -7833.5337 8547.9893 -7833.335 8544.0898 -7835.1382 8540.6973 C -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f 0.015 0.06 0.285 0 k -7843.5337 8535.5957 m -7842.582 8534.9258 L -7845.2046 8534.3516 -7847.8306 8534.9141 -7849.6206 8536.7061 c -7848.1719 8535.2578 -7845.9082 8534.9307 -7843.5337 8535.5957 C f 0.0295 0.118 0.5605 0 k -7843.5337 8535.5957 m -7845.9082 8534.9307 -7848.1719 8535.2578 -7849.6206 8536.7061 c -7851.019 8538.1055 -7851.3706 8540.2637 -7850.7954 8542.5469 C -7848.8672 8539.5449 -7845.4082 8540.5537 V -7843.585 8535.6309 L -7843.5337 8535.5957 L f *u 0.048 0.192 0.912 0 k 1 D -7835.9346 8550.3926 m -7837.2817 8551.7383 -7839.332 8552.1133 -7841.5234 8551.627 C -7851.6714 8561.7734 L -7851.7695 8561.5684 -7851.7695 8561.5684 -7851.6714 8561.7734 c -7850.2246 8564.8145 -7849.9702 8567.916 -7851.082 8570.2168 C -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.5054 8561.3438 -7854.5918 8559.8848 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7855.1816 8556.8945 -7855.1465 8556.9238 -7855.1143 8556.957 c -7855.084 8556.9883 -7855.0566 8557.0176 -7855.0273 8557.0469 c -7855.0278 8557.0469 -7855.0278 8557.0469 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7836.3262 8541.1289 L -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f *U 0.0215 0.086 0.4085 0 k 0 D -7842.582 8534.9258 m -7843.5337 8535.5957 L -7841.6846 8536.1113 -7839.7656 8537.2285 -7838.1138 8538.8828 c -7837.4063 8539.5889 -7836.7998 8540.3418 -7836.2954 8541.1182 C -7835.1382 8540.6973 L -7835.6553 8539.7246 -7836.3374 8538.793 -7837.1802 8537.9512 c -7838.7695 8536.3594 -7840.6758 8535.3428 -7842.582 8534.9258 C f 0.0205 0.082 0.3895 0 k -7836.2954 8541.1182 m -7836.7998 8540.3418 -7837.4063 8539.5889 -7838.1138 8538.8828 c -7839.7656 8537.2285 -7841.6846 8536.1113 -7843.5337 8535.5957 C -7843.585 8535.6309 L -7845.4082 8540.5537 L -7844.2114 8540.9219 -7842.9878 8541.6436 -7841.9302 8542.7012 c -7841.7202 8542.9141 -7841.5264 8543.1328 -7841.3408 8543.3574 C -7836.3262 8541.1289 L -7836.2954 8541.1182 L f U u 0.445 0.356 0.267 0 k -7883.8496 8585.9961 m -7861.957 8562.9688 L -7862.2007 8562.6494 -7862.5752 8562.6133 -7862.8887 8562.6592 C -7867.1802 8567.2891 -7878.3145 8579.4561 -7882.7266 8584.2793 C -7883.5649 8585.3516 -7884 8585.9932 -7883.8496 8585.9961 C f 0.15 0.12 0.09 0 k -7883.834 8585.9961 m -7882.6606 8585.7031 -7861.6934 8564.0029 Y -7861.6934 8563.502 -7861.7993 8563.1758 -7861.957 8562.9688 C -7883.8496 8585.9961 L -7883.8442 8585.9961 -7883.8418 8586 -7883.834 8585.9961 c f 0.2 0.16 0.12 0 k -7882.7266 8584.2793 m -7878.3145 8579.4561 -7867.1802 8567.2891 -7862.8887 8562.6592 C -7863.2002 8562.7041 -7863.4526 8562.8301 Y -7864.603 8563.1328 -7878.5742 8578.9619 -7882.7266 8584.2793 C f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 37) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7882.9502 8585.2324 m -7833.0391 8585.2324 L -7833.0391 8521.1152 L -7882.9502 8521.1152 L -7882.9502 8585.2324 L n u 0 O 0 0 0 1 k 0 R 0 0 0 1 K 0 w -7833.2358 8521.1152 m -7833.6064 8521.248 -7833.9858 8521.2832 -7834.3833 8521.2031 c -7834.4863 8521.168 l -7834.5254 8521.1602 -7834.5703 8521.1787 -7834.6025 8521.1992 c -7834.9434 8521.3926 l -7838.7129 8523.2959 -7842.0962 8525.8965 -7844.5 8529.4473 c -7845.9634 8531.5918 -7847.123 8533.8789 -7848.7993 8535.8564 c -7849.1729 8536.209 -7849.1758 8536.7725 -7848.834 8537.1309 c -7848.4951 8537.501 -7847.918 8537.5078 -7847.561 8537.165 c -7847.4038 8537.21 l -7847.2642 8537.1289 -7847.0742 8537.0703 -7847.0234 8536.957 c -7845.853 8534.2031 -7845.1895 8531.5137 -7843.4336 8529.1387 c -7841.1719 8526.0947 -7838.1777 8523.9941 -7835.0298 8522.0234 c -7834.3672 8521.6055 L -7834.4966 8521.6348 L -7833.7695 8521.6426 l -7833.791 8521.6113 -7833.8008 8521.5957 -7833.8223 8521.5645 C -7833.6064 8521.5234 -7833.377 8521.4746 -7833.1626 8521.4336 c -7833.0762 8521.4238 -7833.0186 8521.3389 -7833.0391 8521.2383 c -7833.0503 8521.1523 -7833.1382 8521.1084 -7833.2358 8521.1152 c -7833.2358 8521.1152 l b -7849.2222 8534.9951 m -7849.5742 8534.8066 -7849.9658 8534.6719 -7850.248 8534.3887 c -7856.4521 8528.1719 -7866.6802 8527.2734 -7874.0488 8533.6855 C -7874.1582 8533.7813 -7874.1582 8533.957 -7874.063 8534.0645 C -7871.0527 8532.9434 -7862.8838 8534.375 -7859.3223 8537.4121 C -7859.2534 8537.4668 -7859.1465 8537.4531 -7859.1055 8537.3711 C -7859.0503 8537.3047 -7859.0664 8537.1953 -7859.1328 8537.1563 C -7862.5625 8534.0859 -7867.0674 8532.29 -7871.6729 8532.748 C -7868.8535 8531.1855 -7865.6313 8530.4941 -7862.3984 8530.6885 c -7857.7144 8530.9717 -7853.4634 8533.1191 -7849.3711 8535.2793 c -7849.291 8535.3193 -7849.1978 8535.293 -7849.1553 8535.2109 C -7849.1016 8535.1309 -7849.1426 8535.0352 -7849.2222 8534.9951 c b -7858.647 8536.3359 m -7860.2266 8540.3613 -7862.3911 8544.3203 -7865.8018 8547.0762 c -7865.9648 8547.2119 -7865.9946 8547.4492 -7865.8711 8547.6055 c -7865.7344 8547.7676 -7865.5049 8547.7793 -7865.3481 8547.6563 c -7861.123 8545.5967 -7858.1904 8541.1309 -7858.1626 8536.4014 c -7858.1626 8536.4014 l -7858.1328 8536.2676 -7858.2354 8536.1348 -7858.3633 8536.1221 c -7858.5039 8536.1055 -7858.6318 8536.1973 -7858.647 8536.3359 c -7858.647 8536.3359 l b -7852.9414 8541.0176 m -7853.042 8541.1816 -7853.1152 8541.3838 -7853.2617 8541.4824 c -7856.0806 8543.3906 -7858.9785 8544.6309 -7861.8848 8546.1328 c -7862.0503 8546.209 -7862.1118 8546.418 -7862.0313 8546.5703 c -7861.9512 8546.7227 -7861.7559 8546.7793 -7861.5898 8546.7041 c -7858.439 8545.3232 -7854.313 8544.5 -7852.6729 8541.1797 c -7852.6289 8541.1113 -7852.6455 8541.0146 -7852.7266 8540.9648 c -7852.7959 8540.9199 -7852.897 8540.9492 -7852.9414 8541.0176 c -7852.9414 8541.0176 l b -7852.6602 8541.918 m -7852.4438 8542.4297 -7852.1431 8542.8896 -7852.0503 8543.4355 c -7851.2183 8548.2773 -7851.1152 8553.042 -7852.248 8557.6875 c -7852.248 8557.6875 l -7852.3418 8557.9531 -7852.2114 8558.2441 -7851.9438 8558.3389 c -7851.6777 8558.4336 -7851.3882 8558.3125 -7851.2935 8558.0479 c -7849.293 8552.8115 -7849.897 8546.7373 -7852.3711 8541.7832 c -7852.4063 8541.7002 -7852.498 8541.6689 -7852.582 8541.6914 c -7852.6641 8541.7275 -7852.6978 8541.835 -7852.6602 8541.918 c -7852.6602 8541.918 l b -7851.5352 8557.5938 m -7848.8984 8555.2275 -7846.6816 8552.252 -7845.853 8548.7363 c -7845.853 8548.7363 l -7845.7246 8548.1816 -7846.0742 8547.623 -7846.6416 8547.4902 c -7847.1992 8547.375 -7847.7578 8547.7246 -7847.8862 8548.2793 c -7848.5649 8551.5313 -7849.8711 8554.6729 -7851.7954 8557.3867 c -7851.7954 8557.3867 l -7851.8462 8557.4551 -7851.834 8557.5576 -7851.7695 8557.6201 c -7851.6992 8557.6699 -7851.5977 8557.6582 -7851.5352 8557.5938 c -7851.5352 8557.5938 l b -7836.3711 8550.1826 m -7837.7114 8545.8301 -7840.2598 8542.0693 -7843.689 8539.1533 C -7843.729 8539.0723 -7843.8242 8539.0322 -7843.9038 8539.0859 C -7843.9863 8539.127 -7844.0122 8539.2207 -7843.9722 8539.3018 C -7843.957 8539.7891 -7843.7144 8540.2334 -7843.4458 8540.5313 c -7838.4063 8546.1621 -7834.9902 8554.7197 -7837.3433 8561.9551 C -7837.0762 8556.4512 -7838.7241 8550.3008 -7842.1362 8545.6738 c -7843.1606 8544.2695 -7844.7422 8544.1211 -7846.3081 8544.2031 C -7846.4023 8544.1895 -7846.4834 8544.2432 -7846.4961 8544.3369 c -7846.5098 8544.4189 -7846.4551 8544.5137 -7846.3623 8544.5254 C -7843.1479 8545.7695 -7841.4878 8549.2246 -7840.084 8552.1943 c -7838.415 8555.7441 -7837.7017 8559.6387 -7838.0054 8563.5 C -7838.0454 8563.6777 -7838.1138 8565.3975 -7837.9775 8565.4102 C -7837.8306 8565.4395 -7837.709 8565.3438 -7837.6802 8565.1943 C -7837.645 8565.0449 -7834.6426 8555.7988 -7836.3711 8550.1826 c b -7844.4863 8537.4912 m -7843.3945 8533.6211 -7841.1094 8530.251 -7838.4824 8527.2383 c -7838.3306 8527.1045 -7838.3145 8526.8867 -7838.4502 8526.7354 c -7838.5752 8526.6006 -7838.8047 8526.582 -7838.957 8526.7178 c -7842.3306 8529.332 -7843.4487 8533.541 -7844.7954 8537.375 c -7844.7954 8537.375 l -7844.8262 8537.4648 -7844.7754 8537.5586 -7844.6982 8537.5869 c -7844.6094 8537.6191 -7844.5166 8537.5684 -7844.4863 8537.4912 c -7844.4863 8537.4912 l b -7838.5313 8562.1094 m -7838.5991 8562.0566 -7838.707 8562.083 -7838.748 8562.1504 C -7838.9634 8562.4746 -7840.6914 8564.5195 -7841.3926 8565.1406 c -7846.1719 8569.3945 -7849.5137 8573.9609 -7857.5391 8577.7227 c -7864.4512 8580.9639 -7867.1113 8583.5957 -7874.3862 8581.8262 c -7877.687 8581.0293 -7879.0313 8580.5313 -7880.4351 8575.4551 C -7881.9473 8569.2988 -7880.8672 8571.7832 -7881.084 8564.4385 c -7881.2222 8559.6973 -7884 8548.4551 -7871.5254 8534.2598 C -7871.4199 8534.1484 -7871.4336 8533.9961 -7871.5337 8533.9072 C -7871.6328 8533.8027 -7871.7959 8533.8164 -7871.8862 8533.916 C -7877.5786 8538.7168 -7881.0234 8545.6582 -7882.3145 8552.9424 c -7883.2871 8558.4668 -7882.9199 8563.25 -7882.666 8569.6367 c -7882.5688 8572.0938 -7883.6855 8579.0723 -7878.9102 8583.0625 c -7875.3926 8586 -7870.3911 8585.5469 -7866.3545 8584.1563 c -7860.6992 8582.2119 -7855.9727 8579.1465 -7850.8711 8575.6094 c -7847.2656 8573.125 -7839.2881 8563.2852 -7838.4785 8562.3262 C -7838.4351 8562.2588 -7838.4502 8562.1504 -7838.5313 8562.1094 C b -7873.0503 8549.3057 m -7872.168 8548.5029 -7871.7017 8549.8457 -7871.4297 8550.6016 c -7871.1626 8551.3574 -7870.189 8551.25 -7870.5127 8551.5732 c -7870.8369 8551.8975 -7870.8369 8551.9521 -7871.3232 8551.5195 c -7871.8086 8551.0879 -7871.8086 8551.7363 -7872.5649 8551.25 c -7873.3198 8550.7627 -7873.645 8549.8457 -7873.0503 8549.3057 c b -7865.6519 8553.9492 m -7865.3657 8553.5918 -7864.6802 8553.5723 -7864.4648 8553.8945 c -7864.25 8554.2197 -7863.3306 8554.2734 -7863.4937 8554.5967 c -7863.6543 8554.9219 -7863.6016 8555.1387 -7864.0874 8554.9219 c -7864.5737 8554.7051 -7864.4121 8555.2998 -7864.897 8555.084 c -7865.3833 8554.8672 -7865.8687 8554.2197 -7865.6519 8553.9492 c b -7857.6074 8559.0791 m -7857.1206 8558.7559 -7855.8794 8559.5117 -7856.4727 8559.5117 c -7857.0674 8559.5117 -7856.311 8560.2676 -7856.8521 8560.4834 c -7857.3906 8560.6992 -7857.2832 8560.4297 -7857.6074 8560.6445 c -7857.9297 8560.8613 -7858.3633 8561.2393 -7858.5239 8560.4297 c -7858.6855 8559.6191 -7858.3633 8559.6191 -7857.9849 8559.3496 c -7857.6074 8559.0791 -7857.6074 8559.0791 y b -7872.2402 8559.3496 m -7871.1074 8559.2422 -7871.8633 8559.998 -7871.269 8560.4834 c -7870.6738 8560.9697 -7869.918 8561.6172 -7870.729 8561.4004 c -7871.5391 8561.1855 -7872.9961 8561.6719 -7872.9434 8560.5381 c -7872.8887 8559.4033 -7872.6328 8559.3867 -7872.2402 8559.3496 c b -7866.5703 8567.6113 m -7866.1016 8567.3438 -7866.6802 8567.7197 -7866.0303 8567.6113 c -7865.3833 8567.5039 -7864.7886 8567.6113 -7865.2207 8567.8281 c -7865.6519 8568.0439 -7866.3008 8568.1523 -7866.4634 8567.9893 c -7866.625 8567.8281 -7866.9473 8567.8281 -7866.5703 8567.6113 c b -7857.0674 8567.1797 m -7857.4785 8566.1797 -7856.0962 8566.4238 -7855.4473 8566.7461 c -7854.7998 8567.0723 -7853.8262 8566.4775 -7854.4209 8566.9102 c -7855.0137 8567.3418 -7854.7998 8566.9102 -7855.3926 8567.2334 c -7855.9873 8567.5566 -7856.6895 8568.0977 -7857.0674 8567.1797 c b -7872.6738 8573.0664 m -7872.7222 8572.0752 -7871.8086 8572.957 -7871.269 8573.0117 c -7870.729 8573.0664 -7870.0801 8573.0664 -7870.2432 8573.2813 c -7870.4038 8573.498 -7870.459 8573.498 -7871.1626 8573.7129 c -7871.8633 8573.9297 -7872.6191 8574.1445 -7872.6738 8573.0664 c b -7873.1582 8567.6113 m -7874.0664 8567.9746 -7874.293 8567.8809 -7874.5625 8568.2051 c -7874.834 8568.5293 -7875.1558 8569.2314 -7875.5352 8568.0977 c -7875.9121 8566.9629 -7875.4282 8565.7764 -7875.0479 8565.9375 c -7874.6714 8566.0996 -7874.293 8566.7461 -7873.8618 8566.9629 c -7873.4297 8567.1797 -7872.6191 8567.3945 -7873.1582 8567.6113 c b U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 41) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7803 8586 L -7803 8481 L -7884 8481 L -7884 8586 L n u u u 0 O 0 0 0 1 k -7865.8057 8498.4258 m -7866.0742 8496.6621 -7867.1602 8495.291 -7868.5239 8495.3965 c -7869.8862 8495.502 -7870.707 8497.0234 -7870.7432 8498.8066 c -7870.748 8499.0693 -7870.6743 8500.2441 -7870.6304 8500.4775 C -7870.6382 8500.582 -7870.6191 8500.6738 -7870.6104 8500.7803 c -7870.5142 8502.0254 -7869.3574 8503.3604 -7867.9414 8503.25 c -7866.5249 8503.1406 -7865.4897 8501.8613 -7865.6367 8500.4727 c -7865.644 8500.4072 -7865.6958 8499.626 -7865.707 8499.5625 C -7865.6816 8499.2852 -7865.7598 8498.7256 -7865.8057 8498.4258 c f -7876.2646 8507.7334 m -7876.9946 8515.916 -7871.5015 8515.1191 v -7868.3682 8514.0186 -7869.4414 8511.1211 v -7869.6426 8509.752 -7871.7847 8508.498 v -7872.146 8508.25 -7872.7632 8507.1016 v -7873.1294 8505.5977 -7874.5186 8505.2979 v -7876.0762 8505.251 -7876.2646 8507.7334 v f -7850.7646 8516.4971 m F -7850.0762 8514.3408 m -7850.7847 8513.1934 -7853.8848 8513.6279 Y -7854.811 8513.6885 -7855.3799 8513.1113 Y -7857.8394 8509.0918 -7861.0386 8509.8857 -7861.4082 8509.9932 C -7861.4097 8509.9863 L -7864.999 8510.6045 -7865.2666 8515.6035 V -7865.4912 8516.3828 -7866.335 8516.7695 V -7869.2695 8517.8613 -7869.3481 8519.208 V -7869.8999 8521.1152 -7867.6006 8521.7422 V -7865.6792 8522.2568 -7863.7886 8519.8945 V -7862.6113 8518.6797 -7859.5762 8517.9395 V -7859.5728 8517.9531 L -7856.3594 8517.0459 -7854.6392 8517.5889 Y -7851.8521 8518.7676 -7850.4063 8517.4014 Y -7848.6826 8515.7559 -7850.0762 8514.3408 Y f -7863.9834 8497.8789 m -7864.5854 8496.2002 -7864.2822 8494.4775 -7863.0327 8493.9229 c -7861.7842 8493.3672 -7860.3384 8494.3164 -7859.4585 8495.8672 c -7859.3286 8496.0957 -7858.8359 8497.165 -7858.7632 8497.3906 C -7858.7065 8497.4785 -7858.6792 8497.5684 -7858.6362 8497.667 c -7858.1289 8498.8086 -7858.5122 8500.5303 -7859.8105 8501.1074 c -7861.1089 8501.6855 -7862.6279 8501.0527 -7863.1582 8499.7617 c -7863.1831 8499.7002 -7863.5078 8498.9883 -7863.5298 8498.9268 C -7863.6831 8498.6963 -7863.8809 8498.166 -7863.9834 8497.8789 c f -7849.7129 8500.9316 m -7845.1802 8507.7822 -7850.3911 8509.6943 v -7853.6714 8510.2168 -7854.103 8507.1572 v -7854.5786 8505.8564 -7853.29 8503.7354 v -7853.0903 8503.3447 -7853.0938 8502.04 v -7853.4858 8500.5449 -7852.4082 8499.6182 v -7851.0591 8498.8359 -7849.7129 8500.9316 v f U u -7824.7358 8550.1074 m -7824.3687 8548.3623 -7824.9048 8546.6963 -7826.2183 8546.3164 c -7827.5322 8545.9375 -7828.8345 8547.0752 -7829.4937 8548.7324 c -7829.5903 8548.9775 -7829.9326 8550.1025 -7829.9746 8550.3369 C -7830.0176 8550.4326 -7830.0322 8550.5244 -7830.0625 8550.6279 c -7830.4087 8551.8271 -7829.7935 8553.4805 -7828.4282 8553.875 c -7827.063 8554.2695 -7825.645 8553.4365 -7825.2969 8552.085 c -7825.2793 8552.0205 -7825.0552 8551.2705 -7825.0425 8551.207 C -7824.9214 8550.9551 -7824.7983 8550.4053 -7824.7358 8550.1074 c f -7838.2705 8554.6172 m -7841.8242 8562.0244 -7836.3999 8563.2061 v -7833.0801 8563.2754 -7833.0688 8560.1846 v -7832.7778 8558.8311 -7834.3433 8556.9072 v -7834.5942 8556.5459 -7834.7695 8555.2539 v -7834.5854 8553.7188 -7835.7793 8552.9492 v -7837.2222 8552.3594 -7838.2705 8554.6172 v f -7817.4648 8571.7695 m F -7816.063 8569.9912 m -7816.3247 8568.6689 -7819.3799 8567.9883 Y -7820.27 8567.7197 -7820.5986 8566.9795 Y -7821.4922 8562.3535 -7824.7666 8561.9746 -7825.1494 8561.9453 C -7825.1494 8561.9395 L -7828.7271 8561.2588 -7830.731 8565.8467 V -7831.2153 8566.4961 -7832.1416 8566.5625 V -7835.272 8566.5557 -7835.8169 8567.7891 V -7837.0039 8569.3809 -7835.0713 8570.7764 V -7833.4526 8571.9316 -7830.853 8570.3818 V -7829.3242 8569.6582 -7826.2222 8570.0293 V -7826.2231 8570.042 L -7822.896 8570.3213 -7821.4766 8571.4326 Y -7819.2793 8573.5146 -7817.4463 8572.7432 Y -7815.2554 8571.8057 -7816.063 8569.9912 Y f -7822.8374 8550.2354 m -7822.813 8548.4512 -7821.9258 8546.9453 -7820.5601 8546.8633 c -7819.1943 8546.7803 -7818.1743 8548.1768 -7817.895 8549.9385 c -7817.854 8550.1973 -7817.7666 8551.3711 -7817.7778 8551.6094 C -7817.7559 8551.7109 -7817.7617 8551.8037 -7817.7559 8551.9121 c -7817.6807 8553.1592 -7818.644 8554.6367 -7820.0625 8554.7217 c -7821.4814 8554.8066 -7822.6826 8553.6826 -7822.7246 8552.2871 c -7822.7271 8552.2217 -7822.7822 8551.4404 -7822.7798 8551.375 C -7822.8433 8551.1045 -7822.8423 8550.54 -7822.8374 8550.2354 c f -7811.0186 8557.5625 m -7809.1777 8565.5684 -7814.7271 8565.5303 v -7817.9834 8564.8691 -7817.3154 8561.8516 v -7817.3032 8560.4668 -7815.353 8558.9326 v -7815.0278 8558.6377 -7814.5742 8557.415 v -7814.417 8555.876 -7813.083 8555.3877 v -7811.5454 8555.1279 -7811.0186 8557.5625 v f U U 1 Ap -7884 8586 m -7884 8481 L -7803 8481 L -7803 8586 L -7884 8586 L n U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 42) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 45) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8543.918 m -7885 8587 L -7798.2217 8587 L -7798.2217 8543.918 L -7885 8543.918 L n u u 0 O 0 0 0 1 k -7825.2217 8573.2363 m -7825.2217 8581.0742 L -7813.2217 8574.1445 L -7801.2217 8567.2168 L -7813.2217 8560.2891 L -7825.2217 8553.3613 L -7825.2217 8561.4824 L -7883.9351 8547.7168 L -7870.9878 8566.8027 L -7885 8587 L -7825.2217 8573.2363 L f 0 1 1 0.1 k 0 R 0 0 0 1 K -7823.2217 8570.2363 m -7823.2217 8578.0742 L -7811.2217 8571.1445 L -7799.2217 8564.2168 L -7811.2217 8557.2891 L -7823.2217 8550.3613 L -7823.2217 8558.4824 L -7881.9351 8544.7168 L -7867.2754 8564.3594 L -7881.9351 8584 L -7823.2217 8570.2363 L b U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 50) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7756.877 8586 L -7756.877 8538.415 L -7884 8538.415 L -7884 8586 L n u *u 0 O 0.9529 0.949 0.1961 0.0745 k -7857.793 8570.417 m -7857.8232 8570.2676 L -7859.9849 8564.3643 -7860.9438 8561.6377 -7861.2754 8560.2891 c -7861.3657 8560.2891 L -7861.6953 8561.6074 -7862.7754 8564.335 -7864.9673 8570.2676 c -7864.9966 8570.417 L -7857.793 8570.417 l f 1 D -7868.1182 8578.9678 m -7869.6191 8582.5371 -7870.3994 8584.709 -7868.1182 8584.917 c -7868.1182 8585.9678 L -7870.6992 8585.9375 -7873.5806 8585.917 -7876.3418 8585.917 c -7880.0649 8585.917 -7882.5273 8585.9375 -7884 8585.9678 c -7884 8584.917 L -7882.1064 8584.709 -7881.0542 8582.5674 -7873.5513 8565.5029 c -7861.6953 8538.415 L -7859.8638 8538.415 L -7848.1582 8565.5029 L -7840.8047 8582.5078 -7839.7246 8584.709 -7837.8887 8584.917 c -7837.8887 8585.9678 L -7839.5142 8585.9375 -7841.916 8585.917 -7845.5767 8585.917 c -7848.5488 8585.917 -7851.6694 8585.9375 -7854.7026 8585.9678 c -7854.7026 8584.917 L -7852.481 8584.709 -7853.3218 8582.5078 -7854.7617 8578.9678 C -7868.1182 8578.9678 l f *U *u 0 D -7813.0762 8554.0811 m -7813.0762 8550.4717 -7815.3535 8548.0947 -7819.1294 8548.0947 c -7820.2383 8548.0947 -7821.0767 8548.2158 -7821.5273 8548.2451 c -7821.5273 8560.5479 L -7820.8672 8560.6084 -7820.208 8560.6084 -7819.729 8560.6084 c -7818.2002 8560.6084 -7816.7026 8560.127 -7815.6841 8559.4053 c -7814.3945 8558.5332 -7813.0762 8556.7881 -7813.0762 8554.1416 C -7813.0762 8554.0811 l f 1 D -7832.0806 8558.3926 m -7832.0806 8542.6445 -7832.0806 8540.4287 -7834.542 8540.2783 c -7834.542 8539.3184 L -7833.042 8539.2588 -7830.3174 8539.1992 -7827.5664 8539.1689 c -7825.6538 8539.1084 -7822.3945 8539.0186 -7820.1479 8538.9775 c -7816.582 8538.9775 -7813.585 8539.4258 -7811.0049 8540.2627 c -7806.353 8541.8477 -7801.9702 8545.8525 -7801.9702 8553.6602 c -7801.9702 8558.7432 -7804.4014 8562.3193 -7806.5034 8564.0605 c -7807.583 8565.0215 -7808.8135 8565.832 -7809.7744 8566.3125 c -7809.7744 8566.4629 L -7807.5234 8569.4912 -7805.6025 8572.0625 -7799.3906 8580.6426 c -7797.5 8583.0645 -7795.9102 8584.7383 -7794.7402 8584.9775 c -7794.7402 8586 L -7796.6602 8586 -7799 8585.8848 -7801.1294 8585.8848 c -7803.3511 8585.8848 -7804.8521 8586 -7806.4424 8586 c -7807.6729 8586 -7808.7241 8585.9404 -7809.5039 8585.2725 c -7813.0151 8579.8477 -7816.9121 8573.7559 -7820.1182 8568.7139 c -7820.5078 8568.7139 -7820.957 8568.7139 -7821.5273 8568.7139 c -7821.5273 8571.2852 L -7821.5273 8582.5264 -7821.437 8584.7686 -7819.1895 8584.9775 c -7819.1895 8585.9697 L -7820.6279 8585.9404 -7823.9194 8585.915 -7826.6992 8585.915 c -7829.9287 8585.915 -7832.8921 8585.9404 -7834.5122 8585.9697 c -7834.5122 8584.9775 L -7832.0518 8584.7686 -7832.0806 8582.5264 -7832.0806 8565.5918 C -7832.0806 8558.3926 l f *U *u 0 D -7781.4561 8565.5928 m -7781.4561 8582.4941 -7781.4561 8584.6484 -7784.2832 8584.9775 C -7784.2832 8585.9697 l -7782.3887 8585.9404 -7779.0542 8585.915 -7775.7822 8585.915 c -7772.6294 8585.915 -7769.5688 8585.9404 -7767.2881 8585.9697 C -7767.2881 8584.9775 l -7770.2578 8584.9775 -7770.2881 8582.5244 -7770.2881 8565.5928 C -7770.2881 8548.1514 L -7762.8193 8548.1514 l -7759.999 8548.1514 -7758.5298 8548.96 -7757.8994 8551.2627 C -7756.9072 8551.2627 l -7756.9072 8546.4697 -7756.877 8542.415 -7756.877 8539.1709 c -7761.3486 8539.2012 -7766.748 8539.2314 -7772.0601 8539.2314 C -7779.7446 8539.2314 l -7784.5537 8539.2314 -7789.9966 8539.2012 -7794.9614 8539.1709 c -7794.9614 8542.3848 -7794.9326 8546.4697 -7794.9326 8551.2627 C -7793.9072 8551.2627 l -7793.3657 8549.1094 -7791.771 8548.1514 -7788.9438 8548.1514 C -7781.4561 8548.1514 l -7781.4561 8565.5928 L f *U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 62) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8569.9043 m -7846.7305 8561.3408 L -7885 8561.3408 L -7885 8569.9043 L -7846.7305 8569.9043 L f -7846.7305 8573.0967 m -7846.7305 8572.4229 L -7885 8572.4229 L -7885 8573.0967 L -7846.7305 8573.0967 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 63) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8565.8262 m -7846.7305 8574.3896 L -7859.3408 8574.3896 L -7859.3408 8587 L -7867.9038 8587 L -7867.9063 8565.8262 L -7867.9038 8565.8262 L -7867.9038 8565.8252 L -7846.7305 8565.8262 L f -7846.7305 8563.3076 m -7870.4233 8563.3076 L -7870.4233 8587 L -7871.0967 8587 L -7871.0977 8562.6328 L -7846.7305 8562.6328 L -7846.7305 8563.3076 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 64) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8586.999 m -7885 8548.7285 L -7846.7305 8548.7285 L -7846.7305 8586.999 L -7885 8586.999 L n 0 O 1 0.14 0.09 0 k -7846.7305 8561.3389 m -7872.3896 8561.3389 L -7872.3896 8586.999 L -7863.8262 8587 L -7863.8262 8569.9033 L -7846.7305 8569.9033 L -7846.7305 8561.3389 L f -7846.7305 8572.4219 m -7861.3081 8572.4219 L -7861.3081 8587 L -7860.6338 8587 L -7860.6338 8573.0957 L -7846.7305 8573.0957 L -7846.7305 8572.4219 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 65) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.0625 8559.4609 m -7884.6025 8559.4609 L -7884.6025 8587 L -7857.0625 8587 L -7857.0625 8559.4609 L n 0 O 0 0.55 1 0.12 k -7856.8418 8572.7002 m -7885 8572.7002 L -7885 8573.8252 L -7856.8418 8573.8252 L -7856.8418 8572.7002 L f u 0 0.55 1 0.3 k -7883.9814 8560.5215 m -7884.4102 8562.5254 -7883.1865 8566.1514 -7880.0874 8569.251 c -7876.9878 8572.3496 -7873.3457 8573.6602 -7871.3594 8573.1455 C -7871.3594 8573.1455 L -7870.875 8571.1895 -7872.1519 8567.5117 -7875.25 8564.4141 c -7878.3457 8561.3184 -7882.0122 8560.1064 -7883.9814 8560.5215 C f 0 0.39 0.7 0.12 k -7883.9814 8585.9912 m -7884.4102 8583.9883 -7883.1865 8580.3613 -7880.0874 8577.2617 c -7876.9878 8574.1641 -7873.3457 8572.8535 -7871.3594 8573.3672 C -7871.3594 8573.3672 L -7870.875 8575.3242 -7872.1519 8579.001 -7875.25 8582.0996 c -7878.3457 8585.1953 -7882.0122 8586.4063 -7883.9814 8585.9912 C f U u 0 0.55 1 0.3 k -7870.1782 8585.9912 m -7870.6074 8583.9883 -7869.3838 8580.3613 -7866.2842 8577.2617 c -7863.1855 8574.1641 -7859.543 8572.8535 -7857.5576 8573.3672 C -7857.5566 8573.3672 L -7857.0718 8575.3242 -7858.3496 8579.001 -7861.4473 8582.0996 c -7864.543 8585.1953 -7868.209 8586.4063 -7870.1782 8585.9912 C f 0 0.39 0.7 0.12 k -7870.1782 8560.5215 m -7870.6074 8562.5254 -7869.3838 8566.1514 -7866.2842 8569.251 c -7863.1855 8572.3496 -7859.543 8573.6602 -7857.5576 8573.1455 C -7857.5566 8573.1455 L -7857.0718 8571.1895 -7858.3496 8567.5117 -7861.4473 8564.4141 c -7864.543 8561.3184 -7868.209 8560.1064 -7870.1782 8560.5215 C f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 67) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 69) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.4609 m -7885 8559.4609 L -7885 8587 L -7857.4609 8587 L -7857.4609 8559.4609 L n 0 O 0 0.55 1 0.3 k -7875.4233 8573.252 m -7874.3096 8571.5313 -7870.8809 8569.833 -7866.4966 8569.833 c -7862.1152 8569.833 -7858.6138 8571.4824 -7857.5718 8573.25 C -7857.5718 8573.25 L -7858.6138 8574.9766 -7862.1152 8576.6738 -7866.4966 8576.6738 c -7870.875 8576.6738 -7874.3242 8574.9375 -7875.4233 8573.252 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 83) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8585.9355 m -7670.4009 8585.9355 L -7670.4009 8578.1348 L -7884 8578.1348 L -7884 8585.9355 L n 0 O 0 0 0 1 k -7884 8582.0352 m -7873.9858 8584.5273 -7867.187 8585.875 -7855.2007 8585.9355 c -7842.2183 8586 -7777.2002 8585.9355 y -7712.1816 8586 -7699.2002 8585.9355 v -7687.2129 8585.875 -7680.415 8584.5273 -7670.4009 8582.0352 C -7680.415 8579.543 -7687.2129 8578.1953 -7699.2002 8578.1348 c -7712.1816 8578.0693 -7777.2002 8578.1348 y -7842.2183 8578.0693 -7855.2007 8578.1348 v -7867.187 8578.1953 -7873.9858 8579.543 -7884 8582.0352 C f U %AI8_EndBrushPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np 4 Bn %AI5_BeginGradient: (Black, White) (Black, White) 0 2 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 %_Br [ 0 0 50 100 %_BS %_0 0 50 100 Bs 1 0 50 0 %_BS %_1 0 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Chrome) (Chrome) 0 6 Bd [ 0 < 464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B 3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272626262625 2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1B1B1B1B1A 1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F 0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 04040403030302020202010101010000 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A 1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 15151515151414141414141414131313131313131312121212121212121211111111111111111010 1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C 0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 07060606060606060606050505050505050504040404040404040303030303030303030202020202 02020201010101010101010000000000 > 1 %_Br 0 0.275 1 < 6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F > 1 %_Br 0 < 00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B 0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 161617171717181818181919191A1A1A1A1B1B1B1C1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C 2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 373738383838393939393A3A3A3B3B3B3B3C3C3C3D3D3D3D3E3E3E3E3F3F3F404040404141414142 42424343434344444444454545464646 > < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > < 00000101020203030304040505050606070708080809090A0A0B0B0B0C0C0D0D0D0E0E0F0F101010 1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5E5F5F606061616162626363646464 6565666666676768686969696A6A6B6B > 1 %_Br 1 0 %_Br < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 35343434333333323232323131313030302F2F2F2E2E2E2E2D2D2D2C2C2C2B2B2B2B2A2A2A292929 282828282727272626262525252524242423232322222222212121202020201F1F1F1E1E1E1D1D1D 1D1C1C1C1B1B1B1A1A1A1A1919191818181717171616161615151514141413131313121212111111 101010100F0F0F0E0E0E0D0D0D0D0C0C0C0B0B0B0A0A0A0A09090908080807070707060606050505 04040404030303020202010101010000 > 0 0 1 %_Br [ 1 0 50 92 %_BS %_1 0 50 92 Bs 0 0.275 1 0.12 1 50 59 %_BS %_0 0.275 1 0.12 1 50 59 Bs 0 0.275 1 0.42 1 50 50 %_BS %_0 0.275 1 0.42 1 50 50 Bs 1 0 50 49 %_BS %_1 0 50 49 Bs 1 0 50 41 %_BS %_1 0 50 41 Bs 1 0.3 0 0 1 50 0 %_BS %_1 0.3 0 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Rainbow) (Rainbow) 0 6 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 0 1 %_Br 1 < 0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E 2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E 7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 F7F8F9FAFBFCFDFEFF > 0 0 1 %_Br 1 < 00000000000000000000000000000000000001010101010101010101010101010101010101010101 01010101010101010101010101010202020202020202020202020202020202020202020202020202 02020202020202020202030303030303030303030303030303030303030303030303030303030303 03030303030304040404040404040404040404040404040404040404040404040404040404040404 04040505050505050505050505050505050505050505050505050505050505050505050505050606 06060606060606060606060606060606060606060606060606060606060606060607070707070707 07070707070707070707070707070707 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 1 %_Br < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > 0 1 0 1 %_Br 0 < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 1 %_Br [ 0 1 0 0 1 50 100 %_BS %_0 1 0 0 1 50 100 Bs 1 1 0 0 1 50 80 %_BS %_1 1 0 0 1 50 80 Bs 1 0.0279 0 0 1 50 60 %_BS %_1 0.0279 0 0 1 50 60 Bs 1 0 1 0 1 50 40 %_BS %_1 0 1 0 1 50 40 Bs 0 0 1 0 1 50 20 %_BS %_0 0 1 0 1 50 20 Bs 0 1 1 0 1 50 0 %_BS %_0 1 1 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Yellow & Orange Radial) (Yellow & Orange Radial) 1 2 Bd [ 0 < 0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F 707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C > < FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E6 > 0 1 %_Br [ 0 0 1 0 1 52 19 %_BS %_0 0 1 0 1 52 19 Bs 0 0.55 0.9 0 1 50 100 %_BS %_0 0.55 0.9 0 1 50 100 Bs BD %AI5_EndGradient %AI5_End_NonPrinting-- %AI5_BeginPalette 0 0 Pb 1 1 1 1 ([Registration]) 0 Xs ([Registration]) Pc 0 0 0 0 k (C=0 M=0 Y=0 K=0) Pc 0 0 0 1 k (C=0 M=0 Y=0 K=100) Pc 0 0.1 1 0 k (C=0 M=10 Y=100 K=0) Pc 0 0.5 0 0 k (C=0 M=50 Y=0 K=0) Pc 0 0.5 1 0 k (C=0 M=50 Y=100 K=0) Pc 1 0.55 1 0 k (C=100 M=55 Y=100 K=0) Pc 1 0.9 0.1 0 k (C=100 M=90 Y=10 K=0) Pc 0.15 1 1 0 k (C=15 M=100 Y=100 K=0) Pc 0.45 0.9 0 0 k (C=45 M=90 Y=0 K=0) Pc 0.5 0.4 0.3 0 k (C=50 M=40 Y=30 K=0) Pc 0.5 0.85 1 0 k (C=50 M=85 Y=100 K=0) Pc 0.75 0.05 1 0 k (C=75 M=5 Y=100 K=0) Pc 0.75 0.9 0 0 k (C=75 M=90 Y=0 K=0) Pc 0.8 0.05 0 0 k (C=80 M=5 Y=0 K=0) Pc Bb 2 (Black, White) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Black, White) Pc Bb 2 (Chrome) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Chrome) Pc Bb 2 (Rainbow) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Rainbow) Pc Bb 0 0 0 0 Bh 2 (Yellow & Orange Radial) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Yellow & Orange Radial) Pc (Brick) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Brick) Pc (Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Confetti) Pc (Leaves - Fall ) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Leaves - Fall ) Pc (Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Stripes) Pc PB %AI5_EndPalette %AI5_Begin_NonPrinting Np %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Dog Tracks) (1 /New Pattern 41/ 1 0 0 0 1 / 0 1 1 0 1 1 0 0 0 0 -90 -90 0 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Fall Leaf) (1 /New Pattern 34/ 1 0.0745 0.9 0.9019 0.18 / 0 0.602793 1 1 0.1 1 1 -) - (1 1 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Ladybug) (1 /New Pattern 10/ 5 0.898039 0 0 / 0 1 1 0 0.803911 1.2 1 -1.55 1.55 ) - (1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Push Pin) (1 /New Pattern 36/ 1 0.025 0.1 0.475 0 / 0 1 1 0 0.401676 1 1 -1.06145) - ( 1.06 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Strawberry) (1 /New Pattern 37/ 1 0 0 0 1 / 0 0.803911 1 1 0.803911 1 1 -0.5 0.5 1 ) - (-75 75.419 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Twinkle Star ) (1 /New Pattern 2/ 0 1 / 1 0.5 1 1 0.25 1 1 -0.5 0.5 1 0 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Double Lines) (1 / New Pattern 62/ New Pattern 63/ New Pattern 64/ / / 1 1 0.14 0.09 ) - (0 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Laurel) (1 / New Pattern 65/ New Pattern 42/ New Pattern 67/ / New Pattern 69/ ) - (1 0 0.55 1 0.3 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Rope ) (1 / New Pattern 1/ / / New Pattern 3/ New Pattern 6/ 5 0 0 0 / 1 0 1 ) - (0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Arrow) (1 / New Pattern 45/ / / / / 5 0.898039 0 0 / 2 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Marker) (1 / New Pattern 8/ / / / / 0 0 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Paintbrush) (1 / New Pattern 5/ / / / / 1 0.5 0.85 1 0.45 / 0 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Tapered Stroke) (1 / New Pattern 83/ / / / / 1 0 0 0 1 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Type) (1 / New Pattern 50/ / / / / 1 0.952941 0.94902 0.196078 0.0745098 / 1) - ( 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (6 pt Flat ) (1 4 8 10 10 90 90 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (10 pt Oval) (1 1 19 15 15 130 130 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (12 pt Oval ) (1 7 17 45 45 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (20 pt Oval) (1 20 20 20 100 40 80 0 2 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (25 pt Round ) (1 10 40 100 100 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (50 pt Flat) (1 40 60 0 0 44 44 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Brush Manager Order) (Adobe Brush Manager Order) ( Adobe Calligraphic Brush Tool/ 6 pt Flat / Adobe Calligraphic Brush T) - (ool/ 10 pt Oval/ Adobe Calligraphic Brush Tool/ 12 pt Oval / Adobe Cal) - (ligraphic Brush Tool/ 20 pt Oval/ Adobe Calligraphic Brush Tool/ 25 pt) - ( Round / Adobe Calligraphic Brush Tool/ 50 pt Flat/ Adobe Scatter Brus) - (h Tool/ Dog Tracks/ Adobe Scatter Brush Tool/ Fall Leaf/ Adobe Scatter) - ( Brush Tool/ Ladybug/ Adobe Scatter Brush Tool/ Push Pin/ Adobe Scatte) - (r Brush Tool/ Strawberry/ Adobe Scatter Brush Tool/ Twinkle Star / Ado) - (be ArtOnPath Brush Tool/ Marker/ Adobe ArtOnPath Brush Tool/ Tapered S) - (troke/ Adobe ArtOnPath Brush Tool/ Arrow/ Adobe ArtOnPath Brush Tool/ ) - (Paintbrush/ Adobe ArtOnPath Brush Tool/ Type/ Adobe PatternOnPath Brus) - (h Tool/ Double Lines/ Adobe PatternOnPath Brush Tool/ Laurel/ Adobe Pa) - (tternOnPath Brush Tool/ Rope /) . %AI8_EndPluginObject %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_PluginGroupInfo (Adobe Path Blends) (Adobe Blends Plugin) (Live Blends) %AI8_PluginGroupInfo (Adobe PatternOnPath Brush Tool) (Adobe Pattern Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe ArtOnPath Brush Tool) (Adobe Art Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe Calligraphic Brush Tool) (Undo New Calligraphic Brush) (Calligraphic Brush Tool) %AI8_PluginGroupInfo (Adobe Scatter Brush Tool) (Adobe Scatter Brush Plugin) (Scatter Brush Tool) %AI5_End_NonPrinting-- %AI5_BeginLayer 1 1 1 1 0 0 1 0 79 128 255 0 50 Lb (Layer 1) Ln 0 A u 0 R 0 G 300 Ar 2 J 0 j 0.72 w 3.86 M []0 d %AI3_Note: 0 D 0 XR 108 297.1201 m 162 297.1201 l 162 224.8799 l 108 224.8799 l 108 297.1201 l s /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 207 290.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M %_ 0 50 XQ /_Times-Roman 10 8.9799 -2.18 Tf 0 Ts 100 100 Tz 0 Tt %_0 0 100 100 Xu %AI55J_GlyphSubst: GlyphSubstNone 1 TA %_ 0 XL 0 TY 0 TV 36 0 Xb XB 0 0 5 TC 100 100 200 TW 25 TG 0 0 0 Ti 0 Ta 0 1 2 2 3 Th 0 Tq 240 Tg 0 0 Tl 0 Tc 0 Tw (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 214.6299 290.1699 0 Tp 0 Tv TP 0 Tr (v_base) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 207 272.1699 0 Tp 0 Tv TP 0 Tr (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 214.6299 272.1699 0 Tp 0 Tv TP 0 Tr (v_len) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 198 306 m 252 306 l 252 270 l 198 270 l 198 306 l s /BBAccumRotation (0.000000) XT 252 288 m 198 288 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 261 290.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 268.6299 290.1699 0 Tp 0 Tv TP 0 Tr (v_base) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 261 272.1699 0 Tp 0 Tv TP 0 Tr (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 268.6299 272.1699 0 Tp 0 Tv TP 0 Tr (v_len) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 252 306 m 306 306 l 306 270 l 252 270 l 252 306 l s /BBAccumRotation (0.000000) XT 306 288 m 252 288 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 369 290.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 376.6299 290.1699 0 Tp 0 Tv TP 0 Tr (v_base) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 369 272.1699 0 Tp 0 Tv TP 0 Tr (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 376.6299 272.1699 0 Tp 0 Tv TP 0 Tr (v_len) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 360 306 m 414 306 l 414 270 l 360 270 l 360 306 l s /BBAccumRotation (0.000000) XT 414 288 m 360 288 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 315 290.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 322.6299 290.1699 0 Tp 0 Tv TP 0 Tr (v_base) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 315 272.1699 0 Tp 0 Tv TP 0 Tr (io) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 322.6299 272.1699 0 Tp 0 Tv TP 0 Tr (v_len) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 306 306 m 360 306 l 360 270 l 306 270 l 306 306 l s /BBAccumRotation (0.000000) XT 360 288 m 306 288 l S /BBAccumRotation (0.000000) XT 0 O 0.75 g 1 XR 255.1201 404.8799 m 354 404.8799 l 354 369.1201 l 255.1201 369.1201 l 255.1201 404.8799 l b /BBAccumRotation (0.000000) XT 0.97 g 263.04 396.96 m 361.9199 396.96 l 361.9199 360.96 l 263.04 360.96 l 263.04 396.96 l b /BBAccumRotation (0.000000) XT 0.1 g 270.96 389.04 m 370.0801 389.04 l 370.0801 353.04 l 270.96 353.04 l 270.96 389.04 l b /BBAccumRotation (0.000000) XT 0.7 g 279.1201 378 m 495.1201 378 l 495.1201 342 l 279.1201 342 l 279.1201 378 l b /BBAccumRotation (0.000000) XT 0 J 1.2 w 0 XR 248.8799 358.0801 m 251.04 367.4404 l 244.3198 360.7197 l 246.48 359.5195 l 248.8799 358.0801 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 248.8799 358.0801 m 251.04 367.4404 l 244.3198 360.7197 l 246.48 359.5195 l 248.8799 358.0801 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 246.2397 359.04 m 216 306 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 263.7598 348.96 m 261.1201 358.0801 l 258.2397 348.96 l 261.1201 348.96 l 263.7598 348.96 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 263.7598 348.96 m 261.1201 358.0801 l 258.2397 348.96 l 261.1201 348.96 l 263.7598 348.96 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 261.1201 348.4795 m 261.1201 306 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 276 341.2803 m 270.48 349.2002 l 270.96 339.5996 l 273.6001 340.5596 l 276 341.2803 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 276 341.2803 m 270.48 349.2002 l 270.96 339.5996 l 273.6001 340.5596 l 276 341.2803 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 273.6001 340.0801 m 279.1201 324 l 315.1201 306 l 324 306 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 290.3999 341.04 m 280.7998 341.5195 l 288.7202 336 l 289.4399 338.4004 l 290.3999 341.04 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 290.3999 341.04 m 280.7998 341.5195 l 288.7202 336 l 289.4399 338.4004 l 290.3999 341.04 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 289.9199 338.4004 m 386.8799 306 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 304.4897 416.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (4 dif) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 322.8496 416.1699 0 Tp 0 Tv TP 0 Tr (ferent b) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 353.4697 416.1699 0 Tp 0 Tv TP 0 Tr (uf) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 361.5498 416.1699 0 Tp 0 Tv TP 0 Tr (fers of v) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 394.6201 416.1699 0 Tp 0 Tv TP 0 Tr (arious sizes) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 131.2202 209.1699 0 Tp 0 Tv TP 0 Tr (uio) Tx 1 0 Tk (\r) TX TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 187.9199 300.7197 m 196.3198 305.5195 l 186.7202 306 l 187.2002 303.3604 l 187.9199 300.7197 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 187.9199 300.7197 m 196.3198 305.5195 l 186.7202 306 l 187.2002 303.3604 l 187.9199 300.7197 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 186.7202 303.1201 m 162 297.1201 l S /BBAccumRotation (0.000000) XT U /BBAccumRotation (0.000000) XT LB %AI5_EndLayer-- gsave annotatepage grestore showpage Adobe_Illustrator_AI5 /terminate get exec Adobe_shading_AI8 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_cshow /terminate get exec Adobe_level2_AI5 /terminate get exec %%EndDocument @endspecial 1075 2323 a Fe(Figure)19 b(3:)26 b(uio)19 b(structure)h(with)g(4)g(distinct)h(memory)d(areas.)83 2590 y Fc(\017)41 b Fe(uio)p 278 2590 25 4 v 29 w(resid)18 b(\226)f(residual)g(count)g(\(set)h(by)f(the)g(\002le)i(system)e(after) 166 2690 y(the)j(I/O)h(is)g(done\))83 2856 y Fc(\017)41 b Fe(uio)p 278 2856 V 29 w(limit)21 b(\226)f(u-limit)g(\(maximum)e (byte)i(of)n(fset\))83 3021 y Fc(\017)41 b Fe(uio)p 278 3021 V 29 w(fp)20 b(\226)g(\002le)h(pointer)0 3259 y Fd(2.4)99 b(lay)o(er)n(ed)26 b(vnode/vfs)0 3415 y Fe(SGI)c(has)f (created)g(a)g(clustered)g(v)o(ersion)f(of)h(XFS)h(called)f(CXFS.)0 3514 y(This)34 b(\002le)g(system)f(lets)h(multiple)f(machines)f(share)i (the)f(same)0 3614 y(XFS)f(\002le)h(system,)h(much)d(lik)o(e)h(NFS)g (clients)g(share)g(the)f(NFS)0 3714 y(serv)o(er')-5 b(s)25 b(local)h(\002le)g(system.)41 b(The)25 b(major)g(dif)n(ference)f (between)0 3813 y(NFS)e(and)e(CXFS)i(is)f(that)g(the)g(data)g(for)f (I/O)h(goes)f(directly)g(from)0 3913 y(the)f(disk)f(de)n(vices)g(to)h (each)f(machine)f(instead)i(of)f(going)f(through)0 4012 y(a)k(serv)o(er)e(lik)o(e)h(NFS.)83 4112 y(The)29 b(CXFS)h(\002le)g (system)g(uses)f(beha)n(viors)f(to)i(layer)f(on)f(top)0 4212 y(of)f(XFS,)h(as)h(sho)n(wn)d(in)i(\002gure)f(4.)47 b(The)27 b(dsvn)g(structure)g(is)h(the)0 4311 y(CXFS)d(layer')-5 b(s)24 b(inode.)36 b(It)25 b(contains)e(information)f(k)o(ept)i(pri)n (v)n(ate)0 4411 y(to)e(the)f(CXFS)i(layer)m(,)e(such)h(as)g(which)f (nodes)g(in)h(the)g(cluster)f(are)0 4511 y(using)k(the)h(\002le.)43 b(The)26 b(dsvnops)e(contains)i(pointers)f(to)h(the)g(\002le-)0 4610 y(system-dependent)17 b(routines)i(in)i(CXFS.)83 4710 y(In)27 b(most)g(cases,)j(each)c(dsvn)h(routine)f(does)h(some)g(w) o(ork)f(be-)0 4809 y(fore)h(calls)h(to)g(the)f(ne)o(xt)g(beha)n(vior)f (in)i(the)f(chain,)i(in)f(this)g(case,)0 4909 y(XFS.)39 b(Theoretically)-5 b(,)40 b(other)e(layers)g(could)f(be)i(inserted)e (be-)0 5009 y(tween)20 b(CXFS)h(and)f(XFS,)h(or)f(abo)o(v)o(e)e(CXFS.) 83 5108 y(Whene)n(v)o(er)k(a)i(vnode)e(needs)h(to)h(ha)n(v)o(e)f(a)h (ne)n(w)g(layer)f(inserted,)0 5208 y(a)h(lock)f(is)h(obtained)e(to)i (pre)n(v)o(ent)d(an)o(y)i(operations)f(from)g(\223cross-)0 5308 y(ing\224)g(the)h(beha)n(vior)-5 b(.)32 b(If)22 b(an)h(operation)e(is)j(currently)d(acti)n(v)o(e,)i(e.g.)0 5407 y(xfs)p 107 5407 V 29 w(read,)d(the)g(insertion)g(must)g(w)o(ait)h (until)g(it)g(completes.)j(Some)1992 2590 y(dsvn)e(routines)g(are)h (simply)g(pass)h(through.)31 b(The)o(y)22 b(just)i(call)g(the)1992 2690 y(ne)o(xt)19 b(layer)h(in)g(the)g(beha)n(vior)f(chain.)1992 2927 y Fd(2.5)99 b(b)n(uffer)26 b(cache/b)n(uf)h(structur)n(e)1992 3083 y Fe(One)h(of)f(the)i(fundamental)c(components)h(of)i(IRIX,)g (XFS,)h(and)1992 3183 y(modern)40 b(\002le)j(systems)g(is)g(the)f(b)n (uf)n(fer)f(cache.)91 b(The)42 b(b)n(uf)n(fer)1992 3282 y(cache)26 b(is)i(main)f(memory)e(maintained)g(by)i(the)g(operating)e (sys-)1992 3382 y(tem)34 b(which)f(contains)g(data)h(being)f (transferred)f(to)i(and)g(from)1992 3482 y(disk.)62 b(Disk)32 b(data)h(is)g(cached)f(to)h(help)f(pre)n(v)o(ent)f(I/O)h(between)1992 3581 y(memory)18 b(and)i(disks.)26 b(The)21 b(basic)f(idea)h(is)g(to)g (k)o(eep)f(parts)g(of)h(disk)1992 3681 y(in)f(memory)e(since)j(disk)f (data)g(is)h(often)e(e)o(xtensi)n(v)o(ely)g(re-used.)2075 3781 y(The)e(top)g(le)n(v)o(el)g(data)h(structure)f(for)g(the)g(b)n(uf) n(fer)f(cache)i(in)f(IRIX)1992 3880 y(is)k(struct)f(b)n(uf.)k(This)d (structure)e(contains)g(information)f(such)i(as:)2075 4046 y Fc(\017)41 b Fe(pointers)19 b(to)h(the)g(actual)g(memory)2075 4212 y Fc(\017)41 b Fe(the)26 b(de)n(vice)g(and)g(block)g(number)e (with)j(which)f(the)h(b)n(uf)n(fer)2158 4312 y(is)21 b(associated)2075 4478 y Fc(\017)41 b Fe(v)n(arious)h(\003ags)i (indicating)f(the)h(state)g(of)g(the)f(memory)2158 4577 y(\(dirty)-5 b(,)18 b(lock)o(ed,)h(already)g(read,)h(b)n(usy)-5 b(,)19 b(etc.\))2075 4743 y Fc(\017)41 b Fe(pointers)19 b(to)h(other)g(b)n(ufs)2075 4909 y Fc(\017)41 b Fe(error)19 b(state)2075 5075 y Fc(\017)41 b Fe(size)20 b(of)g(data)2075 5241 y Fc(\017)41 b Fe(pinned)18 b(status)2075 5407 y Fc(\017)41 b Fe(de)n(vice-speci\002c)18 b(information)1929 5656 y(5)p eop %%Page: 6 6 6 5 bop 296 4036 a @beginspecial 34 @llx 449 @lly 431 @urx 756 @ury 3970 @rwi @setspecial %%BeginDocument: fig4.eps %AI5_FileFormat 4.0 %AI3_ColorUsage: Black&White %AI3_IncludePlacedImages %AI7_ImageSettings: 1 %AI3_TemplateBox: 306.5 395.5 306.5 395.5 %AI3_TileBox: 31 31 583 761 %AI3_DocumentPreview: Header %AI5_ArtSize: 612 792 %AI5_RulerUnits: 2 %AI5_ArtFlags: 1 0 0 1 0 0 1 0 0 %AI5_TargetResolution: 800 %AI5_NumLayers: 1 %AI8_OpenToView: -272.8789 805.1821 0.99 1146 827 18 0 1 3 40 0 0 %AI5_OpenViewLayers: 7 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 userdict /Adobe_level2_AI5 26 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { (AI8_CMYK_CustomColor) 6 packedarray } bind def /findrgbcustomcolor { (AI8_RGB_CustomColor) 5 packedarray } bind def /setcustomcolor { exch aload pop dup (AI8_CMYK_CustomColor) eq { pop pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { dup (AI8_RGB_CustomColor) eq { pop pop 3 { 1 exch sub 3 index mul 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } ifelse } ifelse } def } if /setAIseparationgray { false setoverprint 0 setgray /setseparationgray where{ pop setseparationgray }{ /setcolorspace where{ pop [/Separation (All) /DeviceCMYK {dup dup dup}] setcolorspace 1 exch sub setcolor }{ setgray }ifelse }ifelse } def /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking currentpacking true setpacking userdict /Adobe_typography_AI5 68 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /havefont { systemdict /languagelevel known { /Font resourcestatus dup { exch pop exch pop } if } { systemdict /FontDirectory get 1 index known { pop true } { systemdict /fileposition known { dup length 6 add exch Ss 6 250 getinterval cvs pop Ss exch 0 exch getinterval status { pop pop pop pop true } { false } ifelse } { pop false } ifelse } ifelse } ifelse } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def /subststring { exch 2 index exch search { exch pop exch dup () eq { pop exch concatstring } { 3 -1 roll exch concatstring concatstring } ifelse exch pop true } { pop pop false } ifelse } def /concatstring { 1 index length 1 index length 1 index add string dup 0 5 index putinterval dup 2 index 4 index putinterval 4 1 roll pop pop pop } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def 2 index havefont { 3 index 255 string cvs dup (_Symbol_) eq { pop 2 index findfont } { 1 index 0 eq { dup length 1 sub 1 exch getinterval cvn findfont } { pop 2 index findfont } ifelse } ifelse } { dup 1 eq { 2 index 64 string cvs dup (-90pv-RKSJ-) (-83pv-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop dup (-90ms-RKSJ-) (-Ext-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop pop true } ifelse } ifelse { 1 index 1 eq { /Ryumin-Light-Ext-RKSJ-V havefont {/Ryumin-Light-Ext-RKSJ-V} {/Courier} ifelse } { /Ryumin-Light-83pv-RKSJ-H havefont {/Ryumin-Light-83pv-RKSJ-H} {/Courier} ifelse } ifelse findfont [1 0 0.5 1 0 0] makefont } if } { /Courier findfont } ifelse } ifelse _wv type /arraytype eq { _wv makeblendedfont } if dup length 10 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontScript exch def /FontDirection exch def /FontRequest exch def /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { W B } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { W F } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { W S } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat _shift aload pop _lineorientation 1 eq { exch } if translate _scale aload pop _lineorientation 1 eq _yokoorientation 1 eq or { exch } if scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { 1 index type /nametype eq { dup 0.75 mul 1 index 0.25 mul neg } if /_fontDescent exch ddef /_fontAscent exch ddef /_fontSize exch ddef /_fontRotateAdjust _fontAscent _fontDescent add 2 div neg ddef /_fontHeight _fontSize ddef findfont _fontSize scalefont setfont } def /Tl { pop neg 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { 0 exch _shift astore pop currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { count 1 eq { 100 } if 100 div exch 100 div exch _scale astore pop iTm } def /TA { pop } def /Tq { pop } def /Tg { pop } def /TG { pop } def /Tv { /_lineorientation exch ddef } def /TV { /_charorientation exch ddef } def /Ty { dup /_yokoorientation exch ddef 1 sub neg Tv } def /TY { pop } def /T~ { Tx } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { _fontSize mul 1000 div _lineorientation 0 eq { neg 0 } { 0 exch } ifelse rmoveto pop } def /TK { 2 npop } def /T* { _leading aload pop _lineorientation 0 ne { exch } if Td } def /T*- { _leading aload pop _lineorientation 0 ne { exch } if exch neg exch neg Td } def /T- { _ax neg 0 rmoveto _lineorientation 1 eq _charorientation 0 eq and { 1 TV _hyphen Tx 0 TV } { _hyphen Tx } ifelse } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ findfont _fontSize scalefont setfont 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking % /X^ { currentfont 5 1 roll dup havefont { findfont _fontSize scalefont setfont } { pop exch } ifelse 2 index 0 eq { Tx } { Tj } ifelse pop pop setfont } def /T^ /X^ load def userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 53 dict put } if userdict /Adobe_ColorImage_AI6 get begin /initialize { Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 41 dict def } if Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /_newproc null def /_proc1 null def /_proc2 null def /sourcearray 4 array def /_ptispace null def /_ptiname null def /_pti0 0 def /_pti1 0 def /_ptiproc null def /_ptiscale 0 def /_pticomps 0 def /_ptibuf 0 string def /_gtigray 0 def /_cticmyk null def /_rtirgb null def /XIEnable true def /XIType 0 def /XIEncoding 0 def /XICompression 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIRowBytes 0 def /XIFile null def /XIBuffer1 null def /XIBuffer2 null def /XIBuffer3 null def /XIDataProc null def /XIColorSpace /DeviceGray def /XIColorValues 0 def /XIPlateList false def end /ci6colorimage /colorimage where {/colorimage get}{null} ifelse def /ci6image systemdict /image get def /ci6curtransfer systemdict /currenttransfer get def /ci6curoverprint /currentoverprint where {/currentoverprint get}{{_of}} ifelse def /ci6foureq { 4 index ne { pop pop pop false }{ 4 index ne { pop pop false }{ 4 index ne { pop false }{ 4 index eq } ifelse } ifelse } ifelse } def /ci6testplate { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 ci6foureq { /plateindex 0 def }{ 0 1 0 0 ci6foureq { /plateindex 1 def }{ 0 0 1 0 ci6foureq { /plateindex 2 def }{ 0 0 0 1 ci6foureq { /plateindex 3 def }{ 0 0 0 0 ci6foureq { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /ci6concatprocs { /packedarray where { pop dup type /packedarraytype eq 2 index type /packedarraytype eq or }{ false } ifelse { /_proc2 exch cvlit def /_proc1 exch cvlit def _proc1 aload pop _proc2 aload pop _proc1 length _proc2 length add packedarray cvx }{ /_proc2 exch cvlit def /_proc1 exch cvlit def /_newproc _proc1 length _proc2 length add array def _newproc 0 _proc1 putinterval _newproc _proc1 length _proc2 putinterval _newproc cvx } ifelse } def /ci6istint { type /arraytype eq } def /ci6isspot { dup type /arraytype eq { dup length 1 sub get /Separation eq }{ pop false } ifelse } def /ci6spotname { dup ci6isspot {dup length 2 sub get}{pop ()} ifelse } def /ci6altspace { aload pop pop pop ci6colormake } def /ci6numcomps { dup /DeviceGray eq { pop 1 }{ dup /DeviceRGB eq { pop 3 }{ /DeviceCMYK eq { 4 }{ 1 } ifelse } ifelse } ifelse } def /ci6marksplate { dup /DeviceGray eq { pop plateindex 3 eq }{ dup /DeviceRGB eq { pop plateindex 5 ne }{ dup /DeviceCMYK eq { pop plateindex 5 ne }{ dup ci6isspot { /findcmykcustomcolor where { pop dup length 2 sub get 0.1 0.1 0.1 0.1 5 -1 roll findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop plateindex 5 ne } ifelse }{ pop plateindex 5 ne } ifelse } ifelse } ifelse } ifelse } def /ci6colormake { dup ci6numcomps exch 1 index 2 add 1 roll dup 1 eq {pop}{array astore} ifelse exch } def /ci6colorexpand { dup ci6spotname exch dup ci6istint { ci6altspace exch 4 1 roll }{ 1 3 1 roll } ifelse } def /ci6colortint { dup /DeviceGray eq { 3 1 roll 1 exch sub mul 1 exch sub exch }{ dup /DeviceRGB eq { 3 1 roll {1 exch sub 1 index mul 1 exch sub exch} forall pop 3 array astore exch }{ dup /DeviceCMYK eq { 3 1 roll {1 index mul exch} forall pop 4 array astore exch }{ 3 1 roll mul exch } ifelse } ifelse } ifelse } def /ci6colortocmyk { dup /DeviceGray eq { pop 1 exch sub 0 0 0 4 -1 roll 4 array astore }{ dup /DeviceRGB eq { pop aload pop _rgbtocmyk 4 array astore }{ dup /DeviceCMYK eq { pop }{ ci6altspace ci6colortint ci6colortocmyk } ifelse } ifelse } ifelse } def /ci6makeimagedict { 7 dict begin /ImageType 1 def /Decode exch def /DataSource exch def /ImageMatrix exch def /BitsPerComponent exch def /Height exch def /Width exch def currentdict end } def /ci6stringinvert { 0 1 2 index length 1 sub { dup 2 index exch get 255 exch sub 2 index 3 1 roll put } for } def /ci6stringknockout { 0 1 2 index length 1 sub { 255 2 index 3 1 roll put } for } def /ci6stringapply { 0 1 4 index length 1 sub { dup 4 index exch get 3 index 3 1 roll 3 index exec } for pop exch pop } def /ci6walkrgbstring { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval {} forall 5 index exec 3 index } for 5 {pop} repeat } def /ci6walkcmykstring { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval {} forall 6 index exec 3 index } for 5 { pop } repeat } def /ci6putrgbtograystr { .11 mul exch .59 mul add exch .3 mul add cvi 3 copy put pop 1 add } def /ci6putcmyktograystr { exch .11 mul add exch .59 mul add exch .3 mul add dup 255 gt { pop 255 } if 255 exch sub cvi 3 copy put pop 1 add } def /ci6rgbtograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putrgbtograystr load exch ci6walkrgbstring end } def /ci6cmyktograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putcmyktograystr load exch ci6walkcmykstring end } def /ci6separatecmykproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 0 2 index plateindex 4 2 index length 1 sub { get 255 exch sub 3 copy put pop 1 add 2 index } for pop pop exch pop end } def /ci6compositeimage { dup 1 eq { pop pop image }{ /ci6colorimage load null ne { ci6colorimage }{ 3 1 roll pop sourcearray 0 3 -1 roll put 3 eq {/ci6rgbtograyproc}{/ci6cmyktograyproc} ifelse load image } ifelse } ifelse } def /ci6knockoutimage { gsave 0 ci6curtransfer exec 1 ci6curtransfer exec eq { 0 ci6curtransfer exec 0.5 lt }{ 0 ci6curtransfer exec 1 ci6curtransfer exec gt } ifelse {{pop 0}}{{pop 1}} ifelse systemdict /settransfer get exec ci6compositeimage grestore } def /ci6drawimage { ci6testplate -1 eq { pop ci6compositeimage }{ dup type /arraytype eq { dup length plateindex gt {plateindex get}{pop false} ifelse }{ { true }{ dup 1 eq {plateindex 3 eq}{plateindex 3 le} ifelse } ifelse } ifelse { dup 1 eq { pop pop ci6image }{ dup 3 eq { ci6compositeimage }{ pop pop sourcearray 0 3 -1 roll put /ci6separatecmykproc load ci6image } ifelse } ifelse }{ ci6curoverprint { 7 {pop} repeat }{ ci6knockoutimage } ifelse } ifelse } ifelse } def /ci6proctintimage { /_ptispace exch store /_ptiname exch store /_pti1 exch store /_pti0 exch store /_ptiproc exch store /_pticomps _ptispace ci6numcomps store /_ptiscale _pti1 _pti0 sub store level2? { _ptiname length 0 gt version cvr 2012 ge and { [/Separation _ptiname _ptispace {_ptiproc}] setcolorspace [_pti0 _pti1] ci6makeimagedict ci6image }{ [/Indexed _ptispace 255 {255 div _ptiscale mul _pti0 add _ptiproc}] setcolorspace [0 255] ci6makeimagedict ci6image } ifelse }{ _pticomps 1 eq { { dup { 255 div _ptiscale mul _pti0 add _ptiproc 255 mul cvi put } ci6stringapply } ci6concatprocs ci6image }{ { dup length _pticomps mul dup _ptibuf length ne {/_ptibuf exch string store}{pop} ifelse _ptibuf { exch _pticomps mul exch 255 div _ptiscale mul _pti0 add _ptiproc _pticomps 2 add -2 roll _pticomps 1 sub -1 0 { 1 index add 2 index exch 5 -1 roll 255 mul cvi put } for pop pop } ci6stringapply } ci6concatprocs false _pticomps /ci6colorimage load null eq {7 {pop} repeat}{ci6colorimage} ifelse } ifelse } ifelse } def /ci6graytintimage { /_gtigray 5 -1 roll store {1 _gtigray sub mul 1 exch sub} 4 1 roll /DeviceGray ci6proctintimage } def /ci6cmyktintimage { /_cticmyk 5 -1 roll store {_cticmyk {1 index mul exch} forall pop} 4 1 roll /DeviceCMYK ci6proctintimage } def /ci6rgbtintimage { /_rtirgb 5 -1 roll store {_rtirgb {1 exch sub 1 index mul 1 exch sub exch} forall pop} 4 1 roll /DeviceRGB ci6proctintimage } def /ci6tintimage { ci6testplate -1 eq { ci6colorexpand 3 -1 roll 5 -1 roll {0}{0 exch} ifelse 4 2 roll dup /DeviceGray eq { pop ci6graytintimage }{ dup /DeviceRGB eq { pop ci6rgbtintimage }{ pop ci6cmyktintimage } ifelse } ifelse }{ dup ci6marksplate { plateindex 5 lt { ci6colortocmyk plateindex get dup 0 eq ci6curoverprint and { 7 {pop} repeat }{ 1 exch sub exch {1 0}{0 1} ifelse () ci6graytintimage } ifelse }{ pop exch {0}{0 exch} ifelse 0 3 1 roll () ci6graytintimage } ifelse }{ ci6curoverprint { 8 {pop} repeat }{ pop pop pop {pop 1} 0 1 () /DeviceGray ci6proctintimage } ifelse } ifelse } ifelse } def /XINullImage { } def /XIImageMask { XIImageWidth XIImageHeight false [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load imagemask } def /XIImageTint { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load XIType 3 eq XIColorValues XIColorSpace ci6tintimage } def /XIImage { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load false XIChannelCount XIPlateList ci6drawimage } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale /_lp /null ddef _fc /_lp /imagemask ddef end } def /XH { Adobe_ColorImage_AI6_Vars begin grestore end } def /XIEnable { Adobe_ColorImage_AI6_Vars /XIEnable 3 -1 roll put } def /XC { Adobe_ColorImage_AI6_Vars begin ci6colormake /XIColorSpace exch def /XIColorValues exch def end } def /XIPlates { Adobe_ColorImage_AI6_Vars begin /XIPlateList exch def end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def cvi dup 256 idiv /XICompression exch store 256 mod /XIEncoding exch store pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi }{ XIImageWidth XIChannelCount mul } ifelse /XIRowBytes exch def XIEnable { /XIBuffer3 XIImageWidth string def XICompression 0 eq { /XIBuffer1 XIRowBytes string def XIEncoding 0 eq { {currentfile XIBuffer1 readhexstring pop} }{ {currentfile XIBuffer1 readstring pop} } ifelse }{ /XIBuffer1 256 string def /XIBuffer2 XIRowBytes string def {currentfile XIBuffer1 readline pop (%) anchorsearch {pop} if} /ASCII85Decode filter /DCTDecode filter /XIFile exch def {XIFile XIBuffer2 readstring pop} } ifelse /XIDataProc exch def XIType 1 ne { 0 setgray } if XIType 1 eq { XIImageMask }{ XIType 2 eq XIType 3 eq or { XIImageTint }{ XIImage } ifelse } ifelse }{ XINullImage } ifelse /XIPlateList false def grestore end } def end currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 112 dict dup begin put /_?cmyk false def /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_lineorientation 0 def /_charorientation 0 def /_yokoorientation 0 def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_shift [0 0] def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fontSize 0 def /_fontAscent 0 def /_fontDescent 0 def /_fontHeight 0 def /_fontRotateAdjust 0 def /Ss 256 string def Ss 0 (fonts/) putinterval /_cnt 0 def /_scale [1 1] def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_hfname 100 string def /_hffound false def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_rgbf 3 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_rgbs 3 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /_lobyte 0 def /_hibyte 0 def /_cproc null def /_cscript 0 def /_hvax 0 def /_hvay 0 def /_hvwb 0 def /_hvcx 0 def /_hvcy 0 def /_bitfont null def /_bitlobyte 0 def /_bithibyte 0 def /_bitkey null def /_bitdata null def /_bitindex 0 def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 100 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin /_aicmykps where {pop /_?cmyk _aicmykps def}if discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /hswj { dup stringwidth 3 2 roll { _hvwb eq { exch _hvcx add exch _hvcy add } if exch _hvax add exch _hvay add } cforall } def /vswj { 0 0 3 -1 roll { dup 255 le _charorientation 1 eq and { dup cstring stringwidth 5 2 roll _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub 4 -1 roll sub exch 3 -1 roll sub exch } { _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub _fontHeight sub } ifelse } cforall } def /swj { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hswj } { vswj } ifelse } def /sw { 0 0 0 6 3 roll swj } def /vjss { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index setmatrix stroke grestore _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index setmatrix stroke grestore moveto pop pop } ifelse } cforall 6 npop } def /hjss { 4 1 roll { dup cstring gsave false charpath currentpoint 5 index setmatrix stroke grestore moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jss { _lineorientation 0 eq { hjss } { vjss } ifelse } def /ss { 0 0 0 7 3 roll jss } def /vjsp { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto false charpath currentpoint _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto 2 index false charpath moveto pop pop } ifelse } cforall 6 npop } def /hjsp { 4 1 roll { dup cstring false charpath _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jsp { matrix currentmatrix _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /sp { matrix currentmatrix 0 0 0 7 3 roll _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /_rgbtocmyk { 3 { 1 exch sub 3 1 roll } repeat 3 copy 1 4 1 roll 3 { 3 index 2 copy gt { exch } if pop 4 1 roll } repeat pop pop pop 4 1 roll 3 { 3 index sub 3 1 roll } repeat 4 -1 roll } def /setrgbfill { _rgbf astore pop /_fc { _lp /fill ne { _of setoverprint _rgbf aload pop setrgbcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /setrgbstroke { _rgbs astore pop /_sc { _lp /stroke ne { _os setoverprint _rgbs aload pop setrgbcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xa { _?cmyk { 3 npop k }{ setrgbfill 4 npop } ifelse } def /XA { _?cmyk { 3 npop K }{ setrgbstroke 4 npop } ifelse } def /Xs { /_gf exch ddef 5 npop /_fc { _lp /fill ne { _of setoverprint _gf setAIseparationgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XS { /_gs exch ddef 5 npop /_sc { _lp /stroke ne { _os setoverprint _gs setAIseparationgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xx { exch /_gf exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XX { exch /_gs exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /XK { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll K } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop XA } ifelse } def /Xk { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll k } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop Xa } ifelse } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /Xt { pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if endString eq { cleartomark stop } if }ifelse } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse }ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 6 npop 7 2 roll 5 npop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { /clipForward? true def /Tx /pop load def /Tj /pop load def currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 4 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setrgbcolor { 3 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end /XP { 4 npop } bind def /XD { pop } bind def end setpacking currentpacking true setpacking userdict /Adobe_cshow 14 dict dup begin put /initialize { Adobe_cshow begin Adobe_cshow { dup xcheck { bind } if pop pop } forall end Adobe_cshow begin } def /terminate { currentdict Adobe_cshow eq { end } if } def /cforall { /_lobyte 0 ddef /_hibyte 0 ddef /_cproc exch ddef /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef { /_lobyte exch ddef _hibyte 0 eq _cscript 1 eq _lobyte 129 ge _lobyte 159 le and _lobyte 224 ge _lobyte 252 le and or and _cscript 2 eq _lobyte 161 ge _lobyte 254 le and and _cscript 3 eq _lobyte 161 ge _lobyte 254 le and and _cscript 25 eq _lobyte 161 ge _lobyte 254 le and and _cscript -1 eq or or or or and { /_hibyte _lobyte ddef } { _hibyte 256 mul _lobyte add _cproc /_hibyte 0 ddef } ifelse } forall } def /cstring { dup 256 lt { (s) dup 0 4 3 roll put } { dup 256 idiv exch 256 mod (hl) dup dup 0 6 5 roll put 1 4 3 roll put } ifelse } def /clength { 0 exch { 256 lt { 1 } { 2 } ifelse add } cforall } def /hawidthshow { { dup cstring show _hvax _hvay rmoveto _hvwb eq { _hvcx _hvcy rmoveto } if } cforall } def /vawidthshow { { dup 255 le _charorientation 1 eq and { -90 rotate 0 _fontRotateAdjust rmoveto cstring _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow 0 _fontRotateAdjust neg rmoveto 90 rotate } { currentpoint _fontHeight sub exch _hvay sub exch _hvax sub 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if 3 2 roll cstring dup stringwidth pop 2 div neg _fontAscent neg rmoveto show moveto } ifelse } cforall } def /hvawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse } def /hvwidthshow { 0 0 3 -1 roll hvawidthshow } def /hvashow { 0 0 0 6 -3 roll hvawidthshow } def /hvshow { 0 0 0 0 0 6 -1 roll hvawidthshow } def currentdict readonly pop end setpacking userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_shading_AI8 10 dict dup begin put /initialize { Adobe_shading_AI8 begin Adobe_shading_AI8 bdprocs Mesh /initialize get exec } def /terminate { currentdict Adobe_shading_AI8 eq { end } if } def /bdprocs { { dup xcheck 1 index type /arraytype eq and { bind } if pop pop } forall } def /X! {pop} def /X# {pop pop} def /Mesh 40 dict def Mesh begin /initialize { Mesh bdprocs Mesh begin /emulate? /AI8MeshEmulation where { pop AI8MeshEmulation }{ systemdict /shfill known not } ifelse def end } def /bd { shadingdict begin } def /paint { emulate? { end }{ /_lp /none ddef _fc /_lp /none ddef /AIColorSpace AIColorSpace tocolorspace store /ColorSpace AIColorSpace topsspace store version_ge_3010.106 not systemdict /setsmoothness known and { 0.0001 setsmoothness } if composite? { /DataSource getdatasrc def Matrix concat currentdict end shfill }{ AIColorSpace makesmarks AIPlateList markingplate and not isoverprint and { end }{ /ColorSpace /DeviceGray store /Decode [0 1 0 1 0 1] store /DataSource getplatesrc def Matrix concat currentdict end shfill } ifelse } ifelse } ifelse } def /shadingdict 12 dict def shadingdict begin /ShadingType 6 def /BitsPerCoordinate 16 def /BitsPerComponent 8 def /BitsPerFlag 8 def end /datafile null def /databuf 256 string def /dataptr 0 def /srcspace null def /srcchannels 0 def /dstchannels 0 def /dstplate 0 def /srctodstcolor null def /getplatesrc { /srcspace AIColorSpace store /srcchannels AIColorSpace getnchannels store /dstchannels 1 store /dstplate getplateindex store /srctodstcolor srcspace makesmarks { dstplate 4 eq { {1 exch sub} }{ {srcspace tocmyk 3 dstplate sub index 1 exch sub 5 1 roll 4 {pop} repeat} } ifelse }{ {srcchannels {pop} repeat 1} } ifelse store /datafile getdatasrc store /rdpatch168 load DataLength () /SubFileDecode filter } def /getdatasrc { /rdcmntline load /ASCII85Decode filter } def /rdpatch168 { /dataptr 0 store 49 rdcount 4 { dup {pop srcchannels getint8} if dup {pop srctodstcolor dstchannels putint8 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdpatch3216 { /dataptr 0 store 97 rdcount 4 { dup {pop srcchannels getint16} if dup {pop srctodstcolor dstchannels putint16 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdcount { dup 0 gt { datafile databuf dataptr 4 -1 roll getinterval readstring exch length dataptr add /dataptr exch store }{ true } ifelse } def /getint8 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 255 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint8 { dup dataptr add /dataptr exch store dataptr exch { 1 sub exch 255 mul cvi databuf 2 index 3 -1 roll put } repeat pop } def /getint16 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 256 mul datafile read} if dup {pop add 65535 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint16 { dup 2 mul dataptr add /dataptr exch store dataptr exch { 2 sub exch 65535 mul cvi dup 256 idiv databuf 3 index 3 -1 roll put 256 mod databuf 2 index 1 add 3 -1 roll put } repeat pop } def /srcbuf 256 string def /rdcmntline { currentfile srcbuf readline pop (%) anchorsearch {pop} if } def /getplateindex { 0 [cyan? magenta? yellow? black? customColor?] {{exit} if 1 add} forall } def /aicsarray 4 array def /aicsaltvals 4 array def /aicsaltcolr aicsaltvals def /tocolorspace { dup type /arraytype eq { mark exch aload pop aicsarray 0 3 -1 roll put aicsarray 1 3 -1 roll put dup aicsarray 2 3 -1 roll put gettintxform aicsarray 3 3 -1 roll put counttomark aicsaltvals 0 3 -1 roll getinterval /aicsaltcolr exch store aicsaltcolr astore pop pop aicsarray } if } def /subtintxform {aicsaltcolr {1 index mul exch} forall pop} def /addtintxform {aicsaltcolr {1 sub 1 index mul 1 add exch} forall pop} def /gettintxform { /DeviceRGB eq {/addtintxform}{/subtintxform} ifelse load } def /getnchannels { dup type /arraytype eq {0 get} if colorspacedict exch get begin Channels end } def /makesmarks { composite? { pop true }{ dup dup type /arraytype eq {0 get} if colorspacedict exch get begin MarksPlate end } ifelse } def /markingplate { composite? { pop true }{ dup type /arraytype eq { dup length getplateindex gt {getplateindex get}{pop false} ifelse } if } ifelse } def /tocmyk { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToCMYK end } def /topsspace { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToPSSpace end } def /colorspacedict 5 dict dup begin /DeviceGray 4 dict dup begin /Channels 1 def /MarksPlate {pop black?} def /ToCMYK {pop 1 exch sub 0 0 0 4 -1 roll} def /ToPSSpace {} def end def /DeviceRGB 4 dict dup begin /Channels 3 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop _rgbtocmyk} def /ToPSSpace {} def end def /DeviceCMYK 4 dict dup begin /Channels 4 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop} def /ToPSSpace {} def end def /Separation 4 dict dup begin /Channels 1 def /MarksPlate { /findcmykcustomcolor where { pop dup 1 exch ToCMYK 5 -1 roll 1 get findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace {} def end def /Process 4 dict dup begin /Channels 1 def /MarksPlate { isCMYKSep? { 1 exch ToCMYK 4 array astore getplateindex get 0 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace { 4 array copy dup 0 /Separation put } def end def end def /isoverprint { /currentoverprint where {pop currentoverprint}{_of} ifelse } def /version_ge_3010.106 { version {cvr} stopped { pop false }{ 3010.106 ge } ifelse } def end end defaultpacking setpacking userdict /_useSmoothShade false put userdict /_aicmykps false put userdict /_forceToCMYK false put Adobe_level2_AI5 /initialize get exec Adobe_cshow /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_shading_AI8 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla /hungarumlaut/ogonek/caron TE %AI55J_Tsume: None %AI3_BeginEncoding: _Times-Roman Times-Roman [/_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType [161/degree 173/notequal 176/infinity/plusminus/lessequal/greaterequal 181/mu/partialdiff/summation/product/pi/integral 189/Omega 195/radical 197/approxequal 198/Delta 214/divide/lozenge 240/apple /_Symbol_/Symbol 0 0 0 TZ %AI5_Begin_NonPrinting Np %AI3_BeginPattern: (Brick) (Brick) 0 0 72 72 [ %AI3_Tile (0 O 0 R 0.3 0.85 0.85 0 k 0.3 0.85 0.85 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 0 m 0 72 L 72 72 L 72 0 L 0 0 L f %AI6_EndPatternLayer ) & (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 68.4097 m 72 68.4097 l S 0 61.209 m 72 61.209 L S 0 54.0088 m 72 54.0088 L S 0 46.8076 m 72 46.8076 L S 0 39.6084 m 72 39.6084 L S 0 32.4072 m 72 32.4072 L S 0 25.207 m 72 25.207 L S 0 18.0059 m 72 18.0059 L S 0 10.8057 m 72 10.8057 L S 0 3.6064 m 72 3.6064 L S 68.4102 68.4097 m 68.4102 61.2217 l S 54.0098 68.4097 m 54.0098 61.2217 L S 39.6094 68.4097 m 39.6094 61.2217 L S 25.21 68.4097 m 25.21 61.2217 L S 10.8105 68.4097 m 10.8105 61.2217 L S 68.4102 53.9717 m 68.4102 46.7842 l S 54.0098 53.9717 m 54.0098 46.7842 L S 39.6094 53.9717 m 39.6094 46.7842 L S 25.21 53.9717 m 25.21 46.7842 L S 10.8105 53.9717 m 10.8105 46.7842 L S 68.4102 39.5967 m 68.4102 32.4092 l S 54.0098 39.5967 m 54.0098 32.4092 L S 39.6094 39.5967 m 39.6094 32.4092 L S 25.21 39.5967 m 25.21 32.4092 L S 10.8105 39.5967 m 10.8105 32.4092 L S 68.4102 25.2217 m 68.4102 18.0342 l S 54.0098 25.2217 m 54.0098 18.0342 L S 39.6094 25.2217 m 39.6094 18.0342 L S 25.21 25.2217 m 25.21 18.0342 L S 10.8105 25.2217 m 10.8105 18.0342 L S 68.4102 10.7842 m 68.4102 3.5967 l S 54.0098 10.7842 m 54.0098 3.5967 L S 39.6094 10.7842 m 39.6094 3.5967 L S 25.21 10.7842 m 25.21 3.5967 L S 10.8105 10.7842 m 10.8105 3.5967 L S 61.1973 3.5967 m 61.1973 0 L S 46.7969 3.5967 m 46.7969 0 L S 32.3965 3.5967 m 32.3965 0 L S 17.9971 3.5967 m 17.9971 0 L S 3.5967 3.5967 m 3.5967 0 l S 61.1973 18.0342 m 61.1973 10.8467 L S 46.7969 18.0342 m 46.7969 10.8467 L S 32.3965 18.0342 m 32.3965 10.8467 L S 17.9971 18.0342 m 17.9971 10.8467 L S 3.5967 18.0342 m 3.5967 10.8467 l S 61.1973 32.4092 m 61.1973 25.2217 L S 46.7969 32.4092 m 46.7969 25.2217 L S 17.9971 32.4092 m 17.9971 25.2217 L S 3.5967 32.4092 m 3.5967 25.2217 l S 61.1973 46.7842 m 61.1973 39.5967 L S 46.7969 46.7842 m 46.7969 39.5967 L S 32.3965 46.7842 m 32.3965 39.5967 L S 17.9971 46.7842 m 17.9971 39.5967 L S 3.5967 46.7842 m 3.5967 39.5967 l S 61.1973 61.2217 m 61.1973 54.0347 L S 46.7969 61.2217 m 46.7969 54.0347 L S 32.3965 61.2217 m 32.3965 54.0347 L S 17.9971 61.2217 m 17.9971 54.0347 L S 3.5967 61.2217 m 3.5967 54.0347 l S 61.1973 71.959 m 61.1973 68.4717 L S 46.7969 71.959 m 46.7969 68.4717 L S 32.3965 71.959 m 32.3965 68.4717 L S 17.9971 71.959 m 17.9971 68.4717 L S 3.5967 71.959 m 3.5967 68.4717 l S 32.3965 32.4092 m 32.3965 25.2217 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Confetti) (Confetti) 4.85 3.617 76.85 75.617 [ %AI3_Tile (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 4.85 3.617 m 4.85 75.617 L 76.85 75.617 L 76.85 3.617 L 4.85 3.617 L f %AI6_EndPatternLayer ) & (0 O 0 R 0 g 0 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 10.6 64.867 m 7.85 62.867 l S 9.1 8.617 m 6.85 6.867 l S 78.1 68.617 m 74.85 67.867 l S 76.85 56.867 m 74.35 55.117 l S 79.6 51.617 m 76.6 51.617 l S 76.35 44.117 m 73.6 45.867 l S 78.6 35.867 m 76.6 34.367 l S 76.1 23.867 m 73.35 26.117 l S 78.1 12.867 m 73.85 13.617 l S 68.35 14.617 m 66.1 12.867 l S 76.6 30.617 m 73.6 30.617 l S 62.85 58.117 m 60.956 60.941 l S 32.85 59.617 m 31.196 62.181 l S 47.891 64.061 m 49.744 66.742 l S 72.814 2.769 m 73.928 5.729 l S 67.976 2.633 m 67.35 5.909 l S 61.85 27.617 m 59.956 30.441 l S 53.504 56.053 m 51.85 58.617 l S 52.762 1.779 m 52.876 4.776 l S 45.391 5.311 m 47.244 7.992 l S 37.062 3.375 m 35.639 5.43 l S 55.165 34.828 m 57.518 37.491 l S 20.795 3.242 m 22.12 5.193 l S 14.097 4.747 m 15.008 8.965 l S 9.736 1.91 m 8.073 4.225 l S 31.891 5.573 m 32.005 8.571 l S 12.1 70.367 m 15.6 68.867 l S 9.35 54.867 m 9.6 58.117 l S 12.85 31.867 m 14.35 28.117 l S 10.1 37.367 m 12.35 41.117 l S 34.1 71.117 m 31.85 68.617 l S 38.35 71.117 m 41.6 68.367 l S 55.1 71.117 m 58.35 69.117 l S 57.35 65.117 m 55.35 61.867 l S 64.35 66.367 m 69.35 68.617 l S 71.85 62.867 m 69.35 61.117 l S 23.6 70.867 m 23.6 67.867 l S 20.6 65.867 m 17.35 65.367 l S 24.85 61.367 m 25.35 58.117 l S 25.85 65.867 m 29.35 66.617 l S 14.1 54.117 m 16.85 56.117 l S 12.35 11.617 m 12.6 15.617 l S 12.1 19.867 m 14.35 22.367 l S 26.1 9.867 m 23.6 13.367 l S 34.6 47.117 m 32.1 45.367 l S 62.6 41.867 m 59.85 43.367 l S 31.6 35.617 m 27.85 36.367 l S 36.35 26.117 m 34.35 24.617 l S 33.85 14.117 m 31.1 16.367 l S 37.1 9.867 m 35.1 11.117 l S 34.35 20.867 m 31.35 20.867 l S 44.6 56.617 m 42.1 54.867 l S 47.35 51.367 m 44.35 51.367 l S 44.1 43.867 m 41.35 45.617 l S 43.35 33.117 m 42.6 30.617 l S 43.85 23.617 m 41.1 25.867 l S 44.35 15.617 m 42.35 16.867 l S 67.823 31.1 m 64.823 31.1 l S 27.1 32.617 m 29.6 30.867 l S 31.85 55.117 m 34.85 55.117 l S 19.6 40.867 m 22.1 39.117 l S 16.85 35.617 m 19.85 35.617 l S 20.1 28.117 m 22.85 29.867 l S 52.1 42.617 m 54.484 44.178 l S 52.437 50.146 m 54.821 48.325 l S 59.572 54.133 m 59.35 51.117 l S 50.185 10.055 m 53.234 9.928 l S 51.187 15.896 m 53.571 14.075 l S 58.322 19.883 m 59.445 16.823 l S 53.1 32.117 m 50.6 30.367 l S 52.85 24.617 m 49.6 25.617 l S 61.85 9.117 m 59.1 10.867 l S 69.35 34.617 m 66.6 36.367 l S 67.1 23.617 m 65.1 22.117 l S 24.435 46.055 m 27.484 45.928 l S 25.437 51.896 m 27.821 50.075 l S 62.6 47.117 m 65.321 46.575 l S 19.85 19.867 m 20.35 16.617 l S 21.85 21.867 m 25.35 22.617 l S 37.6 62.867 m 41.6 62.117 l S 38.323 42.1 m 38.823 38.6 l S 69.35 52.617 m 66.85 53.867 l S 14.85 62.117 m 18.1 59.367 l S 9.6 46.117 m 7.1 44.367 l S 20.6 51.617 m 18.6 50.117 l S 46.141 70.811 m 47.994 73.492 l S 69.391 40.561 m 71.244 43.242 l S 38.641 49.311 m 39.35 52.117 l S 25.141 16.811 m 25.85 19.617 l S 36.6 32.867 m 34.6 31.367 l S 6.1 68.617 m 2.85 67.867 l S 4.85 56.867 m 2.35 55.117 l S 7.6 51.617 m 4.6 51.617 l S 6.6 35.867 m 4.6 34.367 l S 6.1 12.867 m 1.85 13.617 l S 4.6 30.617 m 1.6 30.617 l S 72.814 74.769 m 73.928 77.729 l S 67.976 74.633 m 67.35 77.909 l S 52.762 73.779 m 52.876 76.776 l S 37.062 75.375 m 35.639 77.43 l S 20.795 75.242 m 22.12 77.193 l S 9.736 73.91 m 8.073 76.225 l S 10.1 23.617 m 6.35 24.367 l S 73.217 18.276 m 71.323 21.1 l S 28.823 39.6 m 29.505 42.389 l S 49.6 38.617 m 47.6 37.117 l S 60.323 73.6 m 62.323 76.6 l S 60.323 1.6 m 62.323 4.6 l S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Leaves - Fall ) (Leaves - Fall ) 0 0 64.0781 78.9336 [ %AI3_Tile (0 O 0 R 0.05 0.2 1 0 k 0.05 0.2 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 64.0781 78.9336 m 64.0781 0 L 0 0 L 0 78.9336 L 64.0781 78.9336 L f %AI6_EndPatternLayer ) & (0 O 0 R 0.83 0 1 0 k 0.83 0 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 1 D 0 XR 29.7578 0.9902 m 30.4346 1.1914 30.7246 1.3428 V 29.2559 4.0547 33.707 8.3359 34.627 9.0762 C 35.2275 8.8506 35.3477 6.3184 34.6699 4.9805 C 35.5137 5.1035 37.7031 3.7256 38.4609 2.4365 C 38.5254 3.125 40.0957 6.0664 40.9219 6.4434 C 40.002 6.8408 39.3359 8.3135 38.5742 9.7617 C 39.5957 9.9287 40.9961 9.0078 42.4668 8.1025 C 42.9814 8.9043 44.3555 9.875 45.6143 10.3916 C 44.5264 11.0781 44.0313 11.8203 43.5352 13.2793 C 42.4922 12.7139 40.3057 12.5645 39.7764 12.8516 C 40.291 13.9648 42.5371 14.5078 43.2676 14.4551 C 43.0137 15.3164 42.8652 17.4697 43.0391 20.0625 C 41.3789 18.7461 39.834 17.4297 38.1738 17.4883 C 38.4434 16.0664 37.8076 14.2607 37.4307 13.7676 C 36.8574 14.5117 36.4463 15.3389 36.8008 17.3164 C 35.3486 17.8008 34.1113 18.3467 32.7373 19.6045 C 32.7373 17.7734 32.166 16.5723 31.2969 15.2959 C 32.5576 14.8076 33.8301 13.6045 33.8252 12.5664 C 32.9775 12.7178 31.2852 13.4619 30.793 14.4551 C 30.0742 13.707 28.3906 12.3984 26.7871 12.3945 C 27.9746 11.5391 28.8945 10.5059 28.9893 8.5938 C 30.2422 9.5645 32.6953 10.1797 34.0752 9.582 C 29.2344 5.3457 29.7031 2.3125 29.7578 0.9902 C f 13.8525 29.9844 m 13.3281 29.5127 13.1309 29.25 V 15.623 27.4326 13.3691 21.6074 12.8555 20.5439 C 12.2168 20.4883 10.8096 23.2285 10.8457 24.7266 C 9.7129 23.9707 8.0488 24.0918 6.4463 24.3779 C 7.0186 23.2891 6.6172 21.3447 5.8164 20.5439 C 6.8184 20.5801 8.1699 19.8652 9.4785 18.8838 C 8.6436 18.0645 6.8164 18.2246 4.9004 18.8838 C 4.9004 17.5107 4.0781 15.7734 3.2412 14.5918 C 4.5576 14.6484 5.7031 13.9629 6.5605 12.9316 C 7.2256 14.5 9.2598 15.6133 10.166 15.5645 C 10.1826 14.1992 8.6094 12.1094 7.5879 11.7109 C 8.1875 11.041 9.207 9.5107 10.166 7.0947 C 10.9648 9.0205 12.1348 10.2627 13.3672 11.1953 C 12.2256 12.7578 12.3994 13.6289 12.7988 15.1074 C 13.541 14.5664 14.5723 14.1338 14.7441 12.1309 C 16.4609 12.416 17.5957 12.3447 19.0938 11.4434 C 18.6387 13.1055 18.6348 14.707 18.9551 16.4063 C 17.1055 16.2666 15.5449 16.4795 14.5156 17.9688 C 15.3457 18.1953 17.6055 18.2549 18.4795 17.3223 C 18.8066 18.3047 19.7012 19.7109 21.1475 20.4043 C 19.707 20.6641 18.7227 21.7637 17.8135 23.4492 C 17.1006 22.0332 14.873 20.3691 13.3711 20.3145 C 15.373 24.3779 15.373 27.2959 13.8525 29.9844 C f 41.2324 26.0742 m 41.5518 26.7021 41.7549 26.959 V 44.1523 25.0176 48.958 28.3262 49.8535 29.0957 C 49.7432 29.7266 47.6182 30.8643 45.9004 29.834 C 46.3408 31.123 45.4395 33.084 44.2402 34.126 C 45.9805 34.0254 48.126 35.3867 48.6484 36.1289 C 48.8701 35.1514 50.0527 33.8809 51.3379 32.8672 C 51.6895 33.8398 50.9941 35.958 50.0781 37.5605 C 51.3125 38.0605 52.4248 38.9912 52.8828 40.25 C 53.3398 38.9336 54.3428 38.2598 55.6875 37.5039 C 54.5273 36.0762 53.7471 33.9023 54.0273 33.0391 C 55.3496 33.374 56.9209 36.0918 57.0439 37.1816 C 57.9189 36.415 59.4727 35.7285 62.0537 35.4219 C 60.3535 34.3438 59.9902 32.3516 59.4063 30.9219 C 58.2588 31.3682 56.0898 31.4277 55.1152 30.8643 C 55.8281 30.2852 57.168 29.7344 59.1777 29.7207 C 59.1777 28.1758 59.6406 27.043 60.8945 25.8281 C 59.1719 25.8418 57.0723 25.3555 55.5762 24.9629 C 55.3281 26.292 54.4844 27.8887 53.3398 28.2891 C 53.334 27.4277 53.5996 25.1797 54.4844 24.5117 C 53.6201 23.9443 52.3672 22.5674 51.9102 20.8496 C 51.2881 22.1758 50.4268 23.4805 48.5645 23.9238 C 49.749 24.9766 50.584 26.9941 50.25 28.4609 C 45.1973 24.4785 42.5215 25.7773 41.2324 26.0742 C f 27.7578 38.7324 m 28.4346 38.9316 28.7246 39.084 V 27.2559 41.7969 31.707 46.0776 32.627 46.8169 C 33.2275 46.5918 33.3477 44.0586 32.6699 42.7227 C 33.5137 42.8457 35.7031 41.4678 36.4609 40.1787 C 36.5254 40.8652 38.0957 43.8066 38.9219 44.1846 C 38.002 44.582 37.3359 46.0547 36.5742 47.5039 C 37.5957 47.6709 38.9961 46.7485 40.4668 45.8438 C 40.9814 46.6445 42.3555 47.6177 43.6143 48.1328 C 42.5264 48.8198 42.0313 49.5615 41.5352 51.0205 C 40.4922 50.4556 38.3057 50.3057 37.7764 50.5938 C 38.291 51.7056 40.5371 52.2485 41.2676 52.1958 C 41.0137 53.0576 40.8652 55.2109 41.0391 57.8037 C 39.3789 56.4878 37.834 55.1719 36.1738 55.2285 C 36.4434 53.8076 35.8076 52.002 35.4307 51.5088 C 34.8574 52.2529 34.4463 53.0796 34.8008 55.0576 C 33.3486 55.5425 32.1113 56.0879 30.7373 57.3467 C 30.7373 55.5146 30.166 54.314 29.2969 53.0366 C 30.5576 52.5488 31.8301 51.3467 31.8252 50.3076 C 30.9775 50.46 29.2852 51.2036 28.793 52.1958 C 28.0742 51.4497 26.3906 50.1396 24.7871 50.1357 C 25.9746 49.2817 26.8945 48.2466 26.9893 46.335 C 28.2422 47.3057 30.6953 47.9209 32.0752 47.3237 C 27.2344 43.0869 27.7031 40.0547 27.7578 38.7324 C f 13.5195 70.3916 m 12.9941 69.9209 12.7988 69.6587 V 15.2891 67.8418 13.0352 62.0146 12.5225 60.9517 C 11.8828 60.8955 10.4766 63.6367 10.5117 65.1348 C 9.3809 64.3789 7.7148 64.4995 6.1133 64.7856 C 6.6855 63.6987 6.2842 61.7529 5.4834 60.9517 C 6.4854 60.9878 7.8359 60.2729 9.1455 59.2925 C 8.3105 58.4717 6.4834 58.6338 4.5674 59.2925 C 4.5674 57.9189 3.7461 56.1816 2.9082 54.9995 C 4.2246 55.0576 5.3691 54.3706 6.2275 53.3408 C 6.8926 54.9097 8.9258 56.0215 9.832 55.9727 C 9.8496 54.6079 8.2764 52.5176 7.2539 52.1187 C 7.8545 51.4497 8.873 49.9189 9.832 47.5039 C 10.6309 49.4297 11.8008 50.6719 13.0342 51.6045 C 11.8926 53.1655 12.0664 54.0366 12.4648 55.5146 C 13.209 54.9746 14.2393 54.5415 14.4102 52.5386 C 16.127 52.8247 17.2637 52.7529 18.7598 51.8525 C 18.3057 53.5137 18.3027 55.1147 18.623 56.8149 C 16.7725 56.6748 15.2129 56.8887 14.1826 58.377 C 15.0117 58.6035 17.2725 58.6626 18.1465 57.731 C 18.4736 58.7129 19.3691 60.1187 20.8145 60.8125 C 19.375 61.0728 18.3896 62.1719 17.4805 63.8579 C 16.7676 62.4429 14.541 60.7769 13.0371 60.7227 C 15.041 64.7856 15.041 67.7046 13.5195 70.3916 C f 41.2324 64.4824 m 41.5518 65.1113 41.7549 65.3682 V 44.1523 63.4272 48.958 66.7354 49.8535 67.5034 C 49.7432 68.1362 47.6182 69.2725 45.9004 68.2422 C 46.3408 69.5313 45.4395 71.4922 44.2402 72.5342 C 45.9805 72.4341 48.126 73.7954 48.6484 74.5371 C 48.8701 73.5601 50.0527 72.29 51.3379 71.2754 C 51.6895 72.249 50.9941 74.3662 50.0781 75.9683 C 51.3125 76.4692 52.4248 77.3994 52.8828 78.6582 C 53.3398 77.3423 54.3428 76.667 55.6875 75.9111 C 54.5273 74.4844 53.7471 72.3101 54.0273 71.4473 C 55.3496 71.7822 56.9209 74.5 57.0439 75.5903 C 57.9189 74.8232 59.4727 74.1372 62.0537 73.8311 C 60.3535 72.7534 59.9902 70.7612 59.4063 69.3301 C 58.2588 69.7773 56.0898 69.8364 55.1152 69.2725 C 55.8281 68.6934 57.168 68.1431 59.1777 68.1284 C 59.1777 66.583 59.6406 65.4512 60.8945 64.2373 C 59.1719 64.249 57.0723 63.7632 55.5762 63.3721 C 55.3281 64.7002 54.4844 66.2974 53.3398 66.6973 C 53.334 65.8364 53.5996 63.5874 54.4844 62.9214 C 53.6201 62.353 52.3672 60.9751 51.9102 59.2583 C 51.2881 60.583 50.4268 61.8882 48.5645 62.333 C 49.749 63.3862 50.584 65.4033 50.25 66.8691 C 45.1973 62.8872 42.5215 64.1851 41.2324 64.4824 C f %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Stripes) (Stripes) 8.45 4.6001 80.45 76.6001 [ %AI3_Tile (0 O 0 R 1 0.07 1 0 k 1 0.07 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 3.6 w 4 M []0 d %AI3_Note: 0 D 0 XR 8.2 8.2 m 80.7 8.2 L S 8.2 22.6001 m 80.7 22.6001 L S 8.2 37.0002 m 80.7 37.0002 L S 8.2 51.4 m 80.7 51.4 L S 8.2 65.8001 m 80.7 65.8001 L S 8.2 15.4 m 80.7 15.4 L S 8.2 29.8001 m 80.7 29.8001 L S 8.2 44.2 m 80.7 44.2 L S 8.2 58.6001 m 80.7 58.6001 L S 8.2 73.0002 m 80.7 73.0002 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_BeginBrushPattern (New Pattern 1) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7834.75 8587 m -7834.75 8563 L -7884.75 8563 L -7884.75 8587 L -7834.75 8587 L n u 0 Ap 0 O 1 g -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C F -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C F -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C F -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C F -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C F -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C F -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C F -7844.7817 8565.125 m -7850.9009 8563.6162 -7854.7817 8565.125 V -7858.877 8563.6484 -7864.7817 8565.125 V -7869.7446 8563.4492 -7874.7817 8565.125 V -7880.7969 8563.5742 -7884.7817 8565.125 V -7884.7817 8584.8096 L -7881.6958 8585.7842 -7878.2969 8585.9912 -7874.3799 8584.9082 C -7868.2134 8586.4912 -7864.4634 8584.9082 V -7859.4634 8586.4912 -7854.3799 8584.8242 V -7850.0474 8586.4082 -7844.3799 8584.9082 V -7838.8799 8586.3242 -7834.7817 8585.125 V -7834.7817 8565.4404 L -7837.5254 8564.4287 -7840.6514 8563.9287 -7844.7817 8565.125 C f 0 R 0 G 1 J 1 j 0.5 w -7864.75 8585 m -7872.54 8586.9473 -7878.813 8583.585 -7884.75 8579.0488 C S -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C S -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C S -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C S -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C S -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C S -7854.75 8565 m -7846.96 8563.0527 -7840.687 8566.415 -7834.75 8570.9512 C S -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C S -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C S U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 2) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7819.187 8586 L -7819.187 8521.9023 L -7884 8521.9023 L -7884 8586 L n u 0 O 0 g -7849.6978 8544.4297 m -7851.6094 8521.9023 L -7853.5215 8544.4297 L -7852.9033 8544.3066 -7852.2642 8544.2402 -7851.6094 8544.2402 c -7850.9551 8544.2402 -7850.3159 8544.3066 -7849.6978 8544.4297 C f -7861.2402 8552.3975 m -7884 8554.3301 L -7861.1138 8556.2734 L -7861.2856 8555.5469 -7861.3848 8554.793 -7861.3848 8554.0156 c -7861.3848 8553.4629 -7861.3281 8552.9248 -7861.2402 8552.3975 C f -7856.519 8545.5723 m -7870.1626 8536.8047 L -7860.2153 8549.377 L -7859.3574 8547.791 -7858.0718 8546.4766 -7856.519 8545.5723 C f -7853.481 8563.6074 m -7851.5786 8586 L -7849.6768 8563.5967 L -7850.3018 8563.7227 -7850.9473 8563.791 -7851.6094 8563.791 c -7852.25 8563.791 -7852.873 8563.7246 -7853.481 8563.6074 C f -7841.9609 8555.5068 m -7819.187 8553.5732 L -7842.083 8551.6289 L -7842.083 8551.8506 L -7841.9258 8552.5488 -7841.834 8553.2695 -7841.834 8554.0156 c -7841.834 8554.5234 -7841.8848 8555.0195 -7841.9609 8555.5068 C f -7860.1138 8558.8262 m -7870.1641 8571.5293 L -7856.2778 8562.6055 L -7857.8823 8561.7305 -7859.2114 8560.416 -7860.1138 8558.8262 C f -7842.9961 8549.3945 m -7832.875 8536.6055 L -7846.7666 8545.5313 L -7845.1768 8546.4414 -7843.8633 8547.7793 -7842.9961 8549.3945 C f -7846.6895 8562.4512 m -7832.873 8571.3281 L -7842.9658 8558.5732 L -7843.8198 8560.1895 -7845.1152 8561.5313 -7846.6895 8562.4512 C f -7842.8887 8558.6133 m -7842.3862 8557.6641 -7842.043 8556.6211 -7841.875 8555.5195 c -7841.7993 8555.0293 -7841.748 8554.5273 -7841.748 8554.0156 c -7841.748 8553.2637 -7841.8398 8552.5352 -7841.998 8551.8311 c -7842.1958 8550.957 -7842.5049 8550.124 -7842.918 8549.3545 c -7843.7954 8547.7246 -7845.1191 8546.374 -7846.7241 8545.4561 c -7847.6294 8544.9375 -7848.6226 8544.5537 -7849.6802 8544.3457 c -7850.3047 8544.2207 -7850.9497 8544.1523 -7851.6094 8544.1523 c -7852.2695 8544.1523 -7852.915 8544.2207 -7853.5391 8544.3457 c -7854.623 8544.5605 -7855.6382 8544.957 -7856.5625 8545.4961 c -7858.1313 8546.4102 -7859.4282 8547.7363 -7860.291 8549.335 c -7860.7969 8550.2695 -7861.145 8551.2969 -7861.3262 8552.3828 c -7861.415 8552.916 -7861.4727 8553.459 -7861.4727 8554.0156 c -7861.4727 8554.8008 -7861.3711 8555.5605 -7861.1978 8556.293 c -7860.981 8557.207 -7860.6406 8558.0732 -7860.187 8558.8701 c -7859.2793 8560.4727 -7857.939 8561.8008 -7856.3174 8562.6826 c -7855.4487 8563.1553 -7854.5 8563.498 -7853.4961 8563.6934 c -7852.8848 8563.8115 -7852.2554 8563.8779 -7851.6094 8563.8779 c -7850.9414 8563.8779 -7850.29 8563.8086 -7849.6602 8563.6826 c -7848.5786 8563.4668 -7847.5664 8563.0654 -7846.6455 8562.5273 c -7845.0566 8561.5977 -7843.751 8560.2441 -7842.8887 8558.6133 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 3) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7874.75 8587 m -7874.75 8563 L -7884.75 8563 L -7884.75 8587 L -7874.75 8587 L n u u 0 Ap 0 O 1 g -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 c -7877.897 8566.9736 -7881.0898 8565 -7884.75 8565 C -7884.75 8585 L -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 c -7881.9121 8584.7754 -7880.1807 8584.0645 -7878.7441 8582.9824 c -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 c f 0 R 0 G 1 J 1 j 0.5 w -7884.75 8565.3174 m -7881.7207 8566.2744 -7878.8926 8567.9326 -7876.1543 8569.9072 C S -7884.75 8570.9512 m -7881.5991 8573.3564 -7878.543 8576.0869 -7875.4058 8578.5361 C S -7878.7441 8582.9824 m -7880.8105 8581.8916 -7882.7993 8580.5342 -7884.75 8579.043 C S -7883.8018 8584.9521 m -7884.1191 8584.8682 -7884.4375 8584.7852 -7884.75 8584.6865 C S -7878.7441 8582.9824 m -7880.1807 8584.0645 -7881.9121 8584.7744 -7883.8018 8584.9521 C S -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 C S -7884.75 8585 m -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 C S -7878.7441 8582.9824 m -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 C S -7876.1543 8569.9072 m -7877.8975 8566.9736 -7881.0898 8565 -7884.75 8565 C S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 5) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7726.3994 8587 m -7726.3994 8573.4199 L -7885 8573.4199 L -7885 8587 L -7726.3994 8587 L n u u 0 O 0.285 0.228 0.171 0 k -7741.0786 8585.4844 m -7741.043 8586.6895 L -7727.5103 8587.5176 -7726.8418 8586.2822 v -7726.7441 8586.1016 -7726.647 8585.7148 -7726.561 8585.1934 C -7728.584 8585.8242 -7738.291 8585.5713 -7741.0786 8585.4844 C f 0.44 0.352 0.264 0 k -7741.4063 8574.0234 m -7741.3711 8575.2676 L -7738.4912 8575.0488 -7728.1914 8574.3164 -7726.543 8574.8652 C -7726.7031 8574.2188 -7726.9199 8573.7646 -7727.2046 8573.6152 c -7728.8306 8572.7656 -7741.4063 8574.0234 Y f 0.145 0.116 0.087 0 k -7741.3711 8575.2676 m -7741.0786 8585.4844 L -7738.291 8585.5713 -7728.584 8585.8242 -7726.561 8585.1934 C -7726.1519 8582.7773 -7725.9258 8577.3604 -7726.543 8574.8652 C -7728.1914 8574.3164 -7738.4912 8575.0488 -7741.3711 8575.2676 C f U u 0.155 0.124 0.093 0 k -7766.9375 8579.2734 m -7765.897 8579.6563 L -7747.0728 8575.1465 L -7747.481 8574.3145 L -7766.3633 8576.7246 L -7767.252 8577.0059 L -7767.6504 8576.8936 -7768.1934 8576.8242 V -7767.6094 8577.2373 -7767.1426 8578.1406 -7766.9375 8579.2734 C f u 0.085 0.068 0.051 0 k -7771.7993 8583.666 m -7772.5977 8583.7217 -7769.749 8583.6641 Y -7770.3481 8583.0176 -7770.771 8581.8203 -7770.8105 8580.4375 c -7770.8169 8580.2246 -7770.8105 8580.0176 -7770.7993 8579.8135 C -7771.041 8579.707 -7771.0918 8579.7734 -7771.6289 8579.5645 C -7771 8583.6113 -7771.7993 8583.666 v f 0.305 0.244 0.183 0 k -7770.3442 8576.8672 m -7770.5527 8576.8105 -7770.4937 8578.9307 Y -7769.4785 8579.7588 L -7767.8359 8578.9434 L -7766.9375 8579.2734 L -7767.1426 8578.1406 -7767.6094 8577.2373 -7768.1934 8576.8242 C -7768.6094 8576.7715 -7769.874 8576.7998 -7770.3442 8576.8672 C f U 0.115 0.092 0.069 0 k -7766.9375 8579.2734 m -7767.8359 8578.9434 L -7769.4785 8579.7588 L -7770.4937 8578.9307 L -7770.793 8579.708 -7770.7993 8579.8135 V -7769.5137 8580.3789 -7768.1831 8580.7402 -7766.8398 8580.9258 C -7766.79 8580.7275 -7766.7842 8580.543 -7766.79 8580.3369 c -7766.7998 8579.9717 -7766.8218 8579.6182 -7766.9375 8579.2734 C f 0.41 0.328 0.246 0 k -7747.4512 8575.3965 m -7749.377 8576.6426 -7758.3862 8582.0986 -7766.8398 8580.9258 C -7766.9038 8582.0928 -7767.248 8583.0908 -7767.75 8583.6631 C -7767.1895 8583.6621 L -7746.7402 8586.7559 L -7747.0366 8576.4258 L -7747.0728 8575.1465 L -7747.2046 8575.2373 -7747.4512 8575.3965 v f 0.395 0.316 0.237 0 k -7770.8105 8580.4375 m -7770.771 8581.8203 -7770.3481 8583.0176 -7769.749 8583.6641 C -7767.6807 8583.6631 L -7767.1782 8583.0908 -7766.8218 8582.0713 -7766.8398 8580.9258 C -7768.1831 8580.7402 -7769.5137 8580.3789 -7770.7993 8579.8135 C -7770.8105 8580.0176 -7770.8169 8580.2246 -7770.8105 8580.4375 c f U u 0 0 0 0.11 k -7741.2642 8574.2012 m -7740.2407 8574.0352 L -7741.2642 8574.2012 L -7741.2642 8574.2012 L f 0 0 0 0.34 k -7747.481 8574.3145 m -7747.0728 8575.1465 L -7745.6714 8574.918 L -7744.5234 8574.7314 L -7742.6758 8574.4307 L -7741.2642 8574.2012 L -7740.2407 8574.0352 L -7740.2954 8573.7168 -7740.3672 8573.498 -7740.4648 8573.4199 C -7747.481 8574.3145 L f 0 0 0 0.32 k -7745.8042 8579.207 m -7746.041 8586.8613 L -7740.7144 8587 L -7739.7266 8583.5146 -7740.1816 8579.1543 V -7745.8042 8579.207 L f U 0.025 0.02 0.015 0 k -7739.3223 8576.3848 m -7736.373 8576.9199 -7733.2402 8577.1602 -7730.3159 8576.3613 c -7730.2856 8576.3496 -7730.2754 8576.3184 -7730.2871 8576.2969 c -7730.2881 8576.2656 -7730.3198 8576.2559 -7730.3418 8576.2559 c -7733.2422 8577.0645 -7736.375 8576.8242 -7739.3042 8576.2783 c -7739.3262 8576.2793 -7739.3574 8576.291 -7739.3672 8576.3223 c -7739.3662 8576.3438 -7739.355 8576.375 -7739.3223 8576.3848 c -7739.3223 8576.3848 l f -7737.8374 8575.3076 m -7737.7295 8575.3789 -7737.6313 8575.4941 -7737.5234 8575.502 c -7733.7886 8575.832 -7730.1631 8575.7813 -7726.4746 8575.6641 c -7726.4526 8575.6641 -7726.4209 8575.6426 -7726.4214 8575.6211 c -7726.4214 8575.5879 -7726.4551 8575.5684 -7726.4766 8575.5684 c -7729.3223 8575.6816 -7732.1401 8575.6992 -7735.0039 8575.5352 c -7735.9336 8575.4766 -7736.9082 8575.7402 -7737.7778 8575.2207 c -7737.7993 8575.2109 -7737.8306 8575.2109 -7737.8506 8575.2334 c -7737.8618 8575.2559 -7737.8594 8575.2871 -7737.8374 8575.3076 c -7737.8374 8575.3076 l f -7733.373 8577.3672 m -7731.5098 8578.6797 -7729.3022 8579.374 -7727.1001 8579.8867 c -7727.0679 8579.8965 -7727.0474 8579.8848 -7727.0366 8579.8535 c -7727.0273 8579.8203 -7727.0488 8579.8008 -7727.0703 8579.79 c -7729.2617 8579.2656 -7731.459 8578.6035 -7733.3105 8577.2803 c -7733.3433 8577.2598 -7733.375 8577.2715 -7733.3848 8577.293 c -7733.4058 8577.3145 -7733.3945 8577.3457 -7733.373 8577.3672 c -7733.373 8577.3672 l f -7738.9321 8584.0566 m -7736.7295 8584.5703 -7734.5298 8585.0303 -7732.2798 8585.2754 c -7732.2598 8585.2852 -7732.229 8585.2637 -7732.229 8585.2422 c -7732.2183 8585.209 -7732.2407 8585.1777 -7732.2729 8585.1787 c -7734.5122 8584.8809 -7736.7305 8584.5176 -7738.9126 8583.9502 c -7738.9351 8583.9512 -7738.9673 8583.9629 -7738.9766 8583.9941 c -7738.9751 8584.0156 -7738.9648 8584.0479 -7738.9321 8584.0566 c -7738.9321 8584.0566 l f -7738.439 8583.3604 m -7736.3457 8584.1973 -7734.1016 8583.9297 -7731.9023 8583.9629 c -7731.8706 8583.9609 -7731.8496 8583.9395 -7731.8506 8583.9082 c -7731.8521 8583.875 -7731.873 8583.8555 -7731.8945 8583.8555 c -7734.0928 8583.8438 -7736.3374 8584.0996 -7738.4209 8583.2529 c -7738.4434 8583.2539 -7738.4746 8583.2656 -7738.4834 8583.2969 c -7738.4834 8583.3184 -7738.4722 8583.3506 -7738.439 8583.3604 c -7738.439 8583.3604 l f -7737.707 8584.7051 m -7736.3833 8584.752 -7735.1504 8584.5469 -7733.8271 8584.209 c -7733.3594 8584.0996 -7732.9199 8584.2266 -7732.4609 8584.2129 c -7731.897 8584.1973 l -7731.874 8584.1963 -7731.8633 8584.1855 -7731.8535 8584.1738 c -7731.834 8584.1523 -7731.8442 8584.1211 -7731.8662 8584.0996 c -7732.0625 8583.9453 l -7732.0742 8583.9453 -7732.085 8583.9355 -7732.0962 8583.9355 c -7732.5 8583.9473 l -7733.9551 8584.1914 -7735.457 8584.6719 -7736.8926 8584.0742 c -7736.9258 8584.0645 -7736.957 8584.0859 -7736.9673 8584.1074 c -7736.9673 8584.1396 -7736.9551 8584.1602 -7736.9336 8584.1709 c -7735.647 8584.6992 -7734.1714 8584.4756 -7732.8818 8584.0547 c -7732.0918 8584.043 L -7732.124 8584.0332 L -7731.9282 8584.1875 L -7731.8984 8584.0898 L -7732.4639 8584.1064 l -7732.9321 8584.1406 -7733.3848 8583.9834 -7733.8398 8584.1035 c -7735.1543 8584.4609 -7736.3975 8584.625 -7737.71 8584.5986 c -7737.7422 8584.5996 -7737.7642 8584.6211 -7737.7617 8584.6533 c -7737.7617 8584.6855 -7737.7402 8584.7061 -7737.707 8584.7051 c -7737.707 8584.7051 l f -7738.5718 8585.0605 m -7735.8711 8586.2207 -7732.9023 8585.5703 -7730.1279 8585.1816 c -7729.7832 8585.2891 l -7729.7617 8585.2988 -7729.7417 8585.2871 -7729.7207 8585.2656 c -7729.71 8585.2441 -7729.7217 8585.2129 -7729.7422 8585.2021 c -7730.0801 8585.0098 l -7732.7754 8584.3926 -7735.5391 8584.7813 -7738.271 8584.7852 c -7738.3022 8584.7871 -7738.3232 8584.8086 -7738.3223 8584.8398 c -7738.3198 8584.8721 -7738.2983 8584.8926 -7738.2681 8584.8926 c -7735.6738 8584.9355 -7733.0303 8584.4434 -7730.4727 8585.0742 c -7729.7954 8585.2891 L -7729.7534 8585.1914 L -7730.1406 8585.0859 l -7732.9058 8585.4424 -7735.8418 8586.1348 -7738.5313 8584.9746 c -7738.5537 8584.9648 -7738.585 8584.9648 -7738.5962 8584.998 c -7738.6055 8585.0195 -7738.605 8585.0508 -7738.5718 8585.0605 c -7738.5718 8585.0605 l f -7735.6895 8578.3945 m -7734.3945 8578.9004 -7732.9834 8578.6465 -7731.6802 8578.3438 c -7731.647 8578.3418 -7731.6367 8578.3203 -7731.6382 8578.2891 c -7731.6504 8578.2568 -7731.6714 8578.2461 -7731.7031 8578.248 c -7732.998 8578.5303 -7734.377 8578.8154 -7735.6504 8578.2969 c -7735.6826 8578.2871 -7735.7144 8578.2988 -7735.7246 8578.3311 c -7735.7222 8578.3525 -7735.7114 8578.3848 -7735.6895 8578.3945 c -7735.6895 8578.3945 l f -7736.1401 8580.2207 m -7734.2266 8580.6895 -7732.3145 8581.1035 -7730.355 8581.3242 c -7730.3242 8581.334 -7730.3022 8581.3125 -7730.293 8581.2803 c -7730.2954 8581.2598 -7730.3159 8581.2285 -7730.3374 8581.2285 c -7732.2959 8581.0078 -7734.209 8580.582 -7736.1206 8580.1133 c -7736.1426 8580.1152 -7736.1738 8580.126 -7736.1831 8580.1582 c -7736.1831 8580.1797 -7736.1719 8580.2109 -7736.1401 8580.2207 c -7736.1401 8580.2207 l f -7736.9336 8582.6348 m -7734.499 8583.4609 -7731.8647 8583.0547 -7729.3457 8583.0879 c -7729.313 8583.0879 -7729.293 8583.0664 -7729.293 8583.0332 c -7729.2954 8583.0117 -7729.3159 8582.9922 -7729.3481 8582.9922 c -7731.8574 8582.916 -7734.481 8583.3848 -7736.8945 8582.5264 c -7736.9282 8582.5273 -7736.959 8582.5391 -7736.9688 8582.5605 c -7736.9678 8582.5918 -7736.9561 8582.624 -7736.9336 8582.6348 c -7736.9336 8582.6348 l f -7732.0542 8583.8496 m -7730.6582 8584.5449 -7729.0503 8584.4033 -7727.5342 8584.4668 c -7727.502 8584.4648 -7727.4824 8584.4434 -7727.4824 8584.4121 c -7727.4834 8584.3906 -7727.5054 8584.3594 -7727.5366 8584.3594 c -7729.0137 8584.2207 -7730.6489 8584.5234 -7732.0039 8583.7617 c -7732.0366 8583.7529 -7732.0679 8583.7637 -7732.0786 8583.7861 c -7732.0879 8583.8076 -7732.0767 8583.8398 -7732.0542 8583.8496 c -7732.0542 8583.8496 l f -7731.3418 8580.4248 m -7730.3926 8580.3975 -7729.4336 8580.3701 -7728.4839 8580.3428 c -7728.4526 8580.3418 -7728.4312 8580.3203 -7728.4336 8580.2881 c -7728.4336 8580.2559 -7728.4551 8580.2354 -7728.4878 8580.2363 c -7729.437 8580.2637 -7730.397 8580.291 -7731.3457 8580.3184 c -7731.377 8580.3184 -7731.3975 8580.3418 -7731.3975 8580.373 c -7731.397 8580.4043 -7731.374 8580.4258 -7731.3418 8580.4248 c -7731.3418 8580.4248 l f -7729.1592 8578.0361 m -7728.6895 8578.0645 -7728.209 8578.0723 -7727.7383 8578.0918 c -7727.7168 8578.0908 -7727.6855 8578.0684 -7727.6865 8578.0371 c -7727.687 8578.0039 -7727.71 8577.9844 -7727.7417 8577.9844 c -7728.2114 8577.9873 -7728.6816 8577.9375 -7729.1514 8577.9395 c -7729.1831 8577.9297 -7729.2031 8577.9512 -7729.2134 8577.9844 c -7729.2129 8578.0156 -7729.1914 8578.0371 -7729.1592 8578.0361 c -7729.1592 8578.0361 l f -7736.9702 8580.2344 m -7736.5688 8580.5107 -7736.125 8580.6797 -7735.645 8580.751 c -7735.6113 8580.7607 -7735.5918 8580.7383 -7735.5806 8580.7168 c -7735.5703 8580.6855 -7735.5928 8580.6543 -7735.6152 8580.6543 c -7736.0854 8580.5723 -7736.5176 8580.4023 -7736.9209 8580.1475 c -7736.9521 8580.1377 -7736.9849 8580.1387 -7736.9946 8580.1709 c -7737.0039 8580.1934 -7736.9922 8580.2246 -7736.9702 8580.2344 c -7736.9702 8580.2344 l f -7738.1904 8586.085 m -7735.7344 8586.5273 -7733.2983 8587.001 -7730.7993 8586.7266 c -7730.7778 8586.7266 -7730.7568 8586.7041 -7730.7578 8586.6719 c -7730.7578 8586.6406 -7730.7798 8586.6191 -7730.8022 8586.6191 c -7733.291 8586.873 -7735.7344 8586.4844 -7738.1719 8585.9775 c -7738.1934 8585.9785 -7738.2256 8585.9902 -7738.2344 8586.0215 c -7738.2344 8586.043 -7738.2222 8586.0752 -7738.1904 8586.085 c -7738.1904 8586.085 l f 0.195 0.156 0.117 0 k -7738.166 8574.6445 m -7735.7969 8574.2676 -7733.4058 8574.3477 -7731.0298 8574.5898 c -7730.998 8574.5879 -7730.9766 8574.5664 -7730.9766 8574.5352 c -7730.9785 8574.5137 -7731 8574.4824 -7731.0215 8574.4824 c -7733.4082 8574.2422 -7735.791 8574.1602 -7738.1694 8574.5391 c -7738.2026 8574.5391 -7738.2222 8574.5605 -7738.2217 8574.5938 c -7738.2207 8574.625 -7738.1992 8574.6465 -7738.166 8574.6445 c -7738.166 8574.6445 l f 0.335 0.268 0.201 0 k -7737.4351 8574.1113 m -7734.9282 8574.1152 -7732.4146 8574.2773 -7729.918 8573.8965 c -7729.8862 8573.8945 -7729.8647 8573.873 -7729.8662 8573.8418 c -7729.8672 8573.8086 -7729.8896 8573.7891 -7729.9209 8573.7891 c -7732.418 8574.1699 -7734.9297 8574.0293 -7737.4375 8574.0059 c -7737.46 8574.0059 -7737.481 8574.0273 -7737.4785 8574.0596 c -7737.4785 8574.0918 -7737.457 8574.1123 -7737.4351 8574.1113 c -7737.4351 8574.1113 l f 0.205 0.164 0.123 0 k -7738.9766 8574.3262 m -7737.5039 8574.668 -7736.0078 8574.4023 -7734.5391 8574.2207 c -7734.5078 8574.2207 -7734.4873 8574.1973 -7734.499 8574.166 c -7734.5 8574.1348 -7734.5215 8574.1133 -7734.5537 8574.125 c -7736.0103 8574.2842 -7737.4961 8574.583 -7738.9473 8574.2188 c -7738.9785 8574.2207 -7739.0103 8574.2324 -7739.0098 8574.2637 c -7739.019 8574.2852 -7738.998 8574.3164 -7738.9766 8574.3262 c -7738.9766 8574.3262 l f -7732.3535 8573.7949 m -7731.1978 8573.9219 -7730.0273 8573.8145 -7728.8926 8573.5898 c -7728.8711 8573.5781 -7728.8506 8573.5566 -7728.8618 8573.5244 c -7728.8623 8573.5029 -7728.8945 8573.4824 -7728.916 8573.4941 c -7730.0503 8573.7402 -7731.1914 8573.7939 -7732.3462 8573.6885 c -7732.3794 8573.6895 -7732.3984 8573.7109 -7732.4087 8573.7324 c -7732.4082 8573.7646 -7732.3862 8573.7852 -7732.3535 8573.7949 c -7732.3535 8573.7949 l f 0.335 0.268 0.201 0 k -7739.2681 8576.4473 m -7737.9214 8577.1885 -7736.3066 8576.5977 -7734.855 8576.6416 c -7734.8223 8576.6406 -7734.8022 8576.6191 -7734.8022 8576.5859 c -7734.8042 8576.5654 -7734.8262 8576.5449 -7734.8574 8576.5449 c -7736.2886 8576.4902 -7737.8823 8577.0801 -7739.2168 8576.3506 c -7739.2383 8576.3398 -7739.2695 8576.3516 -7739.291 8576.374 c -7739.3008 8576.3955 -7739.2886 8576.4277 -7739.2681 8576.4473 c -7739.2681 8576.4473 l f -7737.8945 8578.5645 m -7735.6719 8579.0449 -7733.3896 8578.6162 -7731.1504 8578.5625 c -7731.1177 8578.5615 -7731.0977 8578.5391 -7731.0977 8578.5078 c -7731.1001 8578.4863 -7731.1318 8578.4668 -7731.1519 8578.4668 c -7733.3833 8578.4775 -7735.6519 8578.9805 -7737.875 8578.457 c -7737.8975 8578.457 -7737.9287 8578.4688 -7737.9375 8578.502 c -7737.9375 8578.5225 -7737.9258 8578.5547 -7737.8945 8578.5645 c -7737.8945 8578.5645 l f -7732.0273 8575.1406 m -7730.3496 8575.9688 -7728.499 8576.502 -7726.603 8576.3613 c -7726.5718 8576.3613 -7726.5513 8576.3389 -7726.5527 8576.3066 c -7726.5527 8576.2754 -7726.5742 8576.2539 -7726.6074 8576.2559 c -7728.481 8576.416 -7730.3198 8575.8604 -7731.9873 8575.0547 c -7732.0078 8575.0449 -7732.041 8575.0449 -7732.0503 8575.0781 c -7732.061 8575.0996 -7732.061 8575.1309 -7732.0273 8575.1406 c -7732.0273 8575.1406 l f u 0.5 0.85 1 0.45 k -7885 8581.9082 m -7885.0254 8582.4883 -7884.5664 8583.1875 -7883.167 8583.9902 C -7882.8521 8584.0029 -7881.3945 8584.0234 -7879.0889 8584.0488 C -7879.0889 8581.8223 L -7881.1382 8581.8457 -7883.1177 8581.8867 -7885 8581.9082 C f -7884.5088 8580.9688 m -7879.0889 8580.8447 L -7879.0889 8579.8145 L -7882.644 8579.959 L -7883.8145 8580.3301 -7884.5088 8580.9688 V f 0.5 0.85 1 0.32 k -7879.0889 8580.8252 m -7884.4746 8580.9434 L -7884.7695 8581.2148 -7884.9849 8581.5566 -7885 8581.9277 C -7883.1177 8581.9063 -7881.1382 8581.8848 -7879.0889 8581.8613 C -7879.0889 8580.8252 L f 0.5 0.85 1 0.45 k -7774.1504 8580.6172 m -7852.3584 8581.541 -7879.1079 8581.8418 V -7879.1079 8584.0488 L -7862.8145 8584.2324 -7803.9902 8584.707 Y -7769.749 8583.6641 L -7770.457 8580.5684 L -7774.1504 8580.6172 L f 0.5 0.85 1 0.12 k -7879.1079 8579.8145 m -7879.1079 8580.8447 L -7770.4258 8579 L -7770.3833 8576.8633 L -7803.6553 8576.7129 L -7879.1079 8579.8145 L f u 0.065 0.052 0.039 0 k -7747.0728 8575.1465 m -7747.0366 8576.4258 L -7747.2954 8575.1172 L -7765.897 8579.6563 L -7766.9375 8579.2734 L -7766.8794 8579.6055 -7766.8398 8579.957 -7766.8306 8580.3223 c -7766.8242 8580.5283 -7766.8281 8580.7285 -7766.8398 8580.9258 C -7758.3862 8582.0986 -7748.9634 8577.6719 -7747.0366 8576.4258 C -7746.7402 8586.7559 L -7746.041 8586.8613 L -7745.8042 8579.207 L -7740.1816 8579.1543 L -7740.0898 8577.0137 -7740.0718 8575.0215 -7740.2407 8574.0352 C -7747.0728 8575.1465 L f 0.4 0.7 1 0 k -7770.457 8580.5879 m -7770.4258 8578.9805 L -7879.1079 8580.8252 L -7879.1079 8581.8613 L -7852.3584 8581.5605 -7770.457 8580.5879 Y f U U 0.025 0.02 0.015 0 k -7734.7344 8583.0293 m -7734.7344 8583.0625 -7734.7129 8583.082 -7734.6802 8583.082 c -7731.6714 8583.1133 -7729.4214 8582.9453 -7726.415 8582.8594 C -7726.4087 8582.7656 L -7729.3262 8582.8701 -7731.7607 8583.0078 -7734.6841 8582.9746 C -7734.7168 8582.9766 -7734.7358 8582.998 -7734.7344 8583.0293 C f -7726.3994 8582.7656 m -7726.4082 8582.7441 L -7726.4087 8582.7656 L -7726.4063 8582.7656 -7726.4033 8582.7656 -7726.3994 8582.7656 C f -7730.4487 8581.4238 m -7731.4458 8581.292 -7732.3394 8581.7656 -7733.2114 8582.1973 C -7733.2441 8582.208 -7733.2534 8582.2402 -7733.2422 8582.2715 C -7733.2305 8582.293 -7733.1982 8582.3027 -7733.1777 8582.291 c -7732.3262 8581.8301 -7731.4312 8581.4199 -7730.4678 8581.5195 c -7729.1079 8581.6621 -7727.9038 8582.375 -7726.5254 8582.4531 C -7726.4463 8582.3594 L -7728.04 8582.2656 -7728.8647 8581.623 -7730.4487 8581.4238 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 6) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.75 8563 m -7884.75 8587 L -7874.75 8587 L -7874.75 8563 L -7884.75 8563 L n 0 Ap 0 O 1 g -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 c -7877.5879 8565.2256 -7879.3198 8565.9346 -7880.7559 8567.0176 c -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 c -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.2319 8578.5996 -7883.3457 8580.0918 c -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C -7874.75 8565 L f 0 R 0 G 1 J 1 j 0.5 w -7874.75 8584.6816 m -7877.7793 8583.7256 -7880.6074 8582.0674 -7883.3457 8580.0918 C S -7874.75 8579.0488 m -7877.8999 8576.6436 -7880.957 8573.9131 -7884.0942 8571.4639 C S -7880.7559 8567.0176 m -7878.6904 8568.1084 -7876.7017 8569.4668 -7874.75 8570.957 C S -7875.6982 8565.0479 m -7875.3809 8565.1309 -7875.063 8565.2148 -7874.75 8565.3145 C S -7880.7559 8567.0176 m -7879.3193 8565.9355 -7877.5879 8565.2256 -7875.6982 8565.0479 C S -7884.0942 8571.4639 m -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.231 8578.5996 -7883.3457 8580.0918 C S -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 C S -7880.7559 8567.0176 m -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 C S -7883.3457 8580.0918 m -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C S U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 8) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.9521 8584.3125 m -7776.7954 8584.3125 L -7776.7954 8570.1855 L -7883.9521 8570.1855 L -7883.9521 8584.3125 L n u 0 O 0 0 0 1 k -7882.2832 8583.623 m -7882.8535 8586 -7882.8184 8582.0039 V -7883.0479 8578.8027 L -7883.6167 8576.4551 L -7883.4502 8574.123 L -7881.9502 8573.4551 -7865.2832 8572.123 V -7858.6167 8570.7891 -7849.6167 8570.7891 V -7784.3936 8571.4766 -7779.4912 8572.8848 v -7820.3882 8570.875 -7822.9688 8571.5117 v -7783.8569 8573.1602 -7780.8545 8574.4316 v -7818.79 8572.5469 -7822.167 8574.1777 v -7787.249 8575.9102 -7783.021 8577.5313 v -7789.7217 8576.8828 -7791.5127 8577.082 v -7788.3896 8577.5703 l -7793.4194 8577.502 l -7796.3218 8577.1289 l -7788.4521 8578.2422 -7787.9033 8578.8086 v -7784.3154 8578.1309 -7798.5186 8578.3848 v -7832.1177 8574.4551 -7882.2832 8583.623 V f /BBAccumRotation (5.805971) XT 0 R 0 0 0 0.5 K 0.025 w -7883.9502 8573.123 m -7863.667 8571.2949 -7843.9727 8570.2207 v -7801.1514 8570.502 -7796.5737 8570.9004 v -7784.1631 8571.0313 -7776.7959 8572.0273 v S /BBAccumRotation (5.805971) XT 0 0 0 1 K -7821.8369 8570.4082 m -7825.2959 8570.0273 -7851.2607 8570.2793 Y -7861.627 8570.1602 -7883.9502 8573.123 Y S /BBAccumRotation (5.805971) XT -7820.9873 8573.6641 m -7790.3608 8574.582 -7783.6606 8575.2324 v S /BBAccumRotation (5.805971) XT 0 0 0 0.5 K -7829.6201 8578.2051 m -7794.3706 8579.6172 -7791.4058 8580.1406 v S /BBAccumRotation (5.805971) XT U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 10) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7833.8921 8586 L -7833.8921 8529.9756 L -7884 8529.9756 L -7884 8586 L n u 0 O 0.1 1 1 0 k -7846.9014 8551.5752 m -7848.7178 8545.0957 -7858.8247 8548.4658 Y -7858.791 8548.5303 L -7868.8999 8545.1611 -7870.7144 8551.6396 V -7876.6758 8569.0068 -7871.4922 8575.7451 V -7864.7529 8585.3369 -7860.6055 8585.3369 V -7857.0103 8585.2705 L -7852.8638 8585.2705 -7846.125 8575.6816 Y -7840.9409 8568.9424 -7846.9014 8551.5752 Y f u 0 0 0 1 k -7851.3926 8529.9756 m -7852.1167 8531.4199 -7852.9238 8532.4756 V -7852.4058 8532.0635 -7851.5151 8531.1924 -7851.3926 8529.9756 C f -7865.064 8532.4854 m -7865.8711 8531.4307 -7866.5942 8529.9863 Y -7866.4727 8531.2021 -7865.582 8532.0732 -7865.064 8532.4854 C f U 0 0.61 0.74 0 k -7850.5977 8554.4609 m -7851.9038 8549.7959 -7859.1816 8552.2217 Y -7859.1567 8552.2686 L -7866.436 8549.8428 -7867.7417 8554.5078 V -7872.0337 8567.0117 -7868.3018 8571.8633 V -7863.4487 8578.7686 -7860.4634 8578.7686 V -7857.875 8578.7227 L -7854.8887 8578.7227 -7850.0366 8571.8174 Y -7846.3042 8566.9639 -7850.5977 8554.4609 Y f u 1 Ap 0.73 0.43 1 0.22 k 0 R 0 0 0 1 K -7854.6226 8557.2754 m -7853.813 8557.2754 -7853.1558 8556.6182 -7853.1558 8555.8096 c -7853.1558 8555 -7853.813 8554.3428 -7854.6226 8554.3428 c -7855.4321 8554.3428 -7856.0889 8555 -7856.0889 8555.8096 c -7856.0889 8556.6182 -7855.4321 8557.2754 -7854.6226 8557.2754 c b -7854.3638 8568.9971 m -7853.0806 8568.9971 -7852.0415 8568.1201 -7852.0415 8567.042 c -7852.0415 8565.9619 -7853.0806 8565.0869 -7854.3638 8565.0869 c -7855.645 8565.0869 -7856.6846 8565.9619 -7856.6846 8567.042 c -7856.6846 8568.1201 -7855.645 8568.9971 -7854.3638 8568.9971 c b -7853.834 8580.7861 m -7852.2817 8580.7861 -7851.0239 8580.1299 -7851.0239 8579.3213 c -7851.0239 8578.5117 -7852.2817 8577.8545 -7853.834 8577.8545 c -7855.3862 8577.8545 -7856.645 8578.5117 -7856.645 8579.3213 c -7856.645 8580.1299 -7855.3862 8580.7861 -7853.834 8580.7861 c b -7849.6104 8552.5264 m -7848.8687 8552.5264 -7848.2671 8551.8154 -7848.2671 8550.9365 c -7848.2671 8550.0596 -7848.8687 8549.3477 -7849.6104 8549.3477 c -7850.353 8549.3477 -7850.9546 8550.0596 -7850.9546 8550.9365 c -7850.9546 8551.8154 -7850.353 8552.5264 -7849.6104 8552.5264 c b -7848.0034 8574.083 m -7848.8818 8573.7354 -7849.1494 8572.335 -7848.603 8570.9541 c -7848.0566 8569.5752 -7846.9014 8568.7363 -7846.0234 8569.085 c -7845.145 8569.4326 -7844.877 8570.833 -7845.4233 8572.2139 c -7845.9702 8573.5947 -7847.125 8574.4316 -7848.0034 8574.083 c b u -7863.0566 8557.1592 m -7863.8662 8557.1592 -7864.5239 8556.502 -7864.5239 8555.6934 c -7864.5239 8554.8828 -7863.8662 8554.2266 -7863.0566 8554.2266 c -7862.248 8554.2266 -7861.5913 8554.8828 -7861.5913 8555.6934 c -7861.5913 8556.502 -7862.248 8557.1592 -7863.0566 8557.1592 c b -7863.3159 8568.8799 m -7864.5991 8568.8799 -7865.6382 8568.0049 -7865.6382 8566.9248 c -7865.6382 8565.8447 -7864.5991 8564.9697 -7863.3159 8564.9697 c -7862.0342 8564.9697 -7860.9951 8565.8447 -7860.9951 8566.9248 c -7860.9951 8568.0049 -7862.0342 8568.8799 -7863.3159 8568.8799 c b -7863.8457 8580.6709 m -7865.3975 8580.6709 -7866.6558 8580.0146 -7866.6558 8579.2041 c -7866.6558 8578.3936 -7865.3975 8577.7383 -7863.8457 8577.7383 c -7862.293 8577.7383 -7861.0352 8578.3936 -7861.0352 8579.2041 c -7861.0352 8580.0146 -7862.293 8580.6709 -7863.8457 8580.6709 c b -7868.0679 8552.4092 m -7868.811 8552.4092 -7869.4121 8551.6982 -7869.4121 8550.8213 c -7869.4121 8549.9443 -7868.811 8549.2334 -7868.0679 8549.2334 c -7867.3262 8549.2334 -7866.7241 8549.9443 -7866.7241 8550.8213 c -7866.7241 8551.6982 -7867.3262 8552.4092 -7868.0679 8552.4092 c b -7869.6758 8573.9678 m -7868.7983 8573.6201 -7868.5298 8572.2188 -7869.0762 8570.8379 c -7869.6226 8569.457 -7870.7778 8568.6201 -7871.6558 8568.9678 c -7872.5342 8569.3164 -7872.8032 8570.7178 -7872.2568 8572.0967 c -7871.7104 8573.4775 -7870.5552 8574.3154 -7869.6758 8573.9678 c b U U 0 Ap 0 0 0 1 k -7859.1318 8552.6553 m -7859.1318 8585.3145 l F u -7843.3906 8538.5303 m -7844.0815 8537.8369 -7847.019 8538.7021 Y -7848.229 8538.874 -7848.0562 8541.2939 Y -7847.019 8543.3682 -7847.7104 8543.1943 Y -7848.2998 8543.1943 -7849.855 8543.1143 -7850.7822 8543.0635 C -7851.1226 8541.6689 -7852.6128 8540.4756 -7854.7217 8539.7695 C -7852.7578 8536.4775 -7854.5176 8535.7949 -7856.2935 8535.79 C -7856.3096 8535.7021 -7856.332 8535.6162 -7856.3599 8535.5332 C -7854.1089 8535.5791 -7853.6392 8533.2588 Y -7853.4048 8533.0635 -7853.1606 8532.7861 -7852.9238 8532.4756 C -7853.1416 8532.6475 -7853.2944 8532.7393 Y -7854.2583 8532.7393 -7855.8774 8534.4941 -7856.4966 8535.207 C -7856.9194 8534.4434 -7857.853 8533.9111 -7858.9434 8533.9111 c -7860.0698 8533.9111 -7861.0322 8534.4795 -7861.4312 8535.2852 C -7861.9985 8534.624 -7863.6968 8532.751 -7864.6943 8532.751 C -7864.8462 8532.6572 -7865.064 8532.4854 V -7864.8281 8532.7939 -7864.583 8533.0732 -7864.3481 8533.2686 C -7863.8638 8535.6563 -7861.5254 8535.5342 V -7861.5449 8535.5889 -7861.5674 8535.6436 -7861.5806 8535.7021 C -7864.9238 8535.6924 -7863.937 8538.3174 -7863.2104 8539.6602 C -7865.5918 8540.376 -7867.2646 8541.7012 -7867.5239 8543.25 C -7868.4473 8543.2998 -7869.6729 8543.3584 -7870.1802 8543.3584 C -7870.8726 8543.5313 -7869.835 8541.458 V -7869.6626 8539.0391 -7870.8726 8538.8662 V -7873.8096 8538.002 -7874.501 8538.6934 V -7875.1919 8539.5566 -7876.0562 8538.3467 V -7875.1919 8540.0752 -7873.291 8539.5566 V -7870.6982 8538.8662 -7871.3906 8540.5938 V -7871.9087 8544.0498 -7870.1802 8544.7402 V -7868.0342 8545.8545 -7866.2822 8546.0889 V -7865.9087 8546.4141 -7865.4639 8546.7109 -7864.958 8546.9766 C -7867.5562 8547.0469 -7870.2246 8547.9209 -7871.0752 8550.9561 C -7871.5151 8552.2432 -7872.0518 8554.2432 V -7873.1025 8554.8252 -7874.3022 8556.0078 -7875.541 8558.2627 C -7876.394 8561.4502 -7877.167 8556.7129 V -7878.3975 8553.6494 -7879.6504 8553.5381 V -7878.4702 8555.2871 -7878.9038 8556.416 V -7877.2998 8560.917 -7875.6138 8559.8994 V -7874.0986 8559.2197 -7872.688 8556.8154 V -7873.0698 8558.4971 -7873.4326 8560.417 -7873.6743 8562.3906 C -7874.4888 8562.3975 L -7876.3506 8561.4795 -7876.3262 8564.959 V -7877.1226 8568.9453 -7876.3594 8571.6826 V -7875.647 8574.1504 -7878.1274 8572.9307 V -7879.2842 8573.3242 -7879.9839 8572.7881 V -7882.3882 8571.4131 -7884 8573.124 V -7882.147 8572.8799 -7881.4482 8573.417 V -7879.9785 8573.5615 -7879.897 8574.1787 V -7876.9561 8574.8555 -7876.188 8574.0771 V -7874.417 8573.2139 -7875.1304 8570.3604 V -7875.8799 8562.4814 -7874.3198 8564.4053 V -7874.1182 8564.4219 -7873.8784 8564.5176 V -7874.1519 8568.4326 -7873.8018 8572.3252 -7871.9961 8574.8516 C -7875.4536 8567.333 -7870.2974 8552.3037 Y -7868.9609 8547.5303 -7863.127 8548.1016 -7860.145 8548.7344 C -7860.0718 8550.1299 -7859.8374 8551.9492 -7859.1318 8552.6553 C -7858.2134 8550.6963 -7858.2358 8549.0732 V -7857.0762 8548.7217 -7850.2817 8546.8447 -7847.4487 8550.3369 C -7848.4312 8547.8135 -7850.8262 8547.0186 -7853.2007 8546.9189 C -7852.667 8546.6318 -7852.2041 8546.3047 -7851.8257 8545.9502 C -7850.041 8545.7861 -7847.7104 8544.5771 Y -7845.9814 8543.8857 -7846.5015 8540.4307 Y -7847.1919 8538.7021 -7844.5991 8539.3936 Y -7842.7002 8539.9111 -7841.835 8538.1836 Y -7842.7002 8539.3936 -7843.3906 8538.5303 Y f -7837.9082 8572.9521 m -7838.6074 8573.4893 -7839.7632 8573.0938 Y -7842.2446 8574.3135 -7841.5327 8571.8467 Y -7840.769 8569.1104 -7841.564 8565.1221 Y -7841.541 8561.6445 -7843.4014 8562.5596 Y -7844.0342 8562.5557 L -7844.3198 8560.6123 -7844.7046 8558.7549 -7845.0898 8557.1699 C -7843.7129 8559.4199 -7842.2778 8560.0635 Y -7840.5913 8561.082 -7838.9878 8556.5791 Y -7839.4214 8555.4502 -7838.2417 8553.7021 Y -7839.4937 8553.8125 -7840.7246 8556.876 Y -7841.4976 8561.6152 -7842.3511 8558.4268 Y -7843.5776 8556.1904 -7844.769 8555.0098 -7845.814 8554.4229 C -7846.2026 8553.0635 -7846.4858 8552.2393 Y -7846.7002 8551.4727 -7847.0337 8550.8486 -7847.4487 8550.3369 C -7847.3799 8550.5127 -7847.3174 8550.6982 -7847.2632 8550.8916 C -7841.3022 8568.2588 -7846.4858 8574.9971 V -7853.2246 8584.5869 -7857.3721 8584.5869 V -7860.9663 8584.6514 L -7865.1138 8584.6514 -7871.853 8575.0615 Y -7871.9038 8574.9961 -7871.9463 8574.9219 -7871.9961 8574.8516 C -7871.7378 8575.4141 -7871.437 8575.9404 -7871.0752 8576.4092 C -7864.3359 8586 -7860.189 8586 V -7856.5942 8585.9346 L -7852.4482 8585.9346 -7845.709 8576.3447 Y -7843.5801 8573.5771 -7843.3306 8569.0176 -7843.7769 8564.6055 C -7843.6553 8564.5752 -7843.5698 8564.5684 Y -7842.0112 8562.6475 -7842.7598 8570.5244 Y -7843.4746 8573.3789 -7841.7026 8574.2402 Y -7840.9351 8575.0186 -7837.9946 8574.3428 Y -7837.9136 8573.7256 -7836.4434 8573.5811 Y -7835.7446 8573.0449 -7833.8921 8573.2881 Y -7835.5024 8571.5771 -7837.9082 8572.9521 Y f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 34) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.0254 8586.0264 m -7828.0542 8586.0264 L -7828.0542 8524.5342 L -7884.0254 8524.5342 L -7884.0254 8586.0264 L n u u 0 O 0.0745 0.9 0.9019 0.18 k 0 R 0 0 0 1 K 1 J 1 j 0.0518 w -7857.5991 8562.7217 m -7857.3594 8573.5215 -7862.8794 8583.8398 v -7862.4009 8586 -7860.959 8586 v -7861.2002 8582.6406 -7860.2393 8582.1611 v -7855.9199 8570.1602 -7856.6382 8562.2402 v -7857.5991 8562.7217 l b -7857.5991 8562.7217 m -7859.2793 8568 -7871.0391 8569.2012 v -7875.3594 8569.6807 -7875.5991 8571.1211 v -7869.1206 8561.5195 -7868.1602 8561.7607 v -7881.3594 8556.001 -7884 8550.7197 v -7878.959 8553.6006 -7875.5991 8551.4404 v -7867.6802 8551.2012 -7862.6406 8553.3613 v -7858.8008 8555.2813 -7866.7202 8539.2012 v -7862.8794 8550.9609 -7859.2793 8524.5605 v -7858.3198 8529.8408 -7856.8799 8531.2813 v -7850.8799 8538.9609 -7851.8398 8541.1211 v -7852.3198 8544.9609 -7847.7598 8538.7207 v -7848 8548.3213 -7850.4009 8551.6807 v -7852.5591 8555.2813 -7846.5591 8553.1211 v -7840.5591 8551.2012 -7835.2793 8552.8809 v -7829.7598 8554.3203 -7828.0801 8551.4404 v -7839.8398 8563.9209 -7845.5991 8563.6807 v -7843.9194 8567.2813 l -7841.519 8572.0811 -7842 8573.2813 v -7857.2681 8563.8828 -7857.5991 8562.7217 v b -7857.5991 8562.7217 m -7854.959 8544.2402 -7857.5991 8536.5605 v -7859.998 8526.001 -7859.2793 8524.5605 v S -7856.1602 8551.4404 m -7850.1602 8546.6406 -7848.959 8541.3604 v S -7856.1602 8550.7197 m -7865.0391 8543.041 -7866.7202 8539.2012 v S -7828.0801 8551.4404 m -7829.2793 8553.6006 -7857.3594 8561.7607 y -7862.4009 8556.2422 -7873.9199 8553.8408 v -7881.5986 8552.8809 -7884 8550.7197 v S -7874.6382 8569.6807 m -7863.1191 8560.5615 -7857.3594 8561.7607 y -7843.1992 8568 -7842 8573.2813 v S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 36) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.8496 8585.9961 m -7833.96 8585.9961 L -7833.96 8534.9258 L -7883.8496 8534.9258 L -7883.8496 8585.9961 L n u 0 O 0.025 0.1 0.475 0 k -7862.1504 8553.9043 m -7864.4766 8552.8125 -7866.6914 8552.4434 -7868.373 8552.9238 c -7869.0518 8553.1172 -7869.645 8553.4473 -7870.123 8553.9238 c -7870.6006 8554.4023 -7870.9297 8554.9951 -7871.123 8555.6729 c -7872.0088 8558.7715 -7870.0103 8563.6777 -7865.9233 8567.7666 c -7861.834 8571.8535 -7856.9297 8573.8516 -7853.8286 8572.9668 c -7853.1519 8572.7715 -7852.5586 8572.4424 -7852.0806 8571.9658 c -7851.603 8571.4883 -7851.2754 8570.8955 -7851.082 8570.2168 c -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.582 8561.21 -7854.791 8559.6133 -7856.2793 8558.123 c -7858.1504 8556.2539 -7860.1914 8554.8242 -7862.1504 8553.9043 c f u 0.0035 0.014 0.0665 0 k -7861.2183 8552.9727 m -7863.8306 8552.0215 -7866.3975 8551.9688 -7868.373 8552.9238 C -7866.6914 8552.4434 -7864.4766 8552.8125 -7862.1504 8553.9043 c -7861.6191 8554.1543 -7861.0806 8554.4434 -7860.543 8554.7676 C -7858.8984 8554.0537 L -7859.667 8553.6172 -7860.4434 8553.2539 -7861.2183 8552.9727 c f 0.015 0.06 0.285 0 k -7858.8984 8554.0537 m -7860.543 8554.7676 L -7859.0962 8555.6348 -7857.6426 8556.7607 -7856.2793 8558.123 c -7856.1538 8558.25 -7856.0327 8558.3779 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7856.3706 8555.7236 -7857.6191 8554.7813 -7858.8984 8554.0537 C f U u 0.039 0.156 0.741 0 k -7849.687 8541.4043 m -7849.9746 8541.6914 -7861.2183 8552.9727 Y -7860.4434 8553.2539 -7859.667 8553.6172 -7858.8984 8554.0537 C -7845.4146 8540.5703 L -7847.061 8540.0996 -7848.6406 8540.3555 -7849.687 8541.4043 c f 0.025 0.1 0.475 0 k -7845.4146 8540.5703 m -7858.8984 8554.0537 L -7857.584 8554.8027 -7856.2969 8555.7754 -7855.1143 8556.957 c -7855.084 8556.9863 -7855.0586 8557.0156 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7841.5264 8543.1328 -7841.7202 8542.9141 -7841.9302 8542.7012 c -7843.0103 8541.623 -7844.2305 8540.9082 -7845.4146 8540.5703 C f U u 0.0115 0.046 0.2185 0 k -7835.9346 8550.3926 m -7833.5337 8547.9893 -7833.335 8544.0898 -7835.1382 8540.6973 C -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f 0.015 0.06 0.285 0 k -7843.5337 8535.5957 m -7842.582 8534.9258 L -7845.2046 8534.3516 -7847.8306 8534.9141 -7849.6206 8536.7061 c -7848.1719 8535.2578 -7845.9082 8534.9307 -7843.5337 8535.5957 C f 0.0295 0.118 0.5605 0 k -7843.5337 8535.5957 m -7845.9082 8534.9307 -7848.1719 8535.2578 -7849.6206 8536.7061 c -7851.019 8538.1055 -7851.3706 8540.2637 -7850.7954 8542.5469 C -7848.8672 8539.5449 -7845.4082 8540.5537 V -7843.585 8535.6309 L -7843.5337 8535.5957 L f *u 0.048 0.192 0.912 0 k 1 D -7835.9346 8550.3926 m -7837.2817 8551.7383 -7839.332 8552.1133 -7841.5234 8551.627 C -7851.6714 8561.7734 L -7851.7695 8561.5684 -7851.7695 8561.5684 -7851.6714 8561.7734 c -7850.2246 8564.8145 -7849.9702 8567.916 -7851.082 8570.2168 C -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.5054 8561.3438 -7854.5918 8559.8848 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7855.1816 8556.8945 -7855.1465 8556.9238 -7855.1143 8556.957 c -7855.084 8556.9883 -7855.0566 8557.0176 -7855.0273 8557.0469 c -7855.0278 8557.0469 -7855.0278 8557.0469 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7836.3262 8541.1289 L -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f *U 0.0215 0.086 0.4085 0 k 0 D -7842.582 8534.9258 m -7843.5337 8535.5957 L -7841.6846 8536.1113 -7839.7656 8537.2285 -7838.1138 8538.8828 c -7837.4063 8539.5889 -7836.7998 8540.3418 -7836.2954 8541.1182 C -7835.1382 8540.6973 L -7835.6553 8539.7246 -7836.3374 8538.793 -7837.1802 8537.9512 c -7838.7695 8536.3594 -7840.6758 8535.3428 -7842.582 8534.9258 C f 0.0205 0.082 0.3895 0 k -7836.2954 8541.1182 m -7836.7998 8540.3418 -7837.4063 8539.5889 -7838.1138 8538.8828 c -7839.7656 8537.2285 -7841.6846 8536.1113 -7843.5337 8535.5957 C -7843.585 8535.6309 L -7845.4082 8540.5537 L -7844.2114 8540.9219 -7842.9878 8541.6436 -7841.9302 8542.7012 c -7841.7202 8542.9141 -7841.5264 8543.1328 -7841.3408 8543.3574 C -7836.3262 8541.1289 L -7836.2954 8541.1182 L f U u 0.445 0.356 0.267 0 k -7883.8496 8585.9961 m -7861.957 8562.9688 L -7862.2007 8562.6494 -7862.5752 8562.6133 -7862.8887 8562.6592 C -7867.1802 8567.2891 -7878.3145 8579.4561 -7882.7266 8584.2793 C -7883.5649 8585.3516 -7884 8585.9932 -7883.8496 8585.9961 C f 0.15 0.12 0.09 0 k -7883.834 8585.9961 m -7882.6606 8585.7031 -7861.6934 8564.0029 Y -7861.6934 8563.502 -7861.7993 8563.1758 -7861.957 8562.9688 C -7883.8496 8585.9961 L -7883.8442 8585.9961 -7883.8418 8586 -7883.834 8585.9961 c f 0.2 0.16 0.12 0 k -7882.7266 8584.2793 m -7878.3145 8579.4561 -7867.1802 8567.2891 -7862.8887 8562.6592 C -7863.2002 8562.7041 -7863.4526 8562.8301 Y -7864.603 8563.1328 -7878.5742 8578.9619 -7882.7266 8584.2793 C f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 37) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7882.9502 8585.2324 m -7833.0391 8585.2324 L -7833.0391 8521.1152 L -7882.9502 8521.1152 L -7882.9502 8585.2324 L n u 0 O 0 0 0 1 k 0 R 0 0 0 1 K 0 w -7833.2358 8521.1152 m -7833.6064 8521.248 -7833.9858 8521.2832 -7834.3833 8521.2031 c -7834.4863 8521.168 l -7834.5254 8521.1602 -7834.5703 8521.1787 -7834.6025 8521.1992 c -7834.9434 8521.3926 l -7838.7129 8523.2959 -7842.0962 8525.8965 -7844.5 8529.4473 c -7845.9634 8531.5918 -7847.123 8533.8789 -7848.7993 8535.8564 c -7849.1729 8536.209 -7849.1758 8536.7725 -7848.834 8537.1309 c -7848.4951 8537.501 -7847.918 8537.5078 -7847.561 8537.165 c -7847.4038 8537.21 l -7847.2642 8537.1289 -7847.0742 8537.0703 -7847.0234 8536.957 c -7845.853 8534.2031 -7845.1895 8531.5137 -7843.4336 8529.1387 c -7841.1719 8526.0947 -7838.1777 8523.9941 -7835.0298 8522.0234 c -7834.3672 8521.6055 L -7834.4966 8521.6348 L -7833.7695 8521.6426 l -7833.791 8521.6113 -7833.8008 8521.5957 -7833.8223 8521.5645 C -7833.6064 8521.5234 -7833.377 8521.4746 -7833.1626 8521.4336 c -7833.0762 8521.4238 -7833.0186 8521.3389 -7833.0391 8521.2383 c -7833.0503 8521.1523 -7833.1382 8521.1084 -7833.2358 8521.1152 c -7833.2358 8521.1152 l b -7849.2222 8534.9951 m -7849.5742 8534.8066 -7849.9658 8534.6719 -7850.248 8534.3887 c -7856.4521 8528.1719 -7866.6802 8527.2734 -7874.0488 8533.6855 C -7874.1582 8533.7813 -7874.1582 8533.957 -7874.063 8534.0645 C -7871.0527 8532.9434 -7862.8838 8534.375 -7859.3223 8537.4121 C -7859.2534 8537.4668 -7859.1465 8537.4531 -7859.1055 8537.3711 C -7859.0503 8537.3047 -7859.0664 8537.1953 -7859.1328 8537.1563 C -7862.5625 8534.0859 -7867.0674 8532.29 -7871.6729 8532.748 C -7868.8535 8531.1855 -7865.6313 8530.4941 -7862.3984 8530.6885 c -7857.7144 8530.9717 -7853.4634 8533.1191 -7849.3711 8535.2793 c -7849.291 8535.3193 -7849.1978 8535.293 -7849.1553 8535.2109 C -7849.1016 8535.1309 -7849.1426 8535.0352 -7849.2222 8534.9951 c b -7858.647 8536.3359 m -7860.2266 8540.3613 -7862.3911 8544.3203 -7865.8018 8547.0762 c -7865.9648 8547.2119 -7865.9946 8547.4492 -7865.8711 8547.6055 c -7865.7344 8547.7676 -7865.5049 8547.7793 -7865.3481 8547.6563 c -7861.123 8545.5967 -7858.1904 8541.1309 -7858.1626 8536.4014 c -7858.1626 8536.4014 l -7858.1328 8536.2676 -7858.2354 8536.1348 -7858.3633 8536.1221 c -7858.5039 8536.1055 -7858.6318 8536.1973 -7858.647 8536.3359 c -7858.647 8536.3359 l b -7852.9414 8541.0176 m -7853.042 8541.1816 -7853.1152 8541.3838 -7853.2617 8541.4824 c -7856.0806 8543.3906 -7858.9785 8544.6309 -7861.8848 8546.1328 c -7862.0503 8546.209 -7862.1118 8546.418 -7862.0313 8546.5703 c -7861.9512 8546.7227 -7861.7559 8546.7793 -7861.5898 8546.7041 c -7858.439 8545.3232 -7854.313 8544.5 -7852.6729 8541.1797 c -7852.6289 8541.1113 -7852.6455 8541.0146 -7852.7266 8540.9648 c -7852.7959 8540.9199 -7852.897 8540.9492 -7852.9414 8541.0176 c -7852.9414 8541.0176 l b -7852.6602 8541.918 m -7852.4438 8542.4297 -7852.1431 8542.8896 -7852.0503 8543.4355 c -7851.2183 8548.2773 -7851.1152 8553.042 -7852.248 8557.6875 c -7852.248 8557.6875 l -7852.3418 8557.9531 -7852.2114 8558.2441 -7851.9438 8558.3389 c -7851.6777 8558.4336 -7851.3882 8558.3125 -7851.2935 8558.0479 c -7849.293 8552.8115 -7849.897 8546.7373 -7852.3711 8541.7832 c -7852.4063 8541.7002 -7852.498 8541.6689 -7852.582 8541.6914 c -7852.6641 8541.7275 -7852.6978 8541.835 -7852.6602 8541.918 c -7852.6602 8541.918 l b -7851.5352 8557.5938 m -7848.8984 8555.2275 -7846.6816 8552.252 -7845.853 8548.7363 c -7845.853 8548.7363 l -7845.7246 8548.1816 -7846.0742 8547.623 -7846.6416 8547.4902 c -7847.1992 8547.375 -7847.7578 8547.7246 -7847.8862 8548.2793 c -7848.5649 8551.5313 -7849.8711 8554.6729 -7851.7954 8557.3867 c -7851.7954 8557.3867 l -7851.8462 8557.4551 -7851.834 8557.5576 -7851.7695 8557.6201 c -7851.6992 8557.6699 -7851.5977 8557.6582 -7851.5352 8557.5938 c -7851.5352 8557.5938 l b -7836.3711 8550.1826 m -7837.7114 8545.8301 -7840.2598 8542.0693 -7843.689 8539.1533 C -7843.729 8539.0723 -7843.8242 8539.0322 -7843.9038 8539.0859 C -7843.9863 8539.127 -7844.0122 8539.2207 -7843.9722 8539.3018 C -7843.957 8539.7891 -7843.7144 8540.2334 -7843.4458 8540.5313 c -7838.4063 8546.1621 -7834.9902 8554.7197 -7837.3433 8561.9551 C -7837.0762 8556.4512 -7838.7241 8550.3008 -7842.1362 8545.6738 c -7843.1606 8544.2695 -7844.7422 8544.1211 -7846.3081 8544.2031 C -7846.4023 8544.1895 -7846.4834 8544.2432 -7846.4961 8544.3369 c -7846.5098 8544.4189 -7846.4551 8544.5137 -7846.3623 8544.5254 C -7843.1479 8545.7695 -7841.4878 8549.2246 -7840.084 8552.1943 c -7838.415 8555.7441 -7837.7017 8559.6387 -7838.0054 8563.5 C -7838.0454 8563.6777 -7838.1138 8565.3975 -7837.9775 8565.4102 C -7837.8306 8565.4395 -7837.709 8565.3438 -7837.6802 8565.1943 C -7837.645 8565.0449 -7834.6426 8555.7988 -7836.3711 8550.1826 c b -7844.4863 8537.4912 m -7843.3945 8533.6211 -7841.1094 8530.251 -7838.4824 8527.2383 c -7838.3306 8527.1045 -7838.3145 8526.8867 -7838.4502 8526.7354 c -7838.5752 8526.6006 -7838.8047 8526.582 -7838.957 8526.7178 c -7842.3306 8529.332 -7843.4487 8533.541 -7844.7954 8537.375 c -7844.7954 8537.375 l -7844.8262 8537.4648 -7844.7754 8537.5586 -7844.6982 8537.5869 c -7844.6094 8537.6191 -7844.5166 8537.5684 -7844.4863 8537.4912 c -7844.4863 8537.4912 l b -7838.5313 8562.1094 m -7838.5991 8562.0566 -7838.707 8562.083 -7838.748 8562.1504 C -7838.9634 8562.4746 -7840.6914 8564.5195 -7841.3926 8565.1406 c -7846.1719 8569.3945 -7849.5137 8573.9609 -7857.5391 8577.7227 c -7864.4512 8580.9639 -7867.1113 8583.5957 -7874.3862 8581.8262 c -7877.687 8581.0293 -7879.0313 8580.5313 -7880.4351 8575.4551 C -7881.9473 8569.2988 -7880.8672 8571.7832 -7881.084 8564.4385 c -7881.2222 8559.6973 -7884 8548.4551 -7871.5254 8534.2598 C -7871.4199 8534.1484 -7871.4336 8533.9961 -7871.5337 8533.9072 C -7871.6328 8533.8027 -7871.7959 8533.8164 -7871.8862 8533.916 C -7877.5786 8538.7168 -7881.0234 8545.6582 -7882.3145 8552.9424 c -7883.2871 8558.4668 -7882.9199 8563.25 -7882.666 8569.6367 c -7882.5688 8572.0938 -7883.6855 8579.0723 -7878.9102 8583.0625 c -7875.3926 8586 -7870.3911 8585.5469 -7866.3545 8584.1563 c -7860.6992 8582.2119 -7855.9727 8579.1465 -7850.8711 8575.6094 c -7847.2656 8573.125 -7839.2881 8563.2852 -7838.4785 8562.3262 C -7838.4351 8562.2588 -7838.4502 8562.1504 -7838.5313 8562.1094 C b -7873.0503 8549.3057 m -7872.168 8548.5029 -7871.7017 8549.8457 -7871.4297 8550.6016 c -7871.1626 8551.3574 -7870.189 8551.25 -7870.5127 8551.5732 c -7870.8369 8551.8975 -7870.8369 8551.9521 -7871.3232 8551.5195 c -7871.8086 8551.0879 -7871.8086 8551.7363 -7872.5649 8551.25 c -7873.3198 8550.7627 -7873.645 8549.8457 -7873.0503 8549.3057 c b -7865.6519 8553.9492 m -7865.3657 8553.5918 -7864.6802 8553.5723 -7864.4648 8553.8945 c -7864.25 8554.2197 -7863.3306 8554.2734 -7863.4937 8554.5967 c -7863.6543 8554.9219 -7863.6016 8555.1387 -7864.0874 8554.9219 c -7864.5737 8554.7051 -7864.4121 8555.2998 -7864.897 8555.084 c -7865.3833 8554.8672 -7865.8687 8554.2197 -7865.6519 8553.9492 c b -7857.6074 8559.0791 m -7857.1206 8558.7559 -7855.8794 8559.5117 -7856.4727 8559.5117 c -7857.0674 8559.5117 -7856.311 8560.2676 -7856.8521 8560.4834 c -7857.3906 8560.6992 -7857.2832 8560.4297 -7857.6074 8560.6445 c -7857.9297 8560.8613 -7858.3633 8561.2393 -7858.5239 8560.4297 c -7858.6855 8559.6191 -7858.3633 8559.6191 -7857.9849 8559.3496 c -7857.6074 8559.0791 -7857.6074 8559.0791 y b -7872.2402 8559.3496 m -7871.1074 8559.2422 -7871.8633 8559.998 -7871.269 8560.4834 c -7870.6738 8560.9697 -7869.918 8561.6172 -7870.729 8561.4004 c -7871.5391 8561.1855 -7872.9961 8561.6719 -7872.9434 8560.5381 c -7872.8887 8559.4033 -7872.6328 8559.3867 -7872.2402 8559.3496 c b -7866.5703 8567.6113 m -7866.1016 8567.3438 -7866.6802 8567.7197 -7866.0303 8567.6113 c -7865.3833 8567.5039 -7864.7886 8567.6113 -7865.2207 8567.8281 c -7865.6519 8568.0439 -7866.3008 8568.1523 -7866.4634 8567.9893 c -7866.625 8567.8281 -7866.9473 8567.8281 -7866.5703 8567.6113 c b -7857.0674 8567.1797 m -7857.4785 8566.1797 -7856.0962 8566.4238 -7855.4473 8566.7461 c -7854.7998 8567.0723 -7853.8262 8566.4775 -7854.4209 8566.9102 c -7855.0137 8567.3418 -7854.7998 8566.9102 -7855.3926 8567.2334 c -7855.9873 8567.5566 -7856.6895 8568.0977 -7857.0674 8567.1797 c b -7872.6738 8573.0664 m -7872.7222 8572.0752 -7871.8086 8572.957 -7871.269 8573.0117 c -7870.729 8573.0664 -7870.0801 8573.0664 -7870.2432 8573.2813 c -7870.4038 8573.498 -7870.459 8573.498 -7871.1626 8573.7129 c -7871.8633 8573.9297 -7872.6191 8574.1445 -7872.6738 8573.0664 c b -7873.1582 8567.6113 m -7874.0664 8567.9746 -7874.293 8567.8809 -7874.5625 8568.2051 c -7874.834 8568.5293 -7875.1558 8569.2314 -7875.5352 8568.0977 c -7875.9121 8566.9629 -7875.4282 8565.7764 -7875.0479 8565.9375 c -7874.6714 8566.0996 -7874.293 8566.7461 -7873.8618 8566.9629 c -7873.4297 8567.1797 -7872.6191 8567.3945 -7873.1582 8567.6113 c b U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 41) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7803 8586 L -7803 8481 L -7884 8481 L -7884 8586 L n u u u 0 O 0 0 0 1 k -7865.8057 8498.4258 m -7866.0742 8496.6621 -7867.1602 8495.291 -7868.5239 8495.3965 c -7869.8862 8495.502 -7870.707 8497.0234 -7870.7432 8498.8066 c -7870.748 8499.0693 -7870.6743 8500.2441 -7870.6304 8500.4775 C -7870.6382 8500.582 -7870.6191 8500.6738 -7870.6104 8500.7803 c -7870.5142 8502.0254 -7869.3574 8503.3604 -7867.9414 8503.25 c -7866.5249 8503.1406 -7865.4897 8501.8613 -7865.6367 8500.4727 c -7865.644 8500.4072 -7865.6958 8499.626 -7865.707 8499.5625 C -7865.6816 8499.2852 -7865.7598 8498.7256 -7865.8057 8498.4258 c f -7876.2646 8507.7334 m -7876.9946 8515.916 -7871.5015 8515.1191 v -7868.3682 8514.0186 -7869.4414 8511.1211 v -7869.6426 8509.752 -7871.7847 8508.498 v -7872.146 8508.25 -7872.7632 8507.1016 v -7873.1294 8505.5977 -7874.5186 8505.2979 v -7876.0762 8505.251 -7876.2646 8507.7334 v f -7850.7646 8516.4971 m F -7850.0762 8514.3408 m -7850.7847 8513.1934 -7853.8848 8513.6279 Y -7854.811 8513.6885 -7855.3799 8513.1113 Y -7857.8394 8509.0918 -7861.0386 8509.8857 -7861.4082 8509.9932 C -7861.4097 8509.9863 L -7864.999 8510.6045 -7865.2666 8515.6035 V -7865.4912 8516.3828 -7866.335 8516.7695 V -7869.2695 8517.8613 -7869.3481 8519.208 V -7869.8999 8521.1152 -7867.6006 8521.7422 V -7865.6792 8522.2568 -7863.7886 8519.8945 V -7862.6113 8518.6797 -7859.5762 8517.9395 V -7859.5728 8517.9531 L -7856.3594 8517.0459 -7854.6392 8517.5889 Y -7851.8521 8518.7676 -7850.4063 8517.4014 Y -7848.6826 8515.7559 -7850.0762 8514.3408 Y f -7863.9834 8497.8789 m -7864.5854 8496.2002 -7864.2822 8494.4775 -7863.0327 8493.9229 c -7861.7842 8493.3672 -7860.3384 8494.3164 -7859.4585 8495.8672 c -7859.3286 8496.0957 -7858.8359 8497.165 -7858.7632 8497.3906 C -7858.7065 8497.4785 -7858.6792 8497.5684 -7858.6362 8497.667 c -7858.1289 8498.8086 -7858.5122 8500.5303 -7859.8105 8501.1074 c -7861.1089 8501.6855 -7862.6279 8501.0527 -7863.1582 8499.7617 c -7863.1831 8499.7002 -7863.5078 8498.9883 -7863.5298 8498.9268 C -7863.6831 8498.6963 -7863.8809 8498.166 -7863.9834 8497.8789 c f -7849.7129 8500.9316 m -7845.1802 8507.7822 -7850.3911 8509.6943 v -7853.6714 8510.2168 -7854.103 8507.1572 v -7854.5786 8505.8564 -7853.29 8503.7354 v -7853.0903 8503.3447 -7853.0938 8502.04 v -7853.4858 8500.5449 -7852.4082 8499.6182 v -7851.0591 8498.8359 -7849.7129 8500.9316 v f U u -7824.7358 8550.1074 m -7824.3687 8548.3623 -7824.9048 8546.6963 -7826.2183 8546.3164 c -7827.5322 8545.9375 -7828.8345 8547.0752 -7829.4937 8548.7324 c -7829.5903 8548.9775 -7829.9326 8550.1025 -7829.9746 8550.3369 C -7830.0176 8550.4326 -7830.0322 8550.5244 -7830.0625 8550.6279 c -7830.4087 8551.8271 -7829.7935 8553.4805 -7828.4282 8553.875 c -7827.063 8554.2695 -7825.645 8553.4365 -7825.2969 8552.085 c -7825.2793 8552.0205 -7825.0552 8551.2705 -7825.0425 8551.207 C -7824.9214 8550.9551 -7824.7983 8550.4053 -7824.7358 8550.1074 c f -7838.2705 8554.6172 m -7841.8242 8562.0244 -7836.3999 8563.2061 v -7833.0801 8563.2754 -7833.0688 8560.1846 v -7832.7778 8558.8311 -7834.3433 8556.9072 v -7834.5942 8556.5459 -7834.7695 8555.2539 v -7834.5854 8553.7188 -7835.7793 8552.9492 v -7837.2222 8552.3594 -7838.2705 8554.6172 v f -7817.4648 8571.7695 m F -7816.063 8569.9912 m -7816.3247 8568.6689 -7819.3799 8567.9883 Y -7820.27 8567.7197 -7820.5986 8566.9795 Y -7821.4922 8562.3535 -7824.7666 8561.9746 -7825.1494 8561.9453 C -7825.1494 8561.9395 L -7828.7271 8561.2588 -7830.731 8565.8467 V -7831.2153 8566.4961 -7832.1416 8566.5625 V -7835.272 8566.5557 -7835.8169 8567.7891 V -7837.0039 8569.3809 -7835.0713 8570.7764 V -7833.4526 8571.9316 -7830.853 8570.3818 V -7829.3242 8569.6582 -7826.2222 8570.0293 V -7826.2231 8570.042 L -7822.896 8570.3213 -7821.4766 8571.4326 Y -7819.2793 8573.5146 -7817.4463 8572.7432 Y -7815.2554 8571.8057 -7816.063 8569.9912 Y f -7822.8374 8550.2354 m -7822.813 8548.4512 -7821.9258 8546.9453 -7820.5601 8546.8633 c -7819.1943 8546.7803 -7818.1743 8548.1768 -7817.895 8549.9385 c -7817.854 8550.1973 -7817.7666 8551.3711 -7817.7778 8551.6094 C -7817.7559 8551.7109 -7817.7617 8551.8037 -7817.7559 8551.9121 c -7817.6807 8553.1592 -7818.644 8554.6367 -7820.0625 8554.7217 c -7821.4814 8554.8066 -7822.6826 8553.6826 -7822.7246 8552.2871 c -7822.7271 8552.2217 -7822.7822 8551.4404 -7822.7798 8551.375 C -7822.8433 8551.1045 -7822.8423 8550.54 -7822.8374 8550.2354 c f -7811.0186 8557.5625 m -7809.1777 8565.5684 -7814.7271 8565.5303 v -7817.9834 8564.8691 -7817.3154 8561.8516 v -7817.3032 8560.4668 -7815.353 8558.9326 v -7815.0278 8558.6377 -7814.5742 8557.415 v -7814.417 8555.876 -7813.083 8555.3877 v -7811.5454 8555.1279 -7811.0186 8557.5625 v f U U 1 Ap -7884 8586 m -7884 8481 L -7803 8481 L -7803 8586 L -7884 8586 L n U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 42) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 45) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8543.918 m -7885 8587 L -7798.2217 8587 L -7798.2217 8543.918 L -7885 8543.918 L n u u 0 O 0 0 0 1 k -7825.2217 8573.2363 m -7825.2217 8581.0742 L -7813.2217 8574.1445 L -7801.2217 8567.2168 L -7813.2217 8560.2891 L -7825.2217 8553.3613 L -7825.2217 8561.4824 L -7883.9351 8547.7168 L -7870.9878 8566.8027 L -7885 8587 L -7825.2217 8573.2363 L f 0 1 1 0.1 k 0 R 0 0 0 1 K -7823.2217 8570.2363 m -7823.2217 8578.0742 L -7811.2217 8571.1445 L -7799.2217 8564.2168 L -7811.2217 8557.2891 L -7823.2217 8550.3613 L -7823.2217 8558.4824 L -7881.9351 8544.7168 L -7867.2754 8564.3594 L -7881.9351 8584 L -7823.2217 8570.2363 L b U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 50) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7756.877 8586 L -7756.877 8538.415 L -7884 8538.415 L -7884 8586 L n u *u 0 O 0.9529 0.949 0.1961 0.0745 k -7857.793 8570.417 m -7857.8232 8570.2676 L -7859.9849 8564.3643 -7860.9438 8561.6377 -7861.2754 8560.2891 c -7861.3657 8560.2891 L -7861.6953 8561.6074 -7862.7754 8564.335 -7864.9673 8570.2676 c -7864.9966 8570.417 L -7857.793 8570.417 l f 1 D -7868.1182 8578.9678 m -7869.6191 8582.5371 -7870.3994 8584.709 -7868.1182 8584.917 c -7868.1182 8585.9678 L -7870.6992 8585.9375 -7873.5806 8585.917 -7876.3418 8585.917 c -7880.0649 8585.917 -7882.5273 8585.9375 -7884 8585.9678 c -7884 8584.917 L -7882.1064 8584.709 -7881.0542 8582.5674 -7873.5513 8565.5029 c -7861.6953 8538.415 L -7859.8638 8538.415 L -7848.1582 8565.5029 L -7840.8047 8582.5078 -7839.7246 8584.709 -7837.8887 8584.917 c -7837.8887 8585.9678 L -7839.5142 8585.9375 -7841.916 8585.917 -7845.5767 8585.917 c -7848.5488 8585.917 -7851.6694 8585.9375 -7854.7026 8585.9678 c -7854.7026 8584.917 L -7852.481 8584.709 -7853.3218 8582.5078 -7854.7617 8578.9678 C -7868.1182 8578.9678 l f *U *u 0 D -7813.0762 8554.0811 m -7813.0762 8550.4717 -7815.3535 8548.0947 -7819.1294 8548.0947 c -7820.2383 8548.0947 -7821.0767 8548.2158 -7821.5273 8548.2451 c -7821.5273 8560.5479 L -7820.8672 8560.6084 -7820.208 8560.6084 -7819.729 8560.6084 c -7818.2002 8560.6084 -7816.7026 8560.127 -7815.6841 8559.4053 c -7814.3945 8558.5332 -7813.0762 8556.7881 -7813.0762 8554.1416 C -7813.0762 8554.0811 l f 1 D -7832.0806 8558.3926 m -7832.0806 8542.6445 -7832.0806 8540.4287 -7834.542 8540.2783 c -7834.542 8539.3184 L -7833.042 8539.2588 -7830.3174 8539.1992 -7827.5664 8539.1689 c -7825.6538 8539.1084 -7822.3945 8539.0186 -7820.1479 8538.9775 c -7816.582 8538.9775 -7813.585 8539.4258 -7811.0049 8540.2627 c -7806.353 8541.8477 -7801.9702 8545.8525 -7801.9702 8553.6602 c -7801.9702 8558.7432 -7804.4014 8562.3193 -7806.5034 8564.0605 c -7807.583 8565.0215 -7808.8135 8565.832 -7809.7744 8566.3125 c -7809.7744 8566.4629 L -7807.5234 8569.4912 -7805.6025 8572.0625 -7799.3906 8580.6426 c -7797.5 8583.0645 -7795.9102 8584.7383 -7794.7402 8584.9775 c -7794.7402 8586 L -7796.6602 8586 -7799 8585.8848 -7801.1294 8585.8848 c -7803.3511 8585.8848 -7804.8521 8586 -7806.4424 8586 c -7807.6729 8586 -7808.7241 8585.9404 -7809.5039 8585.2725 c -7813.0151 8579.8477 -7816.9121 8573.7559 -7820.1182 8568.7139 c -7820.5078 8568.7139 -7820.957 8568.7139 -7821.5273 8568.7139 c -7821.5273 8571.2852 L -7821.5273 8582.5264 -7821.437 8584.7686 -7819.1895 8584.9775 c -7819.1895 8585.9697 L -7820.6279 8585.9404 -7823.9194 8585.915 -7826.6992 8585.915 c -7829.9287 8585.915 -7832.8921 8585.9404 -7834.5122 8585.9697 c -7834.5122 8584.9775 L -7832.0518 8584.7686 -7832.0806 8582.5264 -7832.0806 8565.5918 C -7832.0806 8558.3926 l f *U *u 0 D -7781.4561 8565.5928 m -7781.4561 8582.4941 -7781.4561 8584.6484 -7784.2832 8584.9775 C -7784.2832 8585.9697 l -7782.3887 8585.9404 -7779.0542 8585.915 -7775.7822 8585.915 c -7772.6294 8585.915 -7769.5688 8585.9404 -7767.2881 8585.9697 C -7767.2881 8584.9775 l -7770.2578 8584.9775 -7770.2881 8582.5244 -7770.2881 8565.5928 C -7770.2881 8548.1514 L -7762.8193 8548.1514 l -7759.999 8548.1514 -7758.5298 8548.96 -7757.8994 8551.2627 C -7756.9072 8551.2627 l -7756.9072 8546.4697 -7756.877 8542.415 -7756.877 8539.1709 c -7761.3486 8539.2012 -7766.748 8539.2314 -7772.0601 8539.2314 C -7779.7446 8539.2314 l -7784.5537 8539.2314 -7789.9966 8539.2012 -7794.9614 8539.1709 c -7794.9614 8542.3848 -7794.9326 8546.4697 -7794.9326 8551.2627 C -7793.9072 8551.2627 l -7793.3657 8549.1094 -7791.771 8548.1514 -7788.9438 8548.1514 C -7781.4561 8548.1514 l -7781.4561 8565.5928 L f *U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 62) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8569.9043 m -7846.7305 8561.3408 L -7885 8561.3408 L -7885 8569.9043 L -7846.7305 8569.9043 L f -7846.7305 8573.0967 m -7846.7305 8572.4229 L -7885 8572.4229 L -7885 8573.0967 L -7846.7305 8573.0967 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 63) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8565.8262 m -7846.7305 8574.3896 L -7859.3408 8574.3896 L -7859.3408 8587 L -7867.9038 8587 L -7867.9063 8565.8262 L -7867.9038 8565.8262 L -7867.9038 8565.8252 L -7846.7305 8565.8262 L f -7846.7305 8563.3076 m -7870.4233 8563.3076 L -7870.4233 8587 L -7871.0967 8587 L -7871.0977 8562.6328 L -7846.7305 8562.6328 L -7846.7305 8563.3076 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 64) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8586.999 m -7885 8548.7285 L -7846.7305 8548.7285 L -7846.7305 8586.999 L -7885 8586.999 L n 0 O 1 0.14 0.09 0 k -7846.7305 8561.3389 m -7872.3896 8561.3389 L -7872.3896 8586.999 L -7863.8262 8587 L -7863.8262 8569.9033 L -7846.7305 8569.9033 L -7846.7305 8561.3389 L f -7846.7305 8572.4219 m -7861.3081 8572.4219 L -7861.3081 8587 L -7860.6338 8587 L -7860.6338 8573.0957 L -7846.7305 8573.0957 L -7846.7305 8572.4219 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 65) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.0625 8559.4609 m -7884.6025 8559.4609 L -7884.6025 8587 L -7857.0625 8587 L -7857.0625 8559.4609 L n 0 O 0 0.55 1 0.12 k -7856.8418 8572.7002 m -7885 8572.7002 L -7885 8573.8252 L -7856.8418 8573.8252 L -7856.8418 8572.7002 L f u 0 0.55 1 0.3 k -7883.9814 8560.5215 m -7884.4102 8562.5254 -7883.1865 8566.1514 -7880.0874 8569.251 c -7876.9878 8572.3496 -7873.3457 8573.6602 -7871.3594 8573.1455 C -7871.3594 8573.1455 L -7870.875 8571.1895 -7872.1519 8567.5117 -7875.25 8564.4141 c -7878.3457 8561.3184 -7882.0122 8560.1064 -7883.9814 8560.5215 C f 0 0.39 0.7 0.12 k -7883.9814 8585.9912 m -7884.4102 8583.9883 -7883.1865 8580.3613 -7880.0874 8577.2617 c -7876.9878 8574.1641 -7873.3457 8572.8535 -7871.3594 8573.3672 C -7871.3594 8573.3672 L -7870.875 8575.3242 -7872.1519 8579.001 -7875.25 8582.0996 c -7878.3457 8585.1953 -7882.0122 8586.4063 -7883.9814 8585.9912 C f U u 0 0.55 1 0.3 k -7870.1782 8585.9912 m -7870.6074 8583.9883 -7869.3838 8580.3613 -7866.2842 8577.2617 c -7863.1855 8574.1641 -7859.543 8572.8535 -7857.5576 8573.3672 C -7857.5566 8573.3672 L -7857.0718 8575.3242 -7858.3496 8579.001 -7861.4473 8582.0996 c -7864.543 8585.1953 -7868.209 8586.4063 -7870.1782 8585.9912 C f 0 0.39 0.7 0.12 k -7870.1782 8560.5215 m -7870.6074 8562.5254 -7869.3838 8566.1514 -7866.2842 8569.251 c -7863.1855 8572.3496 -7859.543 8573.6602 -7857.5576 8573.1455 C -7857.5566 8573.1455 L -7857.0718 8571.1895 -7858.3496 8567.5117 -7861.4473 8564.4141 c -7864.543 8561.3184 -7868.209 8560.1064 -7870.1782 8560.5215 C f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 67) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 69) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.4609 m -7885 8559.4609 L -7885 8587 L -7857.4609 8587 L -7857.4609 8559.4609 L n 0 O 0 0.55 1 0.3 k -7875.4233 8573.252 m -7874.3096 8571.5313 -7870.8809 8569.833 -7866.4966 8569.833 c -7862.1152 8569.833 -7858.6138 8571.4824 -7857.5718 8573.25 C -7857.5718 8573.25 L -7858.6138 8574.9766 -7862.1152 8576.6738 -7866.4966 8576.6738 c -7870.875 8576.6738 -7874.3242 8574.9375 -7875.4233 8573.252 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 83) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8585.9355 m -7670.4009 8585.9355 L -7670.4009 8578.1348 L -7884 8578.1348 L -7884 8585.9355 L n 0 O 0 0 0 1 k -7884 8582.0352 m -7873.9858 8584.5273 -7867.187 8585.875 -7855.2007 8585.9355 c -7842.2183 8586 -7777.2002 8585.9355 y -7712.1816 8586 -7699.2002 8585.9355 v -7687.2129 8585.875 -7680.415 8584.5273 -7670.4009 8582.0352 C -7680.415 8579.543 -7687.2129 8578.1953 -7699.2002 8578.1348 c -7712.1816 8578.0693 -7777.2002 8578.1348 y -7842.2183 8578.0693 -7855.2007 8578.1348 v -7867.187 8578.1953 -7873.9858 8579.543 -7884 8582.0352 C f U %AI8_EndBrushPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np 4 Bn %AI5_BeginGradient: (Black, White) (Black, White) 0 2 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 %_Br [ 0 0 50 100 %_BS %_0 0 50 100 Bs 1 0 50 0 %_BS %_1 0 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Chrome) (Chrome) 0 6 Bd [ 0 < 464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B 3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272626262625 2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1B1B1B1B1A 1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F 0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 04040403030302020202010101010000 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A 1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 15151515151414141414141414131313131313131312121212121212121211111111111111111010 1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C 0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 07060606060606060606050505050505050504040404040404040303030303030303030202020202 02020201010101010101010000000000 > 1 %_Br 0 0.275 1 < 6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F > 1 %_Br 0 < 00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B 0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 161617171717181818181919191A1A1A1A1B1B1B1C1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C 2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 373738383838393939393A3A3A3B3B3B3B3C3C3C3D3D3D3D3E3E3E3E3F3F3F404040404141414142 42424343434344444444454545464646 > < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > < 00000101020203030304040505050606070708080809090A0A0B0B0B0C0C0D0D0D0E0E0F0F101010 1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5E5F5F606061616162626363646464 6565666666676768686969696A6A6B6B > 1 %_Br 1 0 %_Br < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 35343434333333323232323131313030302F2F2F2E2E2E2E2D2D2D2C2C2C2B2B2B2B2A2A2A292929 282828282727272626262525252524242423232322222222212121202020201F1F1F1E1E1E1D1D1D 1D1C1C1C1B1B1B1A1A1A1A1919191818181717171616161615151514141413131313121212111111 101010100F0F0F0E0E0E0D0D0D0D0C0C0C0B0B0B0A0A0A0A09090908080807070707060606050505 04040404030303020202010101010000 > 0 0 1 %_Br [ 1 0 50 92 %_BS %_1 0 50 92 Bs 0 0.275 1 0.12 1 50 59 %_BS %_0 0.275 1 0.12 1 50 59 Bs 0 0.275 1 0.42 1 50 50 %_BS %_0 0.275 1 0.42 1 50 50 Bs 1 0 50 49 %_BS %_1 0 50 49 Bs 1 0 50 41 %_BS %_1 0 50 41 Bs 1 0.3 0 0 1 50 0 %_BS %_1 0.3 0 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Rainbow) (Rainbow) 0 6 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 0 1 %_Br 1 < 0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E 2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E 7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 F7F8F9FAFBFCFDFEFF > 0 0 1 %_Br 1 < 00000000000000000000000000000000000001010101010101010101010101010101010101010101 01010101010101010101010101010202020202020202020202020202020202020202020202020202 02020202020202020202030303030303030303030303030303030303030303030303030303030303 03030303030304040404040404040404040404040404040404040404040404040404040404040404 04040505050505050505050505050505050505050505050505050505050505050505050505050606 06060606060606060606060606060606060606060606060606060606060606060607070707070707 07070707070707070707070707070707 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 1 %_Br < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > 0 1 0 1 %_Br 0 < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 1 %_Br [ 0 1 0 0 1 50 100 %_BS %_0 1 0 0 1 50 100 Bs 1 1 0 0 1 50 80 %_BS %_1 1 0 0 1 50 80 Bs 1 0.0279 0 0 1 50 60 %_BS %_1 0.0279 0 0 1 50 60 Bs 1 0 1 0 1 50 40 %_BS %_1 0 1 0 1 50 40 Bs 0 0 1 0 1 50 20 %_BS %_0 0 1 0 1 50 20 Bs 0 1 1 0 1 50 0 %_BS %_0 1 1 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Yellow & Orange Radial) (Yellow & Orange Radial) 1 2 Bd [ 0 < 0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F 707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C > < FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E6 > 0 1 %_Br [ 0 0 1 0 1 52 19 %_BS %_0 0 1 0 1 52 19 Bs 0 0.55 0.9 0 1 50 100 %_BS %_0 0.55 0.9 0 1 50 100 Bs BD %AI5_EndGradient %AI5_End_NonPrinting-- %AI5_BeginPalette 0 0 Pb 1 1 1 1 ([Registration]) 0 Xs ([Registration]) Pc 0 0 0 0 k (C=0 M=0 Y=0 K=0) Pc 0 0 0 1 k (C=0 M=0 Y=0 K=100) Pc 0 0.1 1 0 k (C=0 M=10 Y=100 K=0) Pc 0 0.5 0 0 k (C=0 M=50 Y=0 K=0) Pc 0 0.5 1 0 k (C=0 M=50 Y=100 K=0) Pc 1 0.55 1 0 k (C=100 M=55 Y=100 K=0) Pc 1 0.9 0.1 0 k (C=100 M=90 Y=10 K=0) Pc 0.15 1 1 0 k (C=15 M=100 Y=100 K=0) Pc 0.45 0.9 0 0 k (C=45 M=90 Y=0 K=0) Pc 0.5 0.4 0.3 0 k (C=50 M=40 Y=30 K=0) Pc 0.5 0.85 1 0 k (C=50 M=85 Y=100 K=0) Pc 0.75 0.05 1 0 k (C=75 M=5 Y=100 K=0) Pc 0.75 0.9 0 0 k (C=75 M=90 Y=0 K=0) Pc 0.8 0.05 0 0 k (C=80 M=5 Y=0 K=0) Pc Bb 2 (Black, White) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Black, White) Pc Bb 2 (Chrome) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Chrome) Pc Bb 2 (Rainbow) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Rainbow) Pc Bb 0 0 0 0 Bh 2 (Yellow & Orange Radial) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Yellow & Orange Radial) Pc (Brick) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Brick) Pc (Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Confetti) Pc (Leaves - Fall ) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Leaves - Fall ) Pc (Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Stripes) Pc PB %AI5_EndPalette %AI5_Begin_NonPrinting Np %AI8_BeginPluginObject (Adobe Brush Manager Order) (Adobe Brush Manager Order) ( Adobe Calligraphic Brush Tool/ 6 pt Flat / Adobe Calligraphic Brush T) - (ool/ 10 pt Oval/ Adobe Calligraphic Brush Tool/ 12 pt Oval / Adobe Cal) - (ligraphic Brush Tool/ 20 pt Oval/ Adobe Calligraphic Brush Tool/ 25 pt) - ( Round / Adobe Calligraphic Brush Tool/ 50 pt Flat/ Adobe Scatter Brus) - (h Tool/ Dog Tracks/ Adobe Scatter Brush Tool/ Fall Leaf/ Adobe Scatter) - ( Brush Tool/ Ladybug/ Adobe Scatter Brush Tool/ Push Pin/ Adobe Scatte) - (r Brush Tool/ Strawberry/ Adobe Scatter Brush Tool/ Twinkle Star / Ado) - (be ArtOnPath Brush Tool/ Marker/ Adobe ArtOnPath Brush Tool/ Tapered S) - (troke/ Adobe ArtOnPath Brush Tool/ Arrow/ Adobe ArtOnPath Brush Tool/ ) - (Paintbrush/ Adobe ArtOnPath Brush Tool/ Type/ Adobe PatternOnPath Brus) - (h Tool/ Double Lines/ Adobe PatternOnPath Brush Tool/ Laurel/ Adobe Pa) - (tternOnPath Brush Tool/ Rope /) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (6 pt Flat ) (1 4 8 10 10 90 90 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (10 pt Oval) (1 1 19 15 15 130 130 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (12 pt Oval ) (1 7 17 45 45 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (20 pt Oval) (1 20 20 20 100 40 80 0 2 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (25 pt Round ) (1 10 40 100 100 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (50 pt Flat) (1 40 60 0 0 44 44 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Arrow) (1 / New Pattern 45/ / / / / 5 0.898039 0 0 / 2 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Marker) (1 / New Pattern 8/ / / / / 0 0 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Paintbrush) (1 / New Pattern 5/ / / / / 1 0.5 0.85 1 0.45 / 0 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Tapered Stroke) (1 / New Pattern 83/ / / / / 1 0 0 0 1 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Type) (1 / New Pattern 50/ / / / / 1 0.952941 0.94902 0.196078 0.0745098 / 1) - ( 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Double Lines) (1 / New Pattern 62/ New Pattern 63/ New Pattern 64/ / / 1 1 0.14 0.09 ) - (0 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Laurel) (1 / New Pattern 65/ New Pattern 42/ New Pattern 67/ / New Pattern 69/ ) - (1 0 0.55 1 0.3 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Rope ) (1 / New Pattern 1/ / / New Pattern 3/ New Pattern 6/ 5 0 0 0 / 1 0 1 ) - (0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Dog Tracks) (1 /New Pattern 41/ 1 0 0 0 1 / 0 1 1 0 1 1 0 0 0 0 -90 -90 0 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Fall Leaf) (1 /New Pattern 34/ 1 0.0745 0.9 0.9019 0.18 / 0 0.602793 1 1 0.1 1 1 -) - (1 1 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Ladybug) (1 /New Pattern 10/ 5 0.898039 0 0 / 0 1 1 0 0.803911 1.2 1 -1.55 1.55 ) - (1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Push Pin) (1 /New Pattern 36/ 1 0.025 0.1 0.475 0 / 0 1 1 0 0.401676 1 1 -1.06145) - ( 1.06 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Strawberry) (1 /New Pattern 37/ 1 0 0 0 1 / 0 0.803911 1 1 0.803911 1 1 -0.5 0.5 1 ) - (-75 75.419 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Twinkle Star ) (1 /New Pattern 2/ 0 1 / 1 0.5 1 1 0.25 1 1 -0.5 0.5 1 0 0 0 0 0) . %AI8_EndPluginObject %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_PluginGroupInfo (Adobe Path Blends) (Adobe Blends Plugin) (Live Blends) %AI8_PluginGroupInfo (Adobe PatternOnPath Brush Tool) (Adobe Pattern Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe ArtOnPath Brush Tool) (Adobe Art Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe Calligraphic Brush Tool) (Undo New Calligraphic Brush) (Calligraphic Brush Tool) %AI8_PluginGroupInfo (Adobe Scatter Brush Tool) (Adobe Scatter Brush Plugin) (Scatter Brush Tool) %AI5_End_NonPrinting-- %AI5_BeginLayer 1 1 1 1 0 0 1 0 79 128 255 0 50 Lb (Layer 1) Ln 0 A 0 O 1 g 0 R 0 G 300 Ar 2 J 0 j 0.72 w 3.86 M []0 d %AI3_Note: 0 D 1 XR 61.8799 737.2402 m 115.8799 737.2402 l 115.8799 683.7202 l 61.8799 683.7202 l 61.8799 737.2402 l b /BBAccumRotation (0.000000) XT 170.3599 549.5601 m 224.3599 549.5601 l 224.3599 513.8003 l 170.3599 513.8003 l 170.3599 549.5601 l b /BBAccumRotation (0.000000) XT 0 XR 224.3599 531.8003 m 170.3599 531.8003 l S /BBAccumRotation (0.000000) XT 224.3599 540.6802 m 170.3599 540.6802 l S /BBAccumRotation (0.000000) XT 224.3599 522.6802 m 170.3599 522.6802 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 278.3599 594.2002 m 332.3604 594.2002 l 332.3604 540.6802 l 278.3599 540.6802 l 278.3599 594.2002 l b /BBAccumRotation (0.000000) XT 278.3599 524.8398 m 332.3604 524.8398 l 332.3604 471.3198 l 278.3599 471.3198 l 278.3599 524.8398 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 85.6597 739.3901 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR %_ 0 50 XQ /_Times-Roman 9.93 8.9171 -2.1648 Tf 0 Ts 100.7049 100 Tz 0 Tt %_0 0 100 100 Xu %AI55J_GlyphSubst: GlyphSubstNone 1 TA %_ -- XL 0 TY 0 TV 36 0 Xb XB 0 0 5 TC 100 100 200 TW 25 TG 0 0 0 Ti 0 Ta 0 1 2 2 3 Th 0 Tq 240 Tg 0 0 Tl 0 Tc 0 Tw (vnode) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 177.6797 507.04 0 Tp 0 Tv TP 0 Tr (bhv_desc) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 287.4497 533.8398 0 Tp 0 Tv TP 0 Tr (xfs_inode) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 287.4497 462.3501 0 Tp 0 Tv TP 0 Tr (xfs_vnodeops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 131.48 702.4399 m 141.0801 701.96 l 133.1597 707.48 l 132.4399 705.0801 l 131.48 702.4399 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 131.48 702.4399 m 141.0801 701.96 l 133.1597 707.48 l 132.4399 705.0801 l 131.48 702.4399 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 131.96 705.0801 m 115.8799 710.3599 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 366.4395 522.2002 m 375.5596 524.8398 l 366.4395 527.48 l 366.4395 524.8398 l 366.4395 522.2002 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 366.4395 522.2002 m 375.5596 524.8398 l 366.4395 527.48 l 366.4395 524.8398 l 366.4395 522.2002 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 365.96 524.8398 m 305.48 524.8398 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 272.6001 584.6001 m 277.1597 593 l 268.7598 588.4399 l 270.6797 586.52 l 272.6001 584.6001 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 272.6001 584.6001 m 277.1597 593 l 268.7598 588.4399 l 270.6797 586.52 l 272.6001 584.6001 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 270.1997 586.04 m 224.3599 540.6802 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 267.3198 520.04 m 276.6797 522.6802 l 267.3198 525.3203 l 267.3198 522.6802 l 267.3198 520.04 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 267.3198 520.04 m 276.6797 522.6802 l 267.3198 525.3203 l 267.3198 522.6802 l 267.3198 520.04 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 266.8398 522.6802 m 224.3599 522.6802 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 56.1201 729.3203 m 60.4399 736.04 l 53.2397 732.6802 l 54.6797 731 l 56.1201 729.3203 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 56.1201 729.3203 m 60.4399 736.04 l 53.2397 732.6802 l 54.6797 731 l 56.1201 729.3203 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 54.4399 730.52 m 52.7598 729.3203 l 52.7598 673.6401 l 79.8799 665.7202 l 142.7598 689.48 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 227.48 496.7603 m 232.7598 488.8398 l 232.52 498.4399 l 229.8799 497.48 l 227.48 496.7603 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 227.48 496.7603 m 232.7598 488.8398 l 232.52 498.4399 l 229.8799 497.48 l 227.48 496.7603 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 229.8799 497.96 m 224.3599 513.8003 l S /BBAccumRotation (0.000000) XT 242.3599 478.04 m 224.3599 478.04 l S /BBAccumRotation (0.000000) XT 242.3599 469.1602 m 224.3599 469.1602 l S /BBAccumRotation (0.000000) XT 242.3599 460.2803 m 224.3599 460.2803 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 224.4497 451.2603 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (NULL) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 386.4502 522.75 0 Tp 0 Tv TP 0 Tr (xfs_open\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 366.4395 511.1602 m 375.5596 513.8003 l 366.4395 516.4399 l 366.4395 513.8003 l 366.4395 511.1602 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 366.4395 511.1602 m 375.5596 513.8003 l 366.4395 516.4399 l 366.4395 513.8003 l 366.4395 511.1602 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 365.96 513.8003 m 332.3604 513.8003 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 386.4502 515.9702 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_close\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 413.4502 504.8799 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 413.4502 495.9399 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 413.4502 487.0103 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 1 g 0 R 0 G 2 J 0.72 w 3.86 M 1 XR 142.7598 710.3599 m 197 710.3599 l 197 674.6001 l 142.7598 674.6001 l 142.7598 710.3599 l b /BBAccumRotation (0.000000) XT 0 XR 197 692.6001 m 142.7598 692.6001 l S /BBAccumRotation (0.000000) XT 197 701.48 m 142.7598 701.48 l S /BBAccumRotation (0.000000) XT 197 683.7202 m 142.7598 683.7202 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 250.7598 755 m 305 755 l 305 701.48 l 250.7598 701.48 l 250.7598 755 l b /BBAccumRotation (0.000000) XT 250.7598 685.8799 m 305 685.8799 l 305 632.1201 l 250.7598 632.1201 l 250.7598 685.8799 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 150.1099 667.8901 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR (bhv_desc) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 259.8799 694.7002 0 Tp 0 Tv TP 0 Tr (dsvn) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 259.8799 623.21 0 Tp 0 Tv TP 0 Tr (dsvnops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 338.8398 683.2402 m 347.96 685.8799 l 338.8398 688.52 l 338.8398 685.8799 l 338.8398 683.2402 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 338.8398 683.2402 m 347.96 685.8799 l 338.8398 688.52 l 338.8398 685.8799 l 338.8398 683.2402 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 338.3594 685.8799 m 277.8799 685.8799 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 245 745.3999 m 249.5601 753.7998 l 241.1597 749.2402 l 243.0801 747.3203 l 245 745.3999 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 245 745.3999 m 249.5601 753.7998 l 241.1597 749.2402 l 243.0801 747.3203 l 245 745.3999 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 242.6001 747.0801 m 197 701.48 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 239.96 681.0801 m 249.0801 683.7202 l 239.96 686.3599 l 239.96 683.7202 l 239.96 681.0801 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 239.96 681.0801 m 249.0801 683.7202 l 239.96 686.3599 l 239.96 683.7202 l 239.96 681.0801 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 239.2397 683.7202 m 197 683.7202 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 169.6396 560.8398 m 170.3599 551.2402 l 174.6797 559.8799 l 172.2798 560.3599 l 169.6396 560.8398 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 169.6396 560.8398 m 170.3599 551.2402 l 174.6797 559.8799 l 172.2798 560.3599 l 169.6396 560.8398 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 172.2798 560.8398 m 197 674.6001 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 358.8799 683.6099 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (dsvn_open\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 338.8398 671.96 m 347.96 674.6001 l 338.8398 677.2402 l 338.8398 674.6001 l 338.8398 671.96 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 338.8398 671.96 m 347.96 674.6001 l 338.8398 677.2402 l 338.8398 674.6001 l 338.8398 671.96 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 338.3594 674.6001 m 305 674.6001 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 358.8799 676.8301 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (dsvn_close\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 385.8799 665.7402 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 385.8799 656.8003 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 385.8799 647.8604 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 50.8398 734.6001 m 59.96 737.2402 l 50.8398 739.8799 l 50.8398 737.2402 l 50.8398 734.6001 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 50.8398 734.6001 m 59.96 737.2402 l 50.8398 739.8799 l 50.8398 737.2402 l 50.8398 734.6001 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 50.3599 737.2402 m 35 737.2402 l 35 638.8398 l 169.8799 531.8003 l S /BBAccumRotation (0.000000) XT LB %AI5_EndLayer-- gsave annotatepage grestore showpage Adobe_Illustrator_AI5 /terminate get exec Adobe_shading_AI8 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_cshow /terminate get exec Adobe_level2_AI5 /terminate get exec %%EndDocument @endspecial 1370 4219 a Fe(Figure)19 b(4:)26 b(CXFS)21 b(layered)e(o)o(v)o(er)g(XFS.)1929 5656 y(6)p eop %%Page: 7 7 7 6 bop 83 390 a Fc(\017)41 b Fe(\002le-system)20 b(speci\002c)h (information)83 556 y Fc(\017)41 b Fe(pointer)19 b(to)h(the)h(vnode)83 723 y(Each)c(b)n(uf)g(structure)f(is)i(associated)f(with)g(a)h(de)n (vice)e(and)h(block)0 822 y(number)-5 b(.)31 b(A)23 b(major)f(interf)o (ace)g(routine)f(for)h(the)h(b)n(uf)n(fer)e(cache)h(is)0 922 y(get)p 107 922 25 4 v 29 w(b)n(uf.)47 b(It)28 b(is)g(called)g(to)f (associate)h(a)g(piece)f(of)h(memory)e(and)0 1022 y(the)21 b(b)n(uf)g(structure)f(with)i(a)f(block)f(number)g(and)g(de)n(vice,)h (and)f(re-)0 1121 y(turn)15 b(the)i(b)n(uf)e(structure)h(\223lock)o (ed\224.)22 b(If)16 b(the)g(b)n(uf)g(structure)f(already)0 1221 y(e)o(xists,)k(we)g(ha)n(v)o(e)e(a)i(cache)f(hit.)25 b(If)18 b(it)h(doesn')o(t)e(e)o(xist,)h(a)h(b)n(uf)n(fer)e(\(as-)0 1320 y(sociated)28 b(with)g(a)g(dif)n(ferent)f(de)n(vice)g(and)g (block\))g(may)h(need)f(to)0 1420 y(be)20 b(\003ushed)g(from)f(memory)f (and)i(re-associated)f(with)h(the)g(block)0 1520 y(requested)k(by)h (get)p 560 1520 V 29 w(b)n(uf.)40 b(get)p 862 1520 V 29 w(b)n(uf)25 b(does)g(not)g(read)f(the)h(disk;)j(in-)0 1619 y(stead,)c(bread)e(or)g(breada)g(call)i(get)p 1012 1619 V 29 w(b)n(uf)f(and)f(then)h(read)f(the)h(disk)0 1719 y(\(if)i(the)g(data)g(isn')o(t)f(already)g(there\).)38 b(XFS)26 b(uses)f(get)p 1543 1719 V 30 w(b)n(uf)f(e)o(xten-)0 1819 y(si)n(v)o(ely)e(to)h(associate)f(b)n(uf)n(fers)g(with)g (meta-data)g(such)g(as)h(inodes,)0 1918 y(the)d(super)g(block,)f(and)g (the)i(XFS)g(log.)83 2018 y(There)k(are)h(v)n(arious)e(other)h (routines)g(that)h(are)f(used)h(by)f(XFS)0 2117 y(to)20 b(interf)o(ace)g(with)g(the)g(b)n(uf)n(fer)f(cache)h(including:)83 2300 y Fc(\017)41 b Fe(getblk)19 b(\226)i(same)f(as)h(get)p 845 2300 V 29 w(b)n(uf)f(b)n(ut)g(with)h(no)e(\003ags)83 2467 y Fc(\017)41 b Fe(bread)28 b(\226)g(get)p 557 2467 V 30 w(b)n(uf)g(and)g(read)g(the)h(disk)g(if)g(the)f(data)h(is)g(not) 166 2566 y(already)19 b(there)83 2732 y Fc(\017)41 b Fe(breada)16 b(\226)h(bread,)f(b)n(ut)h(don')o(t)f(w)o(ait)h(for)g(the) g(I/O)g(to)g(complete)83 2899 y Fc(\017)41 b Fe(bwrite)31 b(\226)g(release)g(the)f(b)n(uf,)j(write)f(it,)i(and)c(w)o(ait)i(for)e (I/O)166 2998 y(completion)83 3165 y Fc(\017)41 b Fe(bdwrite)22 b(\226)i(release)f(the)g(b)n(uf,)h(it)f(will)h(be)g(written)f(before)e (it)166 3264 y(is)g(reassociated)83 3430 y Fc(\017)41 b Fe(ba)o(write)20 b(\226)g(release)g(the)g(b)n(uf,)g(start)g(the)h (write,)f(don')o(t)e(w)o(ait)83 3597 y Fc(\017)41 b Fe(brelse)25 b(\226)g(release)g(a)g(pre)n(viously)e(lock)o(ed)h(b)n(uf)n(fer)g (\(get)p 1755 3597 V 29 w(b)n(uf,)166 3696 y(getblk,)19 b(...)25 b(lock\))83 3863 y Fc(\017)41 b Fe(bpin)23 b(\226)i(pin)e(the) i(b)n(uf)n(fer)d(\(don')o(t)h(let)h(it)h(be)f(written\))g(to)g(disk)166 3962 y(until)c(unpinned)83 4128 y Fc(\017)41 b Fe(b)n(unpin)e(\226)i (unpin)e(the)i(b)n(uf)n(fer)e(and)h(w)o(ak)o(eup)f(processes)166 4228 y(w)o(aiting)20 b(on)g(the)g(b)n(uf)n(fer)-5 b(.)83 4411 y(IRIX)39 b(w)o(as)g(enhanced)d(to)j(ha)n(v)o(e)e(b)n(uf)n(fer)g (\223clusters\224)i(abo)o(v)o(e)0 4510 y(the)29 b(standard)f(b)n(uf)n (fer)g(cache)h(to)g(impro)o(v)o(e)f(write)h(performance)0 4610 y([16)o(].)j(This)23 b(allo)n(ws)g(logically)f(contiguous)f(b)n (uf)n(fers)h(\(with)g(non-)0 4710 y(contiguous)34 b(memory\))g(to)i(be) f(handled)g(as)h(if)h(the)o(y)e(were)g(all)0 4809 y(physically)23 b(contiguous.)37 b(The)25 b(b)n(uf)f(structure)g(continues)g(to)h(be)0 4909 y(the)g(basic)h(data)f(structure)g(e)n(v)o(en)f(for)h(clustered)g (b)n(ufs.)40 b(Another)0 5009 y(structure,)19 b(bmapv)n(al,)f(is)j (used)f(to)h(specify)e(the)h(cluster)-5 b(.)83 5108 y(An)17 b(important)e(capability)g(of)h(the)h(b)n(uf)n(fer)e(clusters)i(is)g (delayed)0 5208 y(allocation.)23 b(Actual)17 b(allocation)f(of)h(disk)g (blocks)g(for)f(user)i(writes)0 5308 y(can)f(be)g(postponed)e(or)i (completely)f(eliminated)g(with)i(this)f(func-)0 5407 y(tionality)-5 b(.)67 b(The)34 b(block)g(number)f(of)h(a)h(b)n(uf)f (which)g(is)i(\223under)1992 390 y(delayed)28 b(allocation\224)h(is)j (-1.)54 b(If)30 b(the)g(\002le)h(is)g(truncated)e(before)1992 490 y(the)20 b(actual)g(disk)g(allocation,)f(the)h(data)g(ne)n(v)o(er)f (touches)h(the)g(disk.)1992 589 y(Disk)f(allocation)g(is)h(caused)f (either)g(by)g(a)h(get)p 3313 589 V 30 w(b)n(uf)f(reassociating)1992 689 y(a)e(b)n(uf)n(fer)f(to)h(another)f(de)n(vice)g(and)h(block)f (number)m(,)f(or)i(by)g(a)h(back-)1992 789 y(ground)i(daemon)i(which)g (periodically)g(\003ushes)h(out)g(a)g(percent-)1992 888 y(age)c(of)g(dirty)g(b)n(uf)n(fers)f(\(which)h(can)g(include)f(delayed) h(allocation)1992 988 y(b)n(uf)n(fers\).)2075 1097 y(The)g(interf)o (ace)h(routines)f(for)h(clustering)f(b)n(uf)n(fers)g(are:)2075 1319 y Fc(\017)41 b Fe(chunkread)14 b(\226)k(return)e(a)i(b)n(uf)n(fer) e(cluster)m(,)i(start)g(a)g(readahead,)2158 1418 y(w)o(ait)i(for)g(I/O) 2075 1623 y Fc(\017)41 b Fe(getchunk)22 b(\226)i(return)f(a)i (clustered)e(b)n(uf)n(fer)g(associated)h(with)2158 1723 y(a)c(vnode)2075 1927 y Fc(\017)41 b Fe(chunkpush)14 b(\226)k(push)f(out)g(b)n(uf)n(fers)g(in)h(a)g(range)e(for)h(the)h(gi)n (v)o(en)2158 2027 y(vnode.)2075 2248 y(More)28 b(details)i(on)f(IRIX)g (clustering)f(and)h(the)g(b)n(uf)n(fer)f(cache)1992 2348 y(operation)18 b(are)i(gi)n(v)o(en)f(in)h(later)g(sections.)1992 2681 y Ff(3)119 b(The)30 b(Linux)h(VFS)f(Lay)o(er)1992 2885 y Fe(In)19 b(this)i(section)f(we)h(describe)e(the)h(Linux)f(VFS)i (layer)f([17)o(].)1992 3176 y Fd(3.1)99 b(struct)26 b(\002le)p 2623 3176 30 4 v 36 w(system)p 2947 3176 V 35 w(type)1992 3350 y Fe(The)g Fb(struct)i(\002le)p 2472 3350 25 4 v 30 w(system)p 2723 3350 V 30 w(type)f Fe(structure)f(is)i(used)f(to)h (re)o(gister)e(a)1992 3450 y(particular)18 b(\002le)j(system)g(type)e (with)i(Linux.)j(Its)c(elements)g(are:)1992 3671 y Fa(name)41 b Fe(The)20 b(name)f(of)h(the)g(\002lesystem)h(\(e)o(xt2,)e(nfs,)h (xfs,)g(...\))1992 3876 y Fa(\003ags)40 b Fe(These)20 b(\003ags)f(describe)g(the)g(type)g(of)g(\002le)h(system)g(that)f(this) 2158 3975 y(structure)24 b(represents.)40 b(The)25 b(most)h(commonly)d (used)i(\003ag)2158 4075 y(is)k(FS)p 2339 4075 V 30 w(REQ)o(UIRES)p 2774 4075 V 30 w(DEV)g(which)f(tells)i(Linux)d(that)i(this)2158 4174 y(\002lesystem)d(must)h(mount)e(a)i(block)f(de)n(vice.)43 b(\(Netw)o(ork)o(ed)2158 4274 y(\002lesystems)20 b(such)g(as)h(NFS)g (shouldn')o(t)d(set)j(this)g(\003ag.\))1992 4479 y Fa(r)o(ead)e(super)i (function)41 b Fe(This)21 b(is)g(the)g(function)e(that)h(is)i(called)e (to)2158 4578 y(mount)f(a)h(\002le)h(system)f(of)g(this)h(type.)2075 4800 y(When)31 b(a)i(\002le)g(system)f(module)f(is)i(initialized,)h(it) f(calls)g(the)1992 4899 y(function)e Fb(r)m(e)m(gister)p 2559 4899 V 29 w(\002lesystem)j Fe(with)f(a)g(pointer)f(to)h(this)g (struc-)1992 4999 y(ture.)60 b(From)32 b(that)g(point)g(on,)i(an)o(y)e (attempts)g(to)g(mount)f(a)i(\002le)1992 5099 y(system)21 b(with)h(that)g(name)f(\002nd)h(that)f(structure.)29 b(The)21 b(structure')-5 b(s)1992 5198 y Fb(r)m(ead)p 2147 5198 V 29 w(super)20 b Fe(function)e(is)j(called)f(to)h(mount)e (the)h(\002le)h(system.)2075 5308 y(The)31 b Fb(unr)m(e)m(gister)p 2577 5308 V 29 w(\002lesystem)i Fe(function)e(is)i(called)f(when)g(the) 1992 5407 y(\002le)20 b(system)h(module)e(is)i(unloaded)d(from)h (memory)-5 b(.)1929 5656 y(7)p eop %%Page: 8 8 8 7 bop 0 390 a Fd(3.2)99 b(struct)26 b(super)0 558 y Fe(The)16 b(super)f(block)g(structure,)g Fb(struct)i(super)p Fe(,)f(contains)f(\002elds)i(and)0 658 y(operations)27 b(ha)n(ving)g(to)h(do)g(with)h(the)f(whole)g(\002lesystem.)49 b(The)0 758 y(major)19 b(\002elds)i(in)f(the)h(superblock)d(include:)0 967 y Fa(de)o(vice)i(name)41 b Fe(The)25 b(de)n(vice)g(structure)g (that)h(describes)f(the)g(de-)166 1066 y(vice)f(the)f(\002le)h(system)g (is)h(mounted)d(on.)34 b(The)24 b(de)n(vice)f(may)166 1166 y(be)d(zero)g(for)f(some)h(distrib)n(uted)g(\002le)g(systems.)0 1359 y Fa(\002le)h(system)f(blocksize)42 b Fe(The)33 b(Linux)g(VFS)i(kno)n(ws)e(what)g(size)166 1458 y(b)n(uf)n(fers)19 b(mak)o(e)h(up)g(the)g(\002le)h(system.)0 1651 y Fa(r)o(oot)e(dcache)h (entry)41 b Fe(The)23 b(pointer)g(to)h(the)g(root)f(Dcache)h(entry)-5 b(.)166 1750 y(This)29 b(means)f(that)h(the)g(Linux)f(VFS)h(layer)f(al) o(w)o(ays)i(has)f(a)166 1850 y(handle)16 b(on)g(the)h(root)f(inode)g (of)g(the)h(\002le)g(system.)24 b(vnode/vfs)166 1950 y(style)f(operating)e(systems)i(ha)n(v)o(e)g(a)g(vfs)g(operation)d (that)j(re-)166 2049 y(turns)d(it.)0 2242 y Fa(\002le)h(system)f(pri)o (v)o(ate)g(data)40 b Fe(The)35 b Fb(struct)h(super)f Fe(contains)g(a)g(C)166 2342 y(union)30 b(which)g(is)j(the)e(union)f (of)g(the)i(pri)n(v)n(ate)e(data)h(of)f(all)166 2441 y(the)35 b(dif)n(ferent)f(Linux)g(\002le)i(systems.)70 b(This)35 b(means)g(that)166 2541 y(memory)21 b(for)g(the)i Fb(struct)g(super)f Fe(and)g(the)h(pri)n(v)n(ate)e(data)h(are)166 2640 y(allocated)30 b(all)h(at)f(once)g(to)h(reduce)e(memory)f (fragmenta-)166 2740 y(tion.)k(Installable)23 b(\002lesystems)g(can)g (also)g(use)g(a)g(v)n(oid)f(data)166 2840 y(pointer)30 b(in)h(the)g(union,)i(so)e(the)g(k)o(ernel)g(doesn')o(t)e(ha)n(v)o(e)i (to)166 2939 y(kno)n(w)19 b(about)g(e)n(v)o(ery)g(\002lesystem)i(when)e (it)i(is)g(compiled.)0 3132 y Fa(super)g(block)g(operations)40 b Fe(The)f(superblock)e(de\002nes)h(opera-)166 3231 y(tions)29 b(that)g(operate)f(on)g(that)h(\002le)h(system.)51 b(Some)28 b(of)h(the)166 3331 y(operations)19 b(found)g(here)g(are)i(typical)f (of)g(those)g(associated)166 3431 y(with)g(a)h(vfs)f(layer)m(,)f (including:)266 3646 y Fc(\017)41 b Fe(report)16 b(block)g(and)h(inode) f(usage)h(information)e(about)349 3746 y(the)20 b(\002le)h(system)266 3892 y Fc(\017)41 b Fe(remount)18 b(the)i(\002le)h(system)266 4038 y Fc(\017)41 b Fe(unmount)18 b(the)i(\002le)h(system.)166 4254 y(Linux')-5 b(s)17 b(super)h(block)f(operations)g(are)h(dif)n (ferent)e(from)h(the)166 4354 y(SVR4)31 b(vfs)f(operations)e([15)o(])i (in)g(that)g(the)o(y)g(also)g(include)166 4453 y(operations)e(to)i (deal)g(with)g(the)g(reading)f(and)g(writing)g(in-)166 4553 y(odes.)c(There)19 b(are)h(operations)f(to:)266 4769 y Fc(\017)41 b Fe(read)17 b(in)h(an)g(inode)f(gi)n(v)o(en)f(the)i (\002le)h(system)f(it)g(belongs)349 4868 y(to)i(and)g(its)h(inode)e (number)-5 b(.)266 5014 y Fc(\017)41 b Fe(remo)o(v)o(e)18 b(the)i(inode)f(from)h(memory)266 5160 y Fc(\017)41 b Fe(deallocte)19 b(the)h(inode)266 5307 y Fc(\017)41 b Fe(modify)34 b(the)h(\223stat\224-type)g(information)e(about)i(the)349 5406 y(inode.)1992 390 y Fd(3.3)99 b(struct)26 b(dentry)1992 557 y Fe(The)33 b(Linux)g(VFS)i(layer)f(also)g(e)o(xploits)g(the)g (directory)e(cache)1992 657 y(\(dcache\).)27 b(The)21 b(dcache)f(is)j(a)f(cache)f(of)g(directories)f(and)h(the)h(in-)1992 756 y(odes)f(contained)g(in)h(them.)31 b(Its)23 b(function)d(is)j(to)g (cache)e(directory)1992 856 y(lookups)d(and)h(inodes)h(in)g(memory)e (in)i(order)f(to)h(mak)o(e)f(directory)1992 956 y(manipulation)e (operations)i(f)o(aster)-5 b(.)2075 1061 y(When)23 b(the)h(VFS)h(w)o (ants)f(to)g(\002nd)g(a)g(particular)f(\002lename)g(in)h(a)1992 1161 y(directory)-5 b(,)16 b(it)i(\002rst)h(does)f(a)h(search)e(of)h (the)g(dcache.)24 b(If)18 b(it)g(\002nds)h(the)1992 1260 y(entry)i(in)i(the)g(dcache,)f(it)h(just)h(uses)f(that.)32 b(If)23 b(the)g(entry)e(is)j(not)e(in)1992 1360 y(the)h(dcache,)f(it)i (issues)g(a)f(lookup)f(call)h(to)g(the)g(\002le)h(system.)34 b(The)1992 1460 y(ne)n(w)20 b(inode)f(is)i(then)f(added)f(to)h(the)g (dcache.)2075 1565 y(Since)38 b(hard)f(links)h(are)f(allo)n(wed)h(in)g (UNIX)g(\002le)g(systems,)1992 1665 y(there)29 b(may)h(be)g(more)g (than)g(one)f(dcache)h(entry)f(pointing)g(to)h(a)1992 1764 y(gi)n(v)o(en)h(inode.)62 b(Each)32 b(dcache)g(entry)g(represents) g(a)h(particular)1992 1864 y(path)19 b(to)i(that)f(inode.)2075 1970 y(The)j(dcache)h(is)h(made)f(up)g(of)g Fb(struct)h(dentry)f Fe(structure.)36 b(The)1992 2069 y(major)19 b(members)g(of)h(this)h (structure)e(are:)1992 2276 y Fa(inode)h(pointer)41 b Fe(the)17 b(inode)f(that)h(this)g(dcache)g(entry)f(represents.)1992 2465 y Fa(par)o(ent)j(dir)o(ectory)39 b Fe(a)32 b(pointer)f(the)h(the)f (directory)f(containing)2158 2565 y(this)20 b(dcache)f(entry)-5 b(.)1992 2755 y Fa(name)41 b Fe(the)20 b(name)f(of)h(this)h(inode)e(in) i(the)f(parent)f(directory)-5 b(.)1992 2944 y Fa(list)20 b(of)g(subdir)o(ectories)41 b Fe(If)17 b(this)h(dcache)e(entry)h (represents)f(a)i(di-)2158 3044 y(rectory)-5 b(,)18 b(there)i(is)h(a)f (partial)g(list)h(of)f(its)i(subdirectories.)1992 3234 y Fa(pri)o(v)o(ate)d(data)h(and)g(dcache)h(operations)40 b Fe(The)45 b Fb(struct)i(dentry)2158 3333 y Fe(contains)26 b(a)h(pointer)e(to)i(pri)n(v)n(ate)f(data)g(and)g(a)i(set)f(of)f(oper)n (-)2158 3433 y(ations)f(that)i(each)e(speci\002c)h(\002le)h(system)f (can)g(implement.)2158 3533 y(The)o(y)j(are)i(used)g(by)f(the)h(\002le) h(system)f(to)g(mak)o(e)g(sure)g(the)2158 3632 y(dcache)20 b(is)j(current)d(as)i(other)f(clients)h(of)f(a)h(distrib)n(uted)f (\002le)2158 3732 y(system)f(manipulate)f(the)h(directory)e(tree.)2158 3877 y(The)30 b(most)g(important)f(dcache)g(operation)g(is)i(re)n(v)n (alidate.)2158 3976 y(When)24 b(the)g(Linux)f(VFS)i(uses)g(the)f(data)g (in)h(the)f(dcache)f(to)2158 4076 y(a)n(v)n(oid)30 b(doing)e(a)j (lookup,)g(it)g(calls)g(the)f(re)n(v)n(alidate)f(opera-)2158 4175 y(tion.)41 b(The)25 b(re)n(v)n(alidate)f(asks)i(the)g(underlying)d (\002le)j(system)2158 4275 y(to)20 b(mak)o(e)g(sure)g(the)g(dcache)f (entry)h(is)h(still)g(v)n(alid.)1992 4545 y Fd(3.4)99 b(struct)26 b(inode)1992 4712 y Fe(The)16 b Fb(struct)h(inode)e Fe(represents)h(inodes)g(in)h(the)f(Linux)g(VFS)h(layer)-5 b(.)1992 4812 y(The)19 b(important)g(members)g(of)h(the)g(structure)f (are:)1992 5018 y Fa(inode)h(number)42 b Fe(the)20 b(Linux)g(inode)f (kno)n(ws)h(the)g(number)e(of)j(the)2158 5118 y(inode)e(it')-5 b(s)21 b(representing)1992 5308 y Fa(\223stat\224)d(inf)n(ormation)40 b Fe(the)26 b(inode)f(contains)g(the)h(\002le)g(size,)i(per)n(-)2158 5407 y(missions,)20 b(o)n(wnership,)e(timestamps,)i(and)f(link)h(count) 1929 5656 y(8)p eop %%Page: 9 9 9 8 bop 0 390 a Fa(list)21 b(of)f(Dcache)g(entries)41 b Fe(a)21 b(list)g(of)f(all)g(the)g(Dcache)g(entries)g(that)166 490 y(point)30 b(to)h(the)f(inode)g(is)i(k)o(ept.)56 b(This)30 b(enables)h(the)f(Linux)166 589 y(VFS)24 b(to)f(\002nd)f (full)h(path)g(names)f(for)g(each)h(inode)f(in)h(mem-)166 689 y(ory)0 847 y Fa(inode)e(pri)o(v)o(ate)e(data)41 b Fe(there)36 b(is)h(a)g(union)e(similar)i(to)f(the)h(one)166 947 y(stored)29 b(in)h(the)f Fb(struct)i(super)e Fe(that)h(holds)f (data)g(about)g(the)166 1047 y(inode)19 b(that)i(is)g(pri)n(v)n(ate)e (to)h(the)g(\002le)h(system)0 1205 y Fa(inode)g(operations)40 b Fe(These)d(are)g(the)g(operations)f(that)i(act)f(on)166 1304 y(each)22 b(inode,)h(including)e(lookup,)g(create,)i(symlink,)f (read-)166 1404 y(link,)50 b(rename,)f(mkdir)m(,)g(rmdir)m(,)f(unlink,) h(mknod,)g(and)166 1504 y(bmap.)27 b(Some)21 b(of)g(the)g(notable)f (operations)g(that)h(are)h(miss-)166 1603 y(ing)e(in)g(this)h (structure)e(are:)266 1774 y Fc(\017)41 b Fe(operations)23 b(that)j(read)e(in)i(and)e(thro)n(w)h(a)o(w)o(ay)g(inodes)349 1874 y(are)20 b(in)g(the)g(super)g(block)f(operations)266 1999 y Fc(\017)41 b Fe(readdir)m(,)21 b(read,)h(write,)g(ioctl,)h(and)f (fsync)f(are)h(part)g(of)349 2099 y(the)e(\002le)h(operations.)166 2269 y(One)e(operation)e(that)i(is)g(unique)f(to)h(the)g(linux)f(inode) f(struc-)166 2369 y(ture)f(is)g(the)g(re)n(v)n(alidate)f(operation.)22 b(The)15 b(Linux)g(inode)g(con-)166 2469 y(tains)24 b(\223stat\224)f (information)e(about)h(the)i(inode.)33 b(F)o(or)22 b(a)i(local)166 2568 y(\002le)f(system,)g(the)g(information)d(in)j(the)g Fb(struct)g(inode)e Fe(is)j(al-)166 2668 y(w)o(ays)30 b(at)f(least)h(as)g(current)e(as)i(the)f(information)e(that)i(the)166 2768 y(underlying)e(\002le)k(system)g(has)f(on)g(disk.)54 b(This)31 b(isn')o(t)e(true)166 2867 y(for)i(distrib)n(uted)h(\002le)g (systems.)61 b(The)32 b(Linux)f(VFS)i(layer)166 2967 y(needs)25 b(the)g(re)n(v)n(alidate)e(operation)g(to)j(ask)f(the)g (underlying)166 3066 y(\002le)31 b(system)g(to)f(refresh)g(the)g (information)e(stored)i(in)h(the)166 3166 y Fb(struct)h(inode)p Fe(.)56 b(The)31 b(Linux)f(VFS)h(can)g(then)g(act)g(on)g(this)166 3266 y(current)19 b(information.)0 3500 y Fd(3.5)99 b(struct)26 b(\002le)0 3656 y Fe(Linux')-5 b(s)30 b Fb(struct)h(\002le)f Fe(contains)g(operations)f(that)h(ha)n(v)o(e)g(to)h(do)f(a)0 3755 y(particular)20 b(\002le)j(open.)28 b(The)22 b(important)e (members)g(of)i Fb(struct)g(\002le)0 3855 y Fe(are:)0 4018 y Fa(dcache)e(pointer)41 b Fe(this)24 b(points)f(to)g(the)h (dcache)e(entry)h(\(and)f(thus)166 4118 y(the)e(inode\))f(that)h(this)h Fb(struct)g(\002le)f Fe(represents)0 4276 y Fa(\002le)h(position)41 b Fe(the)26 b(of)n(fset)g(in)g(the)g(\002le)h(where)e(the)h(ne)o(xt)g (read)f(or)166 4375 y(write)20 b(will)h(tak)o(e)g(place)0 4534 y Fa(\002le)g(modes)41 b Fe(the)92 b(mode)g(the)g(\002le)g(w)o(as) h(opened)e(for)166 4633 y(\(O)p 259 4633 25 4 v 30 w(RDONL)-8 b(Y)d(,)20 b(O)p 717 4633 V 30 w(WR)m(ONL)-8 b(Y)d(,)20 b(O)p 1190 4633 V 30 w(RD)n(WR,)h(...\))0 4791 y Fa(\002le)g (operations)40 b Fe(a)28 b(switch)f(table)h(of)f(the)g(operations)f (that)h(can)166 4891 y(happen)32 b(on)g(a)i(\002le.)65 b(These)33 b(include)f(read,)k(write,)h(poll,)166 4991 y(ioctl,)25 b(mmap,)f(open,)g(close)g(\(called)f(release\),)i(lseek,)g (and)166 5090 y(fsync.)g(This)20 b(structure)f(is)i(also)g(used)f(for)g (block)f(and)h(char)n(-)166 5190 y(acter)h(de)n(vices,)f(so)h(these)f (operations)f(are)i(things)f(that)h(you)166 5290 y(w)o(ould)15 b(w)o(ant)h(to)h(do)e(on)h(a)g(de)n(vice)f(or)h(\002le)h(in)f(general.) 22 b(Read-)166 5389 y(dir)e(is)h(also)g(a)f(\002le)h(operation)d(for)i (some)g(strange)g(reason.)1992 390 y Fd(3.6)99 b(The)26 b(Linux)f(Buffer)i(Cache)1992 546 y Fe(The)d(Linux)h(b)n(uf)n(fer)f (cache)g(is)j(made)d(up)h(of)g(a)h(set)g(of)f(structures)1992 646 y(called)17 b(the)g Fb(struct)h(b)n(uf)o(fer)p 2735 646 V 29 w(head)p Fe(.)23 b(Each)16 b(b)n(uf)n(fer)g(contains)h(a)h (block)1992 746 y(of)g(data)h(from)f(disk.)25 b(All)20 b(b)n(uf)n(fers)e(for)g(a)i(gi)n(v)o(en)d(de)n(vice)i(are)g(of)g(the) 1992 845 y(same)29 b(size,)k(although)28 b(dif)n(ferent)g(de)n(vices)h (can)g(ha)n(v)o(e)g(dif)n(ferent)1992 945 y(sized)20 b(blocks.)2075 1045 y(Some)f(of)h(the)h(interesting)e(b)n(uf)n(fer)g (cache)g(operations)g(are:)1992 1229 y Fa(set)p 2094 1229 V 29 w(blocksize)42 b Fe(this)33 b(function)e(sets)j(the)f (fundamental)e(block-)2158 1328 y(size)20 b(for)g(a)h(gi)n(v)o(en)d(de) n(vice)1992 1496 y Fa(getblk)40 b Fe(getblk)31 b(creates)g(a)h(b)n(uf)n (fer)e(for)h(a)h(gi)n(v)o(en)e(block)h(on)g(the)2158 1595 y(underlying)17 b(de)n(vice)1992 1762 y Fa(br)o(else)41 b Fe(brelse)20 b(frees)g(a)g(b)n(uf)n(fer)1992 1930 y Fa(ll)p 2043 1930 V 30 w(rw)p 2170 1930 V 29 w(block)42 b Fe(starts)21 b(I/O)f(on)g(a)g(gi)n(v)o(en)f(block)1992 2212 y Ff(4)119 b(K)m(ey)82 b(Issues)f(in)j(P)n(orting)e(XFS)h(to)2171 2361 y(Linux)1992 2547 y Fe(In)20 b(this)h(section,)g(we)g(describe)f (se)n(v)o(eral)g(additional)g(features)g(re-)1992 2647 y(quired)k(in)i(the)g(Linux)f(k)o(ernel)g(to)i(maximize)d(the)i (performance)1992 2746 y(achie)n(v)n(able)19 b(with)j(XFS.)g(In)f (addition,)f(we)i(describe)f(alternati)n(v)o(e)1992 2846 y(porting)d(strate)o(gies)i(for)g(mo)o(ving)e(XFS)j(to)f(Linux.)1992 3085 y Fd(4.1)99 b(Integrating)35 b(the)h(Linux)f(Buffer)i(and)e(P)o (age)2216 3202 y(Cache)25 b(with)g(XFS)1992 3358 y Fa(4.1.1)81 b(XFS)49 b(r)o(equir)o(ements)f(f)n(or)h(the)g(b)n(uffer)g(and)g(page) 2241 3457 y(cache)1992 3614 y Fe(The)25 b(IRIX)h(implementation)d(of)j (XFS)g(depends)f(on)g(the)h(b)n(uf)n(fer)1992 3713 y(cache)21 b(for)h(se)n(v)o(eral)g(k)o(e)o(y)g(f)o(acilities.)32 b(First,)24 b(the)e(b)n(uf)n(fer)f(cache)h(al-)1992 3813 y(lo)n(ws)h(XFS)i(to)e(store)h(\002le)g(data)f(which)g(has)h(been)e (written)i(by)f(an)1992 3912 y(application)13 b(without)i(\002rst)h (allocating)e(space)i(on)e(disk.)24 b(The)15 b(rou-)1992 4012 y(tines)21 b(which)f(\003ush)h(delayed)f(writes)h(are)g(prepared)e (to)i(call)g(back)1992 4112 y(into)j(XFS,)h(when)f(necessary)-5 b(,)25 b(to)g(get)f(XFS)i(to)f(assign)f(disk)h(ad-)1992 4211 y(dresses)e(to)g(such)g(blocks)g(when)g(it)h(is)g(time)f(to)h (\003ush)f(the)g(blocks)1992 4311 y(to)e(disk.)28 b(Since)22 b(delayed)e(allocation)g(means)h(that)h(XFS)g(can)f(see)1992 4411 y(if)31 b(a)g(lar)o(ge)e(number)g(of)i(blocks)f(ha)n(v)o(e)g(been) g(written)h(before)e(it)1992 4510 y(allocates)d(space,)j(XFS)e(is)h (able)f(to)g(allocate)g(lar)o(ge)f(e)o(xtents)g(for)1992 4610 y(lar)o(ge)21 b(\002les,)i(without)e(ha)n(v)o(e)h(to)g(reallocate) f(or)h(fragment)e(storage)1992 4709 y(when)i(writing)h(small)h (\002les.)35 b(This)23 b(f)o(acility)g(allo)n(ws)h(XFS)g(to)f(op-)1992 4809 y(timize)d(transfer)f(sizes)i(for)f(writes,)g(so)g(that)h(writes)f (can)g(proceed)1992 4909 y(at)31 b(close)g(to)h(the)f(maximum)e(speed)i (of)g(the)g(disk,)i(e)n(v)o(en)d(if)i(the)1992 5008 y(application)18 b(does)i(its)h(write)g(operations)d(in)j(small)f(blocks.)2075 5108 y(Second,)15 b(the)g(b)n(uf)n(fer)f(cache)h(pro)o(vides)f(a)i (reserv)n(ation)d(scheme,)1992 5208 y(so)34 b(that)h(blocks)e(with)i (delayed)e(allocation)g(will)i(not)f(tak)o(e)g(so)1992 5308 y(much)23 b(of)h(the)g(a)n(v)n(ailable)f(memory)g(that)h(XFS)h(w)o (ould)e(deadlock)1992 5407 y(on)h(memory)e(when)i(trying)g(to)g(do)g (metadata)g(reads)g(and)g(writes)1929 5656 y(9)p eop %%Page: 10 10 10 9 bop 0 390 a Fe(in)32 b(the)h(course)e(of)h(allocating)f(space)h (for)g(delayed)f(allocation)0 490 y(blocks.)83 594 y(Third,)19 b(the)i(b)n(uf)n(fer)e(cache)h(and)g(the)h(interf)o(ace)e(to)i(disk)f (dri)n(v)o(ers)0 694 y(support)15 b(the)h(use)h(of)f(a)g(single)g(b)n (uf)n(fer)f(object)h(to)g(refer)g(to)g(as)h(much)0 794 y(as)h(an)g(entire)f(disk)g(e)o(xtent,)g(e)n(v)o(en)g(if)h(the)f(e)o (xtent)g(is)i(v)o(ery)d(lar)o(ge)h(and)0 893 y(the)k(b)n(uf)n(fered)f (pages)g(in)i(memory)d(are)j(not)f(contiguous.)26 b(This)21 b(is)0 993 y(important)14 b(for)i(high)f(performance,)e(since)k (allocating,)e(initializ-)0 1093 y(ing,)j(and)h(processing)e(a)i (control)f(block)f(for)h(each)h(disk)f(block)g(in,)0 1192 y(for)f(e)o(xample,)f(a)i(7)f(MB)i(HDTV)e(video)g(frame,)g(w)o (ould)f(represent)0 1292 y(a)26 b(lar)o(ge)f(amount)f(of)i(processor)e (o)o(v)o(erhead,)h(particularly)f(when)0 1392 y(one)19 b(considers)f(the)i(cost)f(of)g(cache)g(misses)i(on)e(modern)e(proces-) 0 1491 y(sors.)46 b(XFS)28 b(has)f(been)g(able)g(to)g(deli)n(v)o(er)f (7)h(GB/second)g(from)f(a)0 1591 y(single)19 b(\002le)h(on)f(an)g(SGI)g (Origin)g(2000)f(system,)h(so)h(the)f(o)o(v)o(erhead)0 1690 y(of)25 b(processing)e(millions)i(of)g(control)e(blocks)i(per)f (second)g(is)i(of)0 1790 y(practical)20 b(signi\002cance.)83 1895 y(F)o(ourth,)36 b(the)d(b)n(uf)n(fer)g(cache)g(supports)f (\223pinning\224)g(b)n(uf)n(fered)0 1994 y(storage)21 b(in)g(memory)-5 b(,)19 b(which)i(means)g(that)g(the)g(af)n(fected)f(b) n(uf)n(fers)0 2094 y(will)d(not)g(be)f(forced)f(to)i(disk)g(until)f (the)o(y)g(ha)n(v)o(e)g(been)g(\224unpinned\224.)0 2194 y(XFS)34 b(relies)g(on)f(this)h(capability)f(to)g(k)o(eep)g(metadata)g (updates)0 2293 y(from)28 b(being)g(written)g(to)h(disk)g(until)g (after)f(the)h(log)g(entries)g(for)0 2393 y(those)j(updates)g(ha)n(v)o (e)g(been)f(written)i(to)f(disk.)62 b(That)32 b(is,)k(XFS)0 2492 y(k)o(eeps)19 b(just)h(one)f(v)o(ersion)f(of)h(the)h(metadata)e (on)h(disk)h(\(not)e(count-)0 2592 y(ing)38 b(an)o(y)g(copies)g(in)h (the)f(log\),)k(and)c(requiring)e(that)j(the)f(log)0 2692 y(be)29 b(written)f(before)g(the)g(metadata)h(updates)e(are)i (written)g(back)0 2791 y(means)c(that)h(reco)o(v)o(ery)d(can)j(simply)f (apply)g(after)n(-images)f(from)0 2891 y(the)c(log)g(to)g(mak)o(e)g (the)g(metadata)g(consistent.)0 3140 y Fa(4.1.2)81 b(Mapping)26 b(the)g(XFS)g(view)f(of)g(the)h(b)n(uffer)g(and)f(page)249 3239 y(cache)20 b(to)g(Linux)0 3405 y Fe(W)m(ith)d(Linux)e(2.3,)h(the)g (intent)g(is)i(that)e(most)h(\002le)g(system)f(data)g(will)0 3504 y(be)30 b(b)n(uf)n(fered)e(in)i(the)g(page)f(cache,)j(b)n(ut)d (I/O)i(requests)e(are)h(still)0 3604 y(issued)h(one)g(block)f(at)i(a)g (time,)i(with)d(a)h(separate)f(b)n(uf)n(fer)p 1729 3604 25 4 v 28 w(head)0 3703 y(for)c(each)f(disk)i(block)e(and)h(multiple)f (b)n(uf)n(fer)p 1341 3703 V 28 w(head)h(objects)g(for)0 3803 y(each)c(page)g(\(if)h(the)g(disk)f(block)g(size)h(is)h(smaller)f (than)f(the)h(page)0 3903 y(size\).)47 b(As)29 b(in)e(Linux)g(2.2,)h (dri)n(v)o(ers)e(may)i(freely)e(aggre)o(gate)f(re-)0 4002 y(quests)f(for)f(adjacent)f(disk)i(blocks)f(to)g(reduce)g (controller)e(o)o(v)o(er)n(-)0 4102 y(head,)27 b(b)n(ut)g(the)o(y)f (must)h(disco)o(v)o(er)e(an)o(y)h(possibilities)h(for)f(aggre-)0 4202 y(gation)c(by)h(scanning)f(the)h(b)n(uf)n(fer)p 988 4202 V 28 w(head)f(structures)h(on)g(the)g(disk)0 4301 y(queue.)83 4406 y(Our)29 b(plan)f(for)g(porting)g(XFS)i(is)f(to)h (b)n(uild)e(a)i(layered)d(b)n(uf)n(fer)0 4506 y(cache)d(module)g(on)g (top)h(of)f(the)h(Linux)f(page)g(cache,)i(which)e(al-)0 4605 y(lo)n(ws)k(XFS)h(to)f(act)g(on)g(e)o(xtent-sized)e(aggre)o (gates,)h(as)i(in)f(IRIX,)0 4705 y(e)n(v)o(en)15 b(if)i(the)f(actual)g (I/O)g(operations)f(are)h(performed)d(by)j(creating)0 4804 y(a)22 b(list)h(of)f(b)n(uf)n(fer)p 481 4804 V 27 w(head)g(structures)f(to)h(send)f(to)h(the)g(disk)g(dri)n(v)o(ers.)0 4904 y(W)-7 b(e)20 b(will)f(also)g(e)o(xplore)e(ho)n(w)h(to)g(e)o (xtend)f(the)i(Linux)e(dri)n(v)o(er)g(inter)n(-)0 5004 y(f)o(ace)22 b(to)g(support)f(queueing)f(aggre)o(gate)g(b)n(uf)n(fers)h (directly)g(to)h(the)0 5103 y(dri)n(v)o(ers,)16 b(at)h(least)g(for)f (an)o(y)f(dri)n(v)o(ers)h(which)f(support)h(the)g(e)o(xtended)0 5203 y(interf)o(ace.)41 b(If)25 b(the)h(e)o(xtension)e(is)j(optional,)e (then)g(perhaps)g(only)0 5303 y(the)20 b(SCSI)h(dri)n(v)o(er)e(need)g (be)i(changed)d(to)i(support)f(it.)83 5407 y(A)24 b(k)o(e)o(y)g(goal)f (for)h(the)g(layered)e(b)n(uf)n(fer)h(cache)g(module)g(is)i(that)1992 390 y(its)19 b(objects)f(be)g(strictly)g(temporary)-5 b(,)16 b(so)j(that)f(the)o(y)g(are)g(discarded)1992 490 y(when)23 b(released)i(by)f(the)g(\002le)i(system,)f(with)g(all)g (persistent)g(data)1992 589 y(held)i(purely)g(in)h(the)g(page)g(cache.) 48 b(This)28 b(will)h(require)d(storing)1992 689 y(a)h(little)g(more)f (information)f(in)i(each)f(mem)p 3296 689 V 29 w(map)p 3469 689 V 29 w(t,)j(b)n(ut)d(it)i(will)1992 789 y(a)n(v)n(oid)22 b(creating)g(yet)h(another)e(class)j(of)e(permanent)f(system)i(ob-)1992 888 y(ject,)28 b(with)e(separate)g(locking)g(and)f(resource)h (management)e(is-)1992 988 y(sues.)i(The)20 b(IRIX)h(b)n(uf)n(fer)e (cache)h(is)i(about)d(11,000)g(lines)h(of)h(v)o(ery)1992 1088 y(comple)o(x)26 b(code.)46 b(By)29 b(relying)d(purely)h(on)g(the)h (page)f(cache)g(for)1992 1187 y(b)n(uf)n(fering,)16 b(we)j(e)o(xpect)e (to)i(a)n(v)n(oid)f(most)h(of)f(the)h(comple)o(xity)-5 b(,)16 b(par)n(-)1992 1287 y(ticularly)26 b(in)i(re)o(gard)e(to)h (locking)g(and)g(resource)f(management,)1992 1386 y(at)h(the)h(cost)g (of)f(ha)n(ving)f(to)i(pay)e(careful)h(attention)f(to)i(ef)n(\002cient) 1992 1486 y(algorithms)18 b(for)i(assembling)f(lar)o(ge)h(b)n(uf)n (fers)f(from)g(pages.)1992 1726 y Fd(4.2)99 b(Issues)51 b(f)n(or)g(the)h(aggr)n(egate)g(b)n(uffer)h(cache)2216 1843 y(module)1992 1999 y Fa(4.2.1)81 b(P)o(artial)19 b(P)o(age)g(Mappings)1992 2156 y Fe(In)27 b(general,)i(disk)f(e)o (xtents)g(will)h(not)f(align)g(with)g(page)g(bound-)1992 2255 y(aries.)62 b(This)32 b(means)h(that)f(a)h(gi)n(v)o(en)e(page)h (in)h(the)f(page)g(cache)1992 2355 y(may)26 b(map)g(to)h(se)n(v)o(eral) f(dif)n(ferent)f(disk)i(e)o(xtents,)h(depending)c(on)1992 2455 y(the)18 b(block)g(size)i(and)e(the)h(page)f(size,)h(which)g (means)f(that)h(se)n(v)o(eral)1992 2554 y(dif)n(ferent)30 b(aggre)o(gate)g(b)n(uf)n(fers)i(may)g(address)f(the)i(same)g(page.) 1992 2654 y(Moreo)o(v)o(er)m(,)18 b(for)j(ef)n(\002cient)g(I/O,)g(it)h (is)g(desirable)f(to)h(read)e(or)h(write)1992 2754 y(entire)e(e)o (xtents,)h(so)g(a)h(gi)n(v)o(en)d(page)i(may)f(be)h(only)g(partially)f (v)n(alid)1992 2853 y(when)k(an)h(aggre)o(gate)e(b)n(uf)n(fer)h (referencing)e(it)k(is)g(released.)36 b(This)1992 2953 y(implies)30 b(that)h(the)g(mem)p 2728 2953 V 28 w(map)p 2900 2953 V 29 w(t)h(needs)e(to)h(include)e(a)i(bit)g(map)1992 3052 y(of)c(which)h(blocks)f(within)h(the)h(page)e(are)h(v)n(alid.)48 b(On)29 b(a)f(virtual)1992 3152 y(memory)21 b(f)o(ault)i(for)f(such)h (a)g(page)g(the)g(virtual)f(memory)f(system)1992 3252 y(must)d(force)g(the)h(missing)f(parts)h(of)f(the)h(page)f(to)h(be)f (read)g(\(which)1992 3351 y(might,)g(as)j(a)f(side-ef)n(fect,)f(cause)g (other)g(partially-read)f(pages)h(to)1992 3451 y(be)h(created)f(in)h (the)h(page)e(cache\).)1992 3675 y Fa(4.2.2)81 b(P)o(artial)19 b(Aggr)o(egate)e(Buffers)1992 3831 y Fe(In)i(general,)f(not)i(all)g(of) f(the)h(pages)f(in)h(a)g(gi)n(v)o(en)f(aggre)o(gate)e(b)n(uf)n(fer)1992 3931 y(will)h(be)f(in)h(the)f(page)g(cache)g(when)f(the)i(\002le)g (system)g(requests)f(the)1992 4031 y(b)n(uf)n(fer)-5 b(.)44 b(The)27 b(aggre)o(gate)e(b)n(uf)n(fer)h(module)f(will)j(supply) e(se)n(v)o(eral)1992 4130 y(interf)o(aces)d(to)g(obtain)g(b)n(uf)n (fers.)34 b(One)24 b(interf)o(ace)f(will)h(return)f(the)1992 4230 y(b)n(uf)n(fer)j(with)h(empty)g(pages,)h(mark)o(ed)e(not)h(v)n (alid,)i(supplied)d(for)1992 4329 y(the)16 b(\223holes\224.)24 b(Another)15 b(will)j(force)e(the)h(empty)f(pages)g(to)h(be)g(read)1992 4429 y(in)23 b(from)g(disk.)35 b(XFS)24 b(mak)o(es)g(use)g(of)f(both)g (interf)o(aces,)h(since)f(in)1992 4529 y(some)15 b(cases)i(\(such)f(as) h(a)f(write)h(which)e(co)o(v)o(ers)g(an)h(entire)g(e)o(xtent\),)1992 4628 y(the)k(old)g(v)n(alue)f(of)h(the)g(missing)g(pages)g(is)h(not)f (needed.)1992 4852 y Fa(4.2.3)101 b(Ef\002cient)21 b(Assembly)g(of)f (Buffers)1992 5009 y Fe(At)25 b(present,)g(pages)g(are)g(both)f (entered)g(in)h(a)g(hash)g(table,)h(based)1992 5108 y(on)19 b(the)h(inode)f(and)g(of)n(fset,)g(and)h(on)f(a)i(page)e(list)i (associated)e(with)1992 5208 y(the)i(inode.)29 b(This)22 b(means)g(that)g(one)f(must)h(probe)e(the)i(hash)g(table)1992 5308 y(for)16 b(each)g(page)h(in)g(the)g(range)f(of)g(a)i(b)n(uf)n(fer) d(when)h(assembling)h(the)1992 5407 y(b)n(uf)n(fer)-5 b(.)37 b(If)24 b(the)h(list)g(of)g(pages)f(for)g(an)g(inode)g(were)g(k) o(ept)g(sorted,)1908 5656 y(10)p eop %%Page: 11 11 11 10 bop 0 390 a Fe(then)25 b(one)f(could)g(simply)h(\002nd)f(one)h (page)f(and)h(w)o(alk)g(the)g(list)h(to)0 490 y(\002nd)32 b(the)g(rest.)60 b(Better)33 b(yet,)h(if)e(the)g(pages)g(were)g(on)f (an)h(A)-11 b(VL)0 589 y(tree)20 b(associated)f(with)h(the)g(inode,)e (and)i(not)f(in)h(the)f(hash)h(table)g(at)0 689 y(all,)29 b(then)d(one)g(could)g(easily)h(search)f(the)h(tree)f(to)h(\002nd)g (the)f(\002rst)0 789 y(v)n(alid)f(page,)i(and)e(immediately)g(kno)n(w)g (that)h(prior)f(pages)g(were)0 888 y(not)20 b(v)n(alid.)0 1180 y Fd(4.3)99 b(Metadata)26 b(Buffers)0 1354 y Fe(In)f(order)f(to)h (ha)n(v)o(e)f(just)i(one)e(w)o(ay)h(to)h(do)e(I/O)h(for)g(XFS,)g(the)g (ag-)0 1454 y(gre)o(gate)19 b(b)n(uf)n(fer)g(cache)h(will)i(use)f(the)g (page)f(cache)g(to)h(store)f(XFS)0 1554 y(metadata.)25 b(The)20 b(metadata)f(pages)h(will)h(be)f(associated)h(with)f(the)0 1653 y(de)n(vice)f(inode)f(on)h(which)g(the)h(\002le)g(system)f(\(and)g (the)g(log,)g(if)h(sep-)0 1753 y(arate\))g(is)h(located.)0 2044 y Fd(4.4)99 b(Dir)n(ect)26 b(I/O)0 2219 y Fe(F)o(or)c(\002les)i (which)e(are)h(referenced)e(multiple)h(times,)i(and)e(partic-)0 2318 y(ularly)30 b(for)g(small)h(\002les,)i(sa)n(ving)d(a)h(cop)o(y)f (of)g(the)h(\002le)g(contents)0 2418 y(in)e(the)f(page)g(cache)g(is)h (v)o(ery)e(desirable.)49 b(F)o(or)28 b(v)o(ery)g(lar)o(ge)f(data)0 2518 y(\002les,)21 b(such)e(as)h(streaming)f(video)g(\002les,)h(this)h (can)e(be)h(w)o(orse)g(than)0 2617 y(useless,)40 b(since)c(caching)e (such)h(data)g(will)i(force)d(useful)h(data)0 2717 y(out)e(of)g(the)g (cache.)64 b(Also,)37 b(for)32 b(v)o(ery)g(lar)o(ge)h(\002les)h (transferred)0 2817 y(at)g(high)g(rates,)j(the)d(processor)f(o)o(v)o (erhead)e(of)j(cop)o(ying)e(all)i(of)0 2916 y(the)c(data)h(is)g(v)o (ery)e(high.)55 b(XFS)31 b(supports)e(doing)g(the)i(\002le)g(sys-)0 3016 y(tem)24 b(equi)n(v)n(alent)d(of)i(\223ra)o(w)h(I/O\224,)g(called) f(direct)g(I/O,)h(where)e(\002le)0 3115 y(data)j(mo)o(v)o(es)e (directly)h(between)g(the)h(\002le)g(system)g(and)f(the)h(user)0 3215 y(b)n(uf)n(fers)18 b(\(whether)f(reading)g(or)i(writing\).)k(This) c(has)g(pro)o(v)o(ed)d(suf-)0 3315 y(\002ciently)30 b(ef)n(\002cient)g (that)h(e)n(v)o(en)e(lar)o(ge)h(databases)g(may)g(be)g(ef)n(\002-)0 3414 y(ciently)23 b(stored)f(in)i(the)f(\002le)h(system,)f(thereby)f (simplifying)g(sys-)0 3514 y(tem)e(administration.)83 3623 y(Direct)f(I/O)g(shares)g(with)g(ra)o(w)f(I/O)h(the)g(need)f(to)h (lock)f(the)h(user)0 3723 y(b)n(uf)n(fer)i(pages)h(in)h(memory)d (during)h(the)h(I/O)h(transfer)m(,)e(since)i(the)0 3823 y(disk)31 b(dri)n(v)o(er)e(will)i(be)g(ask)o(ed)f(to)h(transfer)f (directly)g(to)h(or)f(from)0 3922 y(those)21 b(pages.)28 b(F)o(or)20 b(consistenc)o(y)g(and)h(simplicity)g(of)g(interf)o(aces,)0 4022 y(it)26 b(is)g(highly)e(desirable,)h(therefore,)f(that)i(the)f (aggre)o(gate)d(b)n(uf)n(fer)0 4122 y(cache)17 b(module)f(allo)n(w)i (XFS)g(to)g(bind)e(a)i(b)n(uf)n(fer)e(object)h(to)h(a)g(range)0 4221 y(of)j(user)h(memory)e(\(suitably)h(lock)o(ed\),)g(and)g(then)g (do)h(I/O)g(on)f(the)0 4321 y(b)n(uf)n(fer)e(object)g(in)i(the)f(usual) g(w)o(ay)-5 b(.)0 4612 y Fd(4.5)99 b(Alter)o(nati)o(v)o(e)25 b(P)n(orting)g(Strategies)0 4787 y Fe(W)-7 b(e)29 b(are)f(considering)f (three)g(principal)g(strate)o(gies)h(for)g(porting)0 4886 y(XFS)21 b(to)f(Linux:)62 5108 y(1.)41 b(change)31 b(Linux)g(to)i(directly)f(support)f(an)h(IRIX-lik)o(e)g(vn-)166 5208 y(ode/vfs)j(interf)o(ace,)k(thereby)c(minimizing)f(the)i(changes) 166 5308 y(required)22 b(in)j(XFS)g(and)e(enhances)g(Linux)g(to)h(more) g(easily)166 5407 y(support)19 b(other)g(vnode/vfs)f(\002le)j(systems) 2054 390 y(2.)41 b(change)e(XFS)j(so)f(that)h(it)f(can)g(be)g(directly) f(inte)o(grated)2158 490 y(into)20 b(the)g(e)o(xisting)f(Linux)g(VFS,)i (thereby)e(minimizing)g(the)2158 589 y(changes)g(required)f(in)i(Linux) 2054 751 y(3.)41 b(introduce)25 b(a)i(layer)g(between)f(XFS)i(code)e (and)h(the)g(Linux)2158 851 y(VFS)33 b(interf)o(ace)e(that)i (translates)f(Linux)g(VFS)h(calls)g(into)2158 951 y(the)20 b(equi)n(v)n(alent)e(IRIX)j(vnode/vfs)d(operations.)2075 1123 y(The)23 b(\002rst)i(strate)o(gy)e(w)o(ould)h(require)f(a)h(ne)n (w)g(vnode/vfs)e(layer)1992 1223 y(that)e(w)o(ould)f(parallel)g(\(b)n (ut)h(probably)e(not)h(replace\))g(the)h(e)o(xisting)1992 1322 y(Linux)j(VFS)j(layer)-5 b(.)40 b(Because)25 b(the)g(vnode/vfs)e (interf)o(ace)h(is)i(not)1992 1422 y(standardized)e(across)j(the)f(dif) n(ferent)f(UNIX)i(implementations)1992 1522 y([15)n(],)e(it)f(is)h (unlik)o(ely)e(that)h(the)f(Linux)g(vnode)f(interf)o(ace)h(created)1992 1621 y(for)29 b(XFS)j(w)o(ould)e(directly)f(support)h(\002le)h(systems) g(from)e(other)1992 1721 y(v)o(endors,)e(b)n(ut)h(it)g(w)o(ould)f(mak)o (e)g(porting)g(vnode/vfs-based)d(\002le)1992 1821 y(systems)g(easier)-5 b(.)37 b(This)24 b(might)f(be)h(turned)f(into)h(an)g(opportunity)1992 1920 y(to)c(de)n(v)o(elop)e(an)i(open)f(source)g(standard)g(vnode/vfs)f (interf)o(ace)h(in)1992 2020 y(the)31 b(highest)f(v)n(olume)g(UNIX)h (implementation,)g(thereby)f(cre-)1992 2120 y(ating)25 b(a)h(de-f)o(acto)e(vnode/vfs)g(interf)o(ace)g(standard)h(in)g(code.)41 b(In)1992 2219 y(an)o(y)18 b(case,)h(this)g(w)o(ould)g(require)e(major) h(changes)g(to)h(the)g(e)o(xisting)1992 2319 y(Linux)14 b(k)o(ernel.)23 b(Also,)17 b(at)g(this)f(time)g(it)h(is)g(unclear)e(ho) n(w)h(the)g(Linux)1992 2418 y(community)h(in)j(general)e(and)h(Linus)h (in)f(particular)g(w)o(ould)g(react)1992 2518 y(to)h(these)g(proposed)e (changes.)2075 2618 y(Changing)k(XFS)i(to)g(\002t)g(directly)f(into)g (Linux)g(VFS)h(interf)o(ace)1992 2717 y(w)o(ould)34 b(require)f (signi\002cant)i(changes)e(to)i(nearly)f(e)n(v)o(ery)g(XFS)1992 2817 y(routine.)23 b(The)18 b(current)f(source)g(code)h(or)o (ganization)d(w)o(ould)i(need)1992 2917 y(to)32 b(be)h(signi\002cantly) f(changed.)60 b(In)33 b(addition,)h(XFS)f(uses)h(the)1992 3016 y(UNIX)27 b(uio)f(structure)g(to)i(describe)e(the)h(I/O)g (transfer)f(required)1992 3116 y(at)20 b(the)g(system)f(call)i(le)n(v)o (el,)e(and)g(the)h(uio)f(structure)g(is)i(embedded)1992 3215 y(throughout)15 b(the)j(XFS)h(code.)24 b(XFS)19 b(consists)g(of)f(a)h(lot)f(of)g(sophis-)1992 3315 y(ticated)h(code.)25 b(Some)19 b(commercial)g(journaled)f(\002le)j(systems)f(we)1992 3415 y(are)d(a)o(w)o(are)g(of)h(consist)f(of)h(more)f(than)g(150,000)e (lines)j(of)f(C)i(code.)2075 3514 y(The)j(third)f(alternati)n(v)o(e)g (is)j(to)e(inte)o(grate)g(the)g(XFS)h(vnode)e(and)1992 3614 y(XFS)31 b(vfs)g(object)f(as)i(pri)n(v)n(ate)e (\002le-system-dependent)e(data)i(in)1992 3714 y(the)20 b Fb(struct)h(inode)e Fe(and)g Fb(struct)i(super)p 3069 3714 25 4 v 30 w(bloc)n(k)f Fe(data)g(in)g(Linux.)2075 3813 y(This)32 b(approach)e(introduces)h(a)i(translation)e(layer)h (between)1992 3913 y(the)e(XFS)h(code)e(and)h(the)g(Linux)f(VFS)i (interf)o(ace.)55 b(This)30 b(layer)1992 4012 y(will)17 b(translate)h(Linux)e(VFS)i(calls)g(into)f(the)g(equi)n(v)n(alent)e (XFS)j(vn-)1992 4112 y(ode)23 b(operations.)35 b(The)24 b(XFS)h(vnode)d(itself)j(w)o(ould)e(be)h(attached)1992 4212 y(to)c(the)g(pri)n(v)n(ate)f(data)h(area)g(of)g(the)g(Linux)f (inode,)g(while)h(the)g(XFS)1992 4311 y(vfs)d(object)h(w)o(ould)f(be)h (attached)f(to)h(the)g(pri)n(v)n(ate)f(data)g(area)h(of)g(the)1992 4411 y(Linux)i(superblock.)29 b(As)23 b(an)f(e)o(xample,)f(a)h(create)g (request)f(to)i(the)1992 4511 y(\002le)j(system)g(w)o(ould)f(get)h (mapped)e(to)i(the)f(XFS)i(create)e(via)h(this)1992 4610 y(pointer)17 b(to)i(the)g(XFS)g(vnode,)e(which)i(includes)f(the)g (vnode)f(oper)n(-)1992 4710 y(ation)23 b(for)g(create.)36 b(Similarly)-5 b(,)24 b(a)h(mount)e(operation)f(\(on)h(Linux,)1992 4809 y(the)e(read)p 2264 4809 V 29 w(super)g(vfs)h(call\))g(w)o(ould)g (result)f(in)h(a)h(call)f(to)g(the)g(XFS-)1992 4909 y(speci\002c)i (mount)f(operation)f(a)n(v)n(ailable)i(through)e(the)i(Linux)g(su-)1992 5009 y(perblock')-5 b(s)18 b(pointer)h(to)h(the)h(vfs)f(object.)2075 5108 y(This)g(approach)e(is)j(sho)n(wn)f(in)g(\002gure)f(5)i(and)e (\002gure)h(6.)2075 5208 y(Currently)-5 b(,)31 b(we)f(are)h(focusing)e (on)h(the)g(third)g(alternati)n(v)o(e)f(as)1992 5308 y(the)j(f)o(astest)h(w)o(ay)f(of)f(getting)h(the)g(port)f(to)h(Linux)f (completed.)1992 5407 y(The)c(o)o(v)o(erhead)f(introduced)f(by)j(the)g (translation)f(layer)h(should)1908 5656 y(11)p eop %%Page: 12 12 12 11 bop 0 3999 a Fe(centerline)p @beginspecial 8 @llx 431 @lly 523 @urx 729 @ury 5150 @rwi @setspecial %%BeginDocument: vfs.linux.eps %AI5_FileFormat 4.0 %AI3_ColorUsage: Black&White %AI3_IncludePlacedImages %AI7_ImageSettings: 1 %AI3_TemplateBox: 306.5 395.5 306.5 395.5 %AI3_TileBox: 31 31 583 761 %AI3_DocumentPreview: Macintosh_ColorPic %AI5_ArtSize: 612 792 %AI5_RulerUnits: 2 %AI5_ArtFlags: 1 0 0 1 0 0 1 0 0 %AI5_TargetResolution: 800 %AI5_NumLayers: 1 %AI8_OpenToView: -221.1348 802.1265 1.19 1274 981 18 0 1 3 40 0 0 %AI5_OpenViewLayers: 7 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 %AI7_Thumbnail: 128 76 8 %0000330000660000990000CC0033000033330033660033990033CC0033FF %0066000066330066660066990066CC0066FF009900009933009966009999 %0099CC0099FF00CC0000CC3300CC6600CC9900CCCC00CCFF00FF3300FF66 %00FF9900FFCC3300003300333300663300993300CC3300FF333300333333 %3333663333993333CC3333FF3366003366333366663366993366CC3366FF %3399003399333399663399993399CC3399FF33CC0033CC3333CC6633CC99 %33CCCC33CCFF33FF0033FF3333FF6633FF9933FFCC33FFFF660000660033 %6600666600996600CC6600FF6633006633336633666633996633CC6633FF %6666006666336666666666996666CC6666FF669900669933669966669999 %6699CC6699FF66CC0066CC3366CC6666CC9966CCCC66CCFF66FF0066FF33 %66FF6666FF9966FFCC66FFFF9900009900339900669900999900CC9900FF %9933009933339933669933999933CC9933FF996600996633996666996699 %9966CC9966FF9999009999339999669999999999CC9999FF99CC0099CC33 %99CC6699CC9999CCCC99CCFF99FF0099FF3399FF6699FF9999FFCC99FFFF %CC0000CC0033CC0066CC0099CC00CCCC00FFCC3300CC3333CC3366CC3399 %CC33CCCC33FFCC6600CC6633CC6666CC6699CC66CCCC66FFCC9900CC9933 %CC9966CC9999CC99CCCC99FFCCCC00CCCC33CCCC66CCCC99CCCCCCCCCCFF %CCFF00CCFF33CCFF66CCFF99CCFFCCCCFFFFFF0033FF0066FF0099FF00CC %FF3300FF3333FF3366FF3399FF33CCFF33FFFF6600FF6633FF6666FF6699 %FF66CCFF66FFFF9900FF9933FF9966FF9999FF99CCFF99FFFFCC00FFCC33 %FFCC66FFCC99FFCCCCFFCCFFFFFF33FFFF66FFFF99FFFFCC110000001100 %000011111111220000002200000022222222440000004400000044444444 %550000005500000055555555770000007700000077777777880000008800 %000088888888AA000000AA000000AAAAAAAABB000000BB000000BBBBBBBB %DD000000DD000000DDDDDDDDEE000000EE000000EEEEEEEE0000000000FF %00FF0000FFFFFF0000FF00FFFFFF00FFFFFF %524C45FD43FF7DFFFFA87DFFFFA8A8FF7DFD04FFA8A8FFA8A8FD67FF527D %FFFFFF7D52A87D7D52FFFD0452A8A8A87D7D277DA87DFD4CFF52A87DA8A8 %A87DA8A8A87DA8A8A852A8A8A87DA8A8A87DA8A8A87D272752FD08FF7DFD %05FFA8FFFFA8FFFFA8FD4CFF2727FD0DFFA8FD5EFFA8FFA8A8FFA87D7DFF %A8A8FD06FF7D2752FD0DFFA8FD11FFA8FFFFFF7DA8FFA8A8A8FFFFA8FF7D %FFA8A8A8FD3AFF527D7D527DFFFD047D52FD06FFA8A8A8FD0DFFA8FD11FF %A8527D7D7D52FF7DA852FF7DA87D7D277D7DA8FD39FFA8A8A87D7DA8A8A8 %7DA8A8A87DA8A8FFFFFFA8FF7DFD0DFF7DA87DA8A8A87DA8A8A87DA8A827 %F852FD08FFA8A8FFFFA8A8FFFFA8FFFFFFA8FD39FFA8FD0DFFA8FFFF7DFF %FFA8FD0DFFA8FD0CFF277DFD4FFFA8FD0DFFA8FD05FFA8FD0DFFA8FD5DFF %A8FD0DFFA8FFA8FFFFFFA8FD0DFFA8FD5DFFA8FD0DFF7DA8FD04FFA8FD0D %FF7DFD5DFFA87DA87DA87DA87DA87DA87DA87DA87DFD04FFA8FD0DFFA8FD %5DFFA8FD0DFF7DFD05FFA8FD0DFFA8FD5DFFA8FD04FFA8A8A8FD06FF7DFD %05FFA8FD0DFFA8FD5DFF7DFD04FF7D7DA8A8FD05FFA8FD05FF7DFD0DFFA8 %FD5DFFA87DA87DA87D7D7DA87DA87DA87DA8FD05FFA87DA87DA87DA87DA8 %7DA87DA87DA8FD14FFA8FD48FFA8FD0DFFA8FD71FFA8FD0DFFA8FD71FFA8 %7DA87DFFA8A8FFA87DA8A8A8FF7DFD71FFA87DA8527D7D7D2752527D7D7D %A8A8FD72FFFD0EA8FD7FFFA8FD7FFFA8FD64FF7DFF7D7DA8A87DFD14FFA8 %FD64FFA8FD067DA8FD13FFA8FD7FFFA8A8FD7FFFA8FD5EFFA8A8A8FD1EFF %7DFD23FFA8FFA8FFA8A8A8FFA8FFA8A8A8FFA8A8A8FFA8FFA8FFFFA8A8FF %A8A8FFA8A8FFFD05A8FFA8A8A8FFA8FFA8FFA8FFA8FFA8A8A8FFA8FFA8A8 %FD11FFA8FFFFFFA8FFA8FFFFFFA8FFA8FFFFFD04A8FFFFFFA8FFA8FFFFFF %A8FFA8A8FFFFA8FFA8FFA8FFA8FFA8A8FFFFA8FD05FFA8FD3EFF7DA8A8FF %A8FFA8FD17FF7DFD7FFFA8FD7FFF7DFD7FFFA8FD7FFF2727FD06FFA8A8A8 %FD24FF7D27A87DA87DA87DA87DA87DA87DA87DFD26FF7DA852FF7DFD16FF %7D27FD05FFA8A87DA8FD23FF27F8A8FD0DFFA8FD25FFA87D7DA8A87DFD16 %FF7D7D7DA87DA87DA87DA87DA87DA87DFD1FFF527D7DFD0DFF7DFD40FF27 %27A8FD0CFFA8FD1EFFA8FFFFA8FD0DFFA8FD40FF5252A8FD0CFF7DFD1CFF %A8A8FFFFFF7DFD0DFF7DFD40FFA8FF7DFD0CFFA8FD1CFFA8FD04FFA8FD0D %FFA8FD40FFA8FFA8FD0CFF7DFD1AFFA8A8FD05FF7DFD0DFF7DFD40FFA8FF %7DA8527D7DA8A87D7DA8A87DA87DFD1AFFA8FD06FFA8FD0DFFA8FD40FFA8 %FFA8FFA827A87DFF5252A87D7DFF7DFD19FFA8FD07FF7DFD0DFF7DFD40FF %7DFF7DA8527DA8FD047DA852A8A87D7DA8A8FF7DFD13FFA8FD08FFA8FD0D %FFA8FD40FFA8FFA8FFA87D7D7DFF7D7D527D7DFF7DFFFFFF52F827FD11FF %A8FD09FF7DFD0DFF7DFD40FFA8FF7DFD05A852FD06A87DFD04FF7D7DFD0F %A8FFA8FD0AFFA8FD0DFFA8FD40FFA8FFA8FD0CFF7DFD06FFA8FD04FFA87D %A87DA8FD04FFA8A8FD0BFF7DFD0DFF7DFD40FFA8FF7DFD0CFFA8FD06FF52 %A8A8A87D7D5252277DA8A87DA87DFD0CFFA87DA87D7D52A87DA852A87DA8 %52A8FD40FFA8FFA8FD0CFF7DFD06FFA8FD04FFA8FF7DA8A8FD04FFA8FD0F %FF7D527DFF7D527DA87D7DA8FD41FFA8FF7DFD0CA87DFD06FF7DFD04FF7D %A87D7DA8FD04FFA8FD12FFA8FD48FFA8FD13FFA87DA87DA87DA87D7D527D %27A87DA87DA8FD5BFF7DFD11FFA8A8FFFFA8FD05FF7D7D7DA8FD04FF7DFD %5BFFA8FD0EFFA8A8A8FD04FFA87DA87DA852A8F8A852A87DA87D7D7DA87D %A8FD24FFA87DA8FFFD09A87DA8FD24FFA8FD0CFFA8A8FD07FFA8FD04FFA8 %7D7D7DA8FD04FFA8FFFFFFFD05A8FF7D7DFD17FF5227FD04FF7D7D7DFFFD %067DA87DA8A8FF7DFD23FF7D7DFD09FF7DA8FD09FFA87DA87DA87DA87DA8 %7DA87DA87D7DFD08FFA87DF82727A87DA87DA87D7D527D527D527D277D52 %7D527D527DF8F8F8FD06FFA8A8FD09FFA8FD26FFA8A8A8FFFFFFA8A8A8FD %19FFA8FD0CFFA8FD0DFFA8FD45FFA8A87DFD1CFFA8FD0CFF7DFD0DFF7DFD %58FFA87DFD04FF7DFFA8FD04FFA8FD0BFFA8FD0DFFA8FD0CFFA8A8A8FFFF %FD06A8FFFF7DA8FD3DFFA87D7D7DFFFD047DA8FFFFFFF87DFD0AFF7DFD0D %FF7DFD07FF277DFFFFFFA87D7DA8FF5252527D52A852A87DFF7DFD40FF7D %FD08FF277DFD0AFFA8FD0DFF7D7DA8A8A87DA8A827F852FD06FFA8FD09FF %A8FD4AFF7D7DFD0AFF7DFD0DFF7DFD71FFA8FD0DFFA8FD71FF7DFD0DFF7D %FD64FFA8A87DA8A8FD08FFA8FD0DFFA8FD71FF7DFD0DFF7DFD64FFFD05A8 %FD08FFA8FD0DFFA8FD71FF7DFD0DFF7DFD64FF7DFD04A8FD08FFA8FD0DFF %A8FD14FFA8FD4FFFFD047DFF7DFD07FF7DFD0DFF7DFD64FF7DA87DA87D7D %A8FD06FFA8FD0DFFA8FD71FF7DA87DA87DA87DA87DA87DA87DA8A8FDF4FF %A87DA8FFFD04A8FFA8A8FD75FF7D7D7DFF7DA87D7D7DA8A8FD78FF7DFD04 %FFA8A8FDFCFFFD28FFFF userdict /Adobe_level2_AI5 26 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { (AI8_CMYK_CustomColor) 6 packedarray } bind def /findrgbcustomcolor { (AI8_RGB_CustomColor) 5 packedarray } bind def /setcustomcolor { exch aload pop dup (AI8_CMYK_CustomColor) eq { pop pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { dup (AI8_RGB_CustomColor) eq { pop pop 3 { 1 exch sub 3 index mul 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } ifelse } ifelse } def } if /setAIseparationgray { false setoverprint 0 setgray /setseparationgray where{ pop setseparationgray }{ /setcolorspace where{ pop [/Separation (All) /DeviceCMYK {dup dup dup}] setcolorspace 1 exch sub setcolor }{ setgray }ifelse }ifelse } def /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking currentpacking true setpacking userdict /Adobe_typography_AI5 68 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /havefont { systemdict /languagelevel known { /Font resourcestatus dup { exch pop exch pop } if } { systemdict /FontDirectory get 1 index known { pop true } { systemdict /fileposition known { dup length 6 add exch Ss 6 250 getinterval cvs pop Ss exch 0 exch getinterval status { pop pop pop pop true } { false } ifelse } { pop false } ifelse } ifelse } ifelse } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def /subststring { exch 2 index exch search { exch pop exch dup () eq { pop exch concatstring } { 3 -1 roll exch concatstring concatstring } ifelse exch pop true } { pop pop false } ifelse } def /concatstring { 1 index length 1 index length 1 index add string dup 0 5 index putinterval dup 2 index 4 index putinterval 4 1 roll pop pop pop } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def 2 index havefont { 3 index 255 string cvs dup (_Symbol_) eq { pop 2 index findfont } { 1 index 0 eq { dup length 1 sub 1 exch getinterval cvn findfont } { pop 2 index findfont } ifelse } ifelse } { dup 1 eq { 2 index 64 string cvs dup (-90pv-RKSJ-) (-83pv-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop dup (-90ms-RKSJ-) (-Ext-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop pop true } ifelse } ifelse { 1 index 1 eq { /Ryumin-Light-Ext-RKSJ-V havefont {/Ryumin-Light-Ext-RKSJ-V} {/Courier} ifelse } { /Ryumin-Light-83pv-RKSJ-H havefont {/Ryumin-Light-83pv-RKSJ-H} {/Courier} ifelse } ifelse findfont [1 0 0.5 1 0 0] makefont } if } { /Courier findfont } ifelse } ifelse _wv type /arraytype eq { _wv makeblendedfont } if dup length 10 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontScript exch def /FontDirection exch def /FontRequest exch def /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { W B } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { W F } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { W S } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat _shift aload pop _lineorientation 1 eq { exch } if translate _scale aload pop _lineorientation 1 eq _yokoorientation 1 eq or { exch } if scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { 1 index type /nametype eq { dup 0.75 mul 1 index 0.25 mul neg } if /_fontDescent exch ddef /_fontAscent exch ddef /_fontSize exch ddef /_fontRotateAdjust _fontAscent _fontDescent add 2 div neg ddef /_fontHeight _fontSize ddef findfont _fontSize scalefont setfont } def /Tl { pop neg 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { 0 exch _shift astore pop currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { count 1 eq { 100 } if 100 div exch 100 div exch _scale astore pop iTm } def /TA { pop } def /Tq { pop } def /Tg { pop } def /TG { pop } def /Tv { /_lineorientation exch ddef } def /TV { /_charorientation exch ddef } def /Ty { dup /_yokoorientation exch ddef 1 sub neg Tv } def /TY { pop } def /T~ { Tx } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { _fontSize mul 1000 div _lineorientation 0 eq { neg 0 } { 0 exch } ifelse rmoveto pop } def /TK { 2 npop } def /T* { _leading aload pop _lineorientation 0 ne { exch } if Td } def /T*- { _leading aload pop _lineorientation 0 ne { exch } if exch neg exch neg Td } def /T- { _ax neg 0 rmoveto _lineorientation 1 eq _charorientation 0 eq and { 1 TV _hyphen Tx 0 TV } { _hyphen Tx } ifelse } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ findfont _fontSize scalefont setfont 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking % /X^ { currentfont 5 1 roll dup havefont { findfont _fontSize scalefont setfont } { pop exch } ifelse 2 index 0 eq { Tx } { Tj } ifelse pop pop setfont } def /T^ /X^ load def userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 53 dict put } if userdict /Adobe_ColorImage_AI6 get begin /initialize { Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 41 dict def } if Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /_newproc null def /_proc1 null def /_proc2 null def /sourcearray 4 array def /_ptispace null def /_ptiname null def /_pti0 0 def /_pti1 0 def /_ptiproc null def /_ptiscale 0 def /_pticomps 0 def /_ptibuf 0 string def /_gtigray 0 def /_cticmyk null def /_rtirgb null def /XIEnable true def /XIType 0 def /XIEncoding 0 def /XICompression 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIRowBytes 0 def /XIFile null def /XIBuffer1 null def /XIBuffer2 null def /XIBuffer3 null def /XIDataProc null def /XIColorSpace /DeviceGray def /XIColorValues 0 def /XIPlateList false def end /ci6colorimage /colorimage where {/colorimage get}{null} ifelse def /ci6image systemdict /image get def /ci6curtransfer systemdict /currenttransfer get def /ci6curoverprint /currentoverprint where {/currentoverprint get}{{_of}} ifelse def /ci6foureq { 4 index ne { pop pop pop false }{ 4 index ne { pop pop false }{ 4 index ne { pop false }{ 4 index eq } ifelse } ifelse } ifelse } def /ci6testplate { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 ci6foureq { /plateindex 0 def }{ 0 1 0 0 ci6foureq { /plateindex 1 def }{ 0 0 1 0 ci6foureq { /plateindex 2 def }{ 0 0 0 1 ci6foureq { /plateindex 3 def }{ 0 0 0 0 ci6foureq { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /ci6concatprocs { /packedarray where { pop dup type /packedarraytype eq 2 index type /packedarraytype eq or }{ false } ifelse { /_proc2 exch cvlit def /_proc1 exch cvlit def _proc1 aload pop _proc2 aload pop _proc1 length _proc2 length add packedarray cvx }{ /_proc2 exch cvlit def /_proc1 exch cvlit def /_newproc _proc1 length _proc2 length add array def _newproc 0 _proc1 putinterval _newproc _proc1 length _proc2 putinterval _newproc cvx } ifelse } def /ci6istint { type /arraytype eq } def /ci6isspot { dup type /arraytype eq { dup length 1 sub get /Separation eq }{ pop false } ifelse } def /ci6spotname { dup ci6isspot {dup length 2 sub get}{pop ()} ifelse } def /ci6altspace { aload pop pop pop ci6colormake } def /ci6numcomps { dup /DeviceGray eq { pop 1 }{ dup /DeviceRGB eq { pop 3 }{ /DeviceCMYK eq { 4 }{ 1 } ifelse } ifelse } ifelse } def /ci6marksplate { dup /DeviceGray eq { pop plateindex 3 eq }{ dup /DeviceRGB eq { pop plateindex 5 ne }{ dup /DeviceCMYK eq { pop plateindex 5 ne }{ dup ci6isspot { /findcmykcustomcolor where { pop dup length 2 sub get 0.1 0.1 0.1 0.1 5 -1 roll findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop plateindex 5 ne } ifelse }{ pop plateindex 5 ne } ifelse } ifelse } ifelse } ifelse } def /ci6colormake { dup ci6numcomps exch 1 index 2 add 1 roll dup 1 eq {pop}{array astore} ifelse exch } def /ci6colorexpand { dup ci6spotname exch dup ci6istint { ci6altspace exch 4 1 roll }{ 1 3 1 roll } ifelse } def /ci6colortint { dup /DeviceGray eq { 3 1 roll 1 exch sub mul 1 exch sub exch }{ dup /DeviceRGB eq { 3 1 roll {1 exch sub 1 index mul 1 exch sub exch} forall pop 3 array astore exch }{ dup /DeviceCMYK eq { 3 1 roll {1 index mul exch} forall pop 4 array astore exch }{ 3 1 roll mul exch } ifelse } ifelse } ifelse } def /ci6colortocmyk { dup /DeviceGray eq { pop 1 exch sub 0 0 0 4 -1 roll 4 array astore }{ dup /DeviceRGB eq { pop aload pop _rgbtocmyk 4 array astore }{ dup /DeviceCMYK eq { pop }{ ci6altspace ci6colortint ci6colortocmyk } ifelse } ifelse } ifelse } def /ci6makeimagedict { 7 dict begin /ImageType 1 def /Decode exch def /DataSource exch def /ImageMatrix exch def /BitsPerComponent exch def /Height exch def /Width exch def currentdict end } def /ci6stringinvert { 0 1 2 index length 1 sub { dup 2 index exch get 255 exch sub 2 index 3 1 roll put } for } def /ci6stringknockout { 0 1 2 index length 1 sub { 255 2 index 3 1 roll put } for } def /ci6stringapply { 0 1 4 index length 1 sub { dup 4 index exch get 3 index 3 1 roll 3 index exec } for pop exch pop } def /ci6walkrgbstring { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval {} forall 5 index exec 3 index } for 5 {pop} repeat } def /ci6walkcmykstring { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval {} forall 6 index exec 3 index } for 5 { pop } repeat } def /ci6putrgbtograystr { .11 mul exch .59 mul add exch .3 mul add cvi 3 copy put pop 1 add } def /ci6putcmyktograystr { exch .11 mul add exch .59 mul add exch .3 mul add dup 255 gt { pop 255 } if 255 exch sub cvi 3 copy put pop 1 add } def /ci6rgbtograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putrgbtograystr load exch ci6walkrgbstring end } def /ci6cmyktograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putcmyktograystr load exch ci6walkcmykstring end } def /ci6separatecmykproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 0 2 index plateindex 4 2 index length 1 sub { get 255 exch sub 3 copy put pop 1 add 2 index } for pop pop exch pop end } def /ci6compositeimage { dup 1 eq { pop pop image }{ /ci6colorimage load null ne { ci6colorimage }{ 3 1 roll pop sourcearray 0 3 -1 roll put 3 eq {/ci6rgbtograyproc}{/ci6cmyktograyproc} ifelse load image } ifelse } ifelse } def /ci6knockoutimage { gsave 0 ci6curtransfer exec 1 ci6curtransfer exec eq { 0 ci6curtransfer exec 0.5 lt }{ 0 ci6curtransfer exec 1 ci6curtransfer exec gt } ifelse {{pop 0}}{{pop 1}} ifelse systemdict /settransfer get exec ci6compositeimage grestore } def /ci6drawimage { ci6testplate -1 eq { pop ci6compositeimage }{ dup type /arraytype eq { dup length plateindex gt {plateindex get}{pop false} ifelse }{ { true }{ dup 1 eq {plateindex 3 eq}{plateindex 3 le} ifelse } ifelse } ifelse { dup 1 eq { pop pop ci6image }{ dup 3 eq { ci6compositeimage }{ pop pop sourcearray 0 3 -1 roll put /ci6separatecmykproc load ci6image } ifelse } ifelse }{ ci6curoverprint { 7 {pop} repeat }{ ci6knockoutimage } ifelse } ifelse } ifelse } def /ci6proctintimage { /_ptispace exch store /_ptiname exch store /_pti1 exch store /_pti0 exch store /_ptiproc exch store /_pticomps _ptispace ci6numcomps store /_ptiscale _pti1 _pti0 sub store level2? { _ptiname length 0 gt version cvr 2012 ge and { [/Separation _ptiname _ptispace {_ptiproc}] setcolorspace [_pti0 _pti1] ci6makeimagedict ci6image }{ [/Indexed _ptispace 255 {255 div _ptiscale mul _pti0 add _ptiproc}] setcolorspace [0 255] ci6makeimagedict ci6image } ifelse }{ _pticomps 1 eq { { dup { 255 div _ptiscale mul _pti0 add _ptiproc 255 mul cvi put } ci6stringapply } ci6concatprocs ci6image }{ { dup length _pticomps mul dup _ptibuf length ne {/_ptibuf exch string store}{pop} ifelse _ptibuf { exch _pticomps mul exch 255 div _ptiscale mul _pti0 add _ptiproc _pticomps 2 add -2 roll _pticomps 1 sub -1 0 { 1 index add 2 index exch 5 -1 roll 255 mul cvi put } for pop pop } ci6stringapply } ci6concatprocs false _pticomps /ci6colorimage load null eq {7 {pop} repeat}{ci6colorimage} ifelse } ifelse } ifelse } def /ci6graytintimage { /_gtigray 5 -1 roll store {1 _gtigray sub mul 1 exch sub} 4 1 roll /DeviceGray ci6proctintimage } def /ci6cmyktintimage { /_cticmyk 5 -1 roll store {_cticmyk {1 index mul exch} forall pop} 4 1 roll /DeviceCMYK ci6proctintimage } def /ci6rgbtintimage { /_rtirgb 5 -1 roll store {_rtirgb {1 exch sub 1 index mul 1 exch sub exch} forall pop} 4 1 roll /DeviceRGB ci6proctintimage } def /ci6tintimage { ci6testplate -1 eq { ci6colorexpand 3 -1 roll 5 -1 roll {0}{0 exch} ifelse 4 2 roll dup /DeviceGray eq { pop ci6graytintimage }{ dup /DeviceRGB eq { pop ci6rgbtintimage }{ pop ci6cmyktintimage } ifelse } ifelse }{ dup ci6marksplate { plateindex 5 lt { ci6colortocmyk plateindex get dup 0 eq ci6curoverprint and { 7 {pop} repeat }{ 1 exch sub exch {1 0}{0 1} ifelse () ci6graytintimage } ifelse }{ pop exch {0}{0 exch} ifelse 0 3 1 roll () ci6graytintimage } ifelse }{ ci6curoverprint { 8 {pop} repeat }{ pop pop pop {pop 1} 0 1 () /DeviceGray ci6proctintimage } ifelse } ifelse } ifelse } def /XINullImage { } def /XIImageMask { XIImageWidth XIImageHeight false [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load imagemask } def /XIImageTint { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load XIType 3 eq XIColorValues XIColorSpace ci6tintimage } def /XIImage { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load false XIChannelCount XIPlateList ci6drawimage } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale /_lp /null ddef _fc /_lp /imagemask ddef end } def /XH { Adobe_ColorImage_AI6_Vars begin grestore end } def /XIEnable { Adobe_ColorImage_AI6_Vars /XIEnable 3 -1 roll put } def /XC { Adobe_ColorImage_AI6_Vars begin ci6colormake /XIColorSpace exch def /XIColorValues exch def end } def /XIPlates { Adobe_ColorImage_AI6_Vars begin /XIPlateList exch def end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def cvi dup 256 idiv /XICompression exch store 256 mod /XIEncoding exch store pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi }{ XIImageWidth XIChannelCount mul } ifelse /XIRowBytes exch def XIEnable { /XIBuffer3 XIImageWidth string def XICompression 0 eq { /XIBuffer1 XIRowBytes string def XIEncoding 0 eq { {currentfile XIBuffer1 readhexstring pop} }{ {currentfile XIBuffer1 readstring pop} } ifelse }{ /XIBuffer1 256 string def /XIBuffer2 XIRowBytes string def {currentfile XIBuffer1 readline pop (%) anchorsearch {pop} if} /ASCII85Decode filter /DCTDecode filter /XIFile exch def {XIFile XIBuffer2 readstring pop} } ifelse /XIDataProc exch def XIType 1 ne { 0 setgray } if XIType 1 eq { XIImageMask }{ XIType 2 eq XIType 3 eq or { XIImageTint }{ XIImage } ifelse } ifelse }{ XINullImage } ifelse /XIPlateList false def grestore end } def end currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 112 dict dup begin put /_?cmyk false def /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_lineorientation 0 def /_charorientation 0 def /_yokoorientation 0 def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_shift [0 0] def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fontSize 0 def /_fontAscent 0 def /_fontDescent 0 def /_fontHeight 0 def /_fontRotateAdjust 0 def /Ss 256 string def Ss 0 (fonts/) putinterval /_cnt 0 def /_scale [1 1] def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_hfname 100 string def /_hffound false def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_rgbf 3 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_rgbs 3 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /_lobyte 0 def /_hibyte 0 def /_cproc null def /_cscript 0 def /_hvax 0 def /_hvay 0 def /_hvwb 0 def /_hvcx 0 def /_hvcy 0 def /_bitfont null def /_bitlobyte 0 def /_bithibyte 0 def /_bitkey null def /_bitdata null def /_bitindex 0 def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 100 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin /_aicmykps where {pop /_?cmyk _aicmykps def}if discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /hswj { dup stringwidth 3 2 roll { _hvwb eq { exch _hvcx add exch _hvcy add } if exch _hvax add exch _hvay add } cforall } def /vswj { 0 0 3 -1 roll { dup 255 le _charorientation 1 eq and { dup cstring stringwidth 5 2 roll _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub 4 -1 roll sub exch 3 -1 roll sub exch } { _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub _fontHeight sub } ifelse } cforall } def /swj { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hswj } { vswj } ifelse } def /sw { 0 0 0 6 3 roll swj } def /vjss { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index setmatrix stroke grestore _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index setmatrix stroke grestore moveto pop pop } ifelse } cforall 6 npop } def /hjss { 4 1 roll { dup cstring gsave false charpath currentpoint 5 index setmatrix stroke grestore moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jss { _lineorientation 0 eq { hjss } { vjss } ifelse } def /ss { 0 0 0 7 3 roll jss } def /vjsp { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto false charpath currentpoint _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto 2 index false charpath moveto pop pop } ifelse } cforall 6 npop } def /hjsp { 4 1 roll { dup cstring false charpath _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jsp { matrix currentmatrix _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /sp { matrix currentmatrix 0 0 0 7 3 roll _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /_rgbtocmyk { 3 { 1 exch sub 3 1 roll } repeat 3 copy 1 4 1 roll 3 { 3 index 2 copy gt { exch } if pop 4 1 roll } repeat pop pop pop 4 1 roll 3 { 3 index sub 3 1 roll } repeat 4 -1 roll } def /setrgbfill { _rgbf astore pop /_fc { _lp /fill ne { _of setoverprint _rgbf aload pop setrgbcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /setrgbstroke { _rgbs astore pop /_sc { _lp /stroke ne { _os setoverprint _rgbs aload pop setrgbcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xa { _?cmyk { 3 npop k }{ setrgbfill 4 npop } ifelse } def /XA { _?cmyk { 3 npop K }{ setrgbstroke 4 npop } ifelse } def /Xs { /_gf exch ddef 5 npop /_fc { _lp /fill ne { _of setoverprint _gf setAIseparationgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XS { /_gs exch ddef 5 npop /_sc { _lp /stroke ne { _os setoverprint _gs setAIseparationgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xx { exch /_gf exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XX { exch /_gs exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /XK { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll K } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop XA } ifelse } def /Xk { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll k } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop Xa } ifelse } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /Xt { pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if endString eq { cleartomark stop } if }ifelse } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse }ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 6 npop 7 2 roll 5 npop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { /clipForward? true def /Tx /pop load def /Tj /pop load def currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 4 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setrgbcolor { 3 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end /XP { 4 npop } bind def /XD { pop } bind def end setpacking currentpacking true setpacking userdict /Adobe_cshow 14 dict dup begin put /initialize { Adobe_cshow begin Adobe_cshow { dup xcheck { bind } if pop pop } forall end Adobe_cshow begin } def /terminate { currentdict Adobe_cshow eq { end } if } def /cforall { /_lobyte 0 ddef /_hibyte 0 ddef /_cproc exch ddef /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef { /_lobyte exch ddef _hibyte 0 eq _cscript 1 eq _lobyte 129 ge _lobyte 159 le and _lobyte 224 ge _lobyte 252 le and or and _cscript 2 eq _lobyte 161 ge _lobyte 254 le and and _cscript 3 eq _lobyte 161 ge _lobyte 254 le and and _cscript 25 eq _lobyte 161 ge _lobyte 254 le and and _cscript -1 eq or or or or and { /_hibyte _lobyte ddef } { _hibyte 256 mul _lobyte add _cproc /_hibyte 0 ddef } ifelse } forall } def /cstring { dup 256 lt { (s) dup 0 4 3 roll put } { dup 256 idiv exch 256 mod (hl) dup dup 0 6 5 roll put 1 4 3 roll put } ifelse } def /clength { 0 exch { 256 lt { 1 } { 2 } ifelse add } cforall } def /hawidthshow { { dup cstring show _hvax _hvay rmoveto _hvwb eq { _hvcx _hvcy rmoveto } if } cforall } def /vawidthshow { { dup 255 le _charorientation 1 eq and { -90 rotate 0 _fontRotateAdjust rmoveto cstring _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow 0 _fontRotateAdjust neg rmoveto 90 rotate } { currentpoint _fontHeight sub exch _hvay sub exch _hvax sub 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if 3 2 roll cstring dup stringwidth pop 2 div neg _fontAscent neg rmoveto show moveto } ifelse } cforall } def /hvawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse } def /hvwidthshow { 0 0 3 -1 roll hvawidthshow } def /hvashow { 0 0 0 6 -3 roll hvawidthshow } def /hvshow { 0 0 0 0 0 6 -1 roll hvawidthshow } def currentdict readonly pop end setpacking userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_shading_AI8 10 dict dup begin put /initialize { Adobe_shading_AI8 begin Adobe_shading_AI8 bdprocs Mesh /initialize get exec } def /terminate { currentdict Adobe_shading_AI8 eq { end } if } def /bdprocs { { dup xcheck 1 index type /arraytype eq and { bind } if pop pop } forall } def /X! {pop} def /X# {pop pop} def /Mesh 40 dict def Mesh begin /initialize { Mesh bdprocs Mesh begin /emulate? /AI8MeshEmulation where { pop AI8MeshEmulation }{ systemdict /shfill known not } ifelse def end } def /bd { shadingdict begin } def /paint { emulate? { end }{ /_lp /none ddef _fc /_lp /none ddef /AIColorSpace AIColorSpace tocolorspace store /ColorSpace AIColorSpace topsspace store version_ge_3010.106 not systemdict /setsmoothness known and { 0.0001 setsmoothness } if composite? { /DataSource getdatasrc def Matrix concat currentdict end shfill }{ AIColorSpace makesmarks AIPlateList markingplate and not isoverprint and { end }{ /ColorSpace /DeviceGray store /Decode [0 1 0 1 0 1] store /DataSource getplatesrc def Matrix concat currentdict end shfill } ifelse } ifelse } ifelse } def /shadingdict 12 dict def shadingdict begin /ShadingType 6 def /BitsPerCoordinate 16 def /BitsPerComponent 8 def /BitsPerFlag 8 def end /datafile null def /databuf 256 string def /dataptr 0 def /srcspace null def /srcchannels 0 def /dstchannels 0 def /dstplate 0 def /srctodstcolor null def /getplatesrc { /srcspace AIColorSpace store /srcchannels AIColorSpace getnchannels store /dstchannels 1 store /dstplate getplateindex store /srctodstcolor srcspace makesmarks { dstplate 4 eq { {1 exch sub} }{ {srcspace tocmyk 3 dstplate sub index 1 exch sub 5 1 roll 4 {pop} repeat} } ifelse }{ {srcchannels {pop} repeat 1} } ifelse store /datafile getdatasrc store /rdpatch168 load DataLength () /SubFileDecode filter } def /getdatasrc { /rdcmntline load /ASCII85Decode filter } def /rdpatch168 { /dataptr 0 store 49 rdcount 4 { dup {pop srcchannels getint8} if dup {pop srctodstcolor dstchannels putint8 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdpatch3216 { /dataptr 0 store 97 rdcount 4 { dup {pop srcchannels getint16} if dup {pop srctodstcolor dstchannels putint16 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdcount { dup 0 gt { datafile databuf dataptr 4 -1 roll getinterval readstring exch length dataptr add /dataptr exch store }{ true } ifelse } def /getint8 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 255 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint8 { dup dataptr add /dataptr exch store dataptr exch { 1 sub exch 255 mul cvi databuf 2 index 3 -1 roll put } repeat pop } def /getint16 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 256 mul datafile read} if dup {pop add 65535 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint16 { dup 2 mul dataptr add /dataptr exch store dataptr exch { 2 sub exch 65535 mul cvi dup 256 idiv databuf 3 index 3 -1 roll put 256 mod databuf 2 index 1 add 3 -1 roll put } repeat pop } def /srcbuf 256 string def /rdcmntline { currentfile srcbuf readline pop (%) anchorsearch {pop} if } def /getplateindex { 0 [cyan? magenta? yellow? black? customColor?] {{exit} if 1 add} forall } def /aicsarray 4 array def /aicsaltvals 4 array def /aicsaltcolr aicsaltvals def /tocolorspace { dup type /arraytype eq { mark exch aload pop aicsarray 0 3 -1 roll put aicsarray 1 3 -1 roll put dup aicsarray 2 3 -1 roll put gettintxform aicsarray 3 3 -1 roll put counttomark aicsaltvals 0 3 -1 roll getinterval /aicsaltcolr exch store aicsaltcolr astore pop pop aicsarray } if } def /subtintxform {aicsaltcolr {1 index mul exch} forall pop} def /addtintxform {aicsaltcolr {1 sub 1 index mul 1 add exch} forall pop} def /gettintxform { /DeviceRGB eq {/addtintxform}{/subtintxform} ifelse load } def /getnchannels { dup type /arraytype eq {0 get} if colorspacedict exch get begin Channels end } def /makesmarks { composite? { pop true }{ dup dup type /arraytype eq {0 get} if colorspacedict exch get begin MarksPlate end } ifelse } def /markingplate { composite? { pop true }{ dup type /arraytype eq { dup length getplateindex gt {getplateindex get}{pop false} ifelse } if } ifelse } def /tocmyk { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToCMYK end } def /topsspace { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToPSSpace end } def /colorspacedict 5 dict dup begin /DeviceGray 4 dict dup begin /Channels 1 def /MarksPlate {pop black?} def /ToCMYK {pop 1 exch sub 0 0 0 4 -1 roll} def /ToPSSpace {} def end def /DeviceRGB 4 dict dup begin /Channels 3 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop _rgbtocmyk} def /ToPSSpace {} def end def /DeviceCMYK 4 dict dup begin /Channels 4 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop} def /ToPSSpace {} def end def /Separation 4 dict dup begin /Channels 1 def /MarksPlate { /findcmykcustomcolor where { pop dup 1 exch ToCMYK 5 -1 roll 1 get findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace {} def end def /Process 4 dict dup begin /Channels 1 def /MarksPlate { isCMYKSep? { 1 exch ToCMYK 4 array astore getplateindex get 0 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace { 4 array copy dup 0 /Separation put } def end def end def /isoverprint { /currentoverprint where {pop currentoverprint}{_of} ifelse } def /version_ge_3010.106 { version {cvr} stopped { pop false }{ 3010.106 ge } ifelse } def end end defaultpacking setpacking userdict /_useSmoothShade false put userdict /_aicmykps false put userdict /_forceToCMYK false put Adobe_level2_AI5 /initialize get exec Adobe_cshow /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_shading_AI8 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla /hungarumlaut/ogonek/caron TE %AI55J_Tsume: None %AI3_BeginEncoding: _Times-Roman Times-Roman [/_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType [161/degree 173/notequal 176/infinity/plusminus/lessequal/greaterequal 181/mu/partialdiff/summation/product/pi/integral 189/Omega 195/radical 197/approxequal 198/Delta 214/divide/lozenge 240/apple /_Symbol_/Symbol 0 0 0 TZ %AI5_Begin_NonPrinting Np %AI3_BeginPattern: (Brick) (Brick) 0 0 72 72 [ %AI3_Tile (0 O 0 R 0.3 0.85 0.85 0 k 0.3 0.85 0.85 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 0 m 0 72 L 72 72 L 72 0 L 0 0 L f %AI6_EndPatternLayer ) & (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 68.4097 m 72 68.4097 l S 0 61.209 m 72 61.209 L S 0 54.0088 m 72 54.0088 L S 0 46.8076 m 72 46.8076 L S 0 39.6084 m 72 39.6084 L S 0 32.4072 m 72 32.4072 L S 0 25.207 m 72 25.207 L S 0 18.0059 m 72 18.0059 L S 0 10.8057 m 72 10.8057 L S 0 3.6064 m 72 3.6064 L S 68.4102 68.4097 m 68.4102 61.2217 l S 54.0098 68.4097 m 54.0098 61.2217 L S 39.6094 68.4097 m 39.6094 61.2217 L S 25.21 68.4097 m 25.21 61.2217 L S 10.8105 68.4097 m 10.8105 61.2217 L S 68.4102 53.9717 m 68.4102 46.7842 l S 54.0098 53.9717 m 54.0098 46.7842 L S 39.6094 53.9717 m 39.6094 46.7842 L S 25.21 53.9717 m 25.21 46.7842 L S 10.8105 53.9717 m 10.8105 46.7842 L S 68.4102 39.5967 m 68.4102 32.4092 l S 54.0098 39.5967 m 54.0098 32.4092 L S 39.6094 39.5967 m 39.6094 32.4092 L S 25.21 39.5967 m 25.21 32.4092 L S 10.8105 39.5967 m 10.8105 32.4092 L S 68.4102 25.2217 m 68.4102 18.0342 l S 54.0098 25.2217 m 54.0098 18.0342 L S 39.6094 25.2217 m 39.6094 18.0342 L S 25.21 25.2217 m 25.21 18.0342 L S 10.8105 25.2217 m 10.8105 18.0342 L S 68.4102 10.7842 m 68.4102 3.5967 l S 54.0098 10.7842 m 54.0098 3.5967 L S 39.6094 10.7842 m 39.6094 3.5967 L S 25.21 10.7842 m 25.21 3.5967 L S 10.8105 10.7842 m 10.8105 3.5967 L S 61.1973 3.5967 m 61.1973 0 L S 46.7969 3.5967 m 46.7969 0 L S 32.3965 3.5967 m 32.3965 0 L S 17.9971 3.5967 m 17.9971 0 L S 3.5967 3.5967 m 3.5967 0 l S 61.1973 18.0342 m 61.1973 10.8467 L S 46.7969 18.0342 m 46.7969 10.8467 L S 32.3965 18.0342 m 32.3965 10.8467 L S 17.9971 18.0342 m 17.9971 10.8467 L S 3.5967 18.0342 m 3.5967 10.8467 l S 61.1973 32.4092 m 61.1973 25.2217 L S 46.7969 32.4092 m 46.7969 25.2217 L S 17.9971 32.4092 m 17.9971 25.2217 L S 3.5967 32.4092 m 3.5967 25.2217 l S 61.1973 46.7842 m 61.1973 39.5967 L S 46.7969 46.7842 m 46.7969 39.5967 L S 32.3965 46.7842 m 32.3965 39.5967 L S 17.9971 46.7842 m 17.9971 39.5967 L S 3.5967 46.7842 m 3.5967 39.5967 l S 61.1973 61.2217 m 61.1973 54.0347 L S 46.7969 61.2217 m 46.7969 54.0347 L S 32.3965 61.2217 m 32.3965 54.0347 L S 17.9971 61.2217 m 17.9971 54.0347 L S 3.5967 61.2217 m 3.5967 54.0347 l S 61.1973 71.959 m 61.1973 68.4717 L S 46.7969 71.959 m 46.7969 68.4717 L S 32.3965 71.959 m 32.3965 68.4717 L S 17.9971 71.959 m 17.9971 68.4717 L S 3.5967 71.959 m 3.5967 68.4717 l S 32.3965 32.4092 m 32.3965 25.2217 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Confetti) (Confetti) 4.85 3.617 76.85 75.617 [ %AI3_Tile (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 4.85 3.617 m 4.85 75.617 L 76.85 75.617 L 76.85 3.617 L 4.85 3.617 L f %AI6_EndPatternLayer ) & (0 O 0 R 0 g 0 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 10.6 64.867 m 7.85 62.867 l S 9.1 8.617 m 6.85 6.867 l S 78.1 68.617 m 74.85 67.867 l S 76.85 56.867 m 74.35 55.117 l S 79.6 51.617 m 76.6 51.617 l S 76.35 44.117 m 73.6 45.867 l S 78.6 35.867 m 76.6 34.367 l S 76.1 23.867 m 73.35 26.117 l S 78.1 12.867 m 73.85 13.617 l S 68.35 14.617 m 66.1 12.867 l S 76.6 30.617 m 73.6 30.617 l S 62.85 58.117 m 60.956 60.941 l S 32.85 59.617 m 31.196 62.181 l S 47.891 64.061 m 49.744 66.742 l S 72.814 2.769 m 73.928 5.729 l S 67.976 2.633 m 67.35 5.909 l S 61.85 27.617 m 59.956 30.441 l S 53.504 56.053 m 51.85 58.617 l S 52.762 1.779 m 52.876 4.776 l S 45.391 5.311 m 47.244 7.992 l S 37.062 3.375 m 35.639 5.43 l S 55.165 34.828 m 57.518 37.491 l S 20.795 3.242 m 22.12 5.193 l S 14.097 4.747 m 15.008 8.965 l S 9.736 1.91 m 8.073 4.225 l S 31.891 5.573 m 32.005 8.571 l S 12.1 70.367 m 15.6 68.867 l S 9.35 54.867 m 9.6 58.117 l S 12.85 31.867 m 14.35 28.117 l S 10.1 37.367 m 12.35 41.117 l S 34.1 71.117 m 31.85 68.617 l S 38.35 71.117 m 41.6 68.367 l S 55.1 71.117 m 58.35 69.117 l S 57.35 65.117 m 55.35 61.867 l S 64.35 66.367 m 69.35 68.617 l S 71.85 62.867 m 69.35 61.117 l S 23.6 70.867 m 23.6 67.867 l S 20.6 65.867 m 17.35 65.367 l S 24.85 61.367 m 25.35 58.117 l S 25.85 65.867 m 29.35 66.617 l S 14.1 54.117 m 16.85 56.117 l S 12.35 11.617 m 12.6 15.617 l S 12.1 19.867 m 14.35 22.367 l S 26.1 9.867 m 23.6 13.367 l S 34.6 47.117 m 32.1 45.367 l S 62.6 41.867 m 59.85 43.367 l S 31.6 35.617 m 27.85 36.367 l S 36.35 26.117 m 34.35 24.617 l S 33.85 14.117 m 31.1 16.367 l S 37.1 9.867 m 35.1 11.117 l S 34.35 20.867 m 31.35 20.867 l S 44.6 56.617 m 42.1 54.867 l S 47.35 51.367 m 44.35 51.367 l S 44.1 43.867 m 41.35 45.617 l S 43.35 33.117 m 42.6 30.617 l S 43.85 23.617 m 41.1 25.867 l S 44.35 15.617 m 42.35 16.867 l S 67.823 31.1 m 64.823 31.1 l S 27.1 32.617 m 29.6 30.867 l S 31.85 55.117 m 34.85 55.117 l S 19.6 40.867 m 22.1 39.117 l S 16.85 35.617 m 19.85 35.617 l S 20.1 28.117 m 22.85 29.867 l S 52.1 42.617 m 54.484 44.178 l S 52.437 50.146 m 54.821 48.325 l S 59.572 54.133 m 59.35 51.117 l S 50.185 10.055 m 53.234 9.928 l S 51.187 15.896 m 53.571 14.075 l S 58.322 19.883 m 59.445 16.823 l S 53.1 32.117 m 50.6 30.367 l S 52.85 24.617 m 49.6 25.617 l S 61.85 9.117 m 59.1 10.867 l S 69.35 34.617 m 66.6 36.367 l S 67.1 23.617 m 65.1 22.117 l S 24.435 46.055 m 27.484 45.928 l S 25.437 51.896 m 27.821 50.075 l S 62.6 47.117 m 65.321 46.575 l S 19.85 19.867 m 20.35 16.617 l S 21.85 21.867 m 25.35 22.617 l S 37.6 62.867 m 41.6 62.117 l S 38.323 42.1 m 38.823 38.6 l S 69.35 52.617 m 66.85 53.867 l S 14.85 62.117 m 18.1 59.367 l S 9.6 46.117 m 7.1 44.367 l S 20.6 51.617 m 18.6 50.117 l S 46.141 70.811 m 47.994 73.492 l S 69.391 40.561 m 71.244 43.242 l S 38.641 49.311 m 39.35 52.117 l S 25.141 16.811 m 25.85 19.617 l S 36.6 32.867 m 34.6 31.367 l S 6.1 68.617 m 2.85 67.867 l S 4.85 56.867 m 2.35 55.117 l S 7.6 51.617 m 4.6 51.617 l S 6.6 35.867 m 4.6 34.367 l S 6.1 12.867 m 1.85 13.617 l S 4.6 30.617 m 1.6 30.617 l S 72.814 74.769 m 73.928 77.729 l S 67.976 74.633 m 67.35 77.909 l S 52.762 73.779 m 52.876 76.776 l S 37.062 75.375 m 35.639 77.43 l S 20.795 75.242 m 22.12 77.193 l S 9.736 73.91 m 8.073 76.225 l S 10.1 23.617 m 6.35 24.367 l S 73.217 18.276 m 71.323 21.1 l S 28.823 39.6 m 29.505 42.389 l S 49.6 38.617 m 47.6 37.117 l S 60.323 73.6 m 62.323 76.6 l S 60.323 1.6 m 62.323 4.6 l S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Leaves - Fall ) (Leaves - Fall ) 0 0 64.0781 78.9336 [ %AI3_Tile (0 O 0 R 0.05 0.2 1 0 k 0.05 0.2 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 64.0781 78.9336 m 64.0781 0 L 0 0 L 0 78.9336 L 64.0781 78.9336 L f %AI6_EndPatternLayer ) & (0 O 0 R 0.83 0 1 0 k 0.83 0 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 1 D 0 XR 29.7578 0.9902 m 30.4346 1.1914 30.7246 1.3428 V 29.2559 4.0547 33.707 8.3359 34.627 9.0762 C 35.2275 8.8506 35.3477 6.3184 34.6699 4.9805 C 35.5137 5.1035 37.7031 3.7256 38.4609 2.4365 C 38.5254 3.125 40.0957 6.0664 40.9219 6.4434 C 40.002 6.8408 39.3359 8.3135 38.5742 9.7617 C 39.5957 9.9287 40.9961 9.0078 42.4668 8.1025 C 42.9814 8.9043 44.3555 9.875 45.6143 10.3916 C 44.5264 11.0781 44.0313 11.8203 43.5352 13.2793 C 42.4922 12.7139 40.3057 12.5645 39.7764 12.8516 C 40.291 13.9648 42.5371 14.5078 43.2676 14.4551 C 43.0137 15.3164 42.8652 17.4697 43.0391 20.0625 C 41.3789 18.7461 39.834 17.4297 38.1738 17.4883 C 38.4434 16.0664 37.8076 14.2607 37.4307 13.7676 C 36.8574 14.5117 36.4463 15.3389 36.8008 17.3164 C 35.3486 17.8008 34.1113 18.3467 32.7373 19.6045 C 32.7373 17.7734 32.166 16.5723 31.2969 15.2959 C 32.5576 14.8076 33.8301 13.6045 33.8252 12.5664 C 32.9775 12.7178 31.2852 13.4619 30.793 14.4551 C 30.0742 13.707 28.3906 12.3984 26.7871 12.3945 C 27.9746 11.5391 28.8945 10.5059 28.9893 8.5938 C 30.2422 9.5645 32.6953 10.1797 34.0752 9.582 C 29.2344 5.3457 29.7031 2.3125 29.7578 0.9902 C f 13.8525 29.9844 m 13.3281 29.5127 13.1309 29.25 V 15.623 27.4326 13.3691 21.6074 12.8555 20.5439 C 12.2168 20.4883 10.8096 23.2285 10.8457 24.7266 C 9.7129 23.9707 8.0488 24.0918 6.4463 24.3779 C 7.0186 23.2891 6.6172 21.3447 5.8164 20.5439 C 6.8184 20.5801 8.1699 19.8652 9.4785 18.8838 C 8.6436 18.0645 6.8164 18.2246 4.9004 18.8838 C 4.9004 17.5107 4.0781 15.7734 3.2412 14.5918 C 4.5576 14.6484 5.7031 13.9629 6.5605 12.9316 C 7.2256 14.5 9.2598 15.6133 10.166 15.5645 C 10.1826 14.1992 8.6094 12.1094 7.5879 11.7109 C 8.1875 11.041 9.207 9.5107 10.166 7.0947 C 10.9648 9.0205 12.1348 10.2627 13.3672 11.1953 C 12.2256 12.7578 12.3994 13.6289 12.7988 15.1074 C 13.541 14.5664 14.5723 14.1338 14.7441 12.1309 C 16.4609 12.416 17.5957 12.3447 19.0938 11.4434 C 18.6387 13.1055 18.6348 14.707 18.9551 16.4063 C 17.1055 16.2666 15.5449 16.4795 14.5156 17.9688 C 15.3457 18.1953 17.6055 18.2549 18.4795 17.3223 C 18.8066 18.3047 19.7012 19.7109 21.1475 20.4043 C 19.707 20.6641 18.7227 21.7637 17.8135 23.4492 C 17.1006 22.0332 14.873 20.3691 13.3711 20.3145 C 15.373 24.3779 15.373 27.2959 13.8525 29.9844 C f 41.2324 26.0742 m 41.5518 26.7021 41.7549 26.959 V 44.1523 25.0176 48.958 28.3262 49.8535 29.0957 C 49.7432 29.7266 47.6182 30.8643 45.9004 29.834 C 46.3408 31.123 45.4395 33.084 44.2402 34.126 C 45.9805 34.0254 48.126 35.3867 48.6484 36.1289 C 48.8701 35.1514 50.0527 33.8809 51.3379 32.8672 C 51.6895 33.8398 50.9941 35.958 50.0781 37.5605 C 51.3125 38.0605 52.4248 38.9912 52.8828 40.25 C 53.3398 38.9336 54.3428 38.2598 55.6875 37.5039 C 54.5273 36.0762 53.7471 33.9023 54.0273 33.0391 C 55.3496 33.374 56.9209 36.0918 57.0439 37.1816 C 57.9189 36.415 59.4727 35.7285 62.0537 35.4219 C 60.3535 34.3438 59.9902 32.3516 59.4063 30.9219 C 58.2588 31.3682 56.0898 31.4277 55.1152 30.8643 C 55.8281 30.2852 57.168 29.7344 59.1777 29.7207 C 59.1777 28.1758 59.6406 27.043 60.8945 25.8281 C 59.1719 25.8418 57.0723 25.3555 55.5762 24.9629 C 55.3281 26.292 54.4844 27.8887 53.3398 28.2891 C 53.334 27.4277 53.5996 25.1797 54.4844 24.5117 C 53.6201 23.9443 52.3672 22.5674 51.9102 20.8496 C 51.2881 22.1758 50.4268 23.4805 48.5645 23.9238 C 49.749 24.9766 50.584 26.9941 50.25 28.4609 C 45.1973 24.4785 42.5215 25.7773 41.2324 26.0742 C f 27.7578 38.7324 m 28.4346 38.9316 28.7246 39.084 V 27.2559 41.7969 31.707 46.0776 32.627 46.8169 C 33.2275 46.5918 33.3477 44.0586 32.6699 42.7227 C 33.5137 42.8457 35.7031 41.4678 36.4609 40.1787 C 36.5254 40.8652 38.0957 43.8066 38.9219 44.1846 C 38.002 44.582 37.3359 46.0547 36.5742 47.5039 C 37.5957 47.6709 38.9961 46.7485 40.4668 45.8438 C 40.9814 46.6445 42.3555 47.6177 43.6143 48.1328 C 42.5264 48.8198 42.0313 49.5615 41.5352 51.0205 C 40.4922 50.4556 38.3057 50.3057 37.7764 50.5938 C 38.291 51.7056 40.5371 52.2485 41.2676 52.1958 C 41.0137 53.0576 40.8652 55.2109 41.0391 57.8037 C 39.3789 56.4878 37.834 55.1719 36.1738 55.2285 C 36.4434 53.8076 35.8076 52.002 35.4307 51.5088 C 34.8574 52.2529 34.4463 53.0796 34.8008 55.0576 C 33.3486 55.5425 32.1113 56.0879 30.7373 57.3467 C 30.7373 55.5146 30.166 54.314 29.2969 53.0366 C 30.5576 52.5488 31.8301 51.3467 31.8252 50.3076 C 30.9775 50.46 29.2852 51.2036 28.793 52.1958 C 28.0742 51.4497 26.3906 50.1396 24.7871 50.1357 C 25.9746 49.2817 26.8945 48.2466 26.9893 46.335 C 28.2422 47.3057 30.6953 47.9209 32.0752 47.3237 C 27.2344 43.0869 27.7031 40.0547 27.7578 38.7324 C f 13.5195 70.3916 m 12.9941 69.9209 12.7988 69.6587 V 15.2891 67.8418 13.0352 62.0146 12.5225 60.9517 C 11.8828 60.8955 10.4766 63.6367 10.5117 65.1348 C 9.3809 64.3789 7.7148 64.4995 6.1133 64.7856 C 6.6855 63.6987 6.2842 61.7529 5.4834 60.9517 C 6.4854 60.9878 7.8359 60.2729 9.1455 59.2925 C 8.3105 58.4717 6.4834 58.6338 4.5674 59.2925 C 4.5674 57.9189 3.7461 56.1816 2.9082 54.9995 C 4.2246 55.0576 5.3691 54.3706 6.2275 53.3408 C 6.8926 54.9097 8.9258 56.0215 9.832 55.9727 C 9.8496 54.6079 8.2764 52.5176 7.2539 52.1187 C 7.8545 51.4497 8.873 49.9189 9.832 47.5039 C 10.6309 49.4297 11.8008 50.6719 13.0342 51.6045 C 11.8926 53.1655 12.0664 54.0366 12.4648 55.5146 C 13.209 54.9746 14.2393 54.5415 14.4102 52.5386 C 16.127 52.8247 17.2637 52.7529 18.7598 51.8525 C 18.3057 53.5137 18.3027 55.1147 18.623 56.8149 C 16.7725 56.6748 15.2129 56.8887 14.1826 58.377 C 15.0117 58.6035 17.2725 58.6626 18.1465 57.731 C 18.4736 58.7129 19.3691 60.1187 20.8145 60.8125 C 19.375 61.0728 18.3896 62.1719 17.4805 63.8579 C 16.7676 62.4429 14.541 60.7769 13.0371 60.7227 C 15.041 64.7856 15.041 67.7046 13.5195 70.3916 C f 41.2324 64.4824 m 41.5518 65.1113 41.7549 65.3682 V 44.1523 63.4272 48.958 66.7354 49.8535 67.5034 C 49.7432 68.1362 47.6182 69.2725 45.9004 68.2422 C 46.3408 69.5313 45.4395 71.4922 44.2402 72.5342 C 45.9805 72.4341 48.126 73.7954 48.6484 74.5371 C 48.8701 73.5601 50.0527 72.29 51.3379 71.2754 C 51.6895 72.249 50.9941 74.3662 50.0781 75.9683 C 51.3125 76.4692 52.4248 77.3994 52.8828 78.6582 C 53.3398 77.3423 54.3428 76.667 55.6875 75.9111 C 54.5273 74.4844 53.7471 72.3101 54.0273 71.4473 C 55.3496 71.7822 56.9209 74.5 57.0439 75.5903 C 57.9189 74.8232 59.4727 74.1372 62.0537 73.8311 C 60.3535 72.7534 59.9902 70.7612 59.4063 69.3301 C 58.2588 69.7773 56.0898 69.8364 55.1152 69.2725 C 55.8281 68.6934 57.168 68.1431 59.1777 68.1284 C 59.1777 66.583 59.6406 65.4512 60.8945 64.2373 C 59.1719 64.249 57.0723 63.7632 55.5762 63.3721 C 55.3281 64.7002 54.4844 66.2974 53.3398 66.6973 C 53.334 65.8364 53.5996 63.5874 54.4844 62.9214 C 53.6201 62.353 52.3672 60.9751 51.9102 59.2583 C 51.2881 60.583 50.4268 61.8882 48.5645 62.333 C 49.749 63.3862 50.584 65.4033 50.25 66.8691 C 45.1973 62.8872 42.5215 64.1851 41.2324 64.4824 C f %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Stripes) (Stripes) 8.45 4.6001 80.45 76.6001 [ %AI3_Tile (0 O 0 R 1 0.07 1 0 k 1 0.07 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 3.6 w 4 M []0 d %AI3_Note: 0 D 0 XR 8.2 8.2 m 80.7 8.2 L S 8.2 22.6001 m 80.7 22.6001 L S 8.2 37.0002 m 80.7 37.0002 L S 8.2 51.4 m 80.7 51.4 L S 8.2 65.8001 m 80.7 65.8001 L S 8.2 15.4 m 80.7 15.4 L S 8.2 29.8001 m 80.7 29.8001 L S 8.2 44.2 m 80.7 44.2 L S 8.2 58.6001 m 80.7 58.6001 L S 8.2 73.0002 m 80.7 73.0002 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_BeginBrushPattern (New Pattern 1) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7834.75 8587 m -7834.75 8563 L -7884.75 8563 L -7884.75 8587 L -7834.75 8587 L n u 0 Ap 0 O 1 g -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C F -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C F -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C F -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C F -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C F -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C F -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C F -7844.7817 8565.125 m -7850.9009 8563.6162 -7854.7817 8565.125 V -7858.877 8563.6484 -7864.7817 8565.125 V -7869.7446 8563.4492 -7874.7817 8565.125 V -7880.7969 8563.5742 -7884.7817 8565.125 V -7884.7817 8584.8096 L -7881.6958 8585.7842 -7878.2969 8585.9912 -7874.3799 8584.9082 C -7868.2134 8586.4912 -7864.4634 8584.9082 V -7859.4634 8586.4912 -7854.3799 8584.8242 V -7850.0474 8586.4082 -7844.3799 8584.9082 V -7838.8799 8586.3242 -7834.7817 8585.125 V -7834.7817 8565.4404 L -7837.5254 8564.4287 -7840.6514 8563.9287 -7844.7817 8565.125 C f 0 R 0 G 1 J 1 j 0.5 w -7864.75 8585 m -7872.54 8586.9473 -7878.813 8583.585 -7884.75 8579.0488 C S -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C S -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C S -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C S -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C S -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C S -7854.75 8565 m -7846.96 8563.0527 -7840.687 8566.415 -7834.75 8570.9512 C S -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C S -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C S U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 2) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7819.187 8586 L -7819.187 8521.9023 L -7884 8521.9023 L -7884 8586 L n u 0 O 0 g -7849.6978 8544.4297 m -7851.6094 8521.9023 L -7853.5215 8544.4297 L -7852.9033 8544.3066 -7852.2642 8544.2402 -7851.6094 8544.2402 c -7850.9551 8544.2402 -7850.3159 8544.3066 -7849.6978 8544.4297 C f -7861.2402 8552.3975 m -7884 8554.3301 L -7861.1138 8556.2734 L -7861.2856 8555.5469 -7861.3848 8554.793 -7861.3848 8554.0156 c -7861.3848 8553.4629 -7861.3281 8552.9248 -7861.2402 8552.3975 C f -7856.519 8545.5723 m -7870.1626 8536.8047 L -7860.2153 8549.377 L -7859.3574 8547.791 -7858.0718 8546.4766 -7856.519 8545.5723 C f -7853.481 8563.6074 m -7851.5786 8586 L -7849.6768 8563.5967 L -7850.3018 8563.7227 -7850.9473 8563.791 -7851.6094 8563.791 c -7852.25 8563.791 -7852.873 8563.7246 -7853.481 8563.6074 C f -7841.9609 8555.5068 m -7819.187 8553.5732 L -7842.083 8551.6289 L -7842.083 8551.8506 L -7841.9258 8552.5488 -7841.834 8553.2695 -7841.834 8554.0156 c -7841.834 8554.5234 -7841.8848 8555.0195 -7841.9609 8555.5068 C f -7860.1138 8558.8262 m -7870.1641 8571.5293 L -7856.2778 8562.6055 L -7857.8823 8561.7305 -7859.2114 8560.416 -7860.1138 8558.8262 C f -7842.9961 8549.3945 m -7832.875 8536.6055 L -7846.7666 8545.5313 L -7845.1768 8546.4414 -7843.8633 8547.7793 -7842.9961 8549.3945 C f -7846.6895 8562.4512 m -7832.873 8571.3281 L -7842.9658 8558.5732 L -7843.8198 8560.1895 -7845.1152 8561.5313 -7846.6895 8562.4512 C f -7842.8887 8558.6133 m -7842.3862 8557.6641 -7842.043 8556.6211 -7841.875 8555.5195 c -7841.7993 8555.0293 -7841.748 8554.5273 -7841.748 8554.0156 c -7841.748 8553.2637 -7841.8398 8552.5352 -7841.998 8551.8311 c -7842.1958 8550.957 -7842.5049 8550.124 -7842.918 8549.3545 c -7843.7954 8547.7246 -7845.1191 8546.374 -7846.7241 8545.4561 c -7847.6294 8544.9375 -7848.6226 8544.5537 -7849.6802 8544.3457 c -7850.3047 8544.2207 -7850.9497 8544.1523 -7851.6094 8544.1523 c -7852.2695 8544.1523 -7852.915 8544.2207 -7853.5391 8544.3457 c -7854.623 8544.5605 -7855.6382 8544.957 -7856.5625 8545.4961 c -7858.1313 8546.4102 -7859.4282 8547.7363 -7860.291 8549.335 c -7860.7969 8550.2695 -7861.145 8551.2969 -7861.3262 8552.3828 c -7861.415 8552.916 -7861.4727 8553.459 -7861.4727 8554.0156 c -7861.4727 8554.8008 -7861.3711 8555.5605 -7861.1978 8556.293 c -7860.981 8557.207 -7860.6406 8558.0732 -7860.187 8558.8701 c -7859.2793 8560.4727 -7857.939 8561.8008 -7856.3174 8562.6826 c -7855.4487 8563.1553 -7854.5 8563.498 -7853.4961 8563.6934 c -7852.8848 8563.8115 -7852.2554 8563.8779 -7851.6094 8563.8779 c -7850.9414 8563.8779 -7850.29 8563.8086 -7849.6602 8563.6826 c -7848.5786 8563.4668 -7847.5664 8563.0654 -7846.6455 8562.5273 c -7845.0566 8561.5977 -7843.751 8560.2441 -7842.8887 8558.6133 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 3) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7874.75 8587 m -7874.75 8563 L -7884.75 8563 L -7884.75 8587 L -7874.75 8587 L n u u 0 Ap 0 O 1 g -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 c -7877.897 8566.9736 -7881.0898 8565 -7884.75 8565 C -7884.75 8585 L -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 c -7881.9121 8584.7754 -7880.1807 8584.0645 -7878.7441 8582.9824 c -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 c f 0 R 0 G 1 J 1 j 0.5 w -7884.75 8565.3174 m -7881.7207 8566.2744 -7878.8926 8567.9326 -7876.1543 8569.9072 C S -7884.75 8570.9512 m -7881.5991 8573.3564 -7878.543 8576.0869 -7875.4058 8578.5361 C S -7878.7441 8582.9824 m -7880.8105 8581.8916 -7882.7993 8580.5342 -7884.75 8579.043 C S -7883.8018 8584.9521 m -7884.1191 8584.8682 -7884.4375 8584.7852 -7884.75 8584.6865 C S -7878.7441 8582.9824 m -7880.1807 8584.0645 -7881.9121 8584.7744 -7883.8018 8584.9521 C S -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 C S -7884.75 8585 m -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 C S -7878.7441 8582.9824 m -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 C S -7876.1543 8569.9072 m -7877.8975 8566.9736 -7881.0898 8565 -7884.75 8565 C S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 5) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7726.3994 8587 m -7726.3994 8573.4199 L -7885 8573.4199 L -7885 8587 L -7726.3994 8587 L n u u 0 O 0.285 0.228 0.171 0 k -7741.0786 8585.4844 m -7741.043 8586.6895 L -7727.5103 8587.5176 -7726.8418 8586.2822 v -7726.7441 8586.1016 -7726.647 8585.7148 -7726.561 8585.1934 C -7728.584 8585.8242 -7738.291 8585.5713 -7741.0786 8585.4844 C f 0.44 0.352 0.264 0 k -7741.4063 8574.0234 m -7741.3711 8575.2676 L -7738.4912 8575.0488 -7728.1914 8574.3164 -7726.543 8574.8652 C -7726.7031 8574.2188 -7726.9199 8573.7646 -7727.2046 8573.6152 c -7728.8306 8572.7656 -7741.4063 8574.0234 Y f 0.145 0.116 0.087 0 k -7741.3711 8575.2676 m -7741.0786 8585.4844 L -7738.291 8585.5713 -7728.584 8585.8242 -7726.561 8585.1934 C -7726.1519 8582.7773 -7725.9258 8577.3604 -7726.543 8574.8652 C -7728.1914 8574.3164 -7738.4912 8575.0488 -7741.3711 8575.2676 C f U u 0.155 0.124 0.093 0 k -7766.9375 8579.2734 m -7765.897 8579.6563 L -7747.0728 8575.1465 L -7747.481 8574.3145 L -7766.3633 8576.7246 L -7767.252 8577.0059 L -7767.6504 8576.8936 -7768.1934 8576.8242 V -7767.6094 8577.2373 -7767.1426 8578.1406 -7766.9375 8579.2734 C f u 0.085 0.068 0.051 0 k -7771.7993 8583.666 m -7772.5977 8583.7217 -7769.749 8583.6641 Y -7770.3481 8583.0176 -7770.771 8581.8203 -7770.8105 8580.4375 c -7770.8169 8580.2246 -7770.8105 8580.0176 -7770.7993 8579.8135 C -7771.041 8579.707 -7771.0918 8579.7734 -7771.6289 8579.5645 C -7771 8583.6113 -7771.7993 8583.666 v f 0.305 0.244 0.183 0 k -7770.3442 8576.8672 m -7770.5527 8576.8105 -7770.4937 8578.9307 Y -7769.4785 8579.7588 L -7767.8359 8578.9434 L -7766.9375 8579.2734 L -7767.1426 8578.1406 -7767.6094 8577.2373 -7768.1934 8576.8242 C -7768.6094 8576.7715 -7769.874 8576.7998 -7770.3442 8576.8672 C f U 0.115 0.092 0.069 0 k -7766.9375 8579.2734 m -7767.8359 8578.9434 L -7769.4785 8579.7588 L -7770.4937 8578.9307 L -7770.793 8579.708 -7770.7993 8579.8135 V -7769.5137 8580.3789 -7768.1831 8580.7402 -7766.8398 8580.9258 C -7766.79 8580.7275 -7766.7842 8580.543 -7766.79 8580.3369 c -7766.7998 8579.9717 -7766.8218 8579.6182 -7766.9375 8579.2734 C f 0.41 0.328 0.246 0 k -7747.4512 8575.3965 m -7749.377 8576.6426 -7758.3862 8582.0986 -7766.8398 8580.9258 C -7766.9038 8582.0928 -7767.248 8583.0908 -7767.75 8583.6631 C -7767.1895 8583.6621 L -7746.7402 8586.7559 L -7747.0366 8576.4258 L -7747.0728 8575.1465 L -7747.2046 8575.2373 -7747.4512 8575.3965 v f 0.395 0.316 0.237 0 k -7770.8105 8580.4375 m -7770.771 8581.8203 -7770.3481 8583.0176 -7769.749 8583.6641 C -7767.6807 8583.6631 L -7767.1782 8583.0908 -7766.8218 8582.0713 -7766.8398 8580.9258 C -7768.1831 8580.7402 -7769.5137 8580.3789 -7770.7993 8579.8135 C -7770.8105 8580.0176 -7770.8169 8580.2246 -7770.8105 8580.4375 c f U u 0 0 0 0.11 k -7741.2642 8574.2012 m -7740.2407 8574.0352 L -7741.2642 8574.2012 L -7741.2642 8574.2012 L f 0 0 0 0.34 k -7747.481 8574.3145 m -7747.0728 8575.1465 L -7745.6714 8574.918 L -7744.5234 8574.7314 L -7742.6758 8574.4307 L -7741.2642 8574.2012 L -7740.2407 8574.0352 L -7740.2954 8573.7168 -7740.3672 8573.498 -7740.4648 8573.4199 C -7747.481 8574.3145 L f 0 0 0 0.32 k -7745.8042 8579.207 m -7746.041 8586.8613 L -7740.7144 8587 L -7739.7266 8583.5146 -7740.1816 8579.1543 V -7745.8042 8579.207 L f U 0.025 0.02 0.015 0 k -7739.3223 8576.3848 m -7736.373 8576.9199 -7733.2402 8577.1602 -7730.3159 8576.3613 c -7730.2856 8576.3496 -7730.2754 8576.3184 -7730.2871 8576.2969 c -7730.2881 8576.2656 -7730.3198 8576.2559 -7730.3418 8576.2559 c -7733.2422 8577.0645 -7736.375 8576.8242 -7739.3042 8576.2783 c -7739.3262 8576.2793 -7739.3574 8576.291 -7739.3672 8576.3223 c -7739.3662 8576.3438 -7739.355 8576.375 -7739.3223 8576.3848 c -7739.3223 8576.3848 l f -7737.8374 8575.3076 m -7737.7295 8575.3789 -7737.6313 8575.4941 -7737.5234 8575.502 c -7733.7886 8575.832 -7730.1631 8575.7813 -7726.4746 8575.6641 c -7726.4526 8575.6641 -7726.4209 8575.6426 -7726.4214 8575.6211 c -7726.4214 8575.5879 -7726.4551 8575.5684 -7726.4766 8575.5684 c -7729.3223 8575.6816 -7732.1401 8575.6992 -7735.0039 8575.5352 c -7735.9336 8575.4766 -7736.9082 8575.7402 -7737.7778 8575.2207 c -7737.7993 8575.2109 -7737.8306 8575.2109 -7737.8506 8575.2334 c -7737.8618 8575.2559 -7737.8594 8575.2871 -7737.8374 8575.3076 c -7737.8374 8575.3076 l f -7733.373 8577.3672 m -7731.5098 8578.6797 -7729.3022 8579.374 -7727.1001 8579.8867 c -7727.0679 8579.8965 -7727.0474 8579.8848 -7727.0366 8579.8535 c -7727.0273 8579.8203 -7727.0488 8579.8008 -7727.0703 8579.79 c -7729.2617 8579.2656 -7731.459 8578.6035 -7733.3105 8577.2803 c -7733.3433 8577.2598 -7733.375 8577.2715 -7733.3848 8577.293 c -7733.4058 8577.3145 -7733.3945 8577.3457 -7733.373 8577.3672 c -7733.373 8577.3672 l f -7738.9321 8584.0566 m -7736.7295 8584.5703 -7734.5298 8585.0303 -7732.2798 8585.2754 c -7732.2598 8585.2852 -7732.229 8585.2637 -7732.229 8585.2422 c -7732.2183 8585.209 -7732.2407 8585.1777 -7732.2729 8585.1787 c -7734.5122 8584.8809 -7736.7305 8584.5176 -7738.9126 8583.9502 c -7738.9351 8583.9512 -7738.9673 8583.9629 -7738.9766 8583.9941 c -7738.9751 8584.0156 -7738.9648 8584.0479 -7738.9321 8584.0566 c -7738.9321 8584.0566 l f -7738.439 8583.3604 m -7736.3457 8584.1973 -7734.1016 8583.9297 -7731.9023 8583.9629 c -7731.8706 8583.9609 -7731.8496 8583.9395 -7731.8506 8583.9082 c -7731.8521 8583.875 -7731.873 8583.8555 -7731.8945 8583.8555 c -7734.0928 8583.8438 -7736.3374 8584.0996 -7738.4209 8583.2529 c -7738.4434 8583.2539 -7738.4746 8583.2656 -7738.4834 8583.2969 c -7738.4834 8583.3184 -7738.4722 8583.3506 -7738.439 8583.3604 c -7738.439 8583.3604 l f -7737.707 8584.7051 m -7736.3833 8584.752 -7735.1504 8584.5469 -7733.8271 8584.209 c -7733.3594 8584.0996 -7732.9199 8584.2266 -7732.4609 8584.2129 c -7731.897 8584.1973 l -7731.874 8584.1963 -7731.8633 8584.1855 -7731.8535 8584.1738 c -7731.834 8584.1523 -7731.8442 8584.1211 -7731.8662 8584.0996 c -7732.0625 8583.9453 l -7732.0742 8583.9453 -7732.085 8583.9355 -7732.0962 8583.9355 c -7732.5 8583.9473 l -7733.9551 8584.1914 -7735.457 8584.6719 -7736.8926 8584.0742 c -7736.9258 8584.0645 -7736.957 8584.0859 -7736.9673 8584.1074 c -7736.9673 8584.1396 -7736.9551 8584.1602 -7736.9336 8584.1709 c -7735.647 8584.6992 -7734.1714 8584.4756 -7732.8818 8584.0547 c -7732.0918 8584.043 L -7732.124 8584.0332 L -7731.9282 8584.1875 L -7731.8984 8584.0898 L -7732.4639 8584.1064 l -7732.9321 8584.1406 -7733.3848 8583.9834 -7733.8398 8584.1035 c -7735.1543 8584.4609 -7736.3975 8584.625 -7737.71 8584.5986 c -7737.7422 8584.5996 -7737.7642 8584.6211 -7737.7617 8584.6533 c -7737.7617 8584.6855 -7737.7402 8584.7061 -7737.707 8584.7051 c -7737.707 8584.7051 l f -7738.5718 8585.0605 m -7735.8711 8586.2207 -7732.9023 8585.5703 -7730.1279 8585.1816 c -7729.7832 8585.2891 l -7729.7617 8585.2988 -7729.7417 8585.2871 -7729.7207 8585.2656 c -7729.71 8585.2441 -7729.7217 8585.2129 -7729.7422 8585.2021 c -7730.0801 8585.0098 l -7732.7754 8584.3926 -7735.5391 8584.7813 -7738.271 8584.7852 c -7738.3022 8584.7871 -7738.3232 8584.8086 -7738.3223 8584.8398 c -7738.3198 8584.8721 -7738.2983 8584.8926 -7738.2681 8584.8926 c -7735.6738 8584.9355 -7733.0303 8584.4434 -7730.4727 8585.0742 c -7729.7954 8585.2891 L -7729.7534 8585.1914 L -7730.1406 8585.0859 l -7732.9058 8585.4424 -7735.8418 8586.1348 -7738.5313 8584.9746 c -7738.5537 8584.9648 -7738.585 8584.9648 -7738.5962 8584.998 c -7738.6055 8585.0195 -7738.605 8585.0508 -7738.5718 8585.0605 c -7738.5718 8585.0605 l f -7735.6895 8578.3945 m -7734.3945 8578.9004 -7732.9834 8578.6465 -7731.6802 8578.3438 c -7731.647 8578.3418 -7731.6367 8578.3203 -7731.6382 8578.2891 c -7731.6504 8578.2568 -7731.6714 8578.2461 -7731.7031 8578.248 c -7732.998 8578.5303 -7734.377 8578.8154 -7735.6504 8578.2969 c -7735.6826 8578.2871 -7735.7144 8578.2988 -7735.7246 8578.3311 c -7735.7222 8578.3525 -7735.7114 8578.3848 -7735.6895 8578.3945 c -7735.6895 8578.3945 l f -7736.1401 8580.2207 m -7734.2266 8580.6895 -7732.3145 8581.1035 -7730.355 8581.3242 c -7730.3242 8581.334 -7730.3022 8581.3125 -7730.293 8581.2803 c -7730.2954 8581.2598 -7730.3159 8581.2285 -7730.3374 8581.2285 c -7732.2959 8581.0078 -7734.209 8580.582 -7736.1206 8580.1133 c -7736.1426 8580.1152 -7736.1738 8580.126 -7736.1831 8580.1582 c -7736.1831 8580.1797 -7736.1719 8580.2109 -7736.1401 8580.2207 c -7736.1401 8580.2207 l f -7736.9336 8582.6348 m -7734.499 8583.4609 -7731.8647 8583.0547 -7729.3457 8583.0879 c -7729.313 8583.0879 -7729.293 8583.0664 -7729.293 8583.0332 c -7729.2954 8583.0117 -7729.3159 8582.9922 -7729.3481 8582.9922 c -7731.8574 8582.916 -7734.481 8583.3848 -7736.8945 8582.5264 c -7736.9282 8582.5273 -7736.959 8582.5391 -7736.9688 8582.5605 c -7736.9678 8582.5918 -7736.9561 8582.624 -7736.9336 8582.6348 c -7736.9336 8582.6348 l f -7732.0542 8583.8496 m -7730.6582 8584.5449 -7729.0503 8584.4033 -7727.5342 8584.4668 c -7727.502 8584.4648 -7727.4824 8584.4434 -7727.4824 8584.4121 c -7727.4834 8584.3906 -7727.5054 8584.3594 -7727.5366 8584.3594 c -7729.0137 8584.2207 -7730.6489 8584.5234 -7732.0039 8583.7617 c -7732.0366 8583.7529 -7732.0679 8583.7637 -7732.0786 8583.7861 c -7732.0879 8583.8076 -7732.0767 8583.8398 -7732.0542 8583.8496 c -7732.0542 8583.8496 l f -7731.3418 8580.4248 m -7730.3926 8580.3975 -7729.4336 8580.3701 -7728.4839 8580.3428 c -7728.4526 8580.3418 -7728.4312 8580.3203 -7728.4336 8580.2881 c -7728.4336 8580.2559 -7728.4551 8580.2354 -7728.4878 8580.2363 c -7729.437 8580.2637 -7730.397 8580.291 -7731.3457 8580.3184 c -7731.377 8580.3184 -7731.3975 8580.3418 -7731.3975 8580.373 c -7731.397 8580.4043 -7731.374 8580.4258 -7731.3418 8580.4248 c -7731.3418 8580.4248 l f -7729.1592 8578.0361 m -7728.6895 8578.0645 -7728.209 8578.0723 -7727.7383 8578.0918 c -7727.7168 8578.0908 -7727.6855 8578.0684 -7727.6865 8578.0371 c -7727.687 8578.0039 -7727.71 8577.9844 -7727.7417 8577.9844 c -7728.2114 8577.9873 -7728.6816 8577.9375 -7729.1514 8577.9395 c -7729.1831 8577.9297 -7729.2031 8577.9512 -7729.2134 8577.9844 c -7729.2129 8578.0156 -7729.1914 8578.0371 -7729.1592 8578.0361 c -7729.1592 8578.0361 l f -7736.9702 8580.2344 m -7736.5688 8580.5107 -7736.125 8580.6797 -7735.645 8580.751 c -7735.6113 8580.7607 -7735.5918 8580.7383 -7735.5806 8580.7168 c -7735.5703 8580.6855 -7735.5928 8580.6543 -7735.6152 8580.6543 c -7736.0854 8580.5723 -7736.5176 8580.4023 -7736.9209 8580.1475 c -7736.9521 8580.1377 -7736.9849 8580.1387 -7736.9946 8580.1709 c -7737.0039 8580.1934 -7736.9922 8580.2246 -7736.9702 8580.2344 c -7736.9702 8580.2344 l f -7738.1904 8586.085 m -7735.7344 8586.5273 -7733.2983 8587.001 -7730.7993 8586.7266 c -7730.7778 8586.7266 -7730.7568 8586.7041 -7730.7578 8586.6719 c -7730.7578 8586.6406 -7730.7798 8586.6191 -7730.8022 8586.6191 c -7733.291 8586.873 -7735.7344 8586.4844 -7738.1719 8585.9775 c -7738.1934 8585.9785 -7738.2256 8585.9902 -7738.2344 8586.0215 c -7738.2344 8586.043 -7738.2222 8586.0752 -7738.1904 8586.085 c -7738.1904 8586.085 l f 0.195 0.156 0.117 0 k -7738.166 8574.6445 m -7735.7969 8574.2676 -7733.4058 8574.3477 -7731.0298 8574.5898 c -7730.998 8574.5879 -7730.9766 8574.5664 -7730.9766 8574.5352 c -7730.9785 8574.5137 -7731 8574.4824 -7731.0215 8574.4824 c -7733.4082 8574.2422 -7735.791 8574.1602 -7738.1694 8574.5391 c -7738.2026 8574.5391 -7738.2222 8574.5605 -7738.2217 8574.5938 c -7738.2207 8574.625 -7738.1992 8574.6465 -7738.166 8574.6445 c -7738.166 8574.6445 l f 0.335 0.268 0.201 0 k -7737.4351 8574.1113 m -7734.9282 8574.1152 -7732.4146 8574.2773 -7729.918 8573.8965 c -7729.8862 8573.8945 -7729.8647 8573.873 -7729.8662 8573.8418 c -7729.8672 8573.8086 -7729.8896 8573.7891 -7729.9209 8573.7891 c -7732.418 8574.1699 -7734.9297 8574.0293 -7737.4375 8574.0059 c -7737.46 8574.0059 -7737.481 8574.0273 -7737.4785 8574.0596 c -7737.4785 8574.0918 -7737.457 8574.1123 -7737.4351 8574.1113 c -7737.4351 8574.1113 l f 0.205 0.164 0.123 0 k -7738.9766 8574.3262 m -7737.5039 8574.668 -7736.0078 8574.4023 -7734.5391 8574.2207 c -7734.5078 8574.2207 -7734.4873 8574.1973 -7734.499 8574.166 c -7734.5 8574.1348 -7734.5215 8574.1133 -7734.5537 8574.125 c -7736.0103 8574.2842 -7737.4961 8574.583 -7738.9473 8574.2188 c -7738.9785 8574.2207 -7739.0103 8574.2324 -7739.0098 8574.2637 c -7739.019 8574.2852 -7738.998 8574.3164 -7738.9766 8574.3262 c -7738.9766 8574.3262 l f -7732.3535 8573.7949 m -7731.1978 8573.9219 -7730.0273 8573.8145 -7728.8926 8573.5898 c -7728.8711 8573.5781 -7728.8506 8573.5566 -7728.8618 8573.5244 c -7728.8623 8573.5029 -7728.8945 8573.4824 -7728.916 8573.4941 c -7730.0503 8573.7402 -7731.1914 8573.7939 -7732.3462 8573.6885 c -7732.3794 8573.6895 -7732.3984 8573.7109 -7732.4087 8573.7324 c -7732.4082 8573.7646 -7732.3862 8573.7852 -7732.3535 8573.7949 c -7732.3535 8573.7949 l f 0.335 0.268 0.201 0 k -7739.2681 8576.4473 m -7737.9214 8577.1885 -7736.3066 8576.5977 -7734.855 8576.6416 c -7734.8223 8576.6406 -7734.8022 8576.6191 -7734.8022 8576.5859 c -7734.8042 8576.5654 -7734.8262 8576.5449 -7734.8574 8576.5449 c -7736.2886 8576.4902 -7737.8823 8577.0801 -7739.2168 8576.3506 c -7739.2383 8576.3398 -7739.2695 8576.3516 -7739.291 8576.374 c -7739.3008 8576.3955 -7739.2886 8576.4277 -7739.2681 8576.4473 c -7739.2681 8576.4473 l f -7737.8945 8578.5645 m -7735.6719 8579.0449 -7733.3896 8578.6162 -7731.1504 8578.5625 c -7731.1177 8578.5615 -7731.0977 8578.5391 -7731.0977 8578.5078 c -7731.1001 8578.4863 -7731.1318 8578.4668 -7731.1519 8578.4668 c -7733.3833 8578.4775 -7735.6519 8578.9805 -7737.875 8578.457 c -7737.8975 8578.457 -7737.9287 8578.4688 -7737.9375 8578.502 c -7737.9375 8578.5225 -7737.9258 8578.5547 -7737.8945 8578.5645 c -7737.8945 8578.5645 l f -7732.0273 8575.1406 m -7730.3496 8575.9688 -7728.499 8576.502 -7726.603 8576.3613 c -7726.5718 8576.3613 -7726.5513 8576.3389 -7726.5527 8576.3066 c -7726.5527 8576.2754 -7726.5742 8576.2539 -7726.6074 8576.2559 c -7728.481 8576.416 -7730.3198 8575.8604 -7731.9873 8575.0547 c -7732.0078 8575.0449 -7732.041 8575.0449 -7732.0503 8575.0781 c -7732.061 8575.0996 -7732.061 8575.1309 -7732.0273 8575.1406 c -7732.0273 8575.1406 l f u 0.5 0.85 1 0.45 k -7885 8581.9082 m -7885.0254 8582.4883 -7884.5664 8583.1875 -7883.167 8583.9902 C -7882.8521 8584.0029 -7881.3945 8584.0234 -7879.0889 8584.0488 C -7879.0889 8581.8223 L -7881.1382 8581.8457 -7883.1177 8581.8867 -7885 8581.9082 C f -7884.5088 8580.9688 m -7879.0889 8580.8447 L -7879.0889 8579.8145 L -7882.644 8579.959 L -7883.8145 8580.3301 -7884.5088 8580.9688 V f 0.5 0.85 1 0.32 k -7879.0889 8580.8252 m -7884.4746 8580.9434 L -7884.7695 8581.2148 -7884.9849 8581.5566 -7885 8581.9277 C -7883.1177 8581.9063 -7881.1382 8581.8848 -7879.0889 8581.8613 C -7879.0889 8580.8252 L f 0.5 0.85 1 0.45 k -7774.1504 8580.6172 m -7852.3584 8581.541 -7879.1079 8581.8418 V -7879.1079 8584.0488 L -7862.8145 8584.2324 -7803.9902 8584.707 Y -7769.749 8583.6641 L -7770.457 8580.5684 L -7774.1504 8580.6172 L f 0.5 0.85 1 0.12 k -7879.1079 8579.8145 m -7879.1079 8580.8447 L -7770.4258 8579 L -7770.3833 8576.8633 L -7803.6553 8576.7129 L -7879.1079 8579.8145 L f u 0.065 0.052 0.039 0 k -7747.0728 8575.1465 m -7747.0366 8576.4258 L -7747.2954 8575.1172 L -7765.897 8579.6563 L -7766.9375 8579.2734 L -7766.8794 8579.6055 -7766.8398 8579.957 -7766.8306 8580.3223 c -7766.8242 8580.5283 -7766.8281 8580.7285 -7766.8398 8580.9258 C -7758.3862 8582.0986 -7748.9634 8577.6719 -7747.0366 8576.4258 C -7746.7402 8586.7559 L -7746.041 8586.8613 L -7745.8042 8579.207 L -7740.1816 8579.1543 L -7740.0898 8577.0137 -7740.0718 8575.0215 -7740.2407 8574.0352 C -7747.0728 8575.1465 L f 0.4 0.7 1 0 k -7770.457 8580.5879 m -7770.4258 8578.9805 L -7879.1079 8580.8252 L -7879.1079 8581.8613 L -7852.3584 8581.5605 -7770.457 8580.5879 Y f U U 0.025 0.02 0.015 0 k -7734.7344 8583.0293 m -7734.7344 8583.0625 -7734.7129 8583.082 -7734.6802 8583.082 c -7731.6714 8583.1133 -7729.4214 8582.9453 -7726.415 8582.8594 C -7726.4087 8582.7656 L -7729.3262 8582.8701 -7731.7607 8583.0078 -7734.6841 8582.9746 C -7734.7168 8582.9766 -7734.7358 8582.998 -7734.7344 8583.0293 C f -7726.3994 8582.7656 m -7726.4082 8582.7441 L -7726.4087 8582.7656 L -7726.4063 8582.7656 -7726.4033 8582.7656 -7726.3994 8582.7656 C f -7730.4487 8581.4238 m -7731.4458 8581.292 -7732.3394 8581.7656 -7733.2114 8582.1973 C -7733.2441 8582.208 -7733.2534 8582.2402 -7733.2422 8582.2715 C -7733.2305 8582.293 -7733.1982 8582.3027 -7733.1777 8582.291 c -7732.3262 8581.8301 -7731.4312 8581.4199 -7730.4678 8581.5195 c -7729.1079 8581.6621 -7727.9038 8582.375 -7726.5254 8582.4531 C -7726.4463 8582.3594 L -7728.04 8582.2656 -7728.8647 8581.623 -7730.4487 8581.4238 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 6) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.75 8563 m -7884.75 8587 L -7874.75 8587 L -7874.75 8563 L -7884.75 8563 L n 0 Ap 0 O 1 g -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 c -7877.5879 8565.2256 -7879.3198 8565.9346 -7880.7559 8567.0176 c -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 c -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.2319 8578.5996 -7883.3457 8580.0918 c -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C -7874.75 8565 L f 0 R 0 G 1 J 1 j 0.5 w -7874.75 8584.6816 m -7877.7793 8583.7256 -7880.6074 8582.0674 -7883.3457 8580.0918 C S -7874.75 8579.0488 m -7877.8999 8576.6436 -7880.957 8573.9131 -7884.0942 8571.4639 C S -7880.7559 8567.0176 m -7878.6904 8568.1084 -7876.7017 8569.4668 -7874.75 8570.957 C S -7875.6982 8565.0479 m -7875.3809 8565.1309 -7875.063 8565.2148 -7874.75 8565.3145 C S -7880.7559 8567.0176 m -7879.3193 8565.9355 -7877.5879 8565.2256 -7875.6982 8565.0479 C S -7884.0942 8571.4639 m -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.231 8578.5996 -7883.3457 8580.0918 C S -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 C S -7880.7559 8567.0176 m -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 C S -7883.3457 8580.0918 m -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C S U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 8) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.9521 8584.3125 m -7776.7954 8584.3125 L -7776.7954 8570.1855 L -7883.9521 8570.1855 L -7883.9521 8584.3125 L n u 0 O 0 0 0 1 k -7882.2832 8583.623 m -7882.8535 8586 -7882.8184 8582.0039 V -7883.0479 8578.8027 L -7883.6167 8576.4551 L -7883.4502 8574.123 L -7881.9502 8573.4551 -7865.2832 8572.123 V -7858.6167 8570.7891 -7849.6167 8570.7891 V -7784.3936 8571.4766 -7779.4912 8572.8848 v -7820.3882 8570.875 -7822.9688 8571.5117 v -7783.8569 8573.1602 -7780.8545 8574.4316 v -7818.79 8572.5469 -7822.167 8574.1777 v -7787.249 8575.9102 -7783.021 8577.5313 v -7789.7217 8576.8828 -7791.5127 8577.082 v -7788.3896 8577.5703 l -7793.4194 8577.502 l -7796.3218 8577.1289 l -7788.4521 8578.2422 -7787.9033 8578.8086 v -7784.3154 8578.1309 -7798.5186 8578.3848 v -7832.1177 8574.4551 -7882.2832 8583.623 V f /BBAccumRotation (5.805971) XT 0 R 0 0 0 0.5 K 0.025 w -7883.9502 8573.123 m -7863.667 8571.2949 -7843.9727 8570.2207 v -7801.1514 8570.502 -7796.5737 8570.9004 v -7784.1631 8571.0313 -7776.7959 8572.0273 v S /BBAccumRotation (5.805971) XT 0 0 0 1 K -7821.8369 8570.4082 m -7825.2959 8570.0273 -7851.2607 8570.2793 Y -7861.627 8570.1602 -7883.9502 8573.123 Y S /BBAccumRotation (5.805971) XT -7820.9873 8573.6641 m -7790.3608 8574.582 -7783.6606 8575.2324 v S /BBAccumRotation (5.805971) XT 0 0 0 0.5 K -7829.6201 8578.2051 m -7794.3706 8579.6172 -7791.4058 8580.1406 v S /BBAccumRotation (5.805971) XT U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 10) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7833.8921 8586 L -7833.8921 8529.9756 L -7884 8529.9756 L -7884 8586 L n u 0 O 0.1 1 1 0 k -7846.9014 8551.5752 m -7848.7178 8545.0957 -7858.8247 8548.4658 Y -7858.791 8548.5303 L -7868.8999 8545.1611 -7870.7144 8551.6396 V -7876.6758 8569.0068 -7871.4922 8575.7451 V -7864.7529 8585.3369 -7860.6055 8585.3369 V -7857.0103 8585.2705 L -7852.8638 8585.2705 -7846.125 8575.6816 Y -7840.9409 8568.9424 -7846.9014 8551.5752 Y f u 0 0 0 1 k -7851.3926 8529.9756 m -7852.1167 8531.4199 -7852.9238 8532.4756 V -7852.4058 8532.0635 -7851.5151 8531.1924 -7851.3926 8529.9756 C f -7865.064 8532.4854 m -7865.8711 8531.4307 -7866.5942 8529.9863 Y -7866.4727 8531.2021 -7865.582 8532.0732 -7865.064 8532.4854 C f U 0 0.61 0.74 0 k -7850.5977 8554.4609 m -7851.9038 8549.7959 -7859.1816 8552.2217 Y -7859.1567 8552.2686 L -7866.436 8549.8428 -7867.7417 8554.5078 V -7872.0337 8567.0117 -7868.3018 8571.8633 V -7863.4487 8578.7686 -7860.4634 8578.7686 V -7857.875 8578.7227 L -7854.8887 8578.7227 -7850.0366 8571.8174 Y -7846.3042 8566.9639 -7850.5977 8554.4609 Y f u 1 Ap 0.73 0.43 1 0.22 k 0 R 0 0 0 1 K -7854.6226 8557.2754 m -7853.813 8557.2754 -7853.1558 8556.6182 -7853.1558 8555.8096 c -7853.1558 8555 -7853.813 8554.3428 -7854.6226 8554.3428 c -7855.4321 8554.3428 -7856.0889 8555 -7856.0889 8555.8096 c -7856.0889 8556.6182 -7855.4321 8557.2754 -7854.6226 8557.2754 c b -7854.3638 8568.9971 m -7853.0806 8568.9971 -7852.0415 8568.1201 -7852.0415 8567.042 c -7852.0415 8565.9619 -7853.0806 8565.0869 -7854.3638 8565.0869 c -7855.645 8565.0869 -7856.6846 8565.9619 -7856.6846 8567.042 c -7856.6846 8568.1201 -7855.645 8568.9971 -7854.3638 8568.9971 c b -7853.834 8580.7861 m -7852.2817 8580.7861 -7851.0239 8580.1299 -7851.0239 8579.3213 c -7851.0239 8578.5117 -7852.2817 8577.8545 -7853.834 8577.8545 c -7855.3862 8577.8545 -7856.645 8578.5117 -7856.645 8579.3213 c -7856.645 8580.1299 -7855.3862 8580.7861 -7853.834 8580.7861 c b -7849.6104 8552.5264 m -7848.8687 8552.5264 -7848.2671 8551.8154 -7848.2671 8550.9365 c -7848.2671 8550.0596 -7848.8687 8549.3477 -7849.6104 8549.3477 c -7850.353 8549.3477 -7850.9546 8550.0596 -7850.9546 8550.9365 c -7850.9546 8551.8154 -7850.353 8552.5264 -7849.6104 8552.5264 c b -7848.0034 8574.083 m -7848.8818 8573.7354 -7849.1494 8572.335 -7848.603 8570.9541 c -7848.0566 8569.5752 -7846.9014 8568.7363 -7846.0234 8569.085 c -7845.145 8569.4326 -7844.877 8570.833 -7845.4233 8572.2139 c -7845.9702 8573.5947 -7847.125 8574.4316 -7848.0034 8574.083 c b u -7863.0566 8557.1592 m -7863.8662 8557.1592 -7864.5239 8556.502 -7864.5239 8555.6934 c -7864.5239 8554.8828 -7863.8662 8554.2266 -7863.0566 8554.2266 c -7862.248 8554.2266 -7861.5913 8554.8828 -7861.5913 8555.6934 c -7861.5913 8556.502 -7862.248 8557.1592 -7863.0566 8557.1592 c b -7863.3159 8568.8799 m -7864.5991 8568.8799 -7865.6382 8568.0049 -7865.6382 8566.9248 c -7865.6382 8565.8447 -7864.5991 8564.9697 -7863.3159 8564.9697 c -7862.0342 8564.9697 -7860.9951 8565.8447 -7860.9951 8566.9248 c -7860.9951 8568.0049 -7862.0342 8568.8799 -7863.3159 8568.8799 c b -7863.8457 8580.6709 m -7865.3975 8580.6709 -7866.6558 8580.0146 -7866.6558 8579.2041 c -7866.6558 8578.3936 -7865.3975 8577.7383 -7863.8457 8577.7383 c -7862.293 8577.7383 -7861.0352 8578.3936 -7861.0352 8579.2041 c -7861.0352 8580.0146 -7862.293 8580.6709 -7863.8457 8580.6709 c b -7868.0679 8552.4092 m -7868.811 8552.4092 -7869.4121 8551.6982 -7869.4121 8550.8213 c -7869.4121 8549.9443 -7868.811 8549.2334 -7868.0679 8549.2334 c -7867.3262 8549.2334 -7866.7241 8549.9443 -7866.7241 8550.8213 c -7866.7241 8551.6982 -7867.3262 8552.4092 -7868.0679 8552.4092 c b -7869.6758 8573.9678 m -7868.7983 8573.6201 -7868.5298 8572.2188 -7869.0762 8570.8379 c -7869.6226 8569.457 -7870.7778 8568.6201 -7871.6558 8568.9678 c -7872.5342 8569.3164 -7872.8032 8570.7178 -7872.2568 8572.0967 c -7871.7104 8573.4775 -7870.5552 8574.3154 -7869.6758 8573.9678 c b U U 0 Ap 0 0 0 1 k -7859.1318 8552.6553 m -7859.1318 8585.3145 l F u -7843.3906 8538.5303 m -7844.0815 8537.8369 -7847.019 8538.7021 Y -7848.229 8538.874 -7848.0562 8541.2939 Y -7847.019 8543.3682 -7847.7104 8543.1943 Y -7848.2998 8543.1943 -7849.855 8543.1143 -7850.7822 8543.0635 C -7851.1226 8541.6689 -7852.6128 8540.4756 -7854.7217 8539.7695 C -7852.7578 8536.4775 -7854.5176 8535.7949 -7856.2935 8535.79 C -7856.3096 8535.7021 -7856.332 8535.6162 -7856.3599 8535.5332 C -7854.1089 8535.5791 -7853.6392 8533.2588 Y -7853.4048 8533.0635 -7853.1606 8532.7861 -7852.9238 8532.4756 C -7853.1416 8532.6475 -7853.2944 8532.7393 Y -7854.2583 8532.7393 -7855.8774 8534.4941 -7856.4966 8535.207 C -7856.9194 8534.4434 -7857.853 8533.9111 -7858.9434 8533.9111 c -7860.0698 8533.9111 -7861.0322 8534.4795 -7861.4312 8535.2852 C -7861.9985 8534.624 -7863.6968 8532.751 -7864.6943 8532.751 C -7864.8462 8532.6572 -7865.064 8532.4854 V -7864.8281 8532.7939 -7864.583 8533.0732 -7864.3481 8533.2686 C -7863.8638 8535.6563 -7861.5254 8535.5342 V -7861.5449 8535.5889 -7861.5674 8535.6436 -7861.5806 8535.7021 C -7864.9238 8535.6924 -7863.937 8538.3174 -7863.2104 8539.6602 C -7865.5918 8540.376 -7867.2646 8541.7012 -7867.5239 8543.25 C -7868.4473 8543.2998 -7869.6729 8543.3584 -7870.1802 8543.3584 C -7870.8726 8543.5313 -7869.835 8541.458 V -7869.6626 8539.0391 -7870.8726 8538.8662 V -7873.8096 8538.002 -7874.501 8538.6934 V -7875.1919 8539.5566 -7876.0562 8538.3467 V -7875.1919 8540.0752 -7873.291 8539.5566 V -7870.6982 8538.8662 -7871.3906 8540.5938 V -7871.9087 8544.0498 -7870.1802 8544.7402 V -7868.0342 8545.8545 -7866.2822 8546.0889 V -7865.9087 8546.4141 -7865.4639 8546.7109 -7864.958 8546.9766 C -7867.5562 8547.0469 -7870.2246 8547.9209 -7871.0752 8550.9561 C -7871.5151 8552.2432 -7872.0518 8554.2432 V -7873.1025 8554.8252 -7874.3022 8556.0078 -7875.541 8558.2627 C -7876.394 8561.4502 -7877.167 8556.7129 V -7878.3975 8553.6494 -7879.6504 8553.5381 V -7878.4702 8555.2871 -7878.9038 8556.416 V -7877.2998 8560.917 -7875.6138 8559.8994 V -7874.0986 8559.2197 -7872.688 8556.8154 V -7873.0698 8558.4971 -7873.4326 8560.417 -7873.6743 8562.3906 C -7874.4888 8562.3975 L -7876.3506 8561.4795 -7876.3262 8564.959 V -7877.1226 8568.9453 -7876.3594 8571.6826 V -7875.647 8574.1504 -7878.1274 8572.9307 V -7879.2842 8573.3242 -7879.9839 8572.7881 V -7882.3882 8571.4131 -7884 8573.124 V -7882.147 8572.8799 -7881.4482 8573.417 V -7879.9785 8573.5615 -7879.897 8574.1787 V -7876.9561 8574.8555 -7876.188 8574.0771 V -7874.417 8573.2139 -7875.1304 8570.3604 V -7875.8799 8562.4814 -7874.3198 8564.4053 V -7874.1182 8564.4219 -7873.8784 8564.5176 V -7874.1519 8568.4326 -7873.8018 8572.3252 -7871.9961 8574.8516 C -7875.4536 8567.333 -7870.2974 8552.3037 Y -7868.9609 8547.5303 -7863.127 8548.1016 -7860.145 8548.7344 C -7860.0718 8550.1299 -7859.8374 8551.9492 -7859.1318 8552.6553 C -7858.2134 8550.6963 -7858.2358 8549.0732 V -7857.0762 8548.7217 -7850.2817 8546.8447 -7847.4487 8550.3369 C -7848.4312 8547.8135 -7850.8262 8547.0186 -7853.2007 8546.9189 C -7852.667 8546.6318 -7852.2041 8546.3047 -7851.8257 8545.9502 C -7850.041 8545.7861 -7847.7104 8544.5771 Y -7845.9814 8543.8857 -7846.5015 8540.4307 Y -7847.1919 8538.7021 -7844.5991 8539.3936 Y -7842.7002 8539.9111 -7841.835 8538.1836 Y -7842.7002 8539.3936 -7843.3906 8538.5303 Y f -7837.9082 8572.9521 m -7838.6074 8573.4893 -7839.7632 8573.0938 Y -7842.2446 8574.3135 -7841.5327 8571.8467 Y -7840.769 8569.1104 -7841.564 8565.1221 Y -7841.541 8561.6445 -7843.4014 8562.5596 Y -7844.0342 8562.5557 L -7844.3198 8560.6123 -7844.7046 8558.7549 -7845.0898 8557.1699 C -7843.7129 8559.4199 -7842.2778 8560.0635 Y -7840.5913 8561.082 -7838.9878 8556.5791 Y -7839.4214 8555.4502 -7838.2417 8553.7021 Y -7839.4937 8553.8125 -7840.7246 8556.876 Y -7841.4976 8561.6152 -7842.3511 8558.4268 Y -7843.5776 8556.1904 -7844.769 8555.0098 -7845.814 8554.4229 C -7846.2026 8553.0635 -7846.4858 8552.2393 Y -7846.7002 8551.4727 -7847.0337 8550.8486 -7847.4487 8550.3369 C -7847.3799 8550.5127 -7847.3174 8550.6982 -7847.2632 8550.8916 C -7841.3022 8568.2588 -7846.4858 8574.9971 V -7853.2246 8584.5869 -7857.3721 8584.5869 V -7860.9663 8584.6514 L -7865.1138 8584.6514 -7871.853 8575.0615 Y -7871.9038 8574.9961 -7871.9463 8574.9219 -7871.9961 8574.8516 C -7871.7378 8575.4141 -7871.437 8575.9404 -7871.0752 8576.4092 C -7864.3359 8586 -7860.189 8586 V -7856.5942 8585.9346 L -7852.4482 8585.9346 -7845.709 8576.3447 Y -7843.5801 8573.5771 -7843.3306 8569.0176 -7843.7769 8564.6055 C -7843.6553 8564.5752 -7843.5698 8564.5684 Y -7842.0112 8562.6475 -7842.7598 8570.5244 Y -7843.4746 8573.3789 -7841.7026 8574.2402 Y -7840.9351 8575.0186 -7837.9946 8574.3428 Y -7837.9136 8573.7256 -7836.4434 8573.5811 Y -7835.7446 8573.0449 -7833.8921 8573.2881 Y -7835.5024 8571.5771 -7837.9082 8572.9521 Y f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 34) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.0254 8586.0264 m -7828.0542 8586.0264 L -7828.0542 8524.5342 L -7884.0254 8524.5342 L -7884.0254 8586.0264 L n u u 0 O 0.0745 0.9 0.9019 0.18 k 0 R 0 0 0 1 K 1 J 1 j 0.0518 w -7857.5991 8562.7217 m -7857.3594 8573.5215 -7862.8794 8583.8398 v -7862.4009 8586 -7860.959 8586 v -7861.2002 8582.6406 -7860.2393 8582.1611 v -7855.9199 8570.1602 -7856.6382 8562.2402 v -7857.5991 8562.7217 l b -7857.5991 8562.7217 m -7859.2793 8568 -7871.0391 8569.2012 v -7875.3594 8569.6807 -7875.5991 8571.1211 v -7869.1206 8561.5195 -7868.1602 8561.7607 v -7881.3594 8556.001 -7884 8550.7197 v -7878.959 8553.6006 -7875.5991 8551.4404 v -7867.6802 8551.2012 -7862.6406 8553.3613 v -7858.8008 8555.2813 -7866.7202 8539.2012 v -7862.8794 8550.9609 -7859.2793 8524.5605 v -7858.3198 8529.8408 -7856.8799 8531.2813 v -7850.8799 8538.9609 -7851.8398 8541.1211 v -7852.3198 8544.9609 -7847.7598 8538.7207 v -7848 8548.3213 -7850.4009 8551.6807 v -7852.5591 8555.2813 -7846.5591 8553.1211 v -7840.5591 8551.2012 -7835.2793 8552.8809 v -7829.7598 8554.3203 -7828.0801 8551.4404 v -7839.8398 8563.9209 -7845.5991 8563.6807 v -7843.9194 8567.2813 l -7841.519 8572.0811 -7842 8573.2813 v -7857.2681 8563.8828 -7857.5991 8562.7217 v b -7857.5991 8562.7217 m -7854.959 8544.2402 -7857.5991 8536.5605 v -7859.998 8526.001 -7859.2793 8524.5605 v S -7856.1602 8551.4404 m -7850.1602 8546.6406 -7848.959 8541.3604 v S -7856.1602 8550.7197 m -7865.0391 8543.041 -7866.7202 8539.2012 v S -7828.0801 8551.4404 m -7829.2793 8553.6006 -7857.3594 8561.7607 y -7862.4009 8556.2422 -7873.9199 8553.8408 v -7881.5986 8552.8809 -7884 8550.7197 v S -7874.6382 8569.6807 m -7863.1191 8560.5615 -7857.3594 8561.7607 y -7843.1992 8568 -7842 8573.2813 v S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 36) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.8496 8585.9961 m -7833.96 8585.9961 L -7833.96 8534.9258 L -7883.8496 8534.9258 L -7883.8496 8585.9961 L n u 0 O 0.025 0.1 0.475 0 k -7862.1504 8553.9043 m -7864.4766 8552.8125 -7866.6914 8552.4434 -7868.373 8552.9238 c -7869.0518 8553.1172 -7869.645 8553.4473 -7870.123 8553.9238 c -7870.6006 8554.4023 -7870.9297 8554.9951 -7871.123 8555.6729 c -7872.0088 8558.7715 -7870.0103 8563.6777 -7865.9233 8567.7666 c -7861.834 8571.8535 -7856.9297 8573.8516 -7853.8286 8572.9668 c -7853.1519 8572.7715 -7852.5586 8572.4424 -7852.0806 8571.9658 c -7851.603 8571.4883 -7851.2754 8570.8955 -7851.082 8570.2168 c -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.582 8561.21 -7854.791 8559.6133 -7856.2793 8558.123 c -7858.1504 8556.2539 -7860.1914 8554.8242 -7862.1504 8553.9043 c f u 0.0035 0.014 0.0665 0 k -7861.2183 8552.9727 m -7863.8306 8552.0215 -7866.3975 8551.9688 -7868.373 8552.9238 C -7866.6914 8552.4434 -7864.4766 8552.8125 -7862.1504 8553.9043 c -7861.6191 8554.1543 -7861.0806 8554.4434 -7860.543 8554.7676 C -7858.8984 8554.0537 L -7859.667 8553.6172 -7860.4434 8553.2539 -7861.2183 8552.9727 c f 0.015 0.06 0.285 0 k -7858.8984 8554.0537 m -7860.543 8554.7676 L -7859.0962 8555.6348 -7857.6426 8556.7607 -7856.2793 8558.123 c -7856.1538 8558.25 -7856.0327 8558.3779 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7856.3706 8555.7236 -7857.6191 8554.7813 -7858.8984 8554.0537 C f U u 0.039 0.156 0.741 0 k -7849.687 8541.4043 m -7849.9746 8541.6914 -7861.2183 8552.9727 Y -7860.4434 8553.2539 -7859.667 8553.6172 -7858.8984 8554.0537 C -7845.4146 8540.5703 L -7847.061 8540.0996 -7848.6406 8540.3555 -7849.687 8541.4043 c f 0.025 0.1 0.475 0 k -7845.4146 8540.5703 m -7858.8984 8554.0537 L -7857.584 8554.8027 -7856.2969 8555.7754 -7855.1143 8556.957 c -7855.084 8556.9863 -7855.0586 8557.0156 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7841.5264 8543.1328 -7841.7202 8542.9141 -7841.9302 8542.7012 c -7843.0103 8541.623 -7844.2305 8540.9082 -7845.4146 8540.5703 C f U u 0.0115 0.046 0.2185 0 k -7835.9346 8550.3926 m -7833.5337 8547.9893 -7833.335 8544.0898 -7835.1382 8540.6973 C -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f 0.015 0.06 0.285 0 k -7843.5337 8535.5957 m -7842.582 8534.9258 L -7845.2046 8534.3516 -7847.8306 8534.9141 -7849.6206 8536.7061 c -7848.1719 8535.2578 -7845.9082 8534.9307 -7843.5337 8535.5957 C f 0.0295 0.118 0.5605 0 k -7843.5337 8535.5957 m -7845.9082 8534.9307 -7848.1719 8535.2578 -7849.6206 8536.7061 c -7851.019 8538.1055 -7851.3706 8540.2637 -7850.7954 8542.5469 C -7848.8672 8539.5449 -7845.4082 8540.5537 V -7843.585 8535.6309 L -7843.5337 8535.5957 L f *u 0.048 0.192 0.912 0 k 1 D -7835.9346 8550.3926 m -7837.2817 8551.7383 -7839.332 8552.1133 -7841.5234 8551.627 C -7851.6714 8561.7734 L -7851.7695 8561.5684 -7851.7695 8561.5684 -7851.6714 8561.7734 c -7850.2246 8564.8145 -7849.9702 8567.916 -7851.082 8570.2168 C -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.5054 8561.3438 -7854.5918 8559.8848 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7855.1816 8556.8945 -7855.1465 8556.9238 -7855.1143 8556.957 c -7855.084 8556.9883 -7855.0566 8557.0176 -7855.0273 8557.0469 c -7855.0278 8557.0469 -7855.0278 8557.0469 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7836.3262 8541.1289 L -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f *U 0.0215 0.086 0.4085 0 k 0 D -7842.582 8534.9258 m -7843.5337 8535.5957 L -7841.6846 8536.1113 -7839.7656 8537.2285 -7838.1138 8538.8828 c -7837.4063 8539.5889 -7836.7998 8540.3418 -7836.2954 8541.1182 C -7835.1382 8540.6973 L -7835.6553 8539.7246 -7836.3374 8538.793 -7837.1802 8537.9512 c -7838.7695 8536.3594 -7840.6758 8535.3428 -7842.582 8534.9258 C f 0.0205 0.082 0.3895 0 k -7836.2954 8541.1182 m -7836.7998 8540.3418 -7837.4063 8539.5889 -7838.1138 8538.8828 c -7839.7656 8537.2285 -7841.6846 8536.1113 -7843.5337 8535.5957 C -7843.585 8535.6309 L -7845.4082 8540.5537 L -7844.2114 8540.9219 -7842.9878 8541.6436 -7841.9302 8542.7012 c -7841.7202 8542.9141 -7841.5264 8543.1328 -7841.3408 8543.3574 C -7836.3262 8541.1289 L -7836.2954 8541.1182 L f U u 0.445 0.356 0.267 0 k -7883.8496 8585.9961 m -7861.957 8562.9688 L -7862.2007 8562.6494 -7862.5752 8562.6133 -7862.8887 8562.6592 C -7867.1802 8567.2891 -7878.3145 8579.4561 -7882.7266 8584.2793 C -7883.5649 8585.3516 -7884 8585.9932 -7883.8496 8585.9961 C f 0.15 0.12 0.09 0 k -7883.834 8585.9961 m -7882.6606 8585.7031 -7861.6934 8564.0029 Y -7861.6934 8563.502 -7861.7993 8563.1758 -7861.957 8562.9688 C -7883.8496 8585.9961 L -7883.8442 8585.9961 -7883.8418 8586 -7883.834 8585.9961 c f 0.2 0.16 0.12 0 k -7882.7266 8584.2793 m -7878.3145 8579.4561 -7867.1802 8567.2891 -7862.8887 8562.6592 C -7863.2002 8562.7041 -7863.4526 8562.8301 Y -7864.603 8563.1328 -7878.5742 8578.9619 -7882.7266 8584.2793 C f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 37) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7882.9502 8585.2324 m -7833.0391 8585.2324 L -7833.0391 8521.1152 L -7882.9502 8521.1152 L -7882.9502 8585.2324 L n u 0 O 0 0 0 1 k 0 R 0 0 0 1 K 0 w -7833.2358 8521.1152 m -7833.6064 8521.248 -7833.9858 8521.2832 -7834.3833 8521.2031 c -7834.4863 8521.168 l -7834.5254 8521.1602 -7834.5703 8521.1787 -7834.6025 8521.1992 c -7834.9434 8521.3926 l -7838.7129 8523.2959 -7842.0962 8525.8965 -7844.5 8529.4473 c -7845.9634 8531.5918 -7847.123 8533.8789 -7848.7993 8535.8564 c -7849.1729 8536.209 -7849.1758 8536.7725 -7848.834 8537.1309 c -7848.4951 8537.501 -7847.918 8537.5078 -7847.561 8537.165 c -7847.4038 8537.21 l -7847.2642 8537.1289 -7847.0742 8537.0703 -7847.0234 8536.957 c -7845.853 8534.2031 -7845.1895 8531.5137 -7843.4336 8529.1387 c -7841.1719 8526.0947 -7838.1777 8523.9941 -7835.0298 8522.0234 c -7834.3672 8521.6055 L -7834.4966 8521.6348 L -7833.7695 8521.6426 l -7833.791 8521.6113 -7833.8008 8521.5957 -7833.8223 8521.5645 C -7833.6064 8521.5234 -7833.377 8521.4746 -7833.1626 8521.4336 c -7833.0762 8521.4238 -7833.0186 8521.3389 -7833.0391 8521.2383 c -7833.0503 8521.1523 -7833.1382 8521.1084 -7833.2358 8521.1152 c -7833.2358 8521.1152 l b -7849.2222 8534.9951 m -7849.5742 8534.8066 -7849.9658 8534.6719 -7850.248 8534.3887 c -7856.4521 8528.1719 -7866.6802 8527.2734 -7874.0488 8533.6855 C -7874.1582 8533.7813 -7874.1582 8533.957 -7874.063 8534.0645 C -7871.0527 8532.9434 -7862.8838 8534.375 -7859.3223 8537.4121 C -7859.2534 8537.4668 -7859.1465 8537.4531 -7859.1055 8537.3711 C -7859.0503 8537.3047 -7859.0664 8537.1953 -7859.1328 8537.1563 C -7862.5625 8534.0859 -7867.0674 8532.29 -7871.6729 8532.748 C -7868.8535 8531.1855 -7865.6313 8530.4941 -7862.3984 8530.6885 c -7857.7144 8530.9717 -7853.4634 8533.1191 -7849.3711 8535.2793 c -7849.291 8535.3193 -7849.1978 8535.293 -7849.1553 8535.2109 C -7849.1016 8535.1309 -7849.1426 8535.0352 -7849.2222 8534.9951 c b -7858.647 8536.3359 m -7860.2266 8540.3613 -7862.3911 8544.3203 -7865.8018 8547.0762 c -7865.9648 8547.2119 -7865.9946 8547.4492 -7865.8711 8547.6055 c -7865.7344 8547.7676 -7865.5049 8547.7793 -7865.3481 8547.6563 c -7861.123 8545.5967 -7858.1904 8541.1309 -7858.1626 8536.4014 c -7858.1626 8536.4014 l -7858.1328 8536.2676 -7858.2354 8536.1348 -7858.3633 8536.1221 c -7858.5039 8536.1055 -7858.6318 8536.1973 -7858.647 8536.3359 c -7858.647 8536.3359 l b -7852.9414 8541.0176 m -7853.042 8541.1816 -7853.1152 8541.3838 -7853.2617 8541.4824 c -7856.0806 8543.3906 -7858.9785 8544.6309 -7861.8848 8546.1328 c -7862.0503 8546.209 -7862.1118 8546.418 -7862.0313 8546.5703 c -7861.9512 8546.7227 -7861.7559 8546.7793 -7861.5898 8546.7041 c -7858.439 8545.3232 -7854.313 8544.5 -7852.6729 8541.1797 c -7852.6289 8541.1113 -7852.6455 8541.0146 -7852.7266 8540.9648 c -7852.7959 8540.9199 -7852.897 8540.9492 -7852.9414 8541.0176 c -7852.9414 8541.0176 l b -7852.6602 8541.918 m -7852.4438 8542.4297 -7852.1431 8542.8896 -7852.0503 8543.4355 c -7851.2183 8548.2773 -7851.1152 8553.042 -7852.248 8557.6875 c -7852.248 8557.6875 l -7852.3418 8557.9531 -7852.2114 8558.2441 -7851.9438 8558.3389 c -7851.6777 8558.4336 -7851.3882 8558.3125 -7851.2935 8558.0479 c -7849.293 8552.8115 -7849.897 8546.7373 -7852.3711 8541.7832 c -7852.4063 8541.7002 -7852.498 8541.6689 -7852.582 8541.6914 c -7852.6641 8541.7275 -7852.6978 8541.835 -7852.6602 8541.918 c -7852.6602 8541.918 l b -7851.5352 8557.5938 m -7848.8984 8555.2275 -7846.6816 8552.252 -7845.853 8548.7363 c -7845.853 8548.7363 l -7845.7246 8548.1816 -7846.0742 8547.623 -7846.6416 8547.4902 c -7847.1992 8547.375 -7847.7578 8547.7246 -7847.8862 8548.2793 c -7848.5649 8551.5313 -7849.8711 8554.6729 -7851.7954 8557.3867 c -7851.7954 8557.3867 l -7851.8462 8557.4551 -7851.834 8557.5576 -7851.7695 8557.6201 c -7851.6992 8557.6699 -7851.5977 8557.6582 -7851.5352 8557.5938 c -7851.5352 8557.5938 l b -7836.3711 8550.1826 m -7837.7114 8545.8301 -7840.2598 8542.0693 -7843.689 8539.1533 C -7843.729 8539.0723 -7843.8242 8539.0322 -7843.9038 8539.0859 C -7843.9863 8539.127 -7844.0122 8539.2207 -7843.9722 8539.3018 C -7843.957 8539.7891 -7843.7144 8540.2334 -7843.4458 8540.5313 c -7838.4063 8546.1621 -7834.9902 8554.7197 -7837.3433 8561.9551 C -7837.0762 8556.4512 -7838.7241 8550.3008 -7842.1362 8545.6738 c -7843.1606 8544.2695 -7844.7422 8544.1211 -7846.3081 8544.2031 C -7846.4023 8544.1895 -7846.4834 8544.2432 -7846.4961 8544.3369 c -7846.5098 8544.4189 -7846.4551 8544.5137 -7846.3623 8544.5254 C -7843.1479 8545.7695 -7841.4878 8549.2246 -7840.084 8552.1943 c -7838.415 8555.7441 -7837.7017 8559.6387 -7838.0054 8563.5 C -7838.0454 8563.6777 -7838.1138 8565.3975 -7837.9775 8565.4102 C -7837.8306 8565.4395 -7837.709 8565.3438 -7837.6802 8565.1943 C -7837.645 8565.0449 -7834.6426 8555.7988 -7836.3711 8550.1826 c b -7844.4863 8537.4912 m -7843.3945 8533.6211 -7841.1094 8530.251 -7838.4824 8527.2383 c -7838.3306 8527.1045 -7838.3145 8526.8867 -7838.4502 8526.7354 c -7838.5752 8526.6006 -7838.8047 8526.582 -7838.957 8526.7178 c -7842.3306 8529.332 -7843.4487 8533.541 -7844.7954 8537.375 c -7844.7954 8537.375 l -7844.8262 8537.4648 -7844.7754 8537.5586 -7844.6982 8537.5869 c -7844.6094 8537.6191 -7844.5166 8537.5684 -7844.4863 8537.4912 c -7844.4863 8537.4912 l b -7838.5313 8562.1094 m -7838.5991 8562.0566 -7838.707 8562.083 -7838.748 8562.1504 C -7838.9634 8562.4746 -7840.6914 8564.5195 -7841.3926 8565.1406 c -7846.1719 8569.3945 -7849.5137 8573.9609 -7857.5391 8577.7227 c -7864.4512 8580.9639 -7867.1113 8583.5957 -7874.3862 8581.8262 c -7877.687 8581.0293 -7879.0313 8580.5313 -7880.4351 8575.4551 C -7881.9473 8569.2988 -7880.8672 8571.7832 -7881.084 8564.4385 c -7881.2222 8559.6973 -7884 8548.4551 -7871.5254 8534.2598 C -7871.4199 8534.1484 -7871.4336 8533.9961 -7871.5337 8533.9072 C -7871.6328 8533.8027 -7871.7959 8533.8164 -7871.8862 8533.916 C -7877.5786 8538.7168 -7881.0234 8545.6582 -7882.3145 8552.9424 c -7883.2871 8558.4668 -7882.9199 8563.25 -7882.666 8569.6367 c -7882.5688 8572.0938 -7883.6855 8579.0723 -7878.9102 8583.0625 c -7875.3926 8586 -7870.3911 8585.5469 -7866.3545 8584.1563 c -7860.6992 8582.2119 -7855.9727 8579.1465 -7850.8711 8575.6094 c -7847.2656 8573.125 -7839.2881 8563.2852 -7838.4785 8562.3262 C -7838.4351 8562.2588 -7838.4502 8562.1504 -7838.5313 8562.1094 C b -7873.0503 8549.3057 m -7872.168 8548.5029 -7871.7017 8549.8457 -7871.4297 8550.6016 c -7871.1626 8551.3574 -7870.189 8551.25 -7870.5127 8551.5732 c -7870.8369 8551.8975 -7870.8369 8551.9521 -7871.3232 8551.5195 c -7871.8086 8551.0879 -7871.8086 8551.7363 -7872.5649 8551.25 c -7873.3198 8550.7627 -7873.645 8549.8457 -7873.0503 8549.3057 c b -7865.6519 8553.9492 m -7865.3657 8553.5918 -7864.6802 8553.5723 -7864.4648 8553.8945 c -7864.25 8554.2197 -7863.3306 8554.2734 -7863.4937 8554.5967 c -7863.6543 8554.9219 -7863.6016 8555.1387 -7864.0874 8554.9219 c -7864.5737 8554.7051 -7864.4121 8555.2998 -7864.897 8555.084 c -7865.3833 8554.8672 -7865.8687 8554.2197 -7865.6519 8553.9492 c b -7857.6074 8559.0791 m -7857.1206 8558.7559 -7855.8794 8559.5117 -7856.4727 8559.5117 c -7857.0674 8559.5117 -7856.311 8560.2676 -7856.8521 8560.4834 c -7857.3906 8560.6992 -7857.2832 8560.4297 -7857.6074 8560.6445 c -7857.9297 8560.8613 -7858.3633 8561.2393 -7858.5239 8560.4297 c -7858.6855 8559.6191 -7858.3633 8559.6191 -7857.9849 8559.3496 c -7857.6074 8559.0791 -7857.6074 8559.0791 y b -7872.2402 8559.3496 m -7871.1074 8559.2422 -7871.8633 8559.998 -7871.269 8560.4834 c -7870.6738 8560.9697 -7869.918 8561.6172 -7870.729 8561.4004 c -7871.5391 8561.1855 -7872.9961 8561.6719 -7872.9434 8560.5381 c -7872.8887 8559.4033 -7872.6328 8559.3867 -7872.2402 8559.3496 c b -7866.5703 8567.6113 m -7866.1016 8567.3438 -7866.6802 8567.7197 -7866.0303 8567.6113 c -7865.3833 8567.5039 -7864.7886 8567.6113 -7865.2207 8567.8281 c -7865.6519 8568.0439 -7866.3008 8568.1523 -7866.4634 8567.9893 c -7866.625 8567.8281 -7866.9473 8567.8281 -7866.5703 8567.6113 c b -7857.0674 8567.1797 m -7857.4785 8566.1797 -7856.0962 8566.4238 -7855.4473 8566.7461 c -7854.7998 8567.0723 -7853.8262 8566.4775 -7854.4209 8566.9102 c -7855.0137 8567.3418 -7854.7998 8566.9102 -7855.3926 8567.2334 c -7855.9873 8567.5566 -7856.6895 8568.0977 -7857.0674 8567.1797 c b -7872.6738 8573.0664 m -7872.7222 8572.0752 -7871.8086 8572.957 -7871.269 8573.0117 c -7870.729 8573.0664 -7870.0801 8573.0664 -7870.2432 8573.2813 c -7870.4038 8573.498 -7870.459 8573.498 -7871.1626 8573.7129 c -7871.8633 8573.9297 -7872.6191 8574.1445 -7872.6738 8573.0664 c b -7873.1582 8567.6113 m -7874.0664 8567.9746 -7874.293 8567.8809 -7874.5625 8568.2051 c -7874.834 8568.5293 -7875.1558 8569.2314 -7875.5352 8568.0977 c -7875.9121 8566.9629 -7875.4282 8565.7764 -7875.0479 8565.9375 c -7874.6714 8566.0996 -7874.293 8566.7461 -7873.8618 8566.9629 c -7873.4297 8567.1797 -7872.6191 8567.3945 -7873.1582 8567.6113 c b U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 41) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7803 8586 L -7803 8481 L -7884 8481 L -7884 8586 L n u u u 0 O 0 0 0 1 k -7865.8057 8498.4258 m -7866.0742 8496.6621 -7867.1602 8495.291 -7868.5239 8495.3965 c -7869.8862 8495.502 -7870.707 8497.0234 -7870.7432 8498.8066 c -7870.748 8499.0693 -7870.6743 8500.2441 -7870.6304 8500.4775 C -7870.6382 8500.582 -7870.6191 8500.6738 -7870.6104 8500.7803 c -7870.5142 8502.0254 -7869.3574 8503.3604 -7867.9414 8503.25 c -7866.5249 8503.1406 -7865.4897 8501.8613 -7865.6367 8500.4727 c -7865.644 8500.4072 -7865.6958 8499.626 -7865.707 8499.5625 C -7865.6816 8499.2852 -7865.7598 8498.7256 -7865.8057 8498.4258 c f -7876.2646 8507.7334 m -7876.9946 8515.916 -7871.5015 8515.1191 v -7868.3682 8514.0186 -7869.4414 8511.1211 v -7869.6426 8509.752 -7871.7847 8508.498 v -7872.146 8508.25 -7872.7632 8507.1016 v -7873.1294 8505.5977 -7874.5186 8505.2979 v -7876.0762 8505.251 -7876.2646 8507.7334 v f -7850.7646 8516.4971 m F -7850.0762 8514.3408 m -7850.7847 8513.1934 -7853.8848 8513.6279 Y -7854.811 8513.6885 -7855.3799 8513.1113 Y -7857.8394 8509.0918 -7861.0386 8509.8857 -7861.4082 8509.9932 C -7861.4097 8509.9863 L -7864.999 8510.6045 -7865.2666 8515.6035 V -7865.4912 8516.3828 -7866.335 8516.7695 V -7869.2695 8517.8613 -7869.3481 8519.208 V -7869.8999 8521.1152 -7867.6006 8521.7422 V -7865.6792 8522.2568 -7863.7886 8519.8945 V -7862.6113 8518.6797 -7859.5762 8517.9395 V -7859.5728 8517.9531 L -7856.3594 8517.0459 -7854.6392 8517.5889 Y -7851.8521 8518.7676 -7850.4063 8517.4014 Y -7848.6826 8515.7559 -7850.0762 8514.3408 Y f -7863.9834 8497.8789 m -7864.5854 8496.2002 -7864.2822 8494.4775 -7863.0327 8493.9229 c -7861.7842 8493.3672 -7860.3384 8494.3164 -7859.4585 8495.8672 c -7859.3286 8496.0957 -7858.8359 8497.165 -7858.7632 8497.3906 C -7858.7065 8497.4785 -7858.6792 8497.5684 -7858.6362 8497.667 c -7858.1289 8498.8086 -7858.5122 8500.5303 -7859.8105 8501.1074 c -7861.1089 8501.6855 -7862.6279 8501.0527 -7863.1582 8499.7617 c -7863.1831 8499.7002 -7863.5078 8498.9883 -7863.5298 8498.9268 C -7863.6831 8498.6963 -7863.8809 8498.166 -7863.9834 8497.8789 c f -7849.7129 8500.9316 m -7845.1802 8507.7822 -7850.3911 8509.6943 v -7853.6714 8510.2168 -7854.103 8507.1572 v -7854.5786 8505.8564 -7853.29 8503.7354 v -7853.0903 8503.3447 -7853.0938 8502.04 v -7853.4858 8500.5449 -7852.4082 8499.6182 v -7851.0591 8498.8359 -7849.7129 8500.9316 v f U u -7824.7358 8550.1074 m -7824.3687 8548.3623 -7824.9048 8546.6963 -7826.2183 8546.3164 c -7827.5322 8545.9375 -7828.8345 8547.0752 -7829.4937 8548.7324 c -7829.5903 8548.9775 -7829.9326 8550.1025 -7829.9746 8550.3369 C -7830.0176 8550.4326 -7830.0322 8550.5244 -7830.0625 8550.6279 c -7830.4087 8551.8271 -7829.7935 8553.4805 -7828.4282 8553.875 c -7827.063 8554.2695 -7825.645 8553.4365 -7825.2969 8552.085 c -7825.2793 8552.0205 -7825.0552 8551.2705 -7825.0425 8551.207 C -7824.9214 8550.9551 -7824.7983 8550.4053 -7824.7358 8550.1074 c f -7838.2705 8554.6172 m -7841.8242 8562.0244 -7836.3999 8563.2061 v -7833.0801 8563.2754 -7833.0688 8560.1846 v -7832.7778 8558.8311 -7834.3433 8556.9072 v -7834.5942 8556.5459 -7834.7695 8555.2539 v -7834.5854 8553.7188 -7835.7793 8552.9492 v -7837.2222 8552.3594 -7838.2705 8554.6172 v f -7817.4648 8571.7695 m F -7816.063 8569.9912 m -7816.3247 8568.6689 -7819.3799 8567.9883 Y -7820.27 8567.7197 -7820.5986 8566.9795 Y -7821.4922 8562.3535 -7824.7666 8561.9746 -7825.1494 8561.9453 C -7825.1494 8561.9395 L -7828.7271 8561.2588 -7830.731 8565.8467 V -7831.2153 8566.4961 -7832.1416 8566.5625 V -7835.272 8566.5557 -7835.8169 8567.7891 V -7837.0039 8569.3809 -7835.0713 8570.7764 V -7833.4526 8571.9316 -7830.853 8570.3818 V -7829.3242 8569.6582 -7826.2222 8570.0293 V -7826.2231 8570.042 L -7822.896 8570.3213 -7821.4766 8571.4326 Y -7819.2793 8573.5146 -7817.4463 8572.7432 Y -7815.2554 8571.8057 -7816.063 8569.9912 Y f -7822.8374 8550.2354 m -7822.813 8548.4512 -7821.9258 8546.9453 -7820.5601 8546.8633 c -7819.1943 8546.7803 -7818.1743 8548.1768 -7817.895 8549.9385 c -7817.854 8550.1973 -7817.7666 8551.3711 -7817.7778 8551.6094 C -7817.7559 8551.7109 -7817.7617 8551.8037 -7817.7559 8551.9121 c -7817.6807 8553.1592 -7818.644 8554.6367 -7820.0625 8554.7217 c -7821.4814 8554.8066 -7822.6826 8553.6826 -7822.7246 8552.2871 c -7822.7271 8552.2217 -7822.7822 8551.4404 -7822.7798 8551.375 C -7822.8433 8551.1045 -7822.8423 8550.54 -7822.8374 8550.2354 c f -7811.0186 8557.5625 m -7809.1777 8565.5684 -7814.7271 8565.5303 v -7817.9834 8564.8691 -7817.3154 8561.8516 v -7817.3032 8560.4668 -7815.353 8558.9326 v -7815.0278 8558.6377 -7814.5742 8557.415 v -7814.417 8555.876 -7813.083 8555.3877 v -7811.5454 8555.1279 -7811.0186 8557.5625 v f U U 1 Ap -7884 8586 m -7884 8481 L -7803 8481 L -7803 8586 L -7884 8586 L n U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 42) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 45) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8543.918 m -7885 8587 L -7798.2217 8587 L -7798.2217 8543.918 L -7885 8543.918 L n u u 0 O 0 0 0 1 k -7825.2217 8573.2363 m -7825.2217 8581.0742 L -7813.2217 8574.1445 L -7801.2217 8567.2168 L -7813.2217 8560.2891 L -7825.2217 8553.3613 L -7825.2217 8561.4824 L -7883.9351 8547.7168 L -7870.9878 8566.8027 L -7885 8587 L -7825.2217 8573.2363 L f 0 1 1 0.1 k 0 R 0 0 0 1 K -7823.2217 8570.2363 m -7823.2217 8578.0742 L -7811.2217 8571.1445 L -7799.2217 8564.2168 L -7811.2217 8557.2891 L -7823.2217 8550.3613 L -7823.2217 8558.4824 L -7881.9351 8544.7168 L -7867.2754 8564.3594 L -7881.9351 8584 L -7823.2217 8570.2363 L b U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 50) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7756.877 8586 L -7756.877 8538.415 L -7884 8538.415 L -7884 8586 L n u *u 0 O 0.9529 0.949 0.1961 0.0745 k -7857.793 8570.417 m -7857.8232 8570.2676 L -7859.9849 8564.3643 -7860.9438 8561.6377 -7861.2754 8560.2891 c -7861.3657 8560.2891 L -7861.6953 8561.6074 -7862.7754 8564.335 -7864.9673 8570.2676 c -7864.9966 8570.417 L -7857.793 8570.417 l f 1 D -7868.1182 8578.9678 m -7869.6191 8582.5371 -7870.3994 8584.709 -7868.1182 8584.917 c -7868.1182 8585.9678 L -7870.6992 8585.9375 -7873.5806 8585.917 -7876.3418 8585.917 c -7880.0649 8585.917 -7882.5273 8585.9375 -7884 8585.9678 c -7884 8584.917 L -7882.1064 8584.709 -7881.0542 8582.5674 -7873.5513 8565.5029 c -7861.6953 8538.415 L -7859.8638 8538.415 L -7848.1582 8565.5029 L -7840.8047 8582.5078 -7839.7246 8584.709 -7837.8887 8584.917 c -7837.8887 8585.9678 L -7839.5142 8585.9375 -7841.916 8585.917 -7845.5767 8585.917 c -7848.5488 8585.917 -7851.6694 8585.9375 -7854.7026 8585.9678 c -7854.7026 8584.917 L -7852.481 8584.709 -7853.3218 8582.5078 -7854.7617 8578.9678 C -7868.1182 8578.9678 l f *U *u 0 D -7813.0762 8554.0811 m -7813.0762 8550.4717 -7815.3535 8548.0947 -7819.1294 8548.0947 c -7820.2383 8548.0947 -7821.0767 8548.2158 -7821.5273 8548.2451 c -7821.5273 8560.5479 L -7820.8672 8560.6084 -7820.208 8560.6084 -7819.729 8560.6084 c -7818.2002 8560.6084 -7816.7026 8560.127 -7815.6841 8559.4053 c -7814.3945 8558.5332 -7813.0762 8556.7881 -7813.0762 8554.1416 C -7813.0762 8554.0811 l f 1 D -7832.0806 8558.3926 m -7832.0806 8542.6445 -7832.0806 8540.4287 -7834.542 8540.2783 c -7834.542 8539.3184 L -7833.042 8539.2588 -7830.3174 8539.1992 -7827.5664 8539.1689 c -7825.6538 8539.1084 -7822.3945 8539.0186 -7820.1479 8538.9775 c -7816.582 8538.9775 -7813.585 8539.4258 -7811.0049 8540.2627 c -7806.353 8541.8477 -7801.9702 8545.8525 -7801.9702 8553.6602 c -7801.9702 8558.7432 -7804.4014 8562.3193 -7806.5034 8564.0605 c -7807.583 8565.0215 -7808.8135 8565.832 -7809.7744 8566.3125 c -7809.7744 8566.4629 L -7807.5234 8569.4912 -7805.6025 8572.0625 -7799.3906 8580.6426 c -7797.5 8583.0645 -7795.9102 8584.7383 -7794.7402 8584.9775 c -7794.7402 8586 L -7796.6602 8586 -7799 8585.8848 -7801.1294 8585.8848 c -7803.3511 8585.8848 -7804.8521 8586 -7806.4424 8586 c -7807.6729 8586 -7808.7241 8585.9404 -7809.5039 8585.2725 c -7813.0151 8579.8477 -7816.9121 8573.7559 -7820.1182 8568.7139 c -7820.5078 8568.7139 -7820.957 8568.7139 -7821.5273 8568.7139 c -7821.5273 8571.2852 L -7821.5273 8582.5264 -7821.437 8584.7686 -7819.1895 8584.9775 c -7819.1895 8585.9697 L -7820.6279 8585.9404 -7823.9194 8585.915 -7826.6992 8585.915 c -7829.9287 8585.915 -7832.8921 8585.9404 -7834.5122 8585.9697 c -7834.5122 8584.9775 L -7832.0518 8584.7686 -7832.0806 8582.5264 -7832.0806 8565.5918 C -7832.0806 8558.3926 l f *U *u 0 D -7781.4561 8565.5928 m -7781.4561 8582.4941 -7781.4561 8584.6484 -7784.2832 8584.9775 C -7784.2832 8585.9697 l -7782.3887 8585.9404 -7779.0542 8585.915 -7775.7822 8585.915 c -7772.6294 8585.915 -7769.5688 8585.9404 -7767.2881 8585.9697 C -7767.2881 8584.9775 l -7770.2578 8584.9775 -7770.2881 8582.5244 -7770.2881 8565.5928 C -7770.2881 8548.1514 L -7762.8193 8548.1514 l -7759.999 8548.1514 -7758.5298 8548.96 -7757.8994 8551.2627 C -7756.9072 8551.2627 l -7756.9072 8546.4697 -7756.877 8542.415 -7756.877 8539.1709 c -7761.3486 8539.2012 -7766.748 8539.2314 -7772.0601 8539.2314 C -7779.7446 8539.2314 l -7784.5537 8539.2314 -7789.9966 8539.2012 -7794.9614 8539.1709 c -7794.9614 8542.3848 -7794.9326 8546.4697 -7794.9326 8551.2627 C -7793.9072 8551.2627 l -7793.3657 8549.1094 -7791.771 8548.1514 -7788.9438 8548.1514 C -7781.4561 8548.1514 l -7781.4561 8565.5928 L f *U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 62) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8569.9043 m -7846.7305 8561.3408 L -7885 8561.3408 L -7885 8569.9043 L -7846.7305 8569.9043 L f -7846.7305 8573.0967 m -7846.7305 8572.4229 L -7885 8572.4229 L -7885 8573.0967 L -7846.7305 8573.0967 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 63) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8565.8262 m -7846.7305 8574.3896 L -7859.3408 8574.3896 L -7859.3408 8587 L -7867.9038 8587 L -7867.9063 8565.8262 L -7867.9038 8565.8262 L -7867.9038 8565.8252 L -7846.7305 8565.8262 L f -7846.7305 8563.3076 m -7870.4233 8563.3076 L -7870.4233 8587 L -7871.0967 8587 L -7871.0977 8562.6328 L -7846.7305 8562.6328 L -7846.7305 8563.3076 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 64) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8586.999 m -7885 8548.7285 L -7846.7305 8548.7285 L -7846.7305 8586.999 L -7885 8586.999 L n 0 O 1 0.14 0.09 0 k -7846.7305 8561.3389 m -7872.3896 8561.3389 L -7872.3896 8586.999 L -7863.8262 8587 L -7863.8262 8569.9033 L -7846.7305 8569.9033 L -7846.7305 8561.3389 L f -7846.7305 8572.4219 m -7861.3081 8572.4219 L -7861.3081 8587 L -7860.6338 8587 L -7860.6338 8573.0957 L -7846.7305 8573.0957 L -7846.7305 8572.4219 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 65) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.0625 8559.4609 m -7884.6025 8559.4609 L -7884.6025 8587 L -7857.0625 8587 L -7857.0625 8559.4609 L n 0 O 0 0.55 1 0.12 k -7856.8418 8572.7002 m -7885 8572.7002 L -7885 8573.8252 L -7856.8418 8573.8252 L -7856.8418 8572.7002 L f u 0 0.55 1 0.3 k -7883.9814 8560.5215 m -7884.4102 8562.5254 -7883.1865 8566.1514 -7880.0874 8569.251 c -7876.9878 8572.3496 -7873.3457 8573.6602 -7871.3594 8573.1455 C -7871.3594 8573.1455 L -7870.875 8571.1895 -7872.1519 8567.5117 -7875.25 8564.4141 c -7878.3457 8561.3184 -7882.0122 8560.1064 -7883.9814 8560.5215 C f 0 0.39 0.7 0.12 k -7883.9814 8585.9912 m -7884.4102 8583.9883 -7883.1865 8580.3613 -7880.0874 8577.2617 c -7876.9878 8574.1641 -7873.3457 8572.8535 -7871.3594 8573.3672 C -7871.3594 8573.3672 L -7870.875 8575.3242 -7872.1519 8579.001 -7875.25 8582.0996 c -7878.3457 8585.1953 -7882.0122 8586.4063 -7883.9814 8585.9912 C f U u 0 0.55 1 0.3 k -7870.1782 8585.9912 m -7870.6074 8583.9883 -7869.3838 8580.3613 -7866.2842 8577.2617 c -7863.1855 8574.1641 -7859.543 8572.8535 -7857.5576 8573.3672 C -7857.5566 8573.3672 L -7857.0718 8575.3242 -7858.3496 8579.001 -7861.4473 8582.0996 c -7864.543 8585.1953 -7868.209 8586.4063 -7870.1782 8585.9912 C f 0 0.39 0.7 0.12 k -7870.1782 8560.5215 m -7870.6074 8562.5254 -7869.3838 8566.1514 -7866.2842 8569.251 c -7863.1855 8572.3496 -7859.543 8573.6602 -7857.5576 8573.1455 C -7857.5566 8573.1455 L -7857.0718 8571.1895 -7858.3496 8567.5117 -7861.4473 8564.4141 c -7864.543 8561.3184 -7868.209 8560.1064 -7870.1782 8560.5215 C f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 67) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 69) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.4609 m -7885 8559.4609 L -7885 8587 L -7857.4609 8587 L -7857.4609 8559.4609 L n 0 O 0 0.55 1 0.3 k -7875.4233 8573.252 m -7874.3096 8571.5313 -7870.8809 8569.833 -7866.4966 8569.833 c -7862.1152 8569.833 -7858.6138 8571.4824 -7857.5718 8573.25 C -7857.5718 8573.25 L -7858.6138 8574.9766 -7862.1152 8576.6738 -7866.4966 8576.6738 c -7870.875 8576.6738 -7874.3242 8574.9375 -7875.4233 8573.252 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 83) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8585.9355 m -7670.4009 8585.9355 L -7670.4009 8578.1348 L -7884 8578.1348 L -7884 8585.9355 L n 0 O 0 0 0 1 k -7884 8582.0352 m -7873.9858 8584.5273 -7867.187 8585.875 -7855.2007 8585.9355 c -7842.2183 8586 -7777.2002 8585.9355 y -7712.1816 8586 -7699.2002 8585.9355 v -7687.2129 8585.875 -7680.415 8584.5273 -7670.4009 8582.0352 C -7680.415 8579.543 -7687.2129 8578.1953 -7699.2002 8578.1348 c -7712.1816 8578.0693 -7777.2002 8578.1348 y -7842.2183 8578.0693 -7855.2007 8578.1348 v -7867.187 8578.1953 -7873.9858 8579.543 -7884 8582.0352 C f U %AI8_EndBrushPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np 4 Bn %AI5_BeginGradient: (Black, White) (Black, White) 0 2 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 %_Br [ 0 0 50 100 %_BS %_0 0 50 100 Bs 1 0 50 0 %_BS %_1 0 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Chrome) (Chrome) 0 6 Bd [ 0 < 464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B 3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272626262625 2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1B1B1B1B1A 1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F 0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 04040403030302020202010101010000 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A 1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 15151515151414141414141414131313131313131312121212121212121211111111111111111010 1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C 0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 07060606060606060606050505050505050504040404040404040303030303030303030202020202 02020201010101010101010000000000 > 1 %_Br 0 0.275 1 < 6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F > 1 %_Br 0 < 00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B 0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 161617171717181818181919191A1A1A1A1B1B1B1C1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C 2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 373738383838393939393A3A3A3B3B3B3B3C3C3C3D3D3D3D3E3E3E3E3F3F3F404040404141414142 42424343434344444444454545464646 > < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > < 00000101020203030304040505050606070708080809090A0A0B0B0B0C0C0D0D0D0E0E0F0F101010 1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5E5F5F606061616162626363646464 6565666666676768686969696A6A6B6B > 1 %_Br 1 0 %_Br < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 35343434333333323232323131313030302F2F2F2E2E2E2E2D2D2D2C2C2C2B2B2B2B2A2A2A292929 282828282727272626262525252524242423232322222222212121202020201F1F1F1E1E1E1D1D1D 1D1C1C1C1B1B1B1A1A1A1A1919191818181717171616161615151514141413131313121212111111 101010100F0F0F0E0E0E0D0D0D0D0C0C0C0B0B0B0A0A0A0A09090908080807070707060606050505 04040404030303020202010101010000 > 0 0 1 %_Br [ 1 0 50 92 %_BS %_1 0 50 92 Bs 0 0.275 1 0.12 1 50 59 %_BS %_0 0.275 1 0.12 1 50 59 Bs 0 0.275 1 0.42 1 50 50 %_BS %_0 0.275 1 0.42 1 50 50 Bs 1 0 50 49 %_BS %_1 0 50 49 Bs 1 0 50 41 %_BS %_1 0 50 41 Bs 1 0.3 0 0 1 50 0 %_BS %_1 0.3 0 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Rainbow) (Rainbow) 0 6 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 0 1 %_Br 1 < 0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E 2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E 7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 F7F8F9FAFBFCFDFEFF > 0 0 1 %_Br 1 < 00000000000000000000000000000000000001010101010101010101010101010101010101010101 01010101010101010101010101010202020202020202020202020202020202020202020202020202 02020202020202020202030303030303030303030303030303030303030303030303030303030303 03030303030304040404040404040404040404040404040404040404040404040404040404040404 04040505050505050505050505050505050505050505050505050505050505050505050505050606 06060606060606060606060606060606060606060606060606060606060606060607070707070707 07070707070707070707070707070707 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 1 %_Br < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > 0 1 0 1 %_Br 0 < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 1 %_Br [ 0 1 0 0 1 50 100 %_BS %_0 1 0 0 1 50 100 Bs 1 1 0 0 1 50 80 %_BS %_1 1 0 0 1 50 80 Bs 1 0.0279 0 0 1 50 60 %_BS %_1 0.0279 0 0 1 50 60 Bs 1 0 1 0 1 50 40 %_BS %_1 0 1 0 1 50 40 Bs 0 0 1 0 1 50 20 %_BS %_0 0 1 0 1 50 20 Bs 0 1 1 0 1 50 0 %_BS %_0 1 1 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Yellow & Orange Radial) (Yellow & Orange Radial) 1 2 Bd [ 0 < 0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F 707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C > < FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E6 > 0 1 %_Br [ 0 0 1 0 1 52 19 %_BS %_0 0 1 0 1 52 19 Bs 0 0.55 0.9 0 1 50 100 %_BS %_0 0.55 0.9 0 1 50 100 Bs BD %AI5_EndGradient %AI5_End_NonPrinting-- %AI5_BeginPalette 0 0 Pb 1 1 1 1 ([Registration]) 0 Xs ([Registration]) Pc 0 0 0 0 k (C=0 M=0 Y=0 K=0) Pc 0 0 0 1 k (C=0 M=0 Y=0 K=100) Pc 0 0.1 1 0 k (C=0 M=10 Y=100 K=0) Pc 0 0.5 0 0 k (C=0 M=50 Y=0 K=0) Pc 0 0.5 1 0 k (C=0 M=50 Y=100 K=0) Pc 1 0.55 1 0 k (C=100 M=55 Y=100 K=0) Pc 1 0.9 0.1 0 k (C=100 M=90 Y=10 K=0) Pc 0.15 1 1 0 k (C=15 M=100 Y=100 K=0) Pc 0.45 0.9 0 0 k (C=45 M=90 Y=0 K=0) Pc 0.5 0.4 0.3 0 k (C=50 M=40 Y=30 K=0) Pc 0.5 0.85 1 0 k (C=50 M=85 Y=100 K=0) Pc 0.75 0.05 1 0 k (C=75 M=5 Y=100 K=0) Pc 0.75 0.9 0 0 k (C=75 M=90 Y=0 K=0) Pc 0.8 0.05 0 0 k (C=80 M=5 Y=0 K=0) Pc Bb 2 (Black, White) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Black, White) Pc Bb 2 (Chrome) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Chrome) Pc Bb 2 (Rainbow) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Rainbow) Pc Bb 0 0 0 0 Bh 2 (Yellow & Orange Radial) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Yellow & Orange Radial) Pc (Brick) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Brick) Pc (Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Confetti) Pc (Leaves - Fall ) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Leaves - Fall ) Pc (Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Stripes) Pc PB %AI5_EndPalette %AI5_Begin_NonPrinting Np %AI8_BeginPluginObject (Adobe Brush Manager Order) (Adobe Brush Manager Order) ( Adobe Calligraphic Brush Tool/ 6 pt Flat / Adobe Calligraphic Brush T) - (ool/ 10 pt Oval/ Adobe Calligraphic Brush Tool/ 12 pt Oval / Adobe Cal) - (ligraphic Brush Tool/ 20 pt Oval/ Adobe Calligraphic Brush Tool/ 25 pt) - ( Round / Adobe Calligraphic Brush Tool/ 50 pt Flat/ Adobe Scatter Brus) - (h Tool/ Dog Tracks/ Adobe Scatter Brush Tool/ Fall Leaf/ Adobe Scatter) - ( Brush Tool/ Ladybug/ Adobe Scatter Brush Tool/ Push Pin/ Adobe Scatte) - (r Brush Tool/ Strawberry/ Adobe Scatter Brush Tool/ Twinkle Star / Ado) - (be ArtOnPath Brush Tool/ Marker/ Adobe ArtOnPath Brush Tool/ Tapered S) - (troke/ Adobe ArtOnPath Brush Tool/ Arrow/ Adobe ArtOnPath Brush Tool/ ) - (Paintbrush/ Adobe ArtOnPath Brush Tool/ Type/ Adobe PatternOnPath Brus) - (h Tool/ Double Lines/ Adobe PatternOnPath Brush Tool/ Laurel/ Adobe Pa) - (tternOnPath Brush Tool/ Rope /) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (6 pt Flat ) (1 4 8 10 10 90 90 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (10 pt Oval) (1 1 19 15 15 130 130 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (12 pt Oval ) (1 7 17 45 45 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (20 pt Oval) (1 20 20 20 100 40 80 0 2 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (25 pt Round ) (1 10 40 100 100 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (50 pt Flat) (1 40 60 0 0 44 44 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Arrow) (1 / New Pattern 45/ / / / / 5 0.898039 0 0 / 2 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Marker) (1 / New Pattern 8/ / / / / 0 0 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Paintbrush) (1 / New Pattern 5/ / / / / 1 0.5 0.85 1 0.45 / 0 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Tapered Stroke) (1 / New Pattern 83/ / / / / 1 0 0 0 1 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Type) (1 / New Pattern 50/ / / / / 1 0.952941 0.94902 0.196078 0.0745098 / 1) - ( 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Double Lines) (1 / New Pattern 62/ New Pattern 63/ New Pattern 64/ / / 1 1 0.14 0.09 ) - (0 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Laurel) (1 / New Pattern 65/ New Pattern 42/ New Pattern 67/ / New Pattern 69/ ) - (1 0 0.55 1 0.3 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Rope ) (1 / New Pattern 1/ / / New Pattern 3/ New Pattern 6/ 5 0 0 0 / 1 0 1 ) - (0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Dog Tracks) (1 /New Pattern 41/ 1 0 0 0 1 / 0 1 1 0 1 1 0 0 0 0 -90 -90 0 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Fall Leaf) (1 /New Pattern 34/ 1 0.0745 0.9 0.9019 0.18 / 0 0.602793 1 1 0.1 1 1 -) - (1 1 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Ladybug) (1 /New Pattern 10/ 5 0.898039 0 0 / 0 1 1 0 0.803911 1.2 1 -1.55 1.55 ) - (1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Push Pin) (1 /New Pattern 36/ 1 0.025 0.1 0.475 0 / 0 1 1 0 0.401676 1 1 -1.06145) - ( 1.06 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Strawberry) (1 /New Pattern 37/ 1 0 0 0 1 / 0 0.803911 1 1 0.803911 1 1 -0.5 0.5 1 ) - (-75 75.419 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Twinkle Star ) (1 /New Pattern 2/ 0 1 / 1 0.5 1 1 0.25 1 1 -0.5 0.5 1 0 0 0 0 0) . %AI8_EndPluginObject %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_PluginGroupInfo (Adobe Path Blends) (Adobe Blends Plugin) (Live Blends) %AI8_PluginGroupInfo (Adobe PatternOnPath Brush Tool) (Adobe Pattern Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe ArtOnPath Brush Tool) (Adobe Art Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe Calligraphic Brush Tool) (Undo New Calligraphic Brush) (Calligraphic Brush Tool) %AI8_PluginGroupInfo (Adobe Scatter Brush Tool) (Adobe Scatter Brush Plugin) (Scatter Brush Tool) %AI5_End_NonPrinting-- %AI5_BeginLayer 1 1 1 1 0 0 1 0 79 128 255 0 50 Lb (Layer 1) Ln 0 A 0 O 1 g 0 R 0 G 300 Ar 2 J 0 j 0.72 w 3.86 M []0 d %AI3_Note: 0 D 1 XR 135.1201 587.2798 m 189.1201 587.2798 l 189.1201 533.2798 l 135.1201 533.2798 l 135.1201 587.2798 l b /BBAccumRotation (0.000000) XT 216 551.2798 m 270 551.2798 l 270 513.3599 l 216 513.3599 l 216 551.2798 l b /BBAccumRotation (0.000000) XT 0 XR 270 532.3198 m 216 532.3198 l S /BBAccumRotation (0.000000) XT 270 541.6802 m 216 541.6802 l S /BBAccumRotation (0.000000) XT 270 522.96 m 216 522.96 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 324 596.1602 m 378 596.1602 l 378 542.1602 l 324 542.1602 l 324 596.1602 l b /BBAccumRotation (0.000000) XT 324 515.2798 m 378 515.2798 l 378 450 l 324 450 l 324 515.2798 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 158.7798 589.3398 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR %_ 0 50 XQ /_Times-Roman 10 8.9799 -2.18 Tf 0 Ts 100 100 Tz 0 Tt %_0 0 100 100 Xu %AI55J_GlyphSubst: GlyphSubstNone 1 TA %_ -- XL 0 TY 0 TV 36 0 Xb XB 0 0 5 TC 100 100 200 TW 25 TG 0 0 0 Ti 0 Ta 0 1 2 2 3 Th 0 Tq 240 Tg 0 0 Tl 0 Tc 0 Tw (vfs) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 223.23 497.27 0 Tp 0 Tv TP 0 Tr /_Times-Roman 10.48 9.411 -2.2847 Tf 95.4198 100 Tz (bhv_desc) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 333 535.3398 0 Tp 0 Tv TP 0 Tr /_Times-Roman 10 8.9799 -2.18 Tf 100 100 Tz (xfs_mount) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 333 434.1699 0 Tp 0 Tv TP 0 Tr (xfs_vfsops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 204.7202 552.2397 m 214.3198 551.7598 l 206.3999 557.2798 l 205.4399 554.6401 l 204.7202 552.2397 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 204.7202 552.2397 m 214.3198 551.7598 l 206.3999 557.2798 l 205.4399 554.6401 l 204.7202 552.2397 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 204.96 554.8799 m 189.1201 560.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 411.8398 512.6401 m 421.2002 515.2798 l 411.8398 517.9199 l 411.8398 515.2798 l 411.8398 512.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 512.6401 m 421.2002 515.2798 l 411.8398 517.9199 l 411.8398 515.2798 l 411.8398 512.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 515.2798 m 351.1201 515.2798 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 318 586.5601 m 322.7998 594.96 l 314.4004 590.1602 l 316.3203 588.48 l 318 586.5601 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 318 586.5601 m 322.7998 594.96 l 314.4004 590.1602 l 316.3203 588.48 l 318 586.5601 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 315.8398 588 m 270 542.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 312.7197 512.6401 m 322.3203 513.3599 l 313.6797 517.9199 l 313.2002 515.2798 l 312.7197 512.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 312.7197 512.6401 m 322.3203 513.3599 l 313.6797 517.9199 l 313.2002 515.2798 l 312.7197 512.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 312.7197 515.2798 m 270 524.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 129.6001 578.3999 m 133.6802 585.8398 l 126.2402 581.7598 l 127.9199 580.0801 l 129.6001 578.3999 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 129.6001 578.3999 m 133.6802 585.8398 l 126.2402 581.7598 l 127.9199 580.0801 l 129.6001 578.3999 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 127.4399 579.6001 m 126 578.1602 l 126 515.2798 l 153.1201 506.1602 l 216 533.2798 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 273.1201 497.7598 m 278.3999 489.8398 l 277.9199 499.4399 l 275.52 498.7202 l 273.1201 497.7598 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 273.1201 497.7598 m 278.3999 489.8398 l 277.9199 499.4399 l 275.52 498.7202 l 273.1201 497.7598 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 275.2798 499.1997 m 270 515.2798 l S /BBAccumRotation (0.000000) XT 288 479.2798 m 270 479.2798 l S /BBAccumRotation (0.000000) XT 288 470.1602 m 270 470.1602 l S /BBAccumRotation (0.000000) XT 288 461.2798 m 270 461.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 270 452.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (NULL) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 433.3398 515.1699 0 Tp 0 Tv TP 0 Tr (xfs_vfsmount\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 411.8398 512.6401 m 421.2002 515.2798 l 411.8398 517.9199 l 411.8398 515.2798 l 411.8398 512.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 512.6401 m 421.2002 515.2798 l 411.8398 517.9199 l 411.8398 515.2798 l 411.8398 512.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 515.2798 m 378 515.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 432 497.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_unmount\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 1 g 0 R 0 G 2 J 0.72 w 3.86 M 1 XR 72 702 m 126 702 l 126 648 l 72 648 l 72 702 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 72 704.1699 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR (super block) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 1 g 0 R 0 G 2 J 0.72 w 3.86 M 1 XR 153.1201 720 m 206.8799 720 l 206.8799 666 l 153.1201 666 l 153.1201 720 l b /BBAccumRotation (0.000000) XT 0 J 1.2 w 0 XR 149.52 709.2002 m 152.1602 718.5601 l 144.96 711.8398 l 147.3599 710.6401 l 149.52 709.2002 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 149.52 709.2002 m 152.1602 718.5601 l 144.96 711.8398 l 147.3599 710.6401 l 149.52 709.2002 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 147.1201 710.1602 m 126 675.1201 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 90 668.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (ops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 9.8398 612 m 9.1201 612 l S /BBAccumRotation (0.000000) XT [1.491 4.474 ]1.491 d 521.2803 620.8799 m 9.8398 612 l S /BBAccumRotation (0.000000) XT []0 d 522 621.1201 m 521.2803 620.8799 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 18 585 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M /_Times-Roman 12 10.7759 -2.616 Tf 109.5 100 Tz (XFS) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 18 630 0 Tp 0 Tv TP 0 Tr 100 100 Tz (Linux) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 258.96 717.3599 m 268.0801 720 l 258.96 722.6401 l 258.96 720 l 258.96 717.3599 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 258.96 717.3599 m 268.0801 720 l 258.96 722.6401 l 258.96 720 l 258.96 717.3599 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 258.48 720 m 206.8799 720 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 279 720 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M /_Times-Roman 10 8.9799 -2.18 Tf (lin) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 289.1602 720 0 Tp 0 Tv TP 0 Tr (vfs_read_super\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 279 704.1699 0 Tp 0 Tv TP 0 Tr (lin) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 289.1602 704.1699 0 Tp 0 Tv TP 0 Tr (vfs_put_super\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 258.96 699.3599 m 268.0801 702 l 258.96 704.6401 l 258.96 702 l 258.96 699.3599 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 258.96 699.3599 m 268.0801 702 l 258.96 704.6401 l 258.96 702 l 258.96 699.3599 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 258.48 702 m 206.8799 702 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 235.3398 542.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (data) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 234.4199 533.1699 0 Tp 0 Tv TP 0 Tr (v) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 239.2197 533.1699 0 Tp 0 Tv TP 0 Tr (obj) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 238.1099 524.1699 0 Tp 0 Tv TP 0 Tr (ops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 234.9302 515.1699 0 Tp 0 Tv TP 0 Tr (ne) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 244.2197 515.1699 0 Tp 0 Tv TP 0 Tr (xt) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 130.7998 595.4399 m 134.6401 586.7998 l 136.0801 596.3999 l 133.4399 595.9199 l 130.7998 595.4399 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 130.7998 595.4399 m 134.6401 586.7998 l 136.0801 596.3999 l 133.4399 595.9199 l 130.7998 595.4399 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 133.4399 596.3999 m 126 648 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 288 684 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 288 666 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 288 675 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 72 650.1699 0 Tp 0 Tv TP 0 Tr (fs dependent) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 126 666 m 72 666 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 141.1201 560.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (bhv_head) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 142.7798 551.1699 0 Tp 0 Tv TP 0 Tr (bhv_lock) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 126 684 m 72 684 l S /BBAccumRotation (0.000000) XT 189.1201 567.1201 m 135.1201 567.1201 l S /BBAccumRotation (0.000000) XT 189.1201 558 m 135.1201 558 l S /BBAccumRotation (0.000000) XT 189.1201 549.1201 m 135.1201 549.1201 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 470.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 411.8398 492.2402 m 421.2002 495.1201 l 411.8398 497.7598 l 411.8398 495.1201 l 411.8398 492.2402 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 492.2402 m 421.2002 495.1201 l 411.8398 497.7598 l 411.8398 495.1201 l 411.8398 492.2402 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 495.1201 m 378 495.1201 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 460.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 450.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT LB %AI5_EndLayer-- gsave annotatepage grestore showpage Adobe_Illustrator_AI5 /terminate get exec Adobe_shading_AI8 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_cshow /terminate get exec Adobe_level2_AI5 /terminate get exec %%EndDocument @endspecial 771 4181 a(Figure)20 b(5:)25 b(Con)m(v)o(erting)18 b(an)i(Linux)f(VFS)i(operation)e(to)h(an)g(XFS)h(vfs)f(operation.)1908 5656 y(12)p eop %%Page: 13 13 13 12 bop 0 4844 a Fe(centerline)p @beginspecial 17 @llx 260 @lly 487 @urx 761 @ury 4700 @rwi @setspecial %%BeginDocument: vnode.linux.eps %AI5_FileFormat 4.0 %AI3_ColorUsage: Black&White %AI3_IncludePlacedImages %AI7_ImageSettings: 1 %AI3_TemplateBox: 306.5 395.5 306.5 395.5 %AI3_TileBox: 31 31 583 761 %AI3_DocumentPreview: Macintosh_ColorPic %AI5_ArtSize: 612 792 %AI5_RulerUnits: 2 %AI5_ArtFlags: 1 0 0 1 0 0 1 0 0 %AI5_TargetResolution: 800 %AI5_NumLayers: 1 %AI8_OpenToView: -221.1348 802.1265 1.19 1274 981 18 0 1 3 40 0 0 %AI5_OpenViewLayers: 7 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 %AI7_Thumbnail: 120 128 8 %0000330000660000990000CC0033000033330033660033990033CC0033FF %0066000066330066660066990066CC0066FF009900009933009966009999 %0099CC0099FF00CC0000CC3300CC6600CC9900CCCC00CCFF00FF3300FF66 %00FF9900FFCC3300003300333300663300993300CC3300FF333300333333 %3333663333993333CC3333FF3366003366333366663366993366CC3366FF %3399003399333399663399993399CC3399FF33CC0033CC3333CC6633CC99 %33CCCC33CCFF33FF0033FF3333FF6633FF9933FFCC33FFFF660000660033 %6600666600996600CC6600FF6633006633336633666633996633CC6633FF %6666006666336666666666996666CC6666FF669900669933669966669999 %6699CC6699FF66CC0066CC3366CC6666CC9966CCCC66CCFF66FF0066FF33 %66FF6666FF9966FFCC66FFFF9900009900339900669900999900CC9900FF %9933009933339933669933999933CC9933FF996600996633996666996699 %9966CC9966FF9999009999339999669999999999CC9999FF99CC0099CC33 %99CC6699CC9999CCCC99CCFF99FF0099FF3399FF6699FF9999FFCC99FFFF %CC0000CC0033CC0066CC0099CC00CCCC00FFCC3300CC3333CC3366CC3399 %CC33CCCC33FFCC6600CC6633CC6666CC6699CC66CCCC66FFCC9900CC9933 %CC9966CC9999CC99CCCC99FFCCCC00CCCC33CCCC66CCCC99CCCCCCCCCCFF %CCFF00CCFF33CCFF66CCFF99CCFFCCCCFFFFFF0033FF0066FF0099FF00CC %FF3300FF3333FF3366FF3399FF33CCFF33FFFF6600FF6633FF6666FF6699 %FF66CCFF66FFFF9900FF9933FF9966FF9999FF99CCFF99FFFFCC00FFCC33 %FFCC66FFCC99FFCCCCFFCCFFFFFF33FFFF66FFFF99FFFFCC110000001100 %000011111111220000002200000022222222440000004400000044444444 %550000005500000055555555770000007700000077777777880000008800 %000088888888AA000000AA000000AAAAAAAABB000000BB000000BBBBBBBB %DD000000DD000000DDDDDDDDEE000000EE000000EEEEEEEE0000000000FF %00FF0000FFFFFF0000FF00FFFFFF00FFFFFF %524C45FD1CFF7D7DFD76FF7D7D52FD75FFA87DA8A8A87DA8A8A87DFD04A8 %FD69FFA8FD0DFFA8FD69FFA8FD0DFFA8FD69FFA8FD0DFFA8FD69FF7DFD0D %FFA8FD69FFA87DA87DA87DA87DA87DA87DA87D7DFD69FFA8FD0DFFA8FD69 %FFA8FD0DFFA8A8FD68FFA8FD05FFA8FFA8FD05FF7DFFA8A87DA8FD28FFFD %06A8FFFFA8FFFD04A8FD2EFFA8FD04FFFD047DFD05FFA8FD05FFA87DA87D %A85252FD1CFFF8527DFFFF7D5252527D52FF7D7D7D52527D7DFD2EFFFD06 %A87DFD07A87DFD0AFF7D27527DFD0CA87DFD0DA82727A8FD08FF7DFFA8FD %04FFA8FD2EFFA8FD0DFFA8FD0DFFA8FD0CFF7DFD4EFF7DFD0DFFA8FD0DFF %7DFD0CFFA8FD12FF7DFD05A8FFFFA8A8FFA8A8FD2FFFA8FFFFFF7DFD05A8 %FD04FFA8FD0DFFA8FD0CFF7DFD0DFF7DFD04FF7D5252527D52FF7D7D527D %7DA87DFD2EFFFD04A8527D525252FD05A87DFD0DFFA8FD0CFFFD0EA8F8F8 %7DFD08FFA8FD05FFA8FD2FFFA8FD1BFFA8FD0CFF7DFD0DFF27A8FD40FFA8 %FD1AFFA8FD0CFFA8FD4FFF7DFD1AFFA8FD0CFF7DFD4FFFA8FD1AFFA8FD0C %FFA8FD4FFF7DFD1AFFA8FD0CFF7DFD50FFA8FD19FF7DFD0CFFA8FD4FFF7D %527DFFFFFF7DFD04A8FD10FFA8FD0CFF7DFD15FFA8FD3AFFF87DFFFFA87D %7DA87D7DFD10FFA8FD0CFFA8FD50FF5227A87DA87DA87DA87DA87DA87DA8 %FD0BFF7D7DA87DA87DA87DA87DA87DA852FD15FFA8FD3AFFA8A8FD0CFFA8 %FD6AFF7DFD0CFFA8FD6AFFA8FD0CFFA8FD6AFF7DFD0CFFA8FD6AFF7D7DA8 %A8A87DA8A8A87DA8A8A852FD6AFF7DFD0CFFA8FD6AFFA8FD0CFFA8FD06FF %7D7DFD62FF7DFFFFFFA8A87DFFA8FD04FFA87DA87DA87DA8F8F827A87DA8 %7DA8FD5CFFA8FFFFFFA87D7D52A8FD04FFA8FD6AFF52A87DA87DA852A87D %A87DA87D7DFD09FFA87DA87DA8FD5CFFA8FD0CFFA8FD6AFF27A8A87DFD0A %A8FD6AFF7D52A87D527D7D7DA87D5252A87DFD09FF527D527D7DA8A8FD5A %FF7DA87DA87D7D7DA87DA87DA87D7DFD09FFFD057D52A8FD5AFFA8FD77FF %A8A8FD78FFA8FD3BFFFD06A8FFA8A8A87DA8A87DFFA8FD2CFFA8A8FD35FF %7D7DFFFFFF7D7D527D7D7DFF7D527D7D7D527D52FF7DFD46FF7D7DFD0CA8 %7DFD0DA8F82752FD08FFA8FD06FF7DFFA8FD2EFFA8FD08FFA8A8A87DFFA8 %FD09FF7D277DFD0CFFA8FD51FFA8FD07FF52A87D527DA8FD09FF2727A8FD %0CFFA8FD12FFFD06A8FFFD05A8FFA8A8A8FD30FF52277DFD13FF52A87DFD %0CFFA8FD12FF7D7D527D7D7DFFA8527D527D7D7DFFA8FD31FF2727FD0EA8 %FD04FFA8FFFFA8FD0CFFFD0EA827527DFD08FFA8FD07FFA8FD33FF7DA8FD %0DFFA8FFFFA8FFFFFF7DFD0CFFA8FD0DFF27277DFD45FFA8FD0DFF7DFFFF %A8FFFFFFA8FD0CFF7DFD55FFA8FD0DFFA8FFA8FD04FF7DFD0CFFA8FD55FF %A8FD0DFFA8FFA8FD04FFA8FD0CFFA8FD55FF7D7DA87DA87DA87DA87DA87D %A87DA87DFD05FF7DFD0CFFA8FD55FF7DFD0DFF7DFD06FFA8FD0CFFA8FD55 %FFA8FD0DFF7DFD06FF7DFD0CFFA8FD55FFA8FD05FFA8FFA8FD05FFA8FD06 %FFA8FD0CFFA8FD55FFA8FD04FF7D7D52A8FD05FFA8FD06FF7DFD0CFFA8FD %55FF7DA87DA8A8A852A8A8A87DA8A8A87DFD06FFA87DA8A8A87DA8A8A87D %A8A8A87DFD55FFA8FD0DFFA8FD69FF7DA8FF7DA8A8FFFFFF7DA8FFA8FFA8 %FD69FF7D52FF52527D7D7DA852527D7DA8A8FD69FF7DA8A8A87D7DA8A87D %A8A8A87DA8A8FD68FFA8A8FD76FFA8FD77FFA8FD76FF7DFD53FFA8A8FD21 %FFA8FD54FF7DFF7DFFA8FFA8FD1CFFA8FD54FFFD057D527DFD1BFFA8FD77 %FFA8FD76FF7DFD56FFA8FFA8FFFFFFA8FFA8FD05FFA8FFFFA8FFFFA8FFA8 %FFFFFFA8FFA8FFFFFF7DFFA8FD05FFA8FFA8FFFFFFA8FFA8FFFFFFA8FFA8 %FD05FFA8FFA8FFFFFFA8FFA8FFFFFFA8FFA8FD05FFA8FFA8FFFFFFA8FFA8 %FFFFFFA8FFA8FD05FFA8FFA8FFFFFFA8FFA8FFFFFFA8FFA8FD25FFA8FD76 %FFA8A8FD76FF7DFD76FF52FD04FFA8A8FFA87DFD26FFFD0EA8FD1BFF7DA8 %A8FF7D7DFD18FF27F87DFFFFFF7D7D7DA8527D7DFD21FF7D2727FD0DFF7D %FD1BFFA8A8FF7D7D7DFD18FF2727A8A8A87DA8A8A87DA8A8A87DFD20FF27 %52A8FD0DFFA8FD1BFF7D7DA87DA87DFD16FF7D5227FD0CFFA8FD1FFFA87D %FF7DFD0DFF7DFD36FF7DF87DA8FD0CFFA8FD1EFFA8FFFFFFA8FD0DFFA8FD %36FFA87DFF7DFD0CFFA8FD1DFFA8FD04FF7DFD0DFF7DFD36FFA8FFFFA8FD %0CFFA8FD1CFFA8FD05FFA8FD0DFFA8FD36FFA8FFFF7DFD0CFFA8FD1BFFA8 %FD06FF7DFD0DFF7DFD36FFA8FFFF7D7DA852A8A8A852A87DA852A87DFD1A %FFA8FD07FFA8FD0DFFA8FD36FFA8FFFF7DA87D5252FFFF52527D7D7DFFA8 %A8FD18FFA8FD08FF7DFD0DFF7DFD36FF7DFFFFFD057D52FD067DA852A8A8 %A8FF7DFD13FFA8FD09FFA8FD0DFFA8FD36FFA8FFFF7DFF7D7D527DFFFD05 %7DFFA8FFFFFFA8F8277DFD10FFA8FD0AFF7DFD0DFF7DFD36FFA8FFFF7DFD %05A87DFD06A87DFD05FF7DFD0FA8FFA8FD0BFFA8FD0DFFA8FD36FFA8FFFF %7DFD0CFFA8FD06FF7DFD05FF7DA87DA8FD04FF7DA8FD0CFF7DFD0DFF7DFD %36FFA8FFFFA8FD0CFFA8FD06FFA8A8A87DA8A852277D52A87DA8A8A8FD0D %FFA8A8A8527D7DA852A87DA852A8A8A8FD36FFA8FFFF7DFD0CFFA8FD06FF %7DFD05FFA8A87DFFA8FFFFFF7DFD10FF7D527DFF7D277D527D27FD38FFA8 %FFFF7DFD0CA87DFD06FFA8FD04FFA8A87D7DA8A8FFFFFFA8FD13FFA8FD3E %FFA8FD14FFA8A827A87DA87DA87DA8527D7DA87DA852FD24FFA8FD04FFFD %05A8FF7DFD04A8FD1EFF7DFD12FFA87DFFFFA8FD05FFA87D7D52FD04FFA8 %FD0AFF52527DA87DA8A8A87DA87D7D527D7D7D527DA8A87DA8A8A87DA8F8 %F87DFFFF7D7DA8A8A87D7D27A87DFFA8FD1DFFA8FD0FFFA87DA8FD04FF52 %A87DA87DA852A8277D52A87DA827A87DA87DA87DA87DA87D27F85227FD0D %FF7DFD08FF7DFD08FFA8FF7DFFFFFFA8FD1EFFA8FD0DFFA8A8A8FD06FFA8 %FD04FF7DA8527DA8FD04FFA8FD0DFFA8FD0DFFA8FD36FFA87DFD0AFFA87D %FD09FF7DA87DA87DA87DA87DA87DA87DA852FD0DFF7DFD0DFF7DFD38FFA8 %A8A8FD05FF7DA8FD1AFFA8FD0CFFA8FD0DFFA8FD0DFFFD04A8FFA8A8A87D %A8A8FD23FFA8A87DA8A8FD1CFFA8FD0CFF7DFD0DFF7DFD08FF527DFFFFFF %527D7DA87D7D527D277D7DFD37FFA8A87DA8FFFF7DA8A8A8FFFFFFA8FD0C %FFA8FD0DFFFD09A8F8277DFD05FFA8FD05FFA8FD38FFA87D52A87DFF5252 %527DFFFFFF7DF8FD0BFF7DFD0DFF7DFD15FFA8FD3EFFA8FD07FF7DF8FD0B %FFA8FD0DFFA8FD5DFFF8FD0BFF7DFD0DFF7DFD15FFA8FD53FFA8FD0DFFA8 %FD69FF7DFD0DFF7DFD0DFFA8A8A8FF7DFFA8FF7DA8A8FFA8FD42FF7DFD04 %A8FD08FFA8FD0DFFA8FD08FF27A8FFFFFF7D7DA8A8A87DA87D7D7DA87DA8 %A8FD4EFF7DFD0DFF52A87DA87DA87DA87DF8F87DFD05FFA8A8FD05FFA8FF %A8FD42FFFD05A8FD08FFA8FD0DFFA8FD69FF7DFD0DFF7DFD0DFFFD05A8FF %7DFFFD05A8FD4FFFA8FD0DFFA8FD0DFF7D7DFD04A8FD047DA8A8A8FD41FF %A8A87DA87DFD09FF7DFD0DFF52A87DA87DA87DA87DF8277DFD06FFA8FD49 %FFFD05A8FFA8FD07FFA8FD0DFFA8FD08FF277DFD51FF7DA852A852A852A8 %FD06FF7DFD0DFF7DFD69FFA8FD0DFFA8FD69FF7DFD0DFF7DFD69FFA8FD0D %FFA8FD69FF7DFD0DFF7DFD69FFA8FD0DFFA8FD69FF7DFD0DFF7DFD69FFA8 %FD0DFFA8FD69FF7DFD0DFF7DFD69FFA8FD0DFFA8FD69FFA8A87DA87DA87D %A87DA87DA87DA8A8FDE1FFA8FF52A8FFA8A8FFA87DA8A8A8FFA8FD69FFA8 %7D7DA8FF7D527DA85252FD047DFD6DFFA8FD07FFA8FD1CFFFF userdict /Adobe_level2_AI5 26 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { (AI8_CMYK_CustomColor) 6 packedarray } bind def /findrgbcustomcolor { (AI8_RGB_CustomColor) 5 packedarray } bind def /setcustomcolor { exch aload pop dup (AI8_CMYK_CustomColor) eq { pop pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { dup (AI8_RGB_CustomColor) eq { pop pop 3 { 1 exch sub 3 index mul 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } ifelse } ifelse } def } if /setAIseparationgray { false setoverprint 0 setgray /setseparationgray where{ pop setseparationgray }{ /setcolorspace where{ pop [/Separation (All) /DeviceCMYK {dup dup dup}] setcolorspace 1 exch sub setcolor }{ setgray }ifelse }ifelse } def /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking currentpacking true setpacking userdict /Adobe_typography_AI5 68 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /havefont { systemdict /languagelevel known { /Font resourcestatus dup { exch pop exch pop } if } { systemdict /FontDirectory get 1 index known { pop true } { systemdict /fileposition known { dup length 6 add exch Ss 6 250 getinterval cvs pop Ss exch 0 exch getinterval status { pop pop pop pop true } { false } ifelse } { pop false } ifelse } ifelse } ifelse } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def /subststring { exch 2 index exch search { exch pop exch dup () eq { pop exch concatstring } { 3 -1 roll exch concatstring concatstring } ifelse exch pop true } { pop pop false } ifelse } def /concatstring { 1 index length 1 index length 1 index add string dup 0 5 index putinterval dup 2 index 4 index putinterval 4 1 roll pop pop pop } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def 2 index havefont { 3 index 255 string cvs dup (_Symbol_) eq { pop 2 index findfont } { 1 index 0 eq { dup length 1 sub 1 exch getinterval cvn findfont } { pop 2 index findfont } ifelse } ifelse } { dup 1 eq { 2 index 64 string cvs dup (-90pv-RKSJ-) (-83pv-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop dup (-90ms-RKSJ-) (-Ext-RKSJ-) subststring { exch pop dup havefont { findfont false } { pop true } ifelse } { pop pop true } ifelse } ifelse { 1 index 1 eq { /Ryumin-Light-Ext-RKSJ-V havefont {/Ryumin-Light-Ext-RKSJ-V} {/Courier} ifelse } { /Ryumin-Light-83pv-RKSJ-H havefont {/Ryumin-Light-83pv-RKSJ-H} {/Courier} ifelse } ifelse findfont [1 0 0.5 1 0 0] makefont } if } { /Courier findfont } ifelse } ifelse _wv type /arraytype eq { _wv makeblendedfont } if dup length 10 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontScript exch def /FontDirection exch def /FontRequest exch def /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { W B } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { W F } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { W S } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat _shift aload pop _lineorientation 1 eq { exch } if translate _scale aload pop _lineorientation 1 eq _yokoorientation 1 eq or { exch } if scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { 1 index type /nametype eq { dup 0.75 mul 1 index 0.25 mul neg } if /_fontDescent exch ddef /_fontAscent exch ddef /_fontSize exch ddef /_fontRotateAdjust _fontAscent _fontDescent add 2 div neg ddef /_fontHeight _fontSize ddef findfont _fontSize scalefont setfont } def /Tl { pop neg 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { 0 exch _shift astore pop currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { count 1 eq { 100 } if 100 div exch 100 div exch _scale astore pop iTm } def /TA { pop } def /Tq { pop } def /Tg { pop } def /TG { pop } def /Tv { /_lineorientation exch ddef } def /TV { /_charorientation exch ddef } def /Ty { dup /_yokoorientation exch ddef 1 sub neg Tv } def /TY { pop } def /T~ { Tx } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { _fontSize mul 1000 div _lineorientation 0 eq { neg 0 } { 0 exch } ifelse rmoveto pop } def /TK { 2 npop } def /T* { _leading aload pop _lineorientation 0 ne { exch } if Td } def /T*- { _leading aload pop _lineorientation 0 ne { exch } if exch neg exch neg Td } def /T- { _ax neg 0 rmoveto _lineorientation 1 eq _charorientation 0 eq and { 1 TV _hyphen Tx 0 TV } { _hyphen Tx } ifelse } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ findfont _fontSize scalefont setfont 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking % /X^ { currentfont 5 1 roll dup havefont { findfont _fontSize scalefont setfont } { pop exch } ifelse 2 index 0 eq { Tx } { Tj } ifelse pop pop setfont } def /T^ /X^ load def userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 53 dict put } if userdict /Adobe_ColorImage_AI6 get begin /initialize { Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 41 dict def } if Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /_newproc null def /_proc1 null def /_proc2 null def /sourcearray 4 array def /_ptispace null def /_ptiname null def /_pti0 0 def /_pti1 0 def /_ptiproc null def /_ptiscale 0 def /_pticomps 0 def /_ptibuf 0 string def /_gtigray 0 def /_cticmyk null def /_rtirgb null def /XIEnable true def /XIType 0 def /XIEncoding 0 def /XICompression 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIRowBytes 0 def /XIFile null def /XIBuffer1 null def /XIBuffer2 null def /XIBuffer3 null def /XIDataProc null def /XIColorSpace /DeviceGray def /XIColorValues 0 def /XIPlateList false def end /ci6colorimage /colorimage where {/colorimage get}{null} ifelse def /ci6image systemdict /image get def /ci6curtransfer systemdict /currenttransfer get def /ci6curoverprint /currentoverprint where {/currentoverprint get}{{_of}} ifelse def /ci6foureq { 4 index ne { pop pop pop false }{ 4 index ne { pop pop false }{ 4 index ne { pop false }{ 4 index eq } ifelse } ifelse } ifelse } def /ci6testplate { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 ci6foureq { /plateindex 0 def }{ 0 1 0 0 ci6foureq { /plateindex 1 def }{ 0 0 1 0 ci6foureq { /plateindex 2 def }{ 0 0 0 1 ci6foureq { /plateindex 3 def }{ 0 0 0 0 ci6foureq { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /ci6concatprocs { /packedarray where { pop dup type /packedarraytype eq 2 index type /packedarraytype eq or }{ false } ifelse { /_proc2 exch cvlit def /_proc1 exch cvlit def _proc1 aload pop _proc2 aload pop _proc1 length _proc2 length add packedarray cvx }{ /_proc2 exch cvlit def /_proc1 exch cvlit def /_newproc _proc1 length _proc2 length add array def _newproc 0 _proc1 putinterval _newproc _proc1 length _proc2 putinterval _newproc cvx } ifelse } def /ci6istint { type /arraytype eq } def /ci6isspot { dup type /arraytype eq { dup length 1 sub get /Separation eq }{ pop false } ifelse } def /ci6spotname { dup ci6isspot {dup length 2 sub get}{pop ()} ifelse } def /ci6altspace { aload pop pop pop ci6colormake } def /ci6numcomps { dup /DeviceGray eq { pop 1 }{ dup /DeviceRGB eq { pop 3 }{ /DeviceCMYK eq { 4 }{ 1 } ifelse } ifelse } ifelse } def /ci6marksplate { dup /DeviceGray eq { pop plateindex 3 eq }{ dup /DeviceRGB eq { pop plateindex 5 ne }{ dup /DeviceCMYK eq { pop plateindex 5 ne }{ dup ci6isspot { /findcmykcustomcolor where { pop dup length 2 sub get 0.1 0.1 0.1 0.1 5 -1 roll findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop plateindex 5 ne } ifelse }{ pop plateindex 5 ne } ifelse } ifelse } ifelse } ifelse } def /ci6colormake { dup ci6numcomps exch 1 index 2 add 1 roll dup 1 eq {pop}{array astore} ifelse exch } def /ci6colorexpand { dup ci6spotname exch dup ci6istint { ci6altspace exch 4 1 roll }{ 1 3 1 roll } ifelse } def /ci6colortint { dup /DeviceGray eq { 3 1 roll 1 exch sub mul 1 exch sub exch }{ dup /DeviceRGB eq { 3 1 roll {1 exch sub 1 index mul 1 exch sub exch} forall pop 3 array astore exch }{ dup /DeviceCMYK eq { 3 1 roll {1 index mul exch} forall pop 4 array astore exch }{ 3 1 roll mul exch } ifelse } ifelse } ifelse } def /ci6colortocmyk { dup /DeviceGray eq { pop 1 exch sub 0 0 0 4 -1 roll 4 array astore }{ dup /DeviceRGB eq { pop aload pop _rgbtocmyk 4 array astore }{ dup /DeviceCMYK eq { pop }{ ci6altspace ci6colortint ci6colortocmyk } ifelse } ifelse } ifelse } def /ci6makeimagedict { 7 dict begin /ImageType 1 def /Decode exch def /DataSource exch def /ImageMatrix exch def /BitsPerComponent exch def /Height exch def /Width exch def currentdict end } def /ci6stringinvert { 0 1 2 index length 1 sub { dup 2 index exch get 255 exch sub 2 index 3 1 roll put } for } def /ci6stringknockout { 0 1 2 index length 1 sub { 255 2 index 3 1 roll put } for } def /ci6stringapply { 0 1 4 index length 1 sub { dup 4 index exch get 3 index 3 1 roll 3 index exec } for pop exch pop } def /ci6walkrgbstring { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval {} forall 5 index exec 3 index } for 5 {pop} repeat } def /ci6walkcmykstring { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval {} forall 6 index exec 3 index } for 5 { pop } repeat } def /ci6putrgbtograystr { .11 mul exch .59 mul add exch .3 mul add cvi 3 copy put pop 1 add } def /ci6putcmyktograystr { exch .11 mul add exch .59 mul add exch .3 mul add dup 255 gt { pop 255 } if 255 exch sub cvi 3 copy put pop 1 add } def /ci6rgbtograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putrgbtograystr load exch ci6walkrgbstring end } def /ci6cmyktograyproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 dup 3 1 roll /ci6putcmyktograystr load exch ci6walkcmykstring end } def /ci6separatecmykproc { Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec XIBuffer3 0 2 index plateindex 4 2 index length 1 sub { get 255 exch sub 3 copy put pop 1 add 2 index } for pop pop exch pop end } def /ci6compositeimage { dup 1 eq { pop pop image }{ /ci6colorimage load null ne { ci6colorimage }{ 3 1 roll pop sourcearray 0 3 -1 roll put 3 eq {/ci6rgbtograyproc}{/ci6cmyktograyproc} ifelse load image } ifelse } ifelse } def /ci6knockoutimage { gsave 0 ci6curtransfer exec 1 ci6curtransfer exec eq { 0 ci6curtransfer exec 0.5 lt }{ 0 ci6curtransfer exec 1 ci6curtransfer exec gt } ifelse {{pop 0}}{{pop 1}} ifelse systemdict /settransfer get exec ci6compositeimage grestore } def /ci6drawimage { ci6testplate -1 eq { pop ci6compositeimage }{ dup type /arraytype eq { dup length plateindex gt {plateindex get}{pop false} ifelse }{ { true }{ dup 1 eq {plateindex 3 eq}{plateindex 3 le} ifelse } ifelse } ifelse { dup 1 eq { pop pop ci6image }{ dup 3 eq { ci6compositeimage }{ pop pop sourcearray 0 3 -1 roll put /ci6separatecmykproc load ci6image } ifelse } ifelse }{ ci6curoverprint { 7 {pop} repeat }{ ci6knockoutimage } ifelse } ifelse } ifelse } def /ci6proctintimage { /_ptispace exch store /_ptiname exch store /_pti1 exch store /_pti0 exch store /_ptiproc exch store /_pticomps _ptispace ci6numcomps store /_ptiscale _pti1 _pti0 sub store level2? { _ptiname length 0 gt version cvr 2012 ge and { [/Separation _ptiname _ptispace {_ptiproc}] setcolorspace [_pti0 _pti1] ci6makeimagedict ci6image }{ [/Indexed _ptispace 255 {255 div _ptiscale mul _pti0 add _ptiproc}] setcolorspace [0 255] ci6makeimagedict ci6image } ifelse }{ _pticomps 1 eq { { dup { 255 div _ptiscale mul _pti0 add _ptiproc 255 mul cvi put } ci6stringapply } ci6concatprocs ci6image }{ { dup length _pticomps mul dup _ptibuf length ne {/_ptibuf exch string store}{pop} ifelse _ptibuf { exch _pticomps mul exch 255 div _ptiscale mul _pti0 add _ptiproc _pticomps 2 add -2 roll _pticomps 1 sub -1 0 { 1 index add 2 index exch 5 -1 roll 255 mul cvi put } for pop pop } ci6stringapply } ci6concatprocs false _pticomps /ci6colorimage load null eq {7 {pop} repeat}{ci6colorimage} ifelse } ifelse } ifelse } def /ci6graytintimage { /_gtigray 5 -1 roll store {1 _gtigray sub mul 1 exch sub} 4 1 roll /DeviceGray ci6proctintimage } def /ci6cmyktintimage { /_cticmyk 5 -1 roll store {_cticmyk {1 index mul exch} forall pop} 4 1 roll /DeviceCMYK ci6proctintimage } def /ci6rgbtintimage { /_rtirgb 5 -1 roll store {_rtirgb {1 exch sub 1 index mul 1 exch sub exch} forall pop} 4 1 roll /DeviceRGB ci6proctintimage } def /ci6tintimage { ci6testplate -1 eq { ci6colorexpand 3 -1 roll 5 -1 roll {0}{0 exch} ifelse 4 2 roll dup /DeviceGray eq { pop ci6graytintimage }{ dup /DeviceRGB eq { pop ci6rgbtintimage }{ pop ci6cmyktintimage } ifelse } ifelse }{ dup ci6marksplate { plateindex 5 lt { ci6colortocmyk plateindex get dup 0 eq ci6curoverprint and { 7 {pop} repeat }{ 1 exch sub exch {1 0}{0 1} ifelse () ci6graytintimage } ifelse }{ pop exch {0}{0 exch} ifelse 0 3 1 roll () ci6graytintimage } ifelse }{ ci6curoverprint { 8 {pop} repeat }{ pop pop pop {pop 1} 0 1 () /DeviceGray ci6proctintimage } ifelse } ifelse } ifelse } def /XINullImage { } def /XIImageMask { XIImageWidth XIImageHeight false [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load imagemask } def /XIImageTint { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load XIType 3 eq XIColorValues XIColorSpace ci6tintimage } def /XIImage { XIImageWidth XIImageHeight XIBitsPerPixel [XIImageWidth 0 0 XIImageHeight neg 0 0] /XIDataProc load false XIChannelCount XIPlateList ci6drawimage } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale /_lp /null ddef _fc /_lp /imagemask ddef end } def /XH { Adobe_ColorImage_AI6_Vars begin grestore end } def /XIEnable { Adobe_ColorImage_AI6_Vars /XIEnable 3 -1 roll put } def /XC { Adobe_ColorImage_AI6_Vars begin ci6colormake /XIColorSpace exch def /XIColorValues exch def end } def /XIPlates { Adobe_ColorImage_AI6_Vars begin /XIPlateList exch def end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIType exch def cvi dup 256 idiv /XICompression exch store 256 mod /XIEncoding exch store pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi }{ XIImageWidth XIChannelCount mul } ifelse /XIRowBytes exch def XIEnable { /XIBuffer3 XIImageWidth string def XICompression 0 eq { /XIBuffer1 XIRowBytes string def XIEncoding 0 eq { {currentfile XIBuffer1 readhexstring pop} }{ {currentfile XIBuffer1 readstring pop} } ifelse }{ /XIBuffer1 256 string def /XIBuffer2 XIRowBytes string def {currentfile XIBuffer1 readline pop (%) anchorsearch {pop} if} /ASCII85Decode filter /DCTDecode filter /XIFile exch def {XIFile XIBuffer2 readstring pop} } ifelse /XIDataProc exch def XIType 1 ne { 0 setgray } if XIType 1 eq { XIImageMask }{ XIType 2 eq XIType 3 eq or { XIImageTint }{ XIImage } ifelse } ifelse }{ XINullImage } ifelse /XIPlateList false def grestore end } def end currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 112 dict dup begin put /_?cmyk false def /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_lineorientation 0 def /_charorientation 0 def /_yokoorientation 0 def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_shift [0 0] def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fontSize 0 def /_fontAscent 0 def /_fontDescent 0 def /_fontHeight 0 def /_fontRotateAdjust 0 def /Ss 256 string def Ss 0 (fonts/) putinterval /_cnt 0 def /_scale [1 1] def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_hfname 100 string def /_hffound false def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_rgbf 3 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_rgbs 3 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /_lobyte 0 def /_hibyte 0 def /_cproc null def /_cscript 0 def /_hvax 0 def /_hvay 0 def /_hvwb 0 def /_hvcx 0 def /_hvcy 0 def /_bitfont null def /_bitlobyte 0 def /_bithibyte 0 def /_bitkey null def /_bitdata null def /_bitindex 0 def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 100 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin /_aicmykps where {pop /_?cmyk _aicmykps def}if discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /hswj { dup stringwidth 3 2 roll { _hvwb eq { exch _hvcx add exch _hvcy add } if exch _hvax add exch _hvay add } cforall } def /vswj { 0 0 3 -1 roll { dup 255 le _charorientation 1 eq and { dup cstring stringwidth 5 2 roll _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub 4 -1 roll sub exch 3 -1 roll sub exch } { _hvwb eq { exch _hvcy sub exch _hvcx sub } if exch _hvay sub exch _hvax sub _fontHeight sub } ifelse } cforall } def /swj { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hswj } { vswj } ifelse } def /sw { 0 0 0 6 3 roll swj } def /vjss { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index setmatrix stroke grestore _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index setmatrix stroke grestore moveto pop pop } ifelse } cforall 6 npop } def /hjss { 4 1 roll { dup cstring gsave false charpath currentpoint 5 index setmatrix stroke grestore moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jss { _lineorientation 0 eq { hjss } { vjss } ifelse } def /ss { 0 0 0 7 3 roll jss } def /vjsp { 4 1 roll { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto false charpath currentpoint _fontRotateAdjust sub moveto _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto 90 rotate } { currentpoint _fontHeight sub 5 index sub 3 index _sp eq { 9 index sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto 2 index false charpath moveto pop pop } ifelse } cforall 6 npop } def /hjsp { 4 1 roll { dup cstring false charpath _sp eq { 5 index 5 index rmoveto } if 2 copy rmoveto } cforall 6 npop } def /jsp { matrix currentmatrix _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /sp { matrix currentmatrix 0 0 0 7 3 roll _lineorientation 0 eq {hjsp} {vjsp} ifelse } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /_rgbtocmyk { 3 { 1 exch sub 3 1 roll } repeat 3 copy 1 4 1 roll 3 { 3 index 2 copy gt { exch } if pop 4 1 roll } repeat pop pop pop 4 1 roll 3 { 3 index sub 3 1 roll } repeat 4 -1 roll } def /setrgbfill { _rgbf astore pop /_fc { _lp /fill ne { _of setoverprint _rgbf aload pop setrgbcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /setrgbstroke { _rgbs astore pop /_sc { _lp /stroke ne { _os setoverprint _rgbs aload pop setrgbcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xa { _?cmyk { 3 npop k }{ setrgbfill 4 npop } ifelse } def /XA { _?cmyk { 3 npop K }{ setrgbstroke 4 npop } ifelse } def /Xs { /_gf exch ddef 5 npop /_fc { _lp /fill ne { _of setoverprint _gf setAIseparationgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XS { /_gs exch ddef 5 npop /_sc { _lp /stroke ne { _os setoverprint _gs setAIseparationgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /Xx { exch /_gf exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /XX { exch /_gs exch ddef 0 eq { findcmykcustomcolor }{ _?cmyk {true}{/findrgbcustomcolor where{pop false}{true}ifelse}ifelse { 4 1 roll 3 npop findcmykcustomcolor }{ 8 -4 roll 4 npop findrgbcustomcolor } ifelse } ifelse /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc hvashow } ddef /_pjsf { _fc hvawidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /XK { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll K } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop XA } ifelse } def /Xk { 3 -1 roll pop 0 eq { 1 exch sub 3 {dup 3 1 roll mul 5 1 roll} repeat mul 4 1 roll k } { 1 exch sub 4 1 roll 3 {1 exch sub 3 index mul 1 exch sub 3 1 roll} repeat 4 -1 roll pop Xa } ifelse } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /Xt { pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if endString eq { cleartomark stop } if }ifelse } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer {readline} stopped { % assume error was due to overfilling the buffer }{ not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse }ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 6 npop 7 2 roll 5 npop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { /clipForward? true def /Tx /pop load def /Tj /pop load def currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 4 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setrgbcolor { 3 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end /XP { 4 npop } bind def /XD { pop } bind def end setpacking currentpacking true setpacking userdict /Adobe_cshow 14 dict dup begin put /initialize { Adobe_cshow begin Adobe_cshow { dup xcheck { bind } if pop pop } forall end Adobe_cshow begin } def /terminate { currentdict Adobe_cshow eq { end } if } def /cforall { /_lobyte 0 ddef /_hibyte 0 ddef /_cproc exch ddef /_cscript currentfont /FontScript known { currentfont /FontScript get } { -1 } ifelse ddef { /_lobyte exch ddef _hibyte 0 eq _cscript 1 eq _lobyte 129 ge _lobyte 159 le and _lobyte 224 ge _lobyte 252 le and or and _cscript 2 eq _lobyte 161 ge _lobyte 254 le and and _cscript 3 eq _lobyte 161 ge _lobyte 254 le and and _cscript 25 eq _lobyte 161 ge _lobyte 254 le and and _cscript -1 eq or or or or and { /_hibyte _lobyte ddef } { _hibyte 256 mul _lobyte add _cproc /_hibyte 0 ddef } ifelse } forall } def /cstring { dup 256 lt { (s) dup 0 4 3 roll put } { dup 256 idiv exch 256 mod (hl) dup dup 0 6 5 roll put 1 4 3 roll put } ifelse } def /clength { 0 exch { 256 lt { 1 } { 2 } ifelse add } cforall } def /hawidthshow { { dup cstring show _hvax _hvay rmoveto _hvwb eq { _hvcx _hvcy rmoveto } if } cforall } def /vawidthshow { { dup 255 le _charorientation 1 eq and { -90 rotate 0 _fontRotateAdjust rmoveto cstring _hvcx _hvcy _hvwb _hvax _hvay 6 -1 roll awidthshow 0 _fontRotateAdjust neg rmoveto 90 rotate } { currentpoint _fontHeight sub exch _hvay sub exch _hvax sub 2 index _hvwb eq { exch _hvcy sub exch _hvcx sub } if 3 2 roll cstring dup stringwidth pop 2 div neg _fontAscent neg rmoveto show moveto } ifelse } cforall } def /hvawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef _lineorientation 0 eq { hawidthshow } { vawidthshow } ifelse } def /hvwidthshow { 0 0 3 -1 roll hvawidthshow } def /hvashow { 0 0 0 6 -3 roll hvawidthshow } def /hvshow { 0 0 0 0 0 6 -1 roll hvawidthshow } def currentdict readonly pop end setpacking userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_shading_AI8 10 dict dup begin put /initialize { Adobe_shading_AI8 begin Adobe_shading_AI8 bdprocs Mesh /initialize get exec } def /terminate { currentdict Adobe_shading_AI8 eq { end } if } def /bdprocs { { dup xcheck 1 index type /arraytype eq and { bind } if pop pop } forall } def /X! {pop} def /X# {pop pop} def /Mesh 40 dict def Mesh begin /initialize { Mesh bdprocs Mesh begin /emulate? /AI8MeshEmulation where { pop AI8MeshEmulation }{ systemdict /shfill known not } ifelse def end } def /bd { shadingdict begin } def /paint { emulate? { end }{ /_lp /none ddef _fc /_lp /none ddef /AIColorSpace AIColorSpace tocolorspace store /ColorSpace AIColorSpace topsspace store version_ge_3010.106 not systemdict /setsmoothness known and { 0.0001 setsmoothness } if composite? { /DataSource getdatasrc def Matrix concat currentdict end shfill }{ AIColorSpace makesmarks AIPlateList markingplate and not isoverprint and { end }{ /ColorSpace /DeviceGray store /Decode [0 1 0 1 0 1] store /DataSource getplatesrc def Matrix concat currentdict end shfill } ifelse } ifelse } ifelse } def /shadingdict 12 dict def shadingdict begin /ShadingType 6 def /BitsPerCoordinate 16 def /BitsPerComponent 8 def /BitsPerFlag 8 def end /datafile null def /databuf 256 string def /dataptr 0 def /srcspace null def /srcchannels 0 def /dstchannels 0 def /dstplate 0 def /srctodstcolor null def /getplatesrc { /srcspace AIColorSpace store /srcchannels AIColorSpace getnchannels store /dstchannels 1 store /dstplate getplateindex store /srctodstcolor srcspace makesmarks { dstplate 4 eq { {1 exch sub} }{ {srcspace tocmyk 3 dstplate sub index 1 exch sub 5 1 roll 4 {pop} repeat} } ifelse }{ {srcchannels {pop} repeat 1} } ifelse store /datafile getdatasrc store /rdpatch168 load DataLength () /SubFileDecode filter } def /getdatasrc { /rdcmntline load /ASCII85Decode filter } def /rdpatch168 { /dataptr 0 store 49 rdcount 4 { dup {pop srcchannels getint8} if dup {pop srctodstcolor dstchannels putint8 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdpatch3216 { /dataptr 0 store 97 rdcount 4 { dup {pop srcchannels getint16} if dup {pop srctodstcolor dstchannels putint16 true} if } repeat {databuf 0 dataptr getinterval}{()} ifelse } def /rdcount { dup 0 gt { datafile databuf dataptr 4 -1 roll getinterval readstring exch length dataptr add /dataptr exch store }{ true } ifelse } def /getint8 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 255 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint8 { dup dataptr add /dataptr exch store dataptr exch { 1 sub exch 255 mul cvi databuf 2 index 3 -1 roll put } repeat pop } def /getint16 { mark true 3 -1 roll { dup {pop datafile read} if dup {pop 256 mul datafile read} if dup {pop add 65535 div true} if } repeat { counttomark 1 add -1 roll pop true }{ cleartomark false } ifelse } def /putint16 { dup 2 mul dataptr add /dataptr exch store dataptr exch { 2 sub exch 65535 mul cvi dup 256 idiv databuf 3 index 3 -1 roll put 256 mod databuf 2 index 1 add 3 -1 roll put } repeat pop } def /srcbuf 256 string def /rdcmntline { currentfile srcbuf readline pop (%) anchorsearch {pop} if } def /getplateindex { 0 [cyan? magenta? yellow? black? customColor?] {{exit} if 1 add} forall } def /aicsarray 4 array def /aicsaltvals 4 array def /aicsaltcolr aicsaltvals def /tocolorspace { dup type /arraytype eq { mark exch aload pop aicsarray 0 3 -1 roll put aicsarray 1 3 -1 roll put dup aicsarray 2 3 -1 roll put gettintxform aicsarray 3 3 -1 roll put counttomark aicsaltvals 0 3 -1 roll getinterval /aicsaltcolr exch store aicsaltcolr astore pop pop aicsarray } if } def /subtintxform {aicsaltcolr {1 index mul exch} forall pop} def /addtintxform {aicsaltcolr {1 sub 1 index mul 1 add exch} forall pop} def /gettintxform { /DeviceRGB eq {/addtintxform}{/subtintxform} ifelse load } def /getnchannels { dup type /arraytype eq {0 get} if colorspacedict exch get begin Channels end } def /makesmarks { composite? { pop true }{ dup dup type /arraytype eq {0 get} if colorspacedict exch get begin MarksPlate end } ifelse } def /markingplate { composite? { pop true }{ dup type /arraytype eq { dup length getplateindex gt {getplateindex get}{pop false} ifelse } if } ifelse } def /tocmyk { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToCMYK end } def /topsspace { dup dup type /arraytype eq {0 get} if colorspacedict exch get begin ToPSSpace end } def /colorspacedict 5 dict dup begin /DeviceGray 4 dict dup begin /Channels 1 def /MarksPlate {pop black?} def /ToCMYK {pop 1 exch sub 0 0 0 4 -1 roll} def /ToPSSpace {} def end def /DeviceRGB 4 dict dup begin /Channels 3 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop _rgbtocmyk} def /ToPSSpace {} def end def /DeviceCMYK 4 dict dup begin /Channels 4 def /MarksPlate {pop isCMYKSep?} def /ToCMYK {pop} def /ToPSSpace {} def end def /Separation 4 dict dup begin /Channels 1 def /MarksPlate { /findcmykcustomcolor where { pop dup 1 exch ToCMYK 5 -1 roll 1 get findcmykcustomcolor 1 setcustomcolor systemdict /currentgray get exec 1 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace {} def end def /Process 4 dict dup begin /Channels 1 def /MarksPlate { isCMYKSep? { 1 exch ToCMYK 4 array astore getplateindex get 0 ne }{ pop false } ifelse } def /ToCMYK { dup 2 get mark exch 4 2 roll 3 get exec counttomark -1 roll tocmyk 5 -1 roll pop } def /ToPSSpace { 4 array copy dup 0 /Separation put } def end def end def /isoverprint { /currentoverprint where {pop currentoverprint}{_of} ifelse } def /version_ge_3010.106 { version {cvr} stopped { pop false }{ 3010.106 ge } ifelse } def end end defaultpacking setpacking userdict /_useSmoothShade false put userdict /_aicmykps false put userdict /_forceToCMYK false put Adobe_level2_AI5 /initialize get exec Adobe_cshow /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_shading_AI8 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla /hungarumlaut/ogonek/caron TE %AI55J_Tsume: None %AI3_BeginEncoding: _Times-Roman Times-Roman [/_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType [161/degree 173/notequal 176/infinity/plusminus/lessequal/greaterequal 181/mu/partialdiff/summation/product/pi/integral 189/Omega 195/radical 197/approxequal 198/Delta 214/divide/lozenge 240/apple /_Symbol_/Symbol 0 0 0 TZ %AI5_Begin_NonPrinting Np %AI3_BeginPattern: (Brick) (Brick) 0 0 72 72 [ %AI3_Tile (0 O 0 R 0.3 0.85 0.85 0 k 0.3 0.85 0.85 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 0 m 0 72 L 72 72 L 72 0 L 0 0 L f %AI6_EndPatternLayer ) & (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 0 68.4097 m 72 68.4097 l S 0 61.209 m 72 61.209 L S 0 54.0088 m 72 54.0088 L S 0 46.8076 m 72 46.8076 L S 0 39.6084 m 72 39.6084 L S 0 32.4072 m 72 32.4072 L S 0 25.207 m 72 25.207 L S 0 18.0059 m 72 18.0059 L S 0 10.8057 m 72 10.8057 L S 0 3.6064 m 72 3.6064 L S 68.4102 68.4097 m 68.4102 61.2217 l S 54.0098 68.4097 m 54.0098 61.2217 L S 39.6094 68.4097 m 39.6094 61.2217 L S 25.21 68.4097 m 25.21 61.2217 L S 10.8105 68.4097 m 10.8105 61.2217 L S 68.4102 53.9717 m 68.4102 46.7842 l S 54.0098 53.9717 m 54.0098 46.7842 L S 39.6094 53.9717 m 39.6094 46.7842 L S 25.21 53.9717 m 25.21 46.7842 L S 10.8105 53.9717 m 10.8105 46.7842 L S 68.4102 39.5967 m 68.4102 32.4092 l S 54.0098 39.5967 m 54.0098 32.4092 L S 39.6094 39.5967 m 39.6094 32.4092 L S 25.21 39.5967 m 25.21 32.4092 L S 10.8105 39.5967 m 10.8105 32.4092 L S 68.4102 25.2217 m 68.4102 18.0342 l S 54.0098 25.2217 m 54.0098 18.0342 L S 39.6094 25.2217 m 39.6094 18.0342 L S 25.21 25.2217 m 25.21 18.0342 L S 10.8105 25.2217 m 10.8105 18.0342 L S 68.4102 10.7842 m 68.4102 3.5967 l S 54.0098 10.7842 m 54.0098 3.5967 L S 39.6094 10.7842 m 39.6094 3.5967 L S 25.21 10.7842 m 25.21 3.5967 L S 10.8105 10.7842 m 10.8105 3.5967 L S 61.1973 3.5967 m 61.1973 0 L S 46.7969 3.5967 m 46.7969 0 L S 32.3965 3.5967 m 32.3965 0 L S 17.9971 3.5967 m 17.9971 0 L S 3.5967 3.5967 m 3.5967 0 l S 61.1973 18.0342 m 61.1973 10.8467 L S 46.7969 18.0342 m 46.7969 10.8467 L S 32.3965 18.0342 m 32.3965 10.8467 L S 17.9971 18.0342 m 17.9971 10.8467 L S 3.5967 18.0342 m 3.5967 10.8467 l S 61.1973 32.4092 m 61.1973 25.2217 L S 46.7969 32.4092 m 46.7969 25.2217 L S 17.9971 32.4092 m 17.9971 25.2217 L S 3.5967 32.4092 m 3.5967 25.2217 l S 61.1973 46.7842 m 61.1973 39.5967 L S 46.7969 46.7842 m 46.7969 39.5967 L S 32.3965 46.7842 m 32.3965 39.5967 L S 17.9971 46.7842 m 17.9971 39.5967 L S 3.5967 46.7842 m 3.5967 39.5967 l S 61.1973 61.2217 m 61.1973 54.0347 L S 46.7969 61.2217 m 46.7969 54.0347 L S 32.3965 61.2217 m 32.3965 54.0347 L S 17.9971 61.2217 m 17.9971 54.0347 L S 3.5967 61.2217 m 3.5967 54.0347 l S 61.1973 71.959 m 61.1973 68.4717 L S 46.7969 71.959 m 46.7969 68.4717 L S 32.3965 71.959 m 32.3965 68.4717 L S 17.9971 71.959 m 17.9971 68.4717 L S 3.5967 71.959 m 3.5967 68.4717 l S 32.3965 32.4092 m 32.3965 25.2217 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Confetti) (Confetti) 4.85 3.617 76.85 75.617 [ %AI3_Tile (0 O 0 R 1 g 1 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 4.85 3.617 m 4.85 75.617 L 76.85 75.617 L 76.85 3.617 L 4.85 3.617 L f %AI6_EndPatternLayer ) & (0 O 0 R 0 g 0 G ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 0.3 w 4 M []0 d %AI3_Note: 0 D 0 XR 10.6 64.867 m 7.85 62.867 l S 9.1 8.617 m 6.85 6.867 l S 78.1 68.617 m 74.85 67.867 l S 76.85 56.867 m 74.35 55.117 l S 79.6 51.617 m 76.6 51.617 l S 76.35 44.117 m 73.6 45.867 l S 78.6 35.867 m 76.6 34.367 l S 76.1 23.867 m 73.35 26.117 l S 78.1 12.867 m 73.85 13.617 l S 68.35 14.617 m 66.1 12.867 l S 76.6 30.617 m 73.6 30.617 l S 62.85 58.117 m 60.956 60.941 l S 32.85 59.617 m 31.196 62.181 l S 47.891 64.061 m 49.744 66.742 l S 72.814 2.769 m 73.928 5.729 l S 67.976 2.633 m 67.35 5.909 l S 61.85 27.617 m 59.956 30.441 l S 53.504 56.053 m 51.85 58.617 l S 52.762 1.779 m 52.876 4.776 l S 45.391 5.311 m 47.244 7.992 l S 37.062 3.375 m 35.639 5.43 l S 55.165 34.828 m 57.518 37.491 l S 20.795 3.242 m 22.12 5.193 l S 14.097 4.747 m 15.008 8.965 l S 9.736 1.91 m 8.073 4.225 l S 31.891 5.573 m 32.005 8.571 l S 12.1 70.367 m 15.6 68.867 l S 9.35 54.867 m 9.6 58.117 l S 12.85 31.867 m 14.35 28.117 l S 10.1 37.367 m 12.35 41.117 l S 34.1 71.117 m 31.85 68.617 l S 38.35 71.117 m 41.6 68.367 l S 55.1 71.117 m 58.35 69.117 l S 57.35 65.117 m 55.35 61.867 l S 64.35 66.367 m 69.35 68.617 l S 71.85 62.867 m 69.35 61.117 l S 23.6 70.867 m 23.6 67.867 l S 20.6 65.867 m 17.35 65.367 l S 24.85 61.367 m 25.35 58.117 l S 25.85 65.867 m 29.35 66.617 l S 14.1 54.117 m 16.85 56.117 l S 12.35 11.617 m 12.6 15.617 l S 12.1 19.867 m 14.35 22.367 l S 26.1 9.867 m 23.6 13.367 l S 34.6 47.117 m 32.1 45.367 l S 62.6 41.867 m 59.85 43.367 l S 31.6 35.617 m 27.85 36.367 l S 36.35 26.117 m 34.35 24.617 l S 33.85 14.117 m 31.1 16.367 l S 37.1 9.867 m 35.1 11.117 l S 34.35 20.867 m 31.35 20.867 l S 44.6 56.617 m 42.1 54.867 l S 47.35 51.367 m 44.35 51.367 l S 44.1 43.867 m 41.35 45.617 l S 43.35 33.117 m 42.6 30.617 l S 43.85 23.617 m 41.1 25.867 l S 44.35 15.617 m 42.35 16.867 l S 67.823 31.1 m 64.823 31.1 l S 27.1 32.617 m 29.6 30.867 l S 31.85 55.117 m 34.85 55.117 l S 19.6 40.867 m 22.1 39.117 l S 16.85 35.617 m 19.85 35.617 l S 20.1 28.117 m 22.85 29.867 l S 52.1 42.617 m 54.484 44.178 l S 52.437 50.146 m 54.821 48.325 l S 59.572 54.133 m 59.35 51.117 l S 50.185 10.055 m 53.234 9.928 l S 51.187 15.896 m 53.571 14.075 l S 58.322 19.883 m 59.445 16.823 l S 53.1 32.117 m 50.6 30.367 l S 52.85 24.617 m 49.6 25.617 l S 61.85 9.117 m 59.1 10.867 l S 69.35 34.617 m 66.6 36.367 l S 67.1 23.617 m 65.1 22.117 l S 24.435 46.055 m 27.484 45.928 l S 25.437 51.896 m 27.821 50.075 l S 62.6 47.117 m 65.321 46.575 l S 19.85 19.867 m 20.35 16.617 l S 21.85 21.867 m 25.35 22.617 l S 37.6 62.867 m 41.6 62.117 l S 38.323 42.1 m 38.823 38.6 l S 69.35 52.617 m 66.85 53.867 l S 14.85 62.117 m 18.1 59.367 l S 9.6 46.117 m 7.1 44.367 l S 20.6 51.617 m 18.6 50.117 l S 46.141 70.811 m 47.994 73.492 l S 69.391 40.561 m 71.244 43.242 l S 38.641 49.311 m 39.35 52.117 l S 25.141 16.811 m 25.85 19.617 l S 36.6 32.867 m 34.6 31.367 l S 6.1 68.617 m 2.85 67.867 l S 4.85 56.867 m 2.35 55.117 l S 7.6 51.617 m 4.6 51.617 l S 6.6 35.867 m 4.6 34.367 l S 6.1 12.867 m 1.85 13.617 l S 4.6 30.617 m 1.6 30.617 l S 72.814 74.769 m 73.928 77.729 l S 67.976 74.633 m 67.35 77.909 l S 52.762 73.779 m 52.876 76.776 l S 37.062 75.375 m 35.639 77.43 l S 20.795 75.242 m 22.12 77.193 l S 9.736 73.91 m 8.073 76.225 l S 10.1 23.617 m 6.35 24.367 l S 73.217 18.276 m 71.323 21.1 l S 28.823 39.6 m 29.505 42.389 l S 49.6 38.617 m 47.6 37.117 l S 60.323 73.6 m 62.323 76.6 l S 60.323 1.6 m 62.323 4.6 l S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Leaves - Fall ) (Leaves - Fall ) 0 0 64.0781 78.9336 [ %AI3_Tile (0 O 0 R 0.05 0.2 1 0 k 0.05 0.2 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR 64.0781 78.9336 m 64.0781 0 L 0 0 L 0 78.9336 L 64.0781 78.9336 L f %AI6_EndPatternLayer ) & (0 O 0 R 0.83 0 1 0 k 0.83 0 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 1 D 0 XR 29.7578 0.9902 m 30.4346 1.1914 30.7246 1.3428 V 29.2559 4.0547 33.707 8.3359 34.627 9.0762 C 35.2275 8.8506 35.3477 6.3184 34.6699 4.9805 C 35.5137 5.1035 37.7031 3.7256 38.4609 2.4365 C 38.5254 3.125 40.0957 6.0664 40.9219 6.4434 C 40.002 6.8408 39.3359 8.3135 38.5742 9.7617 C 39.5957 9.9287 40.9961 9.0078 42.4668 8.1025 C 42.9814 8.9043 44.3555 9.875 45.6143 10.3916 C 44.5264 11.0781 44.0313 11.8203 43.5352 13.2793 C 42.4922 12.7139 40.3057 12.5645 39.7764 12.8516 C 40.291 13.9648 42.5371 14.5078 43.2676 14.4551 C 43.0137 15.3164 42.8652 17.4697 43.0391 20.0625 C 41.3789 18.7461 39.834 17.4297 38.1738 17.4883 C 38.4434 16.0664 37.8076 14.2607 37.4307 13.7676 C 36.8574 14.5117 36.4463 15.3389 36.8008 17.3164 C 35.3486 17.8008 34.1113 18.3467 32.7373 19.6045 C 32.7373 17.7734 32.166 16.5723 31.2969 15.2959 C 32.5576 14.8076 33.8301 13.6045 33.8252 12.5664 C 32.9775 12.7178 31.2852 13.4619 30.793 14.4551 C 30.0742 13.707 28.3906 12.3984 26.7871 12.3945 C 27.9746 11.5391 28.8945 10.5059 28.9893 8.5938 C 30.2422 9.5645 32.6953 10.1797 34.0752 9.582 C 29.2344 5.3457 29.7031 2.3125 29.7578 0.9902 C f 13.8525 29.9844 m 13.3281 29.5127 13.1309 29.25 V 15.623 27.4326 13.3691 21.6074 12.8555 20.5439 C 12.2168 20.4883 10.8096 23.2285 10.8457 24.7266 C 9.7129 23.9707 8.0488 24.0918 6.4463 24.3779 C 7.0186 23.2891 6.6172 21.3447 5.8164 20.5439 C 6.8184 20.5801 8.1699 19.8652 9.4785 18.8838 C 8.6436 18.0645 6.8164 18.2246 4.9004 18.8838 C 4.9004 17.5107 4.0781 15.7734 3.2412 14.5918 C 4.5576 14.6484 5.7031 13.9629 6.5605 12.9316 C 7.2256 14.5 9.2598 15.6133 10.166 15.5645 C 10.1826 14.1992 8.6094 12.1094 7.5879 11.7109 C 8.1875 11.041 9.207 9.5107 10.166 7.0947 C 10.9648 9.0205 12.1348 10.2627 13.3672 11.1953 C 12.2256 12.7578 12.3994 13.6289 12.7988 15.1074 C 13.541 14.5664 14.5723 14.1338 14.7441 12.1309 C 16.4609 12.416 17.5957 12.3447 19.0938 11.4434 C 18.6387 13.1055 18.6348 14.707 18.9551 16.4063 C 17.1055 16.2666 15.5449 16.4795 14.5156 17.9688 C 15.3457 18.1953 17.6055 18.2549 18.4795 17.3223 C 18.8066 18.3047 19.7012 19.7109 21.1475 20.4043 C 19.707 20.6641 18.7227 21.7637 17.8135 23.4492 C 17.1006 22.0332 14.873 20.3691 13.3711 20.3145 C 15.373 24.3779 15.373 27.2959 13.8525 29.9844 C f 41.2324 26.0742 m 41.5518 26.7021 41.7549 26.959 V 44.1523 25.0176 48.958 28.3262 49.8535 29.0957 C 49.7432 29.7266 47.6182 30.8643 45.9004 29.834 C 46.3408 31.123 45.4395 33.084 44.2402 34.126 C 45.9805 34.0254 48.126 35.3867 48.6484 36.1289 C 48.8701 35.1514 50.0527 33.8809 51.3379 32.8672 C 51.6895 33.8398 50.9941 35.958 50.0781 37.5605 C 51.3125 38.0605 52.4248 38.9912 52.8828 40.25 C 53.3398 38.9336 54.3428 38.2598 55.6875 37.5039 C 54.5273 36.0762 53.7471 33.9023 54.0273 33.0391 C 55.3496 33.374 56.9209 36.0918 57.0439 37.1816 C 57.9189 36.415 59.4727 35.7285 62.0537 35.4219 C 60.3535 34.3438 59.9902 32.3516 59.4063 30.9219 C 58.2588 31.3682 56.0898 31.4277 55.1152 30.8643 C 55.8281 30.2852 57.168 29.7344 59.1777 29.7207 C 59.1777 28.1758 59.6406 27.043 60.8945 25.8281 C 59.1719 25.8418 57.0723 25.3555 55.5762 24.9629 C 55.3281 26.292 54.4844 27.8887 53.3398 28.2891 C 53.334 27.4277 53.5996 25.1797 54.4844 24.5117 C 53.6201 23.9443 52.3672 22.5674 51.9102 20.8496 C 51.2881 22.1758 50.4268 23.4805 48.5645 23.9238 C 49.749 24.9766 50.584 26.9941 50.25 28.4609 C 45.1973 24.4785 42.5215 25.7773 41.2324 26.0742 C f 27.7578 38.7324 m 28.4346 38.9316 28.7246 39.084 V 27.2559 41.7969 31.707 46.0776 32.627 46.8169 C 33.2275 46.5918 33.3477 44.0586 32.6699 42.7227 C 33.5137 42.8457 35.7031 41.4678 36.4609 40.1787 C 36.5254 40.8652 38.0957 43.8066 38.9219 44.1846 C 38.002 44.582 37.3359 46.0547 36.5742 47.5039 C 37.5957 47.6709 38.9961 46.7485 40.4668 45.8438 C 40.9814 46.6445 42.3555 47.6177 43.6143 48.1328 C 42.5264 48.8198 42.0313 49.5615 41.5352 51.0205 C 40.4922 50.4556 38.3057 50.3057 37.7764 50.5938 C 38.291 51.7056 40.5371 52.2485 41.2676 52.1958 C 41.0137 53.0576 40.8652 55.2109 41.0391 57.8037 C 39.3789 56.4878 37.834 55.1719 36.1738 55.2285 C 36.4434 53.8076 35.8076 52.002 35.4307 51.5088 C 34.8574 52.2529 34.4463 53.0796 34.8008 55.0576 C 33.3486 55.5425 32.1113 56.0879 30.7373 57.3467 C 30.7373 55.5146 30.166 54.314 29.2969 53.0366 C 30.5576 52.5488 31.8301 51.3467 31.8252 50.3076 C 30.9775 50.46 29.2852 51.2036 28.793 52.1958 C 28.0742 51.4497 26.3906 50.1396 24.7871 50.1357 C 25.9746 49.2817 26.8945 48.2466 26.9893 46.335 C 28.2422 47.3057 30.6953 47.9209 32.0752 47.3237 C 27.2344 43.0869 27.7031 40.0547 27.7578 38.7324 C f 13.5195 70.3916 m 12.9941 69.9209 12.7988 69.6587 V 15.2891 67.8418 13.0352 62.0146 12.5225 60.9517 C 11.8828 60.8955 10.4766 63.6367 10.5117 65.1348 C 9.3809 64.3789 7.7148 64.4995 6.1133 64.7856 C 6.6855 63.6987 6.2842 61.7529 5.4834 60.9517 C 6.4854 60.9878 7.8359 60.2729 9.1455 59.2925 C 8.3105 58.4717 6.4834 58.6338 4.5674 59.2925 C 4.5674 57.9189 3.7461 56.1816 2.9082 54.9995 C 4.2246 55.0576 5.3691 54.3706 6.2275 53.3408 C 6.8926 54.9097 8.9258 56.0215 9.832 55.9727 C 9.8496 54.6079 8.2764 52.5176 7.2539 52.1187 C 7.8545 51.4497 8.873 49.9189 9.832 47.5039 C 10.6309 49.4297 11.8008 50.6719 13.0342 51.6045 C 11.8926 53.1655 12.0664 54.0366 12.4648 55.5146 C 13.209 54.9746 14.2393 54.5415 14.4102 52.5386 C 16.127 52.8247 17.2637 52.7529 18.7598 51.8525 C 18.3057 53.5137 18.3027 55.1147 18.623 56.8149 C 16.7725 56.6748 15.2129 56.8887 14.1826 58.377 C 15.0117 58.6035 17.2725 58.6626 18.1465 57.731 C 18.4736 58.7129 19.3691 60.1187 20.8145 60.8125 C 19.375 61.0728 18.3896 62.1719 17.4805 63.8579 C 16.7676 62.4429 14.541 60.7769 13.0371 60.7227 C 15.041 64.7856 15.041 67.7046 13.5195 70.3916 C f 41.2324 64.4824 m 41.5518 65.1113 41.7549 65.3682 V 44.1523 63.4272 48.958 66.7354 49.8535 67.5034 C 49.7432 68.1362 47.6182 69.2725 45.9004 68.2422 C 46.3408 69.5313 45.4395 71.4922 44.2402 72.5342 C 45.9805 72.4341 48.126 73.7954 48.6484 74.5371 C 48.8701 73.5601 50.0527 72.29 51.3379 71.2754 C 51.6895 72.249 50.9941 74.3662 50.0781 75.9683 C 51.3125 76.4692 52.4248 77.3994 52.8828 78.6582 C 53.3398 77.3423 54.3428 76.667 55.6875 75.9111 C 54.5273 74.4844 53.7471 72.3101 54.0273 71.4473 C 55.3496 71.7822 56.9209 74.5 57.0439 75.5903 C 57.9189 74.8232 59.4727 74.1372 62.0537 73.8311 C 60.3535 72.7534 59.9902 70.7612 59.4063 69.3301 C 58.2588 69.7773 56.0898 69.8364 55.1152 69.2725 C 55.8281 68.6934 57.168 68.1431 59.1777 68.1284 C 59.1777 66.583 59.6406 65.4512 60.8945 64.2373 C 59.1719 64.249 57.0723 63.7632 55.5762 63.3721 C 55.3281 64.7002 54.4844 66.2974 53.3398 66.6973 C 53.334 65.8364 53.5996 63.5874 54.4844 62.9214 C 53.6201 62.353 52.3672 60.9751 51.9102 59.2583 C 51.2881 60.583 50.4268 61.8882 48.5645 62.333 C 49.749 63.3862 50.584 65.4033 50.25 66.8691 C 45.1973 62.8872 42.5215 64.1851 41.2324 64.4824 C f %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI3_BeginPattern: (Stripes) (Stripes) 8.45 4.6001 80.45 76.6001 [ %AI3_Tile (0 O 0 R 1 0.07 1 0 k 1 0.07 1 0 K ) @ ( %AI6_BeginPatternLayer 800 Ar 0 J 0 j 3.6 w 4 M []0 d %AI3_Note: 0 D 0 XR 8.2 8.2 m 80.7 8.2 L S 8.2 22.6001 m 80.7 22.6001 L S 8.2 37.0002 m 80.7 37.0002 L S 8.2 51.4 m 80.7 51.4 L S 8.2 65.8001 m 80.7 65.8001 L S 8.2 15.4 m 80.7 15.4 L S 8.2 29.8001 m 80.7 29.8001 L S 8.2 44.2 m 80.7 44.2 L S 8.2 58.6001 m 80.7 58.6001 L S 8.2 73.0002 m 80.7 73.0002 L S %AI6_EndPatternLayer ) & ] E %AI3_EndPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_BeginBrushPattern (New Pattern 1) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7834.75 8587 m -7834.75 8563 L -7884.75 8563 L -7884.75 8587 L -7834.75 8587 L n u 0 Ap 0 O 1 g -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C F -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C F -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C F -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C F -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C F -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C F -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C F -7844.7817 8565.125 m -7850.9009 8563.6162 -7854.7817 8565.125 V -7858.877 8563.6484 -7864.7817 8565.125 V -7869.7446 8563.4492 -7874.7817 8565.125 V -7880.7969 8563.5742 -7884.7817 8565.125 V -7884.7817 8584.8096 L -7881.6958 8585.7842 -7878.2969 8585.9912 -7874.3799 8584.9082 C -7868.2134 8586.4912 -7864.4634 8584.9082 V -7859.4634 8586.4912 -7854.3799 8584.8242 V -7850.0474 8586.4082 -7844.3799 8584.9082 V -7838.8799 8586.3242 -7834.7817 8585.125 V -7834.7817 8565.4404 L -7837.5254 8564.4287 -7840.6514 8563.9287 -7844.7817 8565.125 C f 0 R 0 G 1 J 1 j 0.5 w -7864.75 8585 m -7872.54 8586.9473 -7878.813 8583.585 -7884.75 8579.0488 C S -7854.75 8585 m -7866.96 8588.0527 -7875.4434 8578.0605 -7884.75 8570.9512 C S -7844.75 8585 m -7861.1279 8589.0947 -7870.8008 8569.7227 -7884.75 8565.3154 C S -7884.75 8565 m -7864.75 8560 -7854.75 8590 -7834.75 8585 C S -7874.75 8565 m -7858.3721 8560.9053 -7848.6992 8580.2773 -7834.75 8584.6846 C S -7864.75 8565 m -7852.54 8561.9473 -7844.0566 8571.9395 -7834.75 8579.0488 C S -7854.75 8565 m -7846.96 8563.0527 -7840.687 8566.415 -7834.75 8570.9512 C S -7844.75 8565 m -7841.1279 8564.0947 -7837.835 8564.3408 -7834.75 8565.3154 C S -7874.75 8585 m -7878.3721 8585.9053 -7881.665 8585.6592 -7884.75 8584.6846 C S U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 2) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7819.187 8586 L -7819.187 8521.9023 L -7884 8521.9023 L -7884 8586 L n u 0 O 0 g -7849.6978 8544.4297 m -7851.6094 8521.9023 L -7853.5215 8544.4297 L -7852.9033 8544.3066 -7852.2642 8544.2402 -7851.6094 8544.2402 c -7850.9551 8544.2402 -7850.3159 8544.3066 -7849.6978 8544.4297 C f -7861.2402 8552.3975 m -7884 8554.3301 L -7861.1138 8556.2734 L -7861.2856 8555.5469 -7861.3848 8554.793 -7861.3848 8554.0156 c -7861.3848 8553.4629 -7861.3281 8552.9248 -7861.2402 8552.3975 C f -7856.519 8545.5723 m -7870.1626 8536.8047 L -7860.2153 8549.377 L -7859.3574 8547.791 -7858.0718 8546.4766 -7856.519 8545.5723 C f -7853.481 8563.6074 m -7851.5786 8586 L -7849.6768 8563.5967 L -7850.3018 8563.7227 -7850.9473 8563.791 -7851.6094 8563.791 c -7852.25 8563.791 -7852.873 8563.7246 -7853.481 8563.6074 C f -7841.9609 8555.5068 m -7819.187 8553.5732 L -7842.083 8551.6289 L -7842.083 8551.8506 L -7841.9258 8552.5488 -7841.834 8553.2695 -7841.834 8554.0156 c -7841.834 8554.5234 -7841.8848 8555.0195 -7841.9609 8555.5068 C f -7860.1138 8558.8262 m -7870.1641 8571.5293 L -7856.2778 8562.6055 L -7857.8823 8561.7305 -7859.2114 8560.416 -7860.1138 8558.8262 C f -7842.9961 8549.3945 m -7832.875 8536.6055 L -7846.7666 8545.5313 L -7845.1768 8546.4414 -7843.8633 8547.7793 -7842.9961 8549.3945 C f -7846.6895 8562.4512 m -7832.873 8571.3281 L -7842.9658 8558.5732 L -7843.8198 8560.1895 -7845.1152 8561.5313 -7846.6895 8562.4512 C f -7842.8887 8558.6133 m -7842.3862 8557.6641 -7842.043 8556.6211 -7841.875 8555.5195 c -7841.7993 8555.0293 -7841.748 8554.5273 -7841.748 8554.0156 c -7841.748 8553.2637 -7841.8398 8552.5352 -7841.998 8551.8311 c -7842.1958 8550.957 -7842.5049 8550.124 -7842.918 8549.3545 c -7843.7954 8547.7246 -7845.1191 8546.374 -7846.7241 8545.4561 c -7847.6294 8544.9375 -7848.6226 8544.5537 -7849.6802 8544.3457 c -7850.3047 8544.2207 -7850.9497 8544.1523 -7851.6094 8544.1523 c -7852.2695 8544.1523 -7852.915 8544.2207 -7853.5391 8544.3457 c -7854.623 8544.5605 -7855.6382 8544.957 -7856.5625 8545.4961 c -7858.1313 8546.4102 -7859.4282 8547.7363 -7860.291 8549.335 c -7860.7969 8550.2695 -7861.145 8551.2969 -7861.3262 8552.3828 c -7861.415 8552.916 -7861.4727 8553.459 -7861.4727 8554.0156 c -7861.4727 8554.8008 -7861.3711 8555.5605 -7861.1978 8556.293 c -7860.981 8557.207 -7860.6406 8558.0732 -7860.187 8558.8701 c -7859.2793 8560.4727 -7857.939 8561.8008 -7856.3174 8562.6826 c -7855.4487 8563.1553 -7854.5 8563.498 -7853.4961 8563.6934 c -7852.8848 8563.8115 -7852.2554 8563.8779 -7851.6094 8563.8779 c -7850.9414 8563.8779 -7850.29 8563.8086 -7849.6602 8563.6826 c -7848.5786 8563.4668 -7847.5664 8563.0654 -7846.6455 8562.5273 c -7845.0566 8561.5977 -7843.751 8560.2441 -7842.8887 8558.6133 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 3) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7874.75 8587 m -7874.75 8563 L -7884.75 8563 L -7884.75 8587 L -7874.75 8587 L n u u 0 Ap 0 O 1 g -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 c -7877.897 8566.9736 -7881.0898 8565 -7884.75 8565 C -7884.75 8585 L -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 c -7881.9121 8584.7754 -7880.1807 8584.0645 -7878.7441 8582.9824 c -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 c f 0 R 0 G 1 J 1 j 0.5 w -7884.75 8565.3174 m -7881.7207 8566.2744 -7878.8926 8567.9326 -7876.1543 8569.9072 C S -7884.75 8570.9512 m -7881.5991 8573.3564 -7878.543 8576.0869 -7875.4058 8578.5361 C S -7878.7441 8582.9824 m -7880.8105 8581.8916 -7882.7993 8580.5342 -7884.75 8579.043 C S -7883.8018 8584.9521 m -7884.1191 8584.8682 -7884.4375 8584.7852 -7884.75 8584.6865 C S -7878.7441 8582.9824 m -7880.1807 8584.0645 -7881.9121 8584.7744 -7883.8018 8584.9521 C S -7875.4058 8578.5361 m -7874.9878 8577.4355 -7874.75 8576.2471 -7874.75 8575 c -7874.75 8573.1377 -7875.2681 8571.4004 -7876.1543 8569.9072 C S -7884.75 8585 m -7884.4297 8585 -7884.1143 8584.9814 -7883.8018 8584.9521 C S -7878.7441 8582.9824 m -7877.2471 8581.8545 -7876.0801 8580.3184 -7875.4058 8578.5361 C S -7876.1543 8569.9072 m -7877.8975 8566.9736 -7881.0898 8565 -7884.75 8565 C S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 5) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7726.3994 8587 m -7726.3994 8573.4199 L -7885 8573.4199 L -7885 8587 L -7726.3994 8587 L n u u 0 O 0.285 0.228 0.171 0 k -7741.0786 8585.4844 m -7741.043 8586.6895 L -7727.5103 8587.5176 -7726.8418 8586.2822 v -7726.7441 8586.1016 -7726.647 8585.7148 -7726.561 8585.1934 C -7728.584 8585.8242 -7738.291 8585.5713 -7741.0786 8585.4844 C f 0.44 0.352 0.264 0 k -7741.4063 8574.0234 m -7741.3711 8575.2676 L -7738.4912 8575.0488 -7728.1914 8574.3164 -7726.543 8574.8652 C -7726.7031 8574.2188 -7726.9199 8573.7646 -7727.2046 8573.6152 c -7728.8306 8572.7656 -7741.4063 8574.0234 Y f 0.145 0.116 0.087 0 k -7741.3711 8575.2676 m -7741.0786 8585.4844 L -7738.291 8585.5713 -7728.584 8585.8242 -7726.561 8585.1934 C -7726.1519 8582.7773 -7725.9258 8577.3604 -7726.543 8574.8652 C -7728.1914 8574.3164 -7738.4912 8575.0488 -7741.3711 8575.2676 C f U u 0.155 0.124 0.093 0 k -7766.9375 8579.2734 m -7765.897 8579.6563 L -7747.0728 8575.1465 L -7747.481 8574.3145 L -7766.3633 8576.7246 L -7767.252 8577.0059 L -7767.6504 8576.8936 -7768.1934 8576.8242 V -7767.6094 8577.2373 -7767.1426 8578.1406 -7766.9375 8579.2734 C f u 0.085 0.068 0.051 0 k -7771.7993 8583.666 m -7772.5977 8583.7217 -7769.749 8583.6641 Y -7770.3481 8583.0176 -7770.771 8581.8203 -7770.8105 8580.4375 c -7770.8169 8580.2246 -7770.8105 8580.0176 -7770.7993 8579.8135 C -7771.041 8579.707 -7771.0918 8579.7734 -7771.6289 8579.5645 C -7771 8583.6113 -7771.7993 8583.666 v f 0.305 0.244 0.183 0 k -7770.3442 8576.8672 m -7770.5527 8576.8105 -7770.4937 8578.9307 Y -7769.4785 8579.7588 L -7767.8359 8578.9434 L -7766.9375 8579.2734 L -7767.1426 8578.1406 -7767.6094 8577.2373 -7768.1934 8576.8242 C -7768.6094 8576.7715 -7769.874 8576.7998 -7770.3442 8576.8672 C f U 0.115 0.092 0.069 0 k -7766.9375 8579.2734 m -7767.8359 8578.9434 L -7769.4785 8579.7588 L -7770.4937 8578.9307 L -7770.793 8579.708 -7770.7993 8579.8135 V -7769.5137 8580.3789 -7768.1831 8580.7402 -7766.8398 8580.9258 C -7766.79 8580.7275 -7766.7842 8580.543 -7766.79 8580.3369 c -7766.7998 8579.9717 -7766.8218 8579.6182 -7766.9375 8579.2734 C f 0.41 0.328 0.246 0 k -7747.4512 8575.3965 m -7749.377 8576.6426 -7758.3862 8582.0986 -7766.8398 8580.9258 C -7766.9038 8582.0928 -7767.248 8583.0908 -7767.75 8583.6631 C -7767.1895 8583.6621 L -7746.7402 8586.7559 L -7747.0366 8576.4258 L -7747.0728 8575.1465 L -7747.2046 8575.2373 -7747.4512 8575.3965 v f 0.395 0.316 0.237 0 k -7770.8105 8580.4375 m -7770.771 8581.8203 -7770.3481 8583.0176 -7769.749 8583.6641 C -7767.6807 8583.6631 L -7767.1782 8583.0908 -7766.8218 8582.0713 -7766.8398 8580.9258 C -7768.1831 8580.7402 -7769.5137 8580.3789 -7770.7993 8579.8135 C -7770.8105 8580.0176 -7770.8169 8580.2246 -7770.8105 8580.4375 c f U u 0 0 0 0.11 k -7741.2642 8574.2012 m -7740.2407 8574.0352 L -7741.2642 8574.2012 L -7741.2642 8574.2012 L f 0 0 0 0.34 k -7747.481 8574.3145 m -7747.0728 8575.1465 L -7745.6714 8574.918 L -7744.5234 8574.7314 L -7742.6758 8574.4307 L -7741.2642 8574.2012 L -7740.2407 8574.0352 L -7740.2954 8573.7168 -7740.3672 8573.498 -7740.4648 8573.4199 C -7747.481 8574.3145 L f 0 0 0 0.32 k -7745.8042 8579.207 m -7746.041 8586.8613 L -7740.7144 8587 L -7739.7266 8583.5146 -7740.1816 8579.1543 V -7745.8042 8579.207 L f U 0.025 0.02 0.015 0 k -7739.3223 8576.3848 m -7736.373 8576.9199 -7733.2402 8577.1602 -7730.3159 8576.3613 c -7730.2856 8576.3496 -7730.2754 8576.3184 -7730.2871 8576.2969 c -7730.2881 8576.2656 -7730.3198 8576.2559 -7730.3418 8576.2559 c -7733.2422 8577.0645 -7736.375 8576.8242 -7739.3042 8576.2783 c -7739.3262 8576.2793 -7739.3574 8576.291 -7739.3672 8576.3223 c -7739.3662 8576.3438 -7739.355 8576.375 -7739.3223 8576.3848 c -7739.3223 8576.3848 l f -7737.8374 8575.3076 m -7737.7295 8575.3789 -7737.6313 8575.4941 -7737.5234 8575.502 c -7733.7886 8575.832 -7730.1631 8575.7813 -7726.4746 8575.6641 c -7726.4526 8575.6641 -7726.4209 8575.6426 -7726.4214 8575.6211 c -7726.4214 8575.5879 -7726.4551 8575.5684 -7726.4766 8575.5684 c -7729.3223 8575.6816 -7732.1401 8575.6992 -7735.0039 8575.5352 c -7735.9336 8575.4766 -7736.9082 8575.7402 -7737.7778 8575.2207 c -7737.7993 8575.2109 -7737.8306 8575.2109 -7737.8506 8575.2334 c -7737.8618 8575.2559 -7737.8594 8575.2871 -7737.8374 8575.3076 c -7737.8374 8575.3076 l f -7733.373 8577.3672 m -7731.5098 8578.6797 -7729.3022 8579.374 -7727.1001 8579.8867 c -7727.0679 8579.8965 -7727.0474 8579.8848 -7727.0366 8579.8535 c -7727.0273 8579.8203 -7727.0488 8579.8008 -7727.0703 8579.79 c -7729.2617 8579.2656 -7731.459 8578.6035 -7733.3105 8577.2803 c -7733.3433 8577.2598 -7733.375 8577.2715 -7733.3848 8577.293 c -7733.4058 8577.3145 -7733.3945 8577.3457 -7733.373 8577.3672 c -7733.373 8577.3672 l f -7738.9321 8584.0566 m -7736.7295 8584.5703 -7734.5298 8585.0303 -7732.2798 8585.2754 c -7732.2598 8585.2852 -7732.229 8585.2637 -7732.229 8585.2422 c -7732.2183 8585.209 -7732.2407 8585.1777 -7732.2729 8585.1787 c -7734.5122 8584.8809 -7736.7305 8584.5176 -7738.9126 8583.9502 c -7738.9351 8583.9512 -7738.9673 8583.9629 -7738.9766 8583.9941 c -7738.9751 8584.0156 -7738.9648 8584.0479 -7738.9321 8584.0566 c -7738.9321 8584.0566 l f -7738.439 8583.3604 m -7736.3457 8584.1973 -7734.1016 8583.9297 -7731.9023 8583.9629 c -7731.8706 8583.9609 -7731.8496 8583.9395 -7731.8506 8583.9082 c -7731.8521 8583.875 -7731.873 8583.8555 -7731.8945 8583.8555 c -7734.0928 8583.8438 -7736.3374 8584.0996 -7738.4209 8583.2529 c -7738.4434 8583.2539 -7738.4746 8583.2656 -7738.4834 8583.2969 c -7738.4834 8583.3184 -7738.4722 8583.3506 -7738.439 8583.3604 c -7738.439 8583.3604 l f -7737.707 8584.7051 m -7736.3833 8584.752 -7735.1504 8584.5469 -7733.8271 8584.209 c -7733.3594 8584.0996 -7732.9199 8584.2266 -7732.4609 8584.2129 c -7731.897 8584.1973 l -7731.874 8584.1963 -7731.8633 8584.1855 -7731.8535 8584.1738 c -7731.834 8584.1523 -7731.8442 8584.1211 -7731.8662 8584.0996 c -7732.0625 8583.9453 l -7732.0742 8583.9453 -7732.085 8583.9355 -7732.0962 8583.9355 c -7732.5 8583.9473 l -7733.9551 8584.1914 -7735.457 8584.6719 -7736.8926 8584.0742 c -7736.9258 8584.0645 -7736.957 8584.0859 -7736.9673 8584.1074 c -7736.9673 8584.1396 -7736.9551 8584.1602 -7736.9336 8584.1709 c -7735.647 8584.6992 -7734.1714 8584.4756 -7732.8818 8584.0547 c -7732.0918 8584.043 L -7732.124 8584.0332 L -7731.9282 8584.1875 L -7731.8984 8584.0898 L -7732.4639 8584.1064 l -7732.9321 8584.1406 -7733.3848 8583.9834 -7733.8398 8584.1035 c -7735.1543 8584.4609 -7736.3975 8584.625 -7737.71 8584.5986 c -7737.7422 8584.5996 -7737.7642 8584.6211 -7737.7617 8584.6533 c -7737.7617 8584.6855 -7737.7402 8584.7061 -7737.707 8584.7051 c -7737.707 8584.7051 l f -7738.5718 8585.0605 m -7735.8711 8586.2207 -7732.9023 8585.5703 -7730.1279 8585.1816 c -7729.7832 8585.2891 l -7729.7617 8585.2988 -7729.7417 8585.2871 -7729.7207 8585.2656 c -7729.71 8585.2441 -7729.7217 8585.2129 -7729.7422 8585.2021 c -7730.0801 8585.0098 l -7732.7754 8584.3926 -7735.5391 8584.7813 -7738.271 8584.7852 c -7738.3022 8584.7871 -7738.3232 8584.8086 -7738.3223 8584.8398 c -7738.3198 8584.8721 -7738.2983 8584.8926 -7738.2681 8584.8926 c -7735.6738 8584.9355 -7733.0303 8584.4434 -7730.4727 8585.0742 c -7729.7954 8585.2891 L -7729.7534 8585.1914 L -7730.1406 8585.0859 l -7732.9058 8585.4424 -7735.8418 8586.1348 -7738.5313 8584.9746 c -7738.5537 8584.9648 -7738.585 8584.9648 -7738.5962 8584.998 c -7738.6055 8585.0195 -7738.605 8585.0508 -7738.5718 8585.0605 c -7738.5718 8585.0605 l f -7735.6895 8578.3945 m -7734.3945 8578.9004 -7732.9834 8578.6465 -7731.6802 8578.3438 c -7731.647 8578.3418 -7731.6367 8578.3203 -7731.6382 8578.2891 c -7731.6504 8578.2568 -7731.6714 8578.2461 -7731.7031 8578.248 c -7732.998 8578.5303 -7734.377 8578.8154 -7735.6504 8578.2969 c -7735.6826 8578.2871 -7735.7144 8578.2988 -7735.7246 8578.3311 c -7735.7222 8578.3525 -7735.7114 8578.3848 -7735.6895 8578.3945 c -7735.6895 8578.3945 l f -7736.1401 8580.2207 m -7734.2266 8580.6895 -7732.3145 8581.1035 -7730.355 8581.3242 c -7730.3242 8581.334 -7730.3022 8581.3125 -7730.293 8581.2803 c -7730.2954 8581.2598 -7730.3159 8581.2285 -7730.3374 8581.2285 c -7732.2959 8581.0078 -7734.209 8580.582 -7736.1206 8580.1133 c -7736.1426 8580.1152 -7736.1738 8580.126 -7736.1831 8580.1582 c -7736.1831 8580.1797 -7736.1719 8580.2109 -7736.1401 8580.2207 c -7736.1401 8580.2207 l f -7736.9336 8582.6348 m -7734.499 8583.4609 -7731.8647 8583.0547 -7729.3457 8583.0879 c -7729.313 8583.0879 -7729.293 8583.0664 -7729.293 8583.0332 c -7729.2954 8583.0117 -7729.3159 8582.9922 -7729.3481 8582.9922 c -7731.8574 8582.916 -7734.481 8583.3848 -7736.8945 8582.5264 c -7736.9282 8582.5273 -7736.959 8582.5391 -7736.9688 8582.5605 c -7736.9678 8582.5918 -7736.9561 8582.624 -7736.9336 8582.6348 c -7736.9336 8582.6348 l f -7732.0542 8583.8496 m -7730.6582 8584.5449 -7729.0503 8584.4033 -7727.5342 8584.4668 c -7727.502 8584.4648 -7727.4824 8584.4434 -7727.4824 8584.4121 c -7727.4834 8584.3906 -7727.5054 8584.3594 -7727.5366 8584.3594 c -7729.0137 8584.2207 -7730.6489 8584.5234 -7732.0039 8583.7617 c -7732.0366 8583.7529 -7732.0679 8583.7637 -7732.0786 8583.7861 c -7732.0879 8583.8076 -7732.0767 8583.8398 -7732.0542 8583.8496 c -7732.0542 8583.8496 l f -7731.3418 8580.4248 m -7730.3926 8580.3975 -7729.4336 8580.3701 -7728.4839 8580.3428 c -7728.4526 8580.3418 -7728.4312 8580.3203 -7728.4336 8580.2881 c -7728.4336 8580.2559 -7728.4551 8580.2354 -7728.4878 8580.2363 c -7729.437 8580.2637 -7730.397 8580.291 -7731.3457 8580.3184 c -7731.377 8580.3184 -7731.3975 8580.3418 -7731.3975 8580.373 c -7731.397 8580.4043 -7731.374 8580.4258 -7731.3418 8580.4248 c -7731.3418 8580.4248 l f -7729.1592 8578.0361 m -7728.6895 8578.0645 -7728.209 8578.0723 -7727.7383 8578.0918 c -7727.7168 8578.0908 -7727.6855 8578.0684 -7727.6865 8578.0371 c -7727.687 8578.0039 -7727.71 8577.9844 -7727.7417 8577.9844 c -7728.2114 8577.9873 -7728.6816 8577.9375 -7729.1514 8577.9395 c -7729.1831 8577.9297 -7729.2031 8577.9512 -7729.2134 8577.9844 c -7729.2129 8578.0156 -7729.1914 8578.0371 -7729.1592 8578.0361 c -7729.1592 8578.0361 l f -7736.9702 8580.2344 m -7736.5688 8580.5107 -7736.125 8580.6797 -7735.645 8580.751 c -7735.6113 8580.7607 -7735.5918 8580.7383 -7735.5806 8580.7168 c -7735.5703 8580.6855 -7735.5928 8580.6543 -7735.6152 8580.6543 c -7736.0854 8580.5723 -7736.5176 8580.4023 -7736.9209 8580.1475 c -7736.9521 8580.1377 -7736.9849 8580.1387 -7736.9946 8580.1709 c -7737.0039 8580.1934 -7736.9922 8580.2246 -7736.9702 8580.2344 c -7736.9702 8580.2344 l f -7738.1904 8586.085 m -7735.7344 8586.5273 -7733.2983 8587.001 -7730.7993 8586.7266 c -7730.7778 8586.7266 -7730.7568 8586.7041 -7730.7578 8586.6719 c -7730.7578 8586.6406 -7730.7798 8586.6191 -7730.8022 8586.6191 c -7733.291 8586.873 -7735.7344 8586.4844 -7738.1719 8585.9775 c -7738.1934 8585.9785 -7738.2256 8585.9902 -7738.2344 8586.0215 c -7738.2344 8586.043 -7738.2222 8586.0752 -7738.1904 8586.085 c -7738.1904 8586.085 l f 0.195 0.156 0.117 0 k -7738.166 8574.6445 m -7735.7969 8574.2676 -7733.4058 8574.3477 -7731.0298 8574.5898 c -7730.998 8574.5879 -7730.9766 8574.5664 -7730.9766 8574.5352 c -7730.9785 8574.5137 -7731 8574.4824 -7731.0215 8574.4824 c -7733.4082 8574.2422 -7735.791 8574.1602 -7738.1694 8574.5391 c -7738.2026 8574.5391 -7738.2222 8574.5605 -7738.2217 8574.5938 c -7738.2207 8574.625 -7738.1992 8574.6465 -7738.166 8574.6445 c -7738.166 8574.6445 l f 0.335 0.268 0.201 0 k -7737.4351 8574.1113 m -7734.9282 8574.1152 -7732.4146 8574.2773 -7729.918 8573.8965 c -7729.8862 8573.8945 -7729.8647 8573.873 -7729.8662 8573.8418 c -7729.8672 8573.8086 -7729.8896 8573.7891 -7729.9209 8573.7891 c -7732.418 8574.1699 -7734.9297 8574.0293 -7737.4375 8574.0059 c -7737.46 8574.0059 -7737.481 8574.0273 -7737.4785 8574.0596 c -7737.4785 8574.0918 -7737.457 8574.1123 -7737.4351 8574.1113 c -7737.4351 8574.1113 l f 0.205 0.164 0.123 0 k -7738.9766 8574.3262 m -7737.5039 8574.668 -7736.0078 8574.4023 -7734.5391 8574.2207 c -7734.5078 8574.2207 -7734.4873 8574.1973 -7734.499 8574.166 c -7734.5 8574.1348 -7734.5215 8574.1133 -7734.5537 8574.125 c -7736.0103 8574.2842 -7737.4961 8574.583 -7738.9473 8574.2188 c -7738.9785 8574.2207 -7739.0103 8574.2324 -7739.0098 8574.2637 c -7739.019 8574.2852 -7738.998 8574.3164 -7738.9766 8574.3262 c -7738.9766 8574.3262 l f -7732.3535 8573.7949 m -7731.1978 8573.9219 -7730.0273 8573.8145 -7728.8926 8573.5898 c -7728.8711 8573.5781 -7728.8506 8573.5566 -7728.8618 8573.5244 c -7728.8623 8573.5029 -7728.8945 8573.4824 -7728.916 8573.4941 c -7730.0503 8573.7402 -7731.1914 8573.7939 -7732.3462 8573.6885 c -7732.3794 8573.6895 -7732.3984 8573.7109 -7732.4087 8573.7324 c -7732.4082 8573.7646 -7732.3862 8573.7852 -7732.3535 8573.7949 c -7732.3535 8573.7949 l f 0.335 0.268 0.201 0 k -7739.2681 8576.4473 m -7737.9214 8577.1885 -7736.3066 8576.5977 -7734.855 8576.6416 c -7734.8223 8576.6406 -7734.8022 8576.6191 -7734.8022 8576.5859 c -7734.8042 8576.5654 -7734.8262 8576.5449 -7734.8574 8576.5449 c -7736.2886 8576.4902 -7737.8823 8577.0801 -7739.2168 8576.3506 c -7739.2383 8576.3398 -7739.2695 8576.3516 -7739.291 8576.374 c -7739.3008 8576.3955 -7739.2886 8576.4277 -7739.2681 8576.4473 c -7739.2681 8576.4473 l f -7737.8945 8578.5645 m -7735.6719 8579.0449 -7733.3896 8578.6162 -7731.1504 8578.5625 c -7731.1177 8578.5615 -7731.0977 8578.5391 -7731.0977 8578.5078 c -7731.1001 8578.4863 -7731.1318 8578.4668 -7731.1519 8578.4668 c -7733.3833 8578.4775 -7735.6519 8578.9805 -7737.875 8578.457 c -7737.8975 8578.457 -7737.9287 8578.4688 -7737.9375 8578.502 c -7737.9375 8578.5225 -7737.9258 8578.5547 -7737.8945 8578.5645 c -7737.8945 8578.5645 l f -7732.0273 8575.1406 m -7730.3496 8575.9688 -7728.499 8576.502 -7726.603 8576.3613 c -7726.5718 8576.3613 -7726.5513 8576.3389 -7726.5527 8576.3066 c -7726.5527 8576.2754 -7726.5742 8576.2539 -7726.6074 8576.2559 c -7728.481 8576.416 -7730.3198 8575.8604 -7731.9873 8575.0547 c -7732.0078 8575.0449 -7732.041 8575.0449 -7732.0503 8575.0781 c -7732.061 8575.0996 -7732.061 8575.1309 -7732.0273 8575.1406 c -7732.0273 8575.1406 l f u 0.5 0.85 1 0.45 k -7885 8581.9082 m -7885.0254 8582.4883 -7884.5664 8583.1875 -7883.167 8583.9902 C -7882.8521 8584.0029 -7881.3945 8584.0234 -7879.0889 8584.0488 C -7879.0889 8581.8223 L -7881.1382 8581.8457 -7883.1177 8581.8867 -7885 8581.9082 C f -7884.5088 8580.9688 m -7879.0889 8580.8447 L -7879.0889 8579.8145 L -7882.644 8579.959 L -7883.8145 8580.3301 -7884.5088 8580.9688 V f 0.5 0.85 1 0.32 k -7879.0889 8580.8252 m -7884.4746 8580.9434 L -7884.7695 8581.2148 -7884.9849 8581.5566 -7885 8581.9277 C -7883.1177 8581.9063 -7881.1382 8581.8848 -7879.0889 8581.8613 C -7879.0889 8580.8252 L f 0.5 0.85 1 0.45 k -7774.1504 8580.6172 m -7852.3584 8581.541 -7879.1079 8581.8418 V -7879.1079 8584.0488 L -7862.8145 8584.2324 -7803.9902 8584.707 Y -7769.749 8583.6641 L -7770.457 8580.5684 L -7774.1504 8580.6172 L f 0.5 0.85 1 0.12 k -7879.1079 8579.8145 m -7879.1079 8580.8447 L -7770.4258 8579 L -7770.3833 8576.8633 L -7803.6553 8576.7129 L -7879.1079 8579.8145 L f u 0.065 0.052 0.039 0 k -7747.0728 8575.1465 m -7747.0366 8576.4258 L -7747.2954 8575.1172 L -7765.897 8579.6563 L -7766.9375 8579.2734 L -7766.8794 8579.6055 -7766.8398 8579.957 -7766.8306 8580.3223 c -7766.8242 8580.5283 -7766.8281 8580.7285 -7766.8398 8580.9258 C -7758.3862 8582.0986 -7748.9634 8577.6719 -7747.0366 8576.4258 C -7746.7402 8586.7559 L -7746.041 8586.8613 L -7745.8042 8579.207 L -7740.1816 8579.1543 L -7740.0898 8577.0137 -7740.0718 8575.0215 -7740.2407 8574.0352 C -7747.0728 8575.1465 L f 0.4 0.7 1 0 k -7770.457 8580.5879 m -7770.4258 8578.9805 L -7879.1079 8580.8252 L -7879.1079 8581.8613 L -7852.3584 8581.5605 -7770.457 8580.5879 Y f U U 0.025 0.02 0.015 0 k -7734.7344 8583.0293 m -7734.7344 8583.0625 -7734.7129 8583.082 -7734.6802 8583.082 c -7731.6714 8583.1133 -7729.4214 8582.9453 -7726.415 8582.8594 C -7726.4087 8582.7656 L -7729.3262 8582.8701 -7731.7607 8583.0078 -7734.6841 8582.9746 C -7734.7168 8582.9766 -7734.7358 8582.998 -7734.7344 8583.0293 C f -7726.3994 8582.7656 m -7726.4082 8582.7441 L -7726.4087 8582.7656 L -7726.4063 8582.7656 -7726.4033 8582.7656 -7726.3994 8582.7656 C f -7730.4487 8581.4238 m -7731.4458 8581.292 -7732.3394 8581.7656 -7733.2114 8582.1973 C -7733.2441 8582.208 -7733.2534 8582.2402 -7733.2422 8582.2715 C -7733.2305 8582.293 -7733.1982 8582.3027 -7733.1777 8582.291 c -7732.3262 8581.8301 -7731.4312 8581.4199 -7730.4678 8581.5195 c -7729.1079 8581.6621 -7727.9038 8582.375 -7726.5254 8582.4531 C -7726.4463 8582.3594 L -7728.04 8582.2656 -7728.8647 8581.623 -7730.4487 8581.4238 c f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 6) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.75 8563 m -7884.75 8587 L -7874.75 8587 L -7874.75 8563 L -7884.75 8563 L n 0 Ap 0 O 1 g -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 c -7877.5879 8565.2256 -7879.3198 8565.9346 -7880.7559 8567.0176 c -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 c -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.2319 8578.5996 -7883.3457 8580.0918 c -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C -7874.75 8565 L f 0 R 0 G 1 J 1 j 0.5 w -7874.75 8584.6816 m -7877.7793 8583.7256 -7880.6074 8582.0674 -7883.3457 8580.0918 C S -7874.75 8579.0488 m -7877.8999 8576.6436 -7880.957 8573.9131 -7884.0942 8571.4639 C S -7880.7559 8567.0176 m -7878.6904 8568.1084 -7876.7017 8569.4668 -7874.75 8570.957 C S -7875.6982 8565.0479 m -7875.3809 8565.1309 -7875.063 8565.2148 -7874.75 8565.3145 C S -7880.7559 8567.0176 m -7879.3193 8565.9355 -7877.5879 8565.2256 -7875.6982 8565.0479 C S -7884.0942 8571.4639 m -7884.5122 8572.5645 -7884.75 8573.7529 -7884.75 8575 c -7884.75 8576.8623 -7884.231 8578.5996 -7883.3457 8580.0918 C S -7874.75 8565 m -7875.0703 8565 -7875.3857 8565.0186 -7875.6982 8565.0479 C S -7880.7559 8567.0176 m -7882.2529 8568.1465 -7883.4199 8569.6816 -7884.0942 8571.4639 C S -7883.3457 8580.0918 m -7881.6025 8583.0273 -7878.4102 8585 -7874.75 8585 C S U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 8) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.9521 8584.3125 m -7776.7954 8584.3125 L -7776.7954 8570.1855 L -7883.9521 8570.1855 L -7883.9521 8584.3125 L n u 0 O 0 0 0 1 k -7882.2832 8583.623 m -7882.8535 8586 -7882.8184 8582.0039 V -7883.0479 8578.8027 L -7883.6167 8576.4551 L -7883.4502 8574.123 L -7881.9502 8573.4551 -7865.2832 8572.123 V -7858.6167 8570.7891 -7849.6167 8570.7891 V -7784.3936 8571.4766 -7779.4912 8572.8848 v -7820.3882 8570.875 -7822.9688 8571.5117 v -7783.8569 8573.1602 -7780.8545 8574.4316 v -7818.79 8572.5469 -7822.167 8574.1777 v -7787.249 8575.9102 -7783.021 8577.5313 v -7789.7217 8576.8828 -7791.5127 8577.082 v -7788.3896 8577.5703 l -7793.4194 8577.502 l -7796.3218 8577.1289 l -7788.4521 8578.2422 -7787.9033 8578.8086 v -7784.3154 8578.1309 -7798.5186 8578.3848 v -7832.1177 8574.4551 -7882.2832 8583.623 V f /BBAccumRotation (5.805971) XT 0 R 0 0 0 0.5 K 0.025 w -7883.9502 8573.123 m -7863.667 8571.2949 -7843.9727 8570.2207 v -7801.1514 8570.502 -7796.5737 8570.9004 v -7784.1631 8571.0313 -7776.7959 8572.0273 v S /BBAccumRotation (5.805971) XT 0 0 0 1 K -7821.8369 8570.4082 m -7825.2959 8570.0273 -7851.2607 8570.2793 Y -7861.627 8570.1602 -7883.9502 8573.123 Y S /BBAccumRotation (5.805971) XT -7820.9873 8573.6641 m -7790.3608 8574.582 -7783.6606 8575.2324 v S /BBAccumRotation (5.805971) XT 0 0 0 0.5 K -7829.6201 8578.2051 m -7794.3706 8579.6172 -7791.4058 8580.1406 v S /BBAccumRotation (5.805971) XT U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 10) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7833.8921 8586 L -7833.8921 8529.9756 L -7884 8529.9756 L -7884 8586 L n u 0 O 0.1 1 1 0 k -7846.9014 8551.5752 m -7848.7178 8545.0957 -7858.8247 8548.4658 Y -7858.791 8548.5303 L -7868.8999 8545.1611 -7870.7144 8551.6396 V -7876.6758 8569.0068 -7871.4922 8575.7451 V -7864.7529 8585.3369 -7860.6055 8585.3369 V -7857.0103 8585.2705 L -7852.8638 8585.2705 -7846.125 8575.6816 Y -7840.9409 8568.9424 -7846.9014 8551.5752 Y f u 0 0 0 1 k -7851.3926 8529.9756 m -7852.1167 8531.4199 -7852.9238 8532.4756 V -7852.4058 8532.0635 -7851.5151 8531.1924 -7851.3926 8529.9756 C f -7865.064 8532.4854 m -7865.8711 8531.4307 -7866.5942 8529.9863 Y -7866.4727 8531.2021 -7865.582 8532.0732 -7865.064 8532.4854 C f U 0 0.61 0.74 0 k -7850.5977 8554.4609 m -7851.9038 8549.7959 -7859.1816 8552.2217 Y -7859.1567 8552.2686 L -7866.436 8549.8428 -7867.7417 8554.5078 V -7872.0337 8567.0117 -7868.3018 8571.8633 V -7863.4487 8578.7686 -7860.4634 8578.7686 V -7857.875 8578.7227 L -7854.8887 8578.7227 -7850.0366 8571.8174 Y -7846.3042 8566.9639 -7850.5977 8554.4609 Y f u 1 Ap 0.73 0.43 1 0.22 k 0 R 0 0 0 1 K -7854.6226 8557.2754 m -7853.813 8557.2754 -7853.1558 8556.6182 -7853.1558 8555.8096 c -7853.1558 8555 -7853.813 8554.3428 -7854.6226 8554.3428 c -7855.4321 8554.3428 -7856.0889 8555 -7856.0889 8555.8096 c -7856.0889 8556.6182 -7855.4321 8557.2754 -7854.6226 8557.2754 c b -7854.3638 8568.9971 m -7853.0806 8568.9971 -7852.0415 8568.1201 -7852.0415 8567.042 c -7852.0415 8565.9619 -7853.0806 8565.0869 -7854.3638 8565.0869 c -7855.645 8565.0869 -7856.6846 8565.9619 -7856.6846 8567.042 c -7856.6846 8568.1201 -7855.645 8568.9971 -7854.3638 8568.9971 c b -7853.834 8580.7861 m -7852.2817 8580.7861 -7851.0239 8580.1299 -7851.0239 8579.3213 c -7851.0239 8578.5117 -7852.2817 8577.8545 -7853.834 8577.8545 c -7855.3862 8577.8545 -7856.645 8578.5117 -7856.645 8579.3213 c -7856.645 8580.1299 -7855.3862 8580.7861 -7853.834 8580.7861 c b -7849.6104 8552.5264 m -7848.8687 8552.5264 -7848.2671 8551.8154 -7848.2671 8550.9365 c -7848.2671 8550.0596 -7848.8687 8549.3477 -7849.6104 8549.3477 c -7850.353 8549.3477 -7850.9546 8550.0596 -7850.9546 8550.9365 c -7850.9546 8551.8154 -7850.353 8552.5264 -7849.6104 8552.5264 c b -7848.0034 8574.083 m -7848.8818 8573.7354 -7849.1494 8572.335 -7848.603 8570.9541 c -7848.0566 8569.5752 -7846.9014 8568.7363 -7846.0234 8569.085 c -7845.145 8569.4326 -7844.877 8570.833 -7845.4233 8572.2139 c -7845.9702 8573.5947 -7847.125 8574.4316 -7848.0034 8574.083 c b u -7863.0566 8557.1592 m -7863.8662 8557.1592 -7864.5239 8556.502 -7864.5239 8555.6934 c -7864.5239 8554.8828 -7863.8662 8554.2266 -7863.0566 8554.2266 c -7862.248 8554.2266 -7861.5913 8554.8828 -7861.5913 8555.6934 c -7861.5913 8556.502 -7862.248 8557.1592 -7863.0566 8557.1592 c b -7863.3159 8568.8799 m -7864.5991 8568.8799 -7865.6382 8568.0049 -7865.6382 8566.9248 c -7865.6382 8565.8447 -7864.5991 8564.9697 -7863.3159 8564.9697 c -7862.0342 8564.9697 -7860.9951 8565.8447 -7860.9951 8566.9248 c -7860.9951 8568.0049 -7862.0342 8568.8799 -7863.3159 8568.8799 c b -7863.8457 8580.6709 m -7865.3975 8580.6709 -7866.6558 8580.0146 -7866.6558 8579.2041 c -7866.6558 8578.3936 -7865.3975 8577.7383 -7863.8457 8577.7383 c -7862.293 8577.7383 -7861.0352 8578.3936 -7861.0352 8579.2041 c -7861.0352 8580.0146 -7862.293 8580.6709 -7863.8457 8580.6709 c b -7868.0679 8552.4092 m -7868.811 8552.4092 -7869.4121 8551.6982 -7869.4121 8550.8213 c -7869.4121 8549.9443 -7868.811 8549.2334 -7868.0679 8549.2334 c -7867.3262 8549.2334 -7866.7241 8549.9443 -7866.7241 8550.8213 c -7866.7241 8551.6982 -7867.3262 8552.4092 -7868.0679 8552.4092 c b -7869.6758 8573.9678 m -7868.7983 8573.6201 -7868.5298 8572.2188 -7869.0762 8570.8379 c -7869.6226 8569.457 -7870.7778 8568.6201 -7871.6558 8568.9678 c -7872.5342 8569.3164 -7872.8032 8570.7178 -7872.2568 8572.0967 c -7871.7104 8573.4775 -7870.5552 8574.3154 -7869.6758 8573.9678 c b U U 0 Ap 0 0 0 1 k -7859.1318 8552.6553 m -7859.1318 8585.3145 l F u -7843.3906 8538.5303 m -7844.0815 8537.8369 -7847.019 8538.7021 Y -7848.229 8538.874 -7848.0562 8541.2939 Y -7847.019 8543.3682 -7847.7104 8543.1943 Y -7848.2998 8543.1943 -7849.855 8543.1143 -7850.7822 8543.0635 C -7851.1226 8541.6689 -7852.6128 8540.4756 -7854.7217 8539.7695 C -7852.7578 8536.4775 -7854.5176 8535.7949 -7856.2935 8535.79 C -7856.3096 8535.7021 -7856.332 8535.6162 -7856.3599 8535.5332 C -7854.1089 8535.5791 -7853.6392 8533.2588 Y -7853.4048 8533.0635 -7853.1606 8532.7861 -7852.9238 8532.4756 C -7853.1416 8532.6475 -7853.2944 8532.7393 Y -7854.2583 8532.7393 -7855.8774 8534.4941 -7856.4966 8535.207 C -7856.9194 8534.4434 -7857.853 8533.9111 -7858.9434 8533.9111 c -7860.0698 8533.9111 -7861.0322 8534.4795 -7861.4312 8535.2852 C -7861.9985 8534.624 -7863.6968 8532.751 -7864.6943 8532.751 C -7864.8462 8532.6572 -7865.064 8532.4854 V -7864.8281 8532.7939 -7864.583 8533.0732 -7864.3481 8533.2686 C -7863.8638 8535.6563 -7861.5254 8535.5342 V -7861.5449 8535.5889 -7861.5674 8535.6436 -7861.5806 8535.7021 C -7864.9238 8535.6924 -7863.937 8538.3174 -7863.2104 8539.6602 C -7865.5918 8540.376 -7867.2646 8541.7012 -7867.5239 8543.25 C -7868.4473 8543.2998 -7869.6729 8543.3584 -7870.1802 8543.3584 C -7870.8726 8543.5313 -7869.835 8541.458 V -7869.6626 8539.0391 -7870.8726 8538.8662 V -7873.8096 8538.002 -7874.501 8538.6934 V -7875.1919 8539.5566 -7876.0562 8538.3467 V -7875.1919 8540.0752 -7873.291 8539.5566 V -7870.6982 8538.8662 -7871.3906 8540.5938 V -7871.9087 8544.0498 -7870.1802 8544.7402 V -7868.0342 8545.8545 -7866.2822 8546.0889 V -7865.9087 8546.4141 -7865.4639 8546.7109 -7864.958 8546.9766 C -7867.5562 8547.0469 -7870.2246 8547.9209 -7871.0752 8550.9561 C -7871.5151 8552.2432 -7872.0518 8554.2432 V -7873.1025 8554.8252 -7874.3022 8556.0078 -7875.541 8558.2627 C -7876.394 8561.4502 -7877.167 8556.7129 V -7878.3975 8553.6494 -7879.6504 8553.5381 V -7878.4702 8555.2871 -7878.9038 8556.416 V -7877.2998 8560.917 -7875.6138 8559.8994 V -7874.0986 8559.2197 -7872.688 8556.8154 V -7873.0698 8558.4971 -7873.4326 8560.417 -7873.6743 8562.3906 C -7874.4888 8562.3975 L -7876.3506 8561.4795 -7876.3262 8564.959 V -7877.1226 8568.9453 -7876.3594 8571.6826 V -7875.647 8574.1504 -7878.1274 8572.9307 V -7879.2842 8573.3242 -7879.9839 8572.7881 V -7882.3882 8571.4131 -7884 8573.124 V -7882.147 8572.8799 -7881.4482 8573.417 V -7879.9785 8573.5615 -7879.897 8574.1787 V -7876.9561 8574.8555 -7876.188 8574.0771 V -7874.417 8573.2139 -7875.1304 8570.3604 V -7875.8799 8562.4814 -7874.3198 8564.4053 V -7874.1182 8564.4219 -7873.8784 8564.5176 V -7874.1519 8568.4326 -7873.8018 8572.3252 -7871.9961 8574.8516 C -7875.4536 8567.333 -7870.2974 8552.3037 Y -7868.9609 8547.5303 -7863.127 8548.1016 -7860.145 8548.7344 C -7860.0718 8550.1299 -7859.8374 8551.9492 -7859.1318 8552.6553 C -7858.2134 8550.6963 -7858.2358 8549.0732 V -7857.0762 8548.7217 -7850.2817 8546.8447 -7847.4487 8550.3369 C -7848.4312 8547.8135 -7850.8262 8547.0186 -7853.2007 8546.9189 C -7852.667 8546.6318 -7852.2041 8546.3047 -7851.8257 8545.9502 C -7850.041 8545.7861 -7847.7104 8544.5771 Y -7845.9814 8543.8857 -7846.5015 8540.4307 Y -7847.1919 8538.7021 -7844.5991 8539.3936 Y -7842.7002 8539.9111 -7841.835 8538.1836 Y -7842.7002 8539.3936 -7843.3906 8538.5303 Y f -7837.9082 8572.9521 m -7838.6074 8573.4893 -7839.7632 8573.0938 Y -7842.2446 8574.3135 -7841.5327 8571.8467 Y -7840.769 8569.1104 -7841.564 8565.1221 Y -7841.541 8561.6445 -7843.4014 8562.5596 Y -7844.0342 8562.5557 L -7844.3198 8560.6123 -7844.7046 8558.7549 -7845.0898 8557.1699 C -7843.7129 8559.4199 -7842.2778 8560.0635 Y -7840.5913 8561.082 -7838.9878 8556.5791 Y -7839.4214 8555.4502 -7838.2417 8553.7021 Y -7839.4937 8553.8125 -7840.7246 8556.876 Y -7841.4976 8561.6152 -7842.3511 8558.4268 Y -7843.5776 8556.1904 -7844.769 8555.0098 -7845.814 8554.4229 C -7846.2026 8553.0635 -7846.4858 8552.2393 Y -7846.7002 8551.4727 -7847.0337 8550.8486 -7847.4487 8550.3369 C -7847.3799 8550.5127 -7847.3174 8550.6982 -7847.2632 8550.8916 C -7841.3022 8568.2588 -7846.4858 8574.9971 V -7853.2246 8584.5869 -7857.3721 8584.5869 V -7860.9663 8584.6514 L -7865.1138 8584.6514 -7871.853 8575.0615 Y -7871.9038 8574.9961 -7871.9463 8574.9219 -7871.9961 8574.8516 C -7871.7378 8575.4141 -7871.437 8575.9404 -7871.0752 8576.4092 C -7864.3359 8586 -7860.189 8586 V -7856.5942 8585.9346 L -7852.4482 8585.9346 -7845.709 8576.3447 Y -7843.5801 8573.5771 -7843.3306 8569.0176 -7843.7769 8564.6055 C -7843.6553 8564.5752 -7843.5698 8564.5684 Y -7842.0112 8562.6475 -7842.7598 8570.5244 Y -7843.4746 8573.3789 -7841.7026 8574.2402 Y -7840.9351 8575.0186 -7837.9946 8574.3428 Y -7837.9136 8573.7256 -7836.4434 8573.5811 Y -7835.7446 8573.0449 -7833.8921 8573.2881 Y -7835.5024 8571.5771 -7837.9082 8572.9521 Y f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 34) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884.0254 8586.0264 m -7828.0542 8586.0264 L -7828.0542 8524.5342 L -7884.0254 8524.5342 L -7884.0254 8586.0264 L n u u 0 O 0.0745 0.9 0.9019 0.18 k 0 R 0 0 0 1 K 1 J 1 j 0.0518 w -7857.5991 8562.7217 m -7857.3594 8573.5215 -7862.8794 8583.8398 v -7862.4009 8586 -7860.959 8586 v -7861.2002 8582.6406 -7860.2393 8582.1611 v -7855.9199 8570.1602 -7856.6382 8562.2402 v -7857.5991 8562.7217 l b -7857.5991 8562.7217 m -7859.2793 8568 -7871.0391 8569.2012 v -7875.3594 8569.6807 -7875.5991 8571.1211 v -7869.1206 8561.5195 -7868.1602 8561.7607 v -7881.3594 8556.001 -7884 8550.7197 v -7878.959 8553.6006 -7875.5991 8551.4404 v -7867.6802 8551.2012 -7862.6406 8553.3613 v -7858.8008 8555.2813 -7866.7202 8539.2012 v -7862.8794 8550.9609 -7859.2793 8524.5605 v -7858.3198 8529.8408 -7856.8799 8531.2813 v -7850.8799 8538.9609 -7851.8398 8541.1211 v -7852.3198 8544.9609 -7847.7598 8538.7207 v -7848 8548.3213 -7850.4009 8551.6807 v -7852.5591 8555.2813 -7846.5591 8553.1211 v -7840.5591 8551.2012 -7835.2793 8552.8809 v -7829.7598 8554.3203 -7828.0801 8551.4404 v -7839.8398 8563.9209 -7845.5991 8563.6807 v -7843.9194 8567.2813 l -7841.519 8572.0811 -7842 8573.2813 v -7857.2681 8563.8828 -7857.5991 8562.7217 v b -7857.5991 8562.7217 m -7854.959 8544.2402 -7857.5991 8536.5605 v -7859.998 8526.001 -7859.2793 8524.5605 v S -7856.1602 8551.4404 m -7850.1602 8546.6406 -7848.959 8541.3604 v S -7856.1602 8550.7197 m -7865.0391 8543.041 -7866.7202 8539.2012 v S -7828.0801 8551.4404 m -7829.2793 8553.6006 -7857.3594 8561.7607 y -7862.4009 8556.2422 -7873.9199 8553.8408 v -7881.5986 8552.8809 -7884 8550.7197 v S -7874.6382 8569.6807 m -7863.1191 8560.5615 -7857.3594 8561.7607 y -7843.1992 8568 -7842 8573.2813 v S U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 36) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7883.8496 8585.9961 m -7833.96 8585.9961 L -7833.96 8534.9258 L -7883.8496 8534.9258 L -7883.8496 8585.9961 L n u 0 O 0.025 0.1 0.475 0 k -7862.1504 8553.9043 m -7864.4766 8552.8125 -7866.6914 8552.4434 -7868.373 8552.9238 c -7869.0518 8553.1172 -7869.645 8553.4473 -7870.123 8553.9238 c -7870.6006 8554.4023 -7870.9297 8554.9951 -7871.123 8555.6729 c -7872.0088 8558.7715 -7870.0103 8563.6777 -7865.9233 8567.7666 c -7861.834 8571.8535 -7856.9297 8573.8516 -7853.8286 8572.9668 c -7853.1519 8572.7715 -7852.5586 8572.4424 -7852.0806 8571.9658 c -7851.603 8571.4883 -7851.2754 8570.8955 -7851.082 8570.2168 c -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.582 8561.21 -7854.791 8559.6133 -7856.2793 8558.123 c -7858.1504 8556.2539 -7860.1914 8554.8242 -7862.1504 8553.9043 c f u 0.0035 0.014 0.0665 0 k -7861.2183 8552.9727 m -7863.8306 8552.0215 -7866.3975 8551.9688 -7868.373 8552.9238 C -7866.6914 8552.4434 -7864.4766 8552.8125 -7862.1504 8553.9043 c -7861.6191 8554.1543 -7861.0806 8554.4434 -7860.543 8554.7676 C -7858.8984 8554.0537 L -7859.667 8553.6172 -7860.4434 8553.2539 -7861.2183 8552.9727 c f 0.015 0.06 0.285 0 k -7858.8984 8554.0537 m -7860.543 8554.7676 L -7859.0962 8555.6348 -7857.6426 8556.7607 -7856.2793 8558.123 c -7856.1538 8558.25 -7856.0327 8558.3779 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7856.3706 8555.7236 -7857.6191 8554.7813 -7858.8984 8554.0537 C f U u 0.039 0.156 0.741 0 k -7849.687 8541.4043 m -7849.9746 8541.6914 -7861.2183 8552.9727 Y -7860.4434 8553.2539 -7859.667 8553.6172 -7858.8984 8554.0537 C -7845.4146 8540.5703 L -7847.061 8540.0996 -7848.6406 8540.3555 -7849.687 8541.4043 c f 0.025 0.1 0.475 0 k -7845.4146 8540.5703 m -7858.8984 8554.0537 L -7857.584 8554.8027 -7856.2969 8555.7754 -7855.1143 8556.957 c -7855.084 8556.9863 -7855.0586 8557.0156 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7841.5264 8543.1328 -7841.7202 8542.9141 -7841.9302 8542.7012 c -7843.0103 8541.623 -7844.2305 8540.9082 -7845.4146 8540.5703 C f U u 0.0115 0.046 0.2185 0 k -7835.9346 8550.3926 m -7833.5337 8547.9893 -7833.335 8544.0898 -7835.1382 8540.6973 C -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f 0.015 0.06 0.285 0 k -7843.5337 8535.5957 m -7842.582 8534.9258 L -7845.2046 8534.3516 -7847.8306 8534.9141 -7849.6206 8536.7061 c -7848.1719 8535.2578 -7845.9082 8534.9307 -7843.5337 8535.5957 C f 0.0295 0.118 0.5605 0 k -7843.5337 8535.5957 m -7845.9082 8534.9307 -7848.1719 8535.2578 -7849.6206 8536.7061 c -7851.019 8538.1055 -7851.3706 8540.2637 -7850.7954 8542.5469 C -7848.8672 8539.5449 -7845.4082 8540.5537 V -7843.585 8535.6309 L -7843.5337 8535.5957 L f *u 0.048 0.192 0.912 0 k 1 D -7835.9346 8550.3926 m -7837.2817 8551.7383 -7839.332 8552.1133 -7841.5234 8551.627 C -7851.6714 8561.7734 L -7851.7695 8561.5684 -7851.7695 8561.5684 -7851.6714 8561.7734 c -7850.2246 8564.8145 -7849.9702 8567.916 -7851.082 8570.2168 C -7850.5176 8568.2461 -7851.1226 8565.5449 -7852.6855 8562.7891 c -7853.5054 8561.3438 -7854.5918 8559.8848 -7855.9102 8558.5059 C -7855.2153 8556.8633 L -7855.1816 8556.8945 -7855.1465 8556.9238 -7855.1143 8556.957 c -7855.084 8556.9883 -7855.0566 8557.0176 -7855.0273 8557.0469 c -7855.0278 8557.0469 -7855.0278 8557.0469 -7855.0278 8557.0449 C -7841.3408 8543.3574 L -7836.3262 8541.1289 L -7836.2954 8541.1182 L -7834.0938 8544.4961 -7833.8398 8548.2949 -7835.9346 8550.3926 c f *U 0.0215 0.086 0.4085 0 k 0 D -7842.582 8534.9258 m -7843.5337 8535.5957 L -7841.6846 8536.1113 -7839.7656 8537.2285 -7838.1138 8538.8828 c -7837.4063 8539.5889 -7836.7998 8540.3418 -7836.2954 8541.1182 C -7835.1382 8540.6973 L -7835.6553 8539.7246 -7836.3374 8538.793 -7837.1802 8537.9512 c -7838.7695 8536.3594 -7840.6758 8535.3428 -7842.582 8534.9258 C f 0.0205 0.082 0.3895 0 k -7836.2954 8541.1182 m -7836.7998 8540.3418 -7837.4063 8539.5889 -7838.1138 8538.8828 c -7839.7656 8537.2285 -7841.6846 8536.1113 -7843.5337 8535.5957 C -7843.585 8535.6309 L -7845.4082 8540.5537 L -7844.2114 8540.9219 -7842.9878 8541.6436 -7841.9302 8542.7012 c -7841.7202 8542.9141 -7841.5264 8543.1328 -7841.3408 8543.3574 C -7836.3262 8541.1289 L -7836.2954 8541.1182 L f U u 0.445 0.356 0.267 0 k -7883.8496 8585.9961 m -7861.957 8562.9688 L -7862.2007 8562.6494 -7862.5752 8562.6133 -7862.8887 8562.6592 C -7867.1802 8567.2891 -7878.3145 8579.4561 -7882.7266 8584.2793 C -7883.5649 8585.3516 -7884 8585.9932 -7883.8496 8585.9961 C f 0.15 0.12 0.09 0 k -7883.834 8585.9961 m -7882.6606 8585.7031 -7861.6934 8564.0029 Y -7861.6934 8563.502 -7861.7993 8563.1758 -7861.957 8562.9688 C -7883.8496 8585.9961 L -7883.8442 8585.9961 -7883.8418 8586 -7883.834 8585.9961 c f 0.2 0.16 0.12 0 k -7882.7266 8584.2793 m -7878.3145 8579.4561 -7867.1802 8567.2891 -7862.8887 8562.6592 C -7863.2002 8562.7041 -7863.4526 8562.8301 Y -7864.603 8563.1328 -7878.5742 8578.9619 -7882.7266 8584.2793 C f U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 37) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7882.9502 8585.2324 m -7833.0391 8585.2324 L -7833.0391 8521.1152 L -7882.9502 8521.1152 L -7882.9502 8585.2324 L n u 0 O 0 0 0 1 k 0 R 0 0 0 1 K 0 w -7833.2358 8521.1152 m -7833.6064 8521.248 -7833.9858 8521.2832 -7834.3833 8521.2031 c -7834.4863 8521.168 l -7834.5254 8521.1602 -7834.5703 8521.1787 -7834.6025 8521.1992 c -7834.9434 8521.3926 l -7838.7129 8523.2959 -7842.0962 8525.8965 -7844.5 8529.4473 c -7845.9634 8531.5918 -7847.123 8533.8789 -7848.7993 8535.8564 c -7849.1729 8536.209 -7849.1758 8536.7725 -7848.834 8537.1309 c -7848.4951 8537.501 -7847.918 8537.5078 -7847.561 8537.165 c -7847.4038 8537.21 l -7847.2642 8537.1289 -7847.0742 8537.0703 -7847.0234 8536.957 c -7845.853 8534.2031 -7845.1895 8531.5137 -7843.4336 8529.1387 c -7841.1719 8526.0947 -7838.1777 8523.9941 -7835.0298 8522.0234 c -7834.3672 8521.6055 L -7834.4966 8521.6348 L -7833.7695 8521.6426 l -7833.791 8521.6113 -7833.8008 8521.5957 -7833.8223 8521.5645 C -7833.6064 8521.5234 -7833.377 8521.4746 -7833.1626 8521.4336 c -7833.0762 8521.4238 -7833.0186 8521.3389 -7833.0391 8521.2383 c -7833.0503 8521.1523 -7833.1382 8521.1084 -7833.2358 8521.1152 c -7833.2358 8521.1152 l b -7849.2222 8534.9951 m -7849.5742 8534.8066 -7849.9658 8534.6719 -7850.248 8534.3887 c -7856.4521 8528.1719 -7866.6802 8527.2734 -7874.0488 8533.6855 C -7874.1582 8533.7813 -7874.1582 8533.957 -7874.063 8534.0645 C -7871.0527 8532.9434 -7862.8838 8534.375 -7859.3223 8537.4121 C -7859.2534 8537.4668 -7859.1465 8537.4531 -7859.1055 8537.3711 C -7859.0503 8537.3047 -7859.0664 8537.1953 -7859.1328 8537.1563 C -7862.5625 8534.0859 -7867.0674 8532.29 -7871.6729 8532.748 C -7868.8535 8531.1855 -7865.6313 8530.4941 -7862.3984 8530.6885 c -7857.7144 8530.9717 -7853.4634 8533.1191 -7849.3711 8535.2793 c -7849.291 8535.3193 -7849.1978 8535.293 -7849.1553 8535.2109 C -7849.1016 8535.1309 -7849.1426 8535.0352 -7849.2222 8534.9951 c b -7858.647 8536.3359 m -7860.2266 8540.3613 -7862.3911 8544.3203 -7865.8018 8547.0762 c -7865.9648 8547.2119 -7865.9946 8547.4492 -7865.8711 8547.6055 c -7865.7344 8547.7676 -7865.5049 8547.7793 -7865.3481 8547.6563 c -7861.123 8545.5967 -7858.1904 8541.1309 -7858.1626 8536.4014 c -7858.1626 8536.4014 l -7858.1328 8536.2676 -7858.2354 8536.1348 -7858.3633 8536.1221 c -7858.5039 8536.1055 -7858.6318 8536.1973 -7858.647 8536.3359 c -7858.647 8536.3359 l b -7852.9414 8541.0176 m -7853.042 8541.1816 -7853.1152 8541.3838 -7853.2617 8541.4824 c -7856.0806 8543.3906 -7858.9785 8544.6309 -7861.8848 8546.1328 c -7862.0503 8546.209 -7862.1118 8546.418 -7862.0313 8546.5703 c -7861.9512 8546.7227 -7861.7559 8546.7793 -7861.5898 8546.7041 c -7858.439 8545.3232 -7854.313 8544.5 -7852.6729 8541.1797 c -7852.6289 8541.1113 -7852.6455 8541.0146 -7852.7266 8540.9648 c -7852.7959 8540.9199 -7852.897 8540.9492 -7852.9414 8541.0176 c -7852.9414 8541.0176 l b -7852.6602 8541.918 m -7852.4438 8542.4297 -7852.1431 8542.8896 -7852.0503 8543.4355 c -7851.2183 8548.2773 -7851.1152 8553.042 -7852.248 8557.6875 c -7852.248 8557.6875 l -7852.3418 8557.9531 -7852.2114 8558.2441 -7851.9438 8558.3389 c -7851.6777 8558.4336 -7851.3882 8558.3125 -7851.2935 8558.0479 c -7849.293 8552.8115 -7849.897 8546.7373 -7852.3711 8541.7832 c -7852.4063 8541.7002 -7852.498 8541.6689 -7852.582 8541.6914 c -7852.6641 8541.7275 -7852.6978 8541.835 -7852.6602 8541.918 c -7852.6602 8541.918 l b -7851.5352 8557.5938 m -7848.8984 8555.2275 -7846.6816 8552.252 -7845.853 8548.7363 c -7845.853 8548.7363 l -7845.7246 8548.1816 -7846.0742 8547.623 -7846.6416 8547.4902 c -7847.1992 8547.375 -7847.7578 8547.7246 -7847.8862 8548.2793 c -7848.5649 8551.5313 -7849.8711 8554.6729 -7851.7954 8557.3867 c -7851.7954 8557.3867 l -7851.8462 8557.4551 -7851.834 8557.5576 -7851.7695 8557.6201 c -7851.6992 8557.6699 -7851.5977 8557.6582 -7851.5352 8557.5938 c -7851.5352 8557.5938 l b -7836.3711 8550.1826 m -7837.7114 8545.8301 -7840.2598 8542.0693 -7843.689 8539.1533 C -7843.729 8539.0723 -7843.8242 8539.0322 -7843.9038 8539.0859 C -7843.9863 8539.127 -7844.0122 8539.2207 -7843.9722 8539.3018 C -7843.957 8539.7891 -7843.7144 8540.2334 -7843.4458 8540.5313 c -7838.4063 8546.1621 -7834.9902 8554.7197 -7837.3433 8561.9551 C -7837.0762 8556.4512 -7838.7241 8550.3008 -7842.1362 8545.6738 c -7843.1606 8544.2695 -7844.7422 8544.1211 -7846.3081 8544.2031 C -7846.4023 8544.1895 -7846.4834 8544.2432 -7846.4961 8544.3369 c -7846.5098 8544.4189 -7846.4551 8544.5137 -7846.3623 8544.5254 C -7843.1479 8545.7695 -7841.4878 8549.2246 -7840.084 8552.1943 c -7838.415 8555.7441 -7837.7017 8559.6387 -7838.0054 8563.5 C -7838.0454 8563.6777 -7838.1138 8565.3975 -7837.9775 8565.4102 C -7837.8306 8565.4395 -7837.709 8565.3438 -7837.6802 8565.1943 C -7837.645 8565.0449 -7834.6426 8555.7988 -7836.3711 8550.1826 c b -7844.4863 8537.4912 m -7843.3945 8533.6211 -7841.1094 8530.251 -7838.4824 8527.2383 c -7838.3306 8527.1045 -7838.3145 8526.8867 -7838.4502 8526.7354 c -7838.5752 8526.6006 -7838.8047 8526.582 -7838.957 8526.7178 c -7842.3306 8529.332 -7843.4487 8533.541 -7844.7954 8537.375 c -7844.7954 8537.375 l -7844.8262 8537.4648 -7844.7754 8537.5586 -7844.6982 8537.5869 c -7844.6094 8537.6191 -7844.5166 8537.5684 -7844.4863 8537.4912 c -7844.4863 8537.4912 l b -7838.5313 8562.1094 m -7838.5991 8562.0566 -7838.707 8562.083 -7838.748 8562.1504 C -7838.9634 8562.4746 -7840.6914 8564.5195 -7841.3926 8565.1406 c -7846.1719 8569.3945 -7849.5137 8573.9609 -7857.5391 8577.7227 c -7864.4512 8580.9639 -7867.1113 8583.5957 -7874.3862 8581.8262 c -7877.687 8581.0293 -7879.0313 8580.5313 -7880.4351 8575.4551 C -7881.9473 8569.2988 -7880.8672 8571.7832 -7881.084 8564.4385 c -7881.2222 8559.6973 -7884 8548.4551 -7871.5254 8534.2598 C -7871.4199 8534.1484 -7871.4336 8533.9961 -7871.5337 8533.9072 C -7871.6328 8533.8027 -7871.7959 8533.8164 -7871.8862 8533.916 C -7877.5786 8538.7168 -7881.0234 8545.6582 -7882.3145 8552.9424 c -7883.2871 8558.4668 -7882.9199 8563.25 -7882.666 8569.6367 c -7882.5688 8572.0938 -7883.6855 8579.0723 -7878.9102 8583.0625 c -7875.3926 8586 -7870.3911 8585.5469 -7866.3545 8584.1563 c -7860.6992 8582.2119 -7855.9727 8579.1465 -7850.8711 8575.6094 c -7847.2656 8573.125 -7839.2881 8563.2852 -7838.4785 8562.3262 C -7838.4351 8562.2588 -7838.4502 8562.1504 -7838.5313 8562.1094 C b -7873.0503 8549.3057 m -7872.168 8548.5029 -7871.7017 8549.8457 -7871.4297 8550.6016 c -7871.1626 8551.3574 -7870.189 8551.25 -7870.5127 8551.5732 c -7870.8369 8551.8975 -7870.8369 8551.9521 -7871.3232 8551.5195 c -7871.8086 8551.0879 -7871.8086 8551.7363 -7872.5649 8551.25 c -7873.3198 8550.7627 -7873.645 8549.8457 -7873.0503 8549.3057 c b -7865.6519 8553.9492 m -7865.3657 8553.5918 -7864.6802 8553.5723 -7864.4648 8553.8945 c -7864.25 8554.2197 -7863.3306 8554.2734 -7863.4937 8554.5967 c -7863.6543 8554.9219 -7863.6016 8555.1387 -7864.0874 8554.9219 c -7864.5737 8554.7051 -7864.4121 8555.2998 -7864.897 8555.084 c -7865.3833 8554.8672 -7865.8687 8554.2197 -7865.6519 8553.9492 c b -7857.6074 8559.0791 m -7857.1206 8558.7559 -7855.8794 8559.5117 -7856.4727 8559.5117 c -7857.0674 8559.5117 -7856.311 8560.2676 -7856.8521 8560.4834 c -7857.3906 8560.6992 -7857.2832 8560.4297 -7857.6074 8560.6445 c -7857.9297 8560.8613 -7858.3633 8561.2393 -7858.5239 8560.4297 c -7858.6855 8559.6191 -7858.3633 8559.6191 -7857.9849 8559.3496 c -7857.6074 8559.0791 -7857.6074 8559.0791 y b -7872.2402 8559.3496 m -7871.1074 8559.2422 -7871.8633 8559.998 -7871.269 8560.4834 c -7870.6738 8560.9697 -7869.918 8561.6172 -7870.729 8561.4004 c -7871.5391 8561.1855 -7872.9961 8561.6719 -7872.9434 8560.5381 c -7872.8887 8559.4033 -7872.6328 8559.3867 -7872.2402 8559.3496 c b -7866.5703 8567.6113 m -7866.1016 8567.3438 -7866.6802 8567.7197 -7866.0303 8567.6113 c -7865.3833 8567.5039 -7864.7886 8567.6113 -7865.2207 8567.8281 c -7865.6519 8568.0439 -7866.3008 8568.1523 -7866.4634 8567.9893 c -7866.625 8567.8281 -7866.9473 8567.8281 -7866.5703 8567.6113 c b -7857.0674 8567.1797 m -7857.4785 8566.1797 -7856.0962 8566.4238 -7855.4473 8566.7461 c -7854.7998 8567.0723 -7853.8262 8566.4775 -7854.4209 8566.9102 c -7855.0137 8567.3418 -7854.7998 8566.9102 -7855.3926 8567.2334 c -7855.9873 8567.5566 -7856.6895 8568.0977 -7857.0674 8567.1797 c b -7872.6738 8573.0664 m -7872.7222 8572.0752 -7871.8086 8572.957 -7871.269 8573.0117 c -7870.729 8573.0664 -7870.0801 8573.0664 -7870.2432 8573.2813 c -7870.4038 8573.498 -7870.459 8573.498 -7871.1626 8573.7129 c -7871.8633 8573.9297 -7872.6191 8574.1445 -7872.6738 8573.0664 c b -7873.1582 8567.6113 m -7874.0664 8567.9746 -7874.293 8567.8809 -7874.5625 8568.2051 c -7874.834 8568.5293 -7875.1558 8569.2314 -7875.5352 8568.0977 c -7875.9121 8566.9629 -7875.4282 8565.7764 -7875.0479 8565.9375 c -7874.6714 8566.0996 -7874.293 8566.7461 -7873.8618 8566.9629 c -7873.4297 8567.1797 -7872.6191 8567.3945 -7873.1582 8567.6113 c b U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 41) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7803 8586 L -7803 8481 L -7884 8481 L -7884 8586 L n u u u 0 O 0 0 0 1 k -7865.8057 8498.4258 m -7866.0742 8496.6621 -7867.1602 8495.291 -7868.5239 8495.3965 c -7869.8862 8495.502 -7870.707 8497.0234 -7870.7432 8498.8066 c -7870.748 8499.0693 -7870.6743 8500.2441 -7870.6304 8500.4775 C -7870.6382 8500.582 -7870.6191 8500.6738 -7870.6104 8500.7803 c -7870.5142 8502.0254 -7869.3574 8503.3604 -7867.9414 8503.25 c -7866.5249 8503.1406 -7865.4897 8501.8613 -7865.6367 8500.4727 c -7865.644 8500.4072 -7865.6958 8499.626 -7865.707 8499.5625 C -7865.6816 8499.2852 -7865.7598 8498.7256 -7865.8057 8498.4258 c f -7876.2646 8507.7334 m -7876.9946 8515.916 -7871.5015 8515.1191 v -7868.3682 8514.0186 -7869.4414 8511.1211 v -7869.6426 8509.752 -7871.7847 8508.498 v -7872.146 8508.25 -7872.7632 8507.1016 v -7873.1294 8505.5977 -7874.5186 8505.2979 v -7876.0762 8505.251 -7876.2646 8507.7334 v f -7850.7646 8516.4971 m F -7850.0762 8514.3408 m -7850.7847 8513.1934 -7853.8848 8513.6279 Y -7854.811 8513.6885 -7855.3799 8513.1113 Y -7857.8394 8509.0918 -7861.0386 8509.8857 -7861.4082 8509.9932 C -7861.4097 8509.9863 L -7864.999 8510.6045 -7865.2666 8515.6035 V -7865.4912 8516.3828 -7866.335 8516.7695 V -7869.2695 8517.8613 -7869.3481 8519.208 V -7869.8999 8521.1152 -7867.6006 8521.7422 V -7865.6792 8522.2568 -7863.7886 8519.8945 V -7862.6113 8518.6797 -7859.5762 8517.9395 V -7859.5728 8517.9531 L -7856.3594 8517.0459 -7854.6392 8517.5889 Y -7851.8521 8518.7676 -7850.4063 8517.4014 Y -7848.6826 8515.7559 -7850.0762 8514.3408 Y f -7863.9834 8497.8789 m -7864.5854 8496.2002 -7864.2822 8494.4775 -7863.0327 8493.9229 c -7861.7842 8493.3672 -7860.3384 8494.3164 -7859.4585 8495.8672 c -7859.3286 8496.0957 -7858.8359 8497.165 -7858.7632 8497.3906 C -7858.7065 8497.4785 -7858.6792 8497.5684 -7858.6362 8497.667 c -7858.1289 8498.8086 -7858.5122 8500.5303 -7859.8105 8501.1074 c -7861.1089 8501.6855 -7862.6279 8501.0527 -7863.1582 8499.7617 c -7863.1831 8499.7002 -7863.5078 8498.9883 -7863.5298 8498.9268 C -7863.6831 8498.6963 -7863.8809 8498.166 -7863.9834 8497.8789 c f -7849.7129 8500.9316 m -7845.1802 8507.7822 -7850.3911 8509.6943 v -7853.6714 8510.2168 -7854.103 8507.1572 v -7854.5786 8505.8564 -7853.29 8503.7354 v -7853.0903 8503.3447 -7853.0938 8502.04 v -7853.4858 8500.5449 -7852.4082 8499.6182 v -7851.0591 8498.8359 -7849.7129 8500.9316 v f U u -7824.7358 8550.1074 m -7824.3687 8548.3623 -7824.9048 8546.6963 -7826.2183 8546.3164 c -7827.5322 8545.9375 -7828.8345 8547.0752 -7829.4937 8548.7324 c -7829.5903 8548.9775 -7829.9326 8550.1025 -7829.9746 8550.3369 C -7830.0176 8550.4326 -7830.0322 8550.5244 -7830.0625 8550.6279 c -7830.4087 8551.8271 -7829.7935 8553.4805 -7828.4282 8553.875 c -7827.063 8554.2695 -7825.645 8553.4365 -7825.2969 8552.085 c -7825.2793 8552.0205 -7825.0552 8551.2705 -7825.0425 8551.207 C -7824.9214 8550.9551 -7824.7983 8550.4053 -7824.7358 8550.1074 c f -7838.2705 8554.6172 m -7841.8242 8562.0244 -7836.3999 8563.2061 v -7833.0801 8563.2754 -7833.0688 8560.1846 v -7832.7778 8558.8311 -7834.3433 8556.9072 v -7834.5942 8556.5459 -7834.7695 8555.2539 v -7834.5854 8553.7188 -7835.7793 8552.9492 v -7837.2222 8552.3594 -7838.2705 8554.6172 v f -7817.4648 8571.7695 m F -7816.063 8569.9912 m -7816.3247 8568.6689 -7819.3799 8567.9883 Y -7820.27 8567.7197 -7820.5986 8566.9795 Y -7821.4922 8562.3535 -7824.7666 8561.9746 -7825.1494 8561.9453 C -7825.1494 8561.9395 L -7828.7271 8561.2588 -7830.731 8565.8467 V -7831.2153 8566.4961 -7832.1416 8566.5625 V -7835.272 8566.5557 -7835.8169 8567.7891 V -7837.0039 8569.3809 -7835.0713 8570.7764 V -7833.4526 8571.9316 -7830.853 8570.3818 V -7829.3242 8569.6582 -7826.2222 8570.0293 V -7826.2231 8570.042 L -7822.896 8570.3213 -7821.4766 8571.4326 Y -7819.2793 8573.5146 -7817.4463 8572.7432 Y -7815.2554 8571.8057 -7816.063 8569.9912 Y f -7822.8374 8550.2354 m -7822.813 8548.4512 -7821.9258 8546.9453 -7820.5601 8546.8633 c -7819.1943 8546.7803 -7818.1743 8548.1768 -7817.895 8549.9385 c -7817.854 8550.1973 -7817.7666 8551.3711 -7817.7778 8551.6094 C -7817.7559 8551.7109 -7817.7617 8551.8037 -7817.7559 8551.9121 c -7817.6807 8553.1592 -7818.644 8554.6367 -7820.0625 8554.7217 c -7821.4814 8554.8066 -7822.6826 8553.6826 -7822.7246 8552.2871 c -7822.7271 8552.2217 -7822.7822 8551.4404 -7822.7798 8551.375 C -7822.8433 8551.1045 -7822.8423 8550.54 -7822.8374 8550.2354 c f -7811.0186 8557.5625 m -7809.1777 8565.5684 -7814.7271 8565.5303 v -7817.9834 8564.8691 -7817.3154 8561.8516 v -7817.3032 8560.4668 -7815.353 8558.9326 v -7815.0278 8558.6377 -7814.5742 8557.415 v -7814.417 8555.876 -7813.083 8555.3877 v -7811.5454 8555.1279 -7811.0186 8557.5625 v f U U 1 Ap -7884 8586 m -7884 8481 L -7803 8481 L -7803 8586 L -7884 8586 L n U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 42) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 45) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8543.918 m -7885 8587 L -7798.2217 8587 L -7798.2217 8543.918 L -7885 8543.918 L n u u 0 O 0 0 0 1 k -7825.2217 8573.2363 m -7825.2217 8581.0742 L -7813.2217 8574.1445 L -7801.2217 8567.2168 L -7813.2217 8560.2891 L -7825.2217 8553.3613 L -7825.2217 8561.4824 L -7883.9351 8547.7168 L -7870.9878 8566.8027 L -7885 8587 L -7825.2217 8573.2363 L f 0 1 1 0.1 k 0 R 0 0 0 1 K -7823.2217 8570.2363 m -7823.2217 8578.0742 L -7811.2217 8571.1445 L -7799.2217 8564.2168 L -7811.2217 8557.2891 L -7823.2217 8550.3613 L -7823.2217 8558.4824 L -7881.9351 8544.7168 L -7867.2754 8564.3594 L -7881.9351 8584 L -7823.2217 8570.2363 L b U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 50) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8586 m -7756.877 8586 L -7756.877 8538.415 L -7884 8538.415 L -7884 8586 L n u *u 0 O 0.9529 0.949 0.1961 0.0745 k -7857.793 8570.417 m -7857.8232 8570.2676 L -7859.9849 8564.3643 -7860.9438 8561.6377 -7861.2754 8560.2891 c -7861.3657 8560.2891 L -7861.6953 8561.6074 -7862.7754 8564.335 -7864.9673 8570.2676 c -7864.9966 8570.417 L -7857.793 8570.417 l f 1 D -7868.1182 8578.9678 m -7869.6191 8582.5371 -7870.3994 8584.709 -7868.1182 8584.917 c -7868.1182 8585.9678 L -7870.6992 8585.9375 -7873.5806 8585.917 -7876.3418 8585.917 c -7880.0649 8585.917 -7882.5273 8585.9375 -7884 8585.9678 c -7884 8584.917 L -7882.1064 8584.709 -7881.0542 8582.5674 -7873.5513 8565.5029 c -7861.6953 8538.415 L -7859.8638 8538.415 L -7848.1582 8565.5029 L -7840.8047 8582.5078 -7839.7246 8584.709 -7837.8887 8584.917 c -7837.8887 8585.9678 L -7839.5142 8585.9375 -7841.916 8585.917 -7845.5767 8585.917 c -7848.5488 8585.917 -7851.6694 8585.9375 -7854.7026 8585.9678 c -7854.7026 8584.917 L -7852.481 8584.709 -7853.3218 8582.5078 -7854.7617 8578.9678 C -7868.1182 8578.9678 l f *U *u 0 D -7813.0762 8554.0811 m -7813.0762 8550.4717 -7815.3535 8548.0947 -7819.1294 8548.0947 c -7820.2383 8548.0947 -7821.0767 8548.2158 -7821.5273 8548.2451 c -7821.5273 8560.5479 L -7820.8672 8560.6084 -7820.208 8560.6084 -7819.729 8560.6084 c -7818.2002 8560.6084 -7816.7026 8560.127 -7815.6841 8559.4053 c -7814.3945 8558.5332 -7813.0762 8556.7881 -7813.0762 8554.1416 C -7813.0762 8554.0811 l f 1 D -7832.0806 8558.3926 m -7832.0806 8542.6445 -7832.0806 8540.4287 -7834.542 8540.2783 c -7834.542 8539.3184 L -7833.042 8539.2588 -7830.3174 8539.1992 -7827.5664 8539.1689 c -7825.6538 8539.1084 -7822.3945 8539.0186 -7820.1479 8538.9775 c -7816.582 8538.9775 -7813.585 8539.4258 -7811.0049 8540.2627 c -7806.353 8541.8477 -7801.9702 8545.8525 -7801.9702 8553.6602 c -7801.9702 8558.7432 -7804.4014 8562.3193 -7806.5034 8564.0605 c -7807.583 8565.0215 -7808.8135 8565.832 -7809.7744 8566.3125 c -7809.7744 8566.4629 L -7807.5234 8569.4912 -7805.6025 8572.0625 -7799.3906 8580.6426 c -7797.5 8583.0645 -7795.9102 8584.7383 -7794.7402 8584.9775 c -7794.7402 8586 L -7796.6602 8586 -7799 8585.8848 -7801.1294 8585.8848 c -7803.3511 8585.8848 -7804.8521 8586 -7806.4424 8586 c -7807.6729 8586 -7808.7241 8585.9404 -7809.5039 8585.2725 c -7813.0151 8579.8477 -7816.9121 8573.7559 -7820.1182 8568.7139 c -7820.5078 8568.7139 -7820.957 8568.7139 -7821.5273 8568.7139 c -7821.5273 8571.2852 L -7821.5273 8582.5264 -7821.437 8584.7686 -7819.1895 8584.9775 c -7819.1895 8585.9697 L -7820.6279 8585.9404 -7823.9194 8585.915 -7826.6992 8585.915 c -7829.9287 8585.915 -7832.8921 8585.9404 -7834.5122 8585.9697 c -7834.5122 8584.9775 L -7832.0518 8584.7686 -7832.0806 8582.5264 -7832.0806 8565.5918 C -7832.0806 8558.3926 l f *U *u 0 D -7781.4561 8565.5928 m -7781.4561 8582.4941 -7781.4561 8584.6484 -7784.2832 8584.9775 C -7784.2832 8585.9697 l -7782.3887 8585.9404 -7779.0542 8585.915 -7775.7822 8585.915 c -7772.6294 8585.915 -7769.5688 8585.9404 -7767.2881 8585.9697 C -7767.2881 8584.9775 l -7770.2578 8584.9775 -7770.2881 8582.5244 -7770.2881 8565.5928 C -7770.2881 8548.1514 L -7762.8193 8548.1514 l -7759.999 8548.1514 -7758.5298 8548.96 -7757.8994 8551.2627 C -7756.9072 8551.2627 l -7756.9072 8546.4697 -7756.877 8542.415 -7756.877 8539.1709 c -7761.3486 8539.2012 -7766.748 8539.2314 -7772.0601 8539.2314 C -7779.7446 8539.2314 l -7784.5537 8539.2314 -7789.9966 8539.2012 -7794.9614 8539.1709 c -7794.9614 8542.3848 -7794.9326 8546.4697 -7794.9326 8551.2627 C -7793.9072 8551.2627 l -7793.3657 8549.1094 -7791.771 8548.1514 -7788.9438 8548.1514 C -7781.4561 8548.1514 l -7781.4561 8565.5928 L f *U U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 62) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8569.9043 m -7846.7305 8561.3408 L -7885 8561.3408 L -7885 8569.9043 L -7846.7305 8569.9043 L f -7846.7305 8573.0967 m -7846.7305 8572.4229 L -7885 8572.4229 L -7885 8573.0967 L -7846.7305 8573.0967 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 63) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8587 m -7885 8548.7305 L -7846.7305 8548.7305 L -7846.7305 8587 L -7885 8587 L n 0 O 1 0.14 0.09 0 k -7846.7305 8565.8262 m -7846.7305 8574.3896 L -7859.3408 8574.3896 L -7859.3408 8587 L -7867.9038 8587 L -7867.9063 8565.8262 L -7867.9038 8565.8262 L -7867.9038 8565.8252 L -7846.7305 8565.8262 L f -7846.7305 8563.3076 m -7870.4233 8563.3076 L -7870.4233 8587 L -7871.0967 8587 L -7871.0977 8562.6328 L -7846.7305 8562.6328 L -7846.7305 8563.3076 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 64) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7885 8586.999 m -7885 8548.7285 L -7846.7305 8548.7285 L -7846.7305 8586.999 L -7885 8586.999 L n 0 O 1 0.14 0.09 0 k -7846.7305 8561.3389 m -7872.3896 8561.3389 L -7872.3896 8586.999 L -7863.8262 8587 L -7863.8262 8569.9033 L -7846.7305 8569.9033 L -7846.7305 8561.3389 L f -7846.7305 8572.4219 m -7861.3081 8572.4219 L -7861.3081 8587 L -7860.6338 8587 L -7860.6338 8573.0957 L -7846.7305 8573.0957 L -7846.7305 8572.4219 L f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 65) 0 A u 1 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.0625 8559.4609 m -7884.6025 8559.4609 L -7884.6025 8587 L -7857.0625 8587 L -7857.0625 8559.4609 L n 0 O 0 0.55 1 0.12 k -7856.8418 8572.7002 m -7885 8572.7002 L -7885 8573.8252 L -7856.8418 8573.8252 L -7856.8418 8572.7002 L f u 0 0.55 1 0.3 k -7883.9814 8560.5215 m -7884.4102 8562.5254 -7883.1865 8566.1514 -7880.0874 8569.251 c -7876.9878 8572.3496 -7873.3457 8573.6602 -7871.3594 8573.1455 C -7871.3594 8573.1455 L -7870.875 8571.1895 -7872.1519 8567.5117 -7875.25 8564.4141 c -7878.3457 8561.3184 -7882.0122 8560.1064 -7883.9814 8560.5215 C f 0 0.39 0.7 0.12 k -7883.9814 8585.9912 m -7884.4102 8583.9883 -7883.1865 8580.3613 -7880.0874 8577.2617 c -7876.9878 8574.1641 -7873.3457 8572.8535 -7871.3594 8573.3672 C -7871.3594 8573.3672 L -7870.875 8575.3242 -7872.1519 8579.001 -7875.25 8582.0996 c -7878.3457 8585.1953 -7882.0122 8586.4063 -7883.9814 8585.9912 C f U u 0 0.55 1 0.3 k -7870.1782 8585.9912 m -7870.6074 8583.9883 -7869.3838 8580.3613 -7866.2842 8577.2617 c -7863.1855 8574.1641 -7859.543 8572.8535 -7857.5576 8573.3672 C -7857.5566 8573.3672 L -7857.0718 8575.3242 -7858.3496 8579.001 -7861.4473 8582.0996 c -7864.543 8585.1953 -7868.209 8586.4063 -7870.1782 8585.9912 C f 0 0.39 0.7 0.12 k -7870.1782 8560.5215 m -7870.6074 8562.5254 -7869.3838 8566.1514 -7866.2842 8569.251 c -7863.1855 8572.3496 -7859.543 8573.6602 -7857.5576 8573.1455 C -7857.5566 8573.1455 L -7857.0718 8571.1895 -7858.3496 8567.5117 -7861.4473 8564.4141 c -7864.543 8561.3184 -7868.209 8560.1064 -7870.1782 8560.5215 C f U U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 67) 0 A u 0 Ap 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.085 m -7885 8559.085 L -7885 8586.624 L -7857.4609 8586.624 L -7857.4609 8559.085 L n 0 O 0 0.55 1 0.12 k -7871.7598 8577.3623 m -7871.7598 8587 L -7870.6343 8587 L -7870.6343 8577.3623 L -7871.7598 8577.3623 L f 0 0.55 1 0.3 k -7875.4233 8572.876 m -7874.3096 8571.1553 -7870.8809 8569.457 -7866.4966 8569.457 c -7862.1152 8569.457 -7858.6138 8571.1064 -7857.5718 8572.874 C -7857.5718 8572.874 L -7858.6138 8574.6006 -7862.1152 8576.2979 -7866.4966 8576.2979 c -7870.875 8576.2979 -7874.3242 8574.5615 -7875.4233 8572.876 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 69) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7857.4609 8559.4609 m -7885 8559.4609 L -7885 8587 L -7857.4609 8587 L -7857.4609 8559.4609 L n 0 O 0 0.55 1 0.3 k -7875.4233 8573.252 m -7874.3096 8571.5313 -7870.8809 8569.833 -7866.4966 8569.833 c -7862.1152 8569.833 -7858.6138 8571.4824 -7857.5718 8573.25 C -7857.5718 8573.25 L -7858.6138 8574.9766 -7862.1152 8576.6738 -7866.4966 8576.6738 c -7870.875 8576.6738 -7874.3242 8574.9375 -7875.4233 8573.252 C f U %AI8_EndBrushPattern %AI8_BeginBrushPattern (New Pattern 83) 0 A u 800 Ar 0 J 0 j 1 w 4 M []0 d %AI3_Note: 0 D 0 XR -7884 8585.9355 m -7670.4009 8585.9355 L -7670.4009 8578.1348 L -7884 8578.1348 L -7884 8585.9355 L n 0 O 0 0 0 1 k -7884 8582.0352 m -7873.9858 8584.5273 -7867.187 8585.875 -7855.2007 8585.9355 c -7842.2183 8586 -7777.2002 8585.9355 y -7712.1816 8586 -7699.2002 8585.9355 v -7687.2129 8585.875 -7680.415 8584.5273 -7670.4009 8582.0352 C -7680.415 8579.543 -7687.2129 8578.1953 -7699.2002 8578.1348 c -7712.1816 8578.0693 -7777.2002 8578.1348 y -7842.2183 8578.0693 -7855.2007 8578.1348 v -7867.187 8578.1953 -7873.9858 8579.543 -7884 8582.0352 C f U %AI8_EndBrushPattern %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np 4 Bn %AI5_BeginGradient: (Black, White) (Black, White) 0 2 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 %_Br [ 0 0 50 100 %_BS %_0 0 50 100 Bs 1 0 50 0 %_BS %_1 0 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Chrome) (Chrome) 0 6 Bd [ 0 < 464646454545444444444343434342424241414141404040403F3F3F3E3E3E3E3D3D3D3C3C3C3C3B 3B3B3B3A3A3A39393939383838383737373636363635353535343434333333333232323131313130 3030302F2F2F2E2E2E2E2D2D2D2D2C2C2C2B2B2B2B2A2A2A2A292929282828282727272626262625 2525252424242323232322222222212121202020201F1F1F1F1E1E1E1D1D1D1D1C1C1C1B1B1B1B1A 1A1A1A1919191818181817171717161616151515151414141413131312121212111111101010100F 0F0F0F0E0E0E0D0D0D0D0C0C0C0C0B0B0B0A0A0A0A09090909080808070707070606060505050504 04040403030302020202010101010000 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 1F1E1E1E1E1E1E1E1E1E1D1D1D1D1D1D1D1D1C1C1C1C1C1C1C1C1B1B1B1B1B1B1B1B1B1A1A1A1A1A 1A1A1A19191919191919191818181818181818181717171717171717161616161616161615151515 15151515151414141414141414131313131313131312121212121212121211111111111111111010 1010101010100F0F0F0F0F0F0F0F0F0E0E0E0E0E0E0E0E0D0D0D0D0D0D0D0D0C0C0C0C0C0C0C0C0C 0B0B0B0B0B0B0B0B0A0A0A0A0A0A0A0A090909090909090909080808080808080807070707070707 07060606060606060606050505050505050504040404040404040303030303030303030202020202 02020201010101010101010000000000 > 1 %_Br 0 0.275 1 < 6B6A696867666564636261605F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544 434241403F3E3D3C3B3A393837363534333231302F2E2D2C2B2A292827262524232221201F > 1 %_Br 0 < 00000101010102020202030303040404040505050506060607070707080808090909090A0A0A0A0B 0B0B0C0C0C0C0D0D0D0D0E0E0E0F0F0F0F1010101011111112121212131313141414141515151516 161617171717181818181919191A1A1A1A1B1B1B1C1C1C1C1D1D1D1D1E1E1E1F1F1F1F2020202021 212122222222232323232424242525252526262626272727282828282929292A2A2A2A2B2B2B2B2C 2C2C2D2D2D2D2E2E2E2E2F2F2F303030303131313132323233333333343434353535353636363637 373738383838393939393A3A3A3B3B3B3B3C3C3C3D3D3D3D3E3E3E3E3F3F3F404040404141414142 42424343434344444444454545464646 > < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > < 00000101020203030304040505050606070708080809090A0A0B0B0B0C0C0D0D0D0E0E0F0F101010 1111121212131314141515151616171718181819191A1A1A1B1B1C1C1D1D1D1E1E1F1F1F20202121 222222232324242525252626272727282829292A2A2A2B2B2C2C2D2D2D2E2E2F2F2F303031313232 32333334343435353636373737383839393A3A3A3B3B3C3C3C3D3D3E3E3F3F3F4040414142424243 434444444545464647474748484949494A4A4B4B4C4C4C4D4D4E4E4F4F4F50505151515252535354 54545555565657575758585959595A5A5B5B5C5C5C5D5D5E5E5E5F5F606061616162626363646464 6565666666676768686969696A6A6B6B > 1 %_Br 1 0 %_Br < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > < 4D4C4C4C4B4B4B4A4A4A4A4949494848484747474746464645454544444444434343424242414141 414040403F3F3F3E3E3E3E3D3D3D3C3C3C3B3B3B3B3A3A3A39393938383838373737363636353535 35343434333333323232323131313030302F2F2F2E2E2E2E2D2D2D2C2C2C2B2B2B2B2A2A2A292929 282828282727272626262525252524242423232322222222212121202020201F1F1F1E1E1E1D1D1D 1D1C1C1C1B1B1B1A1A1A1A1919191818181717171616161615151514141413131313121212111111 101010100F0F0F0E0E0E0D0D0D0D0C0C0C0B0B0B0A0A0A0A09090908080807070707060606050505 04040404030303020202010101010000 > 0 0 1 %_Br [ 1 0 50 92 %_BS %_1 0 50 92 Bs 0 0.275 1 0.12 1 50 59 %_BS %_0 0.275 1 0.12 1 50 59 Bs 0 0.275 1 0.42 1 50 50 %_BS %_0 0.275 1 0.42 1 50 50 Bs 1 0 50 49 %_BS %_1 0 50 49 Bs 1 0 50 41 %_BS %_1 0 50 41 Bs 1 0.3 0 0 1 50 0 %_BS %_1 0.3 0 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Rainbow) (Rainbow) 0 6 Bd [ < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 0 1 %_Br 1 < 0708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F202122232425262728292A2B2C2D2E 2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F50515253545556 5758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F707172737475767778797A7B7C7D7E 7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9FA0A1A2A3A4A5A6 A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7C8C9CACBCCCDCE CFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEFF0F1F2F3F4F5F6 F7F8F9FAFBFCFDFEFF > 0 0 1 %_Br 1 < 00000000000000000000000000000000000001010101010101010101010101010101010101010101 01010101010101010101010101010202020202020202020202020202020202020202020202020202 02020202020202020202030303030303030303030303030303030303030303030303030303030303 03030303030304040404040404040404040404040404040404040404040404040404040404040404 04040505050505050505050505050505050505050505050505050505050505050505050505050606 06060606060606060606060606060606060606060606060606060606060606060607070707070707 07070707070707070707070707070707 > < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 0 1 %_Br < 000102030405060708090A0B0C0D0E0F101112131415161718191A1B1C1D1E1F2021222324252627 28292A2B2C2D2E2F303132333435363738393A3B3C3D3E3F404142434445464748494A4B4C4D4E4F 505152535455565758595A5B5C5D5E5F606162636465666768696A6B6C6D6E6F7071727374757677 78797A7B7C7D7E7F808182838485868788898A8B8C8D8E8F909192939495969798999A9B9C9D9E9F A0A1A2A3A4A5A6A7A8A9AAABACADAEAFB0B1B2B3B4B5B6B7B8B9BABBBCBDBEBFC0C1C2C3C4C5C6C7 C8C9CACBCCCDCECFD0D1D2D3D4D5D6D7D8D9DADBDCDDDEDFE0E1E2E3E4E5E6E7E8E9EAEBECEDEEEF F0F1F2F3F4F5F6F7F8F9FAFBFCFDFEFF > 0 1 0 1 %_Br 0 < FFFEFDFCFBFAF9F8F7F6F5F4F3F2F1F0EFEEEDECEBEAE9E8E7E6E5E4E3E2E1E0DFDEDDDCDBDAD9D8 D7D6D5D4D3D2D1D0CFCECDCCCBCAC9C8C7C6C5C4C3C2C1C0BFBEBDBCBBBAB9B8B7B6B5B4B3B2B1B0 AFAEADACABAAA9A8A7A6A5A4A3A2A1A09F9E9D9C9B9A999897969594939291908F8E8D8C8B8A8988 87868584838281807F7E7D7C7B7A797877767574737271706F6E6D6C6B6A69686766656463626160 5F5E5D5C5B5A595857565554535251504F4E4D4C4B4A494847464544434241403F3E3D3C3B3A3938 37363534333231302F2E2D2C2B2A292827262524232221201F1E1D1C1B1A19181716151413121110 0F0E0D0C0B0A09080706050403020100 > 1 0 1 %_Br [ 0 1 0 0 1 50 100 %_BS %_0 1 0 0 1 50 100 Bs 1 1 0 0 1 50 80 %_BS %_1 1 0 0 1 50 80 Bs 1 0.0279 0 0 1 50 60 %_BS %_1 0.0279 0 0 1 50 60 Bs 1 0 1 0 1 50 40 %_BS %_1 0 1 0 1 50 40 Bs 0 0 1 0 1 50 20 %_BS %_0 0 1 0 1 50 20 Bs 0 1 1 0 1 50 0 %_BS %_0 1 1 0 1 50 0 Bs BD %AI5_EndGradient %AI5_BeginGradient: (Yellow & Orange Radial) (Yellow & Orange Radial) 1 2 Bd [ 0 < 0001010203040506060708090A0B0C0C0D0E0F10111213131415161718191A1B1C1D1D1E1F202122 232425262728292A2B2B2C2D2E2F303132333435363738393A3B3C3D3E3E3F404142434445464748 494A4B4C4D4E4F505152535455565758595A5B5C5D5E5F60606162636465666768696A6B6C6D6E6F 707172737475767778797A7B7C7D7E7F808182838485868788898A8B8C > < FFFFFFFFFEFEFEFEFEFEFEFDFDFDFDFDFDFCFCFCFCFCFCFBFBFBFBFBFBFAFAFAFAFAFAF9F9F9F9F9 F9F8F8F8F8F8F8F7F7F7F7F7F7F6F6F6F6F6F6F5F5F5F5F5F5F4F4F4F4F4F3F3F3F3F3F3F2F2F2F2 F2F2F1F1F1F1F1F0F0F0F0F0F0EFEFEFEFEFEFEEEEEEEEEEEDEDEDEDEDEDECECECECECEBEBEBEBEB EBEAEAEAEAEAE9E9E9E9E9E9E8E8E8E8E8E8E7E7E7E7E7E6E6E6E6E6E6 > 0 1 %_Br [ 0 0 1 0 1 52 19 %_BS %_0 0 1 0 1 52 19 Bs 0 0.55 0.9 0 1 50 100 %_BS %_0 0.55 0.9 0 1 50 100 Bs BD %AI5_EndGradient %AI5_End_NonPrinting-- %AI5_BeginPalette 0 0 Pb 1 1 1 1 ([Registration]) 0 Xs ([Registration]) Pc 0 0 0 0 k (C=0 M=0 Y=0 K=0) Pc 0 0 0 1 k (C=0 M=0 Y=0 K=100) Pc 0 0.1 1 0 k (C=0 M=10 Y=100 K=0) Pc 0 0.5 0 0 k (C=0 M=50 Y=0 K=0) Pc 0 0.5 1 0 k (C=0 M=50 Y=100 K=0) Pc 1 0.55 1 0 k (C=100 M=55 Y=100 K=0) Pc 1 0.9 0.1 0 k (C=100 M=90 Y=10 K=0) Pc 0.15 1 1 0 k (C=15 M=100 Y=100 K=0) Pc 0.45 0.9 0 0 k (C=45 M=90 Y=0 K=0) Pc 0.5 0.4 0.3 0 k (C=50 M=40 Y=30 K=0) Pc 0.5 0.85 1 0 k (C=50 M=85 Y=100 K=0) Pc 0.75 0.05 1 0 k (C=75 M=5 Y=100 K=0) Pc 0.75 0.9 0 0 k (C=75 M=90 Y=0 K=0) Pc 0.8 0.05 0 0 k (C=80 M=5 Y=0 K=0) Pc Bb 2 (Black, White) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Black, White) Pc Bb 2 (Chrome) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Chrome) Pc Bb 2 (Rainbow) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Rainbow) Pc Bb 0 0 0 0 Bh 2 (Yellow & Orange Radial) -7885 8587 0 0 1 0 0 1 0 0 Bg 0 BB (Yellow & Orange Radial) Pc (Brick) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Brick) Pc (Confetti) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Confetti) Pc (Leaves - Fall ) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Leaves - Fall ) Pc (Stripes) 0 0 1 1 0 0 0 0 0 [1 0 0 1 0 0] p (Stripes) Pc PB %AI5_EndPalette %AI5_Begin_NonPrinting Np %AI8_BeginPluginObject (Adobe Brush Manager Order) (Adobe Brush Manager Order) ( Adobe Calligraphic Brush Tool/ 6 pt Flat / Adobe Calligraphic Brush T) - (ool/ 10 pt Oval/ Adobe Calligraphic Brush Tool/ 12 pt Oval / Adobe Cal) - (ligraphic Brush Tool/ 20 pt Oval/ Adobe Calligraphic Brush Tool/ 25 pt) - ( Round / Adobe Calligraphic Brush Tool/ 50 pt Flat/ Adobe Scatter Brus) - (h Tool/ Dog Tracks/ Adobe Scatter Brush Tool/ Fall Leaf/ Adobe Scatter) - ( Brush Tool/ Ladybug/ Adobe Scatter Brush Tool/ Push Pin/ Adobe Scatte) - (r Brush Tool/ Strawberry/ Adobe Scatter Brush Tool/ Twinkle Star / Ado) - (be ArtOnPath Brush Tool/ Marker/ Adobe ArtOnPath Brush Tool/ Tapered S) - (troke/ Adobe ArtOnPath Brush Tool/ Arrow/ Adobe ArtOnPath Brush Tool/ ) - (Paintbrush/ Adobe ArtOnPath Brush Tool/ Type/ Adobe PatternOnPath Brus) - (h Tool/ Double Lines/ Adobe PatternOnPath Brush Tool/ Laurel/ Adobe Pa) - (tternOnPath Brush Tool/ Rope /) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (6 pt Flat ) (1 4 8 10 10 90 90 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (10 pt Oval) (1 1 19 15 15 130 130 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (12 pt Oval ) (1 7 17 45 45 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (20 pt Oval) (1 20 20 20 100 40 80 0 2 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (25 pt Round ) (1 10 40 100 100 0 0 2 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Calligraphic Brush Tool) (50 pt Flat) (1 40 60 0 0 44 44 0 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Arrow) (1 / New Pattern 45/ / / / / 5 0.898039 0 0 / 2 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Marker) (1 / New Pattern 8/ / / / / 0 0 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Paintbrush) (1 / New Pattern 5/ / / / / 1 0.5 0.85 1 0.45 / 0 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Tapered Stroke) (1 / New Pattern 83/ / / / / 1 0 0 0 1 / 1 1 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe ArtOnPath Brush Tool) (Type) (1 / New Pattern 50/ / / / / 1 0.952941 0.94902 0.196078 0.0745098 / 1) - ( 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Double Lines) (1 / New Pattern 62/ New Pattern 63/ New Pattern 64/ / / 1 1 0.14 0.09 ) - (0 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Laurel) (1 / New Pattern 65/ New Pattern 42/ New Pattern 67/ / New Pattern 69/ ) - (1 0 0.55 1 0.3 / 1 0 1 0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe PatternOnPath Brush Tool) (Rope ) (1 / New Pattern 1/ / / New Pattern 3/ New Pattern 6/ 5 0 0 0 / 1 0 1 ) - (0 1 0 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Dog Tracks) (1 /New Pattern 41/ 1 0 0 0 1 / 0 1 1 0 1 1 0 0 0 0 -90 -90 0 1 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Fall Leaf) (1 /New Pattern 34/ 1 0.0745 0.9 0.9019 0.18 / 0 0.602793 1 1 0.1 1 1 -) - (1 1 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Ladybug) (1 /New Pattern 10/ 5 0.898039 0 0 / 0 1 1 0 0.803911 1.2 1 -1.55 1.55 ) - (1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Push Pin) (1 /New Pattern 36/ 1 0.025 0.1 0.475 0 / 0 1 1 0 0.401676 1 1 -1.06145) - ( 1.06 1 -180 180 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Strawberry) (1 /New Pattern 37/ 1 0 0 0 1 / 0 0.803911 1 1 0.803911 1 1 -0.5 0.5 1 ) - (-75 75.419 1 0 0) . %AI8_EndPluginObject %AI8_BeginPluginObject (Adobe Scatter Brush Tool) (Twinkle Star ) (1 /New Pattern 2/ 0 1 / 1 0.5 1 1 0.25 1 1 -0.5 0.5 1 0 0 0 0 0) . %AI8_EndPluginObject %AI5_End_NonPrinting-- %AI5_Begin_NonPrinting Np %AI8_PluginGroupInfo (Adobe Path Blends) (Adobe Blends Plugin) (Live Blends) %AI8_PluginGroupInfo (Adobe PatternOnPath Brush Tool) (Adobe Pattern Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe ArtOnPath Brush Tool) (Adobe Art Brush Plugin) (Art Brush Tool) %AI8_PluginGroupInfo (Adobe Calligraphic Brush Tool) (Undo New Calligraphic Brush) (Calligraphic Brush Tool) %AI8_PluginGroupInfo (Adobe Scatter Brush Tool) (Adobe Scatter Brush Plugin) (Scatter Brush Tool) %AI5_End_NonPrinting-- %AI5_BeginLayer 1 1 1 1 0 0 1 0 79 128 255 0 50 Lb (Layer 1) Ln 0 A 0 O 1 g 0 R 0 G 300 Ar 2 J 0 j 0.72 w 3.86 M []0 d %AI3_Note: 0 D 1 XR 135.1201 452.1602 m 189.1201 452.1602 l 189.1201 398.1602 l 135.1201 398.1602 l 135.1201 452.1602 l b /BBAccumRotation (0.000000) XT 216 416.1602 m 270 416.1602 l 270 378.4795 l 216 378.4795 l 216 416.1602 l b /BBAccumRotation (0.000000) XT 0 XR 270 397.2002 m 216 397.2002 l S /BBAccumRotation (0.000000) XT 270 406.7998 m 216 406.7998 l S /BBAccumRotation (0.000000) XT 270 387.8398 m 216 387.8398 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 324 461.2798 m 378 461.2798 l 378 407.2798 l 324 407.2798 l 324 461.2798 l b /BBAccumRotation (0.000000) XT 324 391.4404 m 378 391.4404 l 378 279.1201 l 324 279.1201 l 324 391.4404 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 158.7798 454.3398 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR %_ 0 50 XQ /_Times-Roman 10 8.9799 -2.18 Tf 0 Ts 100 100 Tz 0 Tt %_0 0 100 100 Xu %AI55J_GlyphSubst: GlyphSubstNone 1 TA %_ -- XL 0 TY 0 TV 36 0 Xb XB 0 0 5 TC 100 100 200 TW 25 TG 0 0 0 Ti 0 Ta 0 1 2 2 3 Th 0 Tq 240 Tg 0 0 Tl 0 Tc 0 Tw (vnode) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 223.23 362.2695 0 Tp 0 Tv TP 0 Tr /_Times-Roman 10.48 9.411 -2.2847 Tf 95.4198 100 Tz (bhv_desc) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 333 400.3398 0 Tp 0 Tv TP 0 Tr /_Times-Roman 10 8.9799 -2.18 Tf 100 100 Tz (xfs_inode) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 324 263.1699 0 Tp 0 Tv TP 0 Tr (xfs_vnodeops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 204.7202 417.1201 m 214.3198 416.6401 l 206.3999 422.1602 l 205.4399 419.7598 l 204.7202 417.1201 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 204.7202 417.1201 m 214.3198 416.6401 l 206.3999 422.1602 l 205.4399 419.7598 l 204.7202 417.1201 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 204.96 419.7598 m 189.1201 425.2798 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 411.8398 388.7998 m 421.2002 391.4404 l 411.8398 394.0801 l 411.8398 391.4404 l 411.8398 388.7998 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 388.7998 m 421.2002 391.4404 l 411.8398 394.0801 l 411.8398 391.4404 l 411.8398 388.7998 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 391.4404 m 351.1201 391.4404 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 318 451.4399 m 322.7998 459.8398 l 314.4004 455.2798 l 316.3203 453.3599 l 318 451.4399 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 318 451.4399 m 322.7998 459.8398 l 314.4004 455.2798 l 316.3203 453.3599 l 318 451.4399 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 315.8398 453.1201 m 270 407.2798 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 312.96 386.6396 m 322.0801 389.2803 l 312.96 391.9199 l 312.96 389.2803 l 312.96 386.6396 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 312.96 386.6396 m 322.0801 389.2803 l 312.96 391.9199 l 312.96 389.2803 l 312.96 386.6396 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 312.4795 389.2803 m 270 389.2803 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 129.6001 443.2798 m 133.6802 450.96 l 126.2402 446.6401 l 127.9199 444.96 l 129.6001 443.2798 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 129.6001 443.2798 m 133.6802 450.96 l 126.2402 446.6401 l 127.9199 444.96 l 129.6001 443.2798 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 127.4399 444.7197 m 126 443.2798 l 126 380.1602 l 153.1201 371.2803 l 216 398.1602 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 273.1201 362.8799 m 278.3999 354.96 l 277.9199 364.5596 l 275.52 363.5996 l 273.1201 362.8799 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 273.1201 362.8799 m 278.3999 354.96 l 277.9199 364.5596 l 275.52 363.5996 l 273.1201 362.8799 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 275.2798 364.0801 m 270 380.1602 l S /BBAccumRotation (0.000000) XT 288 344.1602 m 270 344.1602 l S /BBAccumRotation (0.000000) XT 288 335.2803 m 270 335.2803 l S /BBAccumRotation (0.000000) XT 288 326.1602 m 270 326.1602 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 270 317.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (NULL) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 432 389.1699 0 Tp 0 Tv TP 0 Tr (xfs_open\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 411.8398 366.2402 m 421.2002 369.1201 l 411.8398 371.7598 l 411.8398 369.1201 l 411.8398 366.2402 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 366.2402 m 421.2002 369.1201 l 411.8398 371.7598 l 411.8398 369.1201 l 411.8398 366.2402 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 369.1201 m 378 369.1201 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 432 371.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_read\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 371.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 362.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 353.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 1 g 0 R 0 G 2 J 0.72 w 3.86 M 1 XR 171.1201 569.2798 m 224.8799 569.2798 l 224.8799 515.2798 l 171.1201 515.2798 l 171.1201 569.2798 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 185.4399 578.1699 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR 97 100 Tz (inode) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 1 g 0 R 0 G 2 J 0.72 w 3.86 M 1 XR 252 587.2798 m 306 587.2798 l 306 533.2798 l 252 533.2798 l 252 587.2798 l b /BBAccumRotation (0.000000) XT 0 J 1.2 w 0 XR 248.6401 576.2397 m 251.04 585.6001 l 244.0801 579.1201 l 246.2397 577.6797 l 248.6401 576.2397 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 248.6401 576.2397 m 251.04 585.6001 l 244.0801 579.1201 l 246.2397 577.6797 l 248.6401 576.2397 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 246 577.2002 m 224.8799 542.1602 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 189 535.3398 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M 100 100 Tz (ops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 18.7202 476.8799 m 18 476.8799 l S /BBAccumRotation (0.000000) XT [1.5 4.5 ]1.5 d 485.2803 476.8799 m 18.7202 476.8799 l S /BBAccumRotation (0.000000) XT []0 d 486 476.8799 m 485.2803 476.8799 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 18 450 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M /_Times-Roman 12 10.7759 -2.616 Tf 109.5 100 Tz (XFS) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 18 487.98 0 Tp 0 Tv TP 0 Tr (Linux) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 357.8398 584.6401 m 367.2002 587.2798 l 357.8398 589.9199 l 357.8398 587.2798 l 357.8398 584.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 357.8398 584.6401 m 367.2002 587.2798 l 357.8398 589.9199 l 357.8398 587.2798 l 357.8398 584.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 357.3604 587.2798 m 306 587.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 378 587.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M /_Times-Roman 10 8.9799 -2.18 Tf 100 100 Tz (lin) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 388.1602 587.1699 0 Tp 0 Tv TP 0 Tr (vfs_lookup\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 378 571.3398 0 Tp 0 Tv TP 0 Tr (lin) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 388.1602 571.3398 0 Tp 0 Tv TP 0 Tr (vfs_create\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 357.8398 566.6401 m 367.2002 569.2798 l 357.8398 571.9199 l 357.8398 569.2798 l 357.8398 566.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 357.8398 566.6401 m 367.2002 569.2798 l 357.8398 571.9199 l 357.8398 569.2798 l 357.8398 566.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 357.3604 569.2798 m 306 569.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 235.3398 407.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (data) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 234.4199 398.1699 0 Tp 0 Tv TP 0 Tr (v) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 239.2197 398.1699 0 Tp 0 Tv TP 0 Tr (obj) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 238.1099 389.1699 0 Tp 0 Tv TP 0 Tr (ops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 234.9302 380.1699 0 Tp 0 Tv TP 0 Tr (ne) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 244.2197 380.1699 0 Tp 0 Tv TP 0 Tr (xt) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 138.2397 460.7998 m 135.8398 451.6802 l 142.7998 458.1602 l 140.3999 459.6001 l 138.2397 460.7998 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 138.2397 460.7998 m 135.8398 451.6802 l 142.7998 458.1602 l 140.3999 459.6001 l 138.2397 460.7998 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 140.6401 460.0801 m 171.1201 513.1201 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 387 551.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 387 533.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 387 542.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 171 517.3398 0 Tp 0 Tv TP 0 Tr (fs dependent) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 224.8799 533.2798 m 171.1201 533.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 141.1201 425.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (bhv_head) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 142.7798 416.1699 0 Tp 0 Tv TP 0 Tr (bhv_lock) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 224.8799 551.2798 m 171.1201 551.2798 l S /BBAccumRotation (0.000000) XT 189.1201 432 m 135.1201 432 l S /BBAccumRotation (0.000000) XT 189.1201 422.8799 m 135.1201 422.8799 l S /BBAccumRotation (0.000000) XT 189.1201 414 m 135.1201 414 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 432 344.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_lookup\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 411.8398 321.3604 m 421.2002 324 l 411.8398 326.6396 l 411.8398 324 l 411.8398 321.3604 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 321.3604 m 421.2002 324 l 411.8398 326.6396 l 411.8398 324 l 411.8398 321.3604 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 324 m 378 324 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 432 326.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (xfs_create\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 344.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 459 335.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 411.8398 339.3604 m 421.2002 342 l 411.8398 344.6396 l 411.8398 342 l 411.8398 339.3604 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 411.8398 339.3604 m 421.2002 342 l 411.8398 344.6396 l 411.8398 342 l 411.8398 339.3604 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 411.3604 342 m 378 342 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 135.1201 659.2798 m 189.1201 659.2798 l 189.1201 605.2798 l 135.1201 605.2798 l 135.1201 659.2798 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 148.3599 661.3398 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR 97 100 Tz (dirent) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 153 625.3398 0 Tp 0 Tv TP 0 Tr 100 100 Tz (ops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 135 607.3398 0 Tp 0 Tv TP 0 Tr (fs dependent) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 189.1201 623.2798 m 135.1201 623.2798 l S /BBAccumRotation (0.000000) XT 189.1201 641.2798 m 135.1201 641.2798 l S /BBAccumRotation (0.000000) XT 0 O 1 g 1 XR 126 749.2798 m 180 749.2798 l 180 695.2798 l 126 695.2798 l 126 749.2798 l b /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 126 751.3398 0 Tp 0 Tv TP 0 Tr 0 g 0 J 1 w 4 M 0 XR 97 100 Tz (\336) Tx 1 0 Tk (le) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 1 g 0 R 0 G 2 J 0.72 w 3.86 M 1 XR 232.5601 713.2798 m 286.5601 713.2798 l 286.5601 659.2798 l 232.5601 659.2798 l 232.5601 713.2798 l b /BBAccumRotation (0.000000) XT 0 J 1.2 w 0 XR 222.7202 710.6401 m 232.3198 711.3599 l 223.6802 715.9199 l 223.2002 713.2798 l 222.7202 710.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 222.7202 710.6401 m 232.3198 711.3599 l 223.6802 715.9199 l 223.2002 713.2798 l 222.7202 710.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 222.7202 713.2798 m 180 722.1602 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 144 715.3398 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M 100 100 Tz (ops) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 338.4004 710.6401 m 347.7598 713.2798 l 338.4004 715.9199 l 338.4004 713.2798 l 338.4004 710.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 338.4004 710.6401 m 347.7598 713.2798 l 338.4004 715.9199 l 338.4004 713.2798 l 338.4004 710.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 337.9199 713.2798 m 286.5601 713.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 358.5596 713.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (lin) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 368.7197 713.1699 0 Tp 0 Tv TP 0 Tr (vfs_open\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 358.5596 697.3398 0 Tp 0 Tv TP 0 Tr (lin) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 368.7197 697.3398 0 Tp 0 Tv TP 0 Tr (vfs_read\(\)) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 1.2 w 3.86 M 338.4004 692.6401 m 347.7598 695.2798 l 338.4004 697.9199 l 338.4004 695.2798 l 338.4004 692.6401 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 338.4004 692.6401 m 347.7598 695.2798 l 338.4004 697.9199 l 338.4004 695.2798 l 338.4004 692.6401 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 337.9199 695.2798 m 286.5601 695.2798 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 367.5596 677.1699 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 367.5596 659.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 367.5596 668.1699 0 Tp 0 Tv TP 0 Tr (.) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 138.6699 695.1699 0 Tp 0 Tv TP 0 Tr (dirent) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 180 713.2798 m 126 713.2798 l S /BBAccumRotation (0.000000) XT 180 731.2798 m 126 731.2798 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 161.2798 572.8799 m 169.6802 568.3198 l 165.1201 576.7197 l 163.2002 574.7998 l 161.2798 572.8799 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 161.2798 572.8799 m 169.6802 568.3198 l 165.1201 576.7197 l 163.2002 574.7998 l 161.2798 572.8799 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 162.7202 575.04 m 135.1201 603.1201 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 129.8398 666.96 m 134.6401 658.7998 l 134.8799 668.3999 l 132.2397 667.6797 l 129.8398 666.96 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 129.8398 666.96 m 134.6401 658.7998 l 134.8799 668.3999 l 132.2397 667.6797 l 129.8398 666.96 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 132.2397 668.1602 m 126 693.1201 l S /BBAccumRotation (0.000000) XT 0 J 1.2 w 214.0801 627.3599 m 223.2002 630 l 214.0801 632.6401 l 214.0801 630 l 214.0801 627.3599 l s /BBAccumRotation (0.000000) XT 0 O 0 g 1 w 4 M 1 XR 214.0801 627.3599 m 223.2002 630 l 214.0801 632.6401 l 214.0801 630 l 214.0801 627.3599 l f /BBAccumRotation (0.000000) XT 0 R 0 G 2 J 0.72 w 3.86 M 0 XR 213.3599 630 m 189.1201 630 l S /BBAccumRotation (0.000000) XT 243.3599 630 m 225.3599 630 l S /BBAccumRotation (0.000000) XT 243.3599 621.1201 m 225.3599 621.1201 l S /BBAccumRotation (0.000000) XT 243.3599 612 m 225.3599 612 l S /BBAccumRotation (0.000000) XT 0 To 1 0 0 1 225.3398 603 0 Tp 0 Tv TP 0 Tr 0 O 0 g 0 J 1 w 4 M (NULL) Tx 1 0 Tk (\r) Tx 1 0 Tk TO /BBAccumRotation (0.000000) XT LB %AI5_EndLayer-- gsave annotatepage grestore showpage Adobe_Illustrator_AI5 /terminate get exec Adobe_shading_AI8 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_cshow /terminate get exec Adobe_level2_AI5 /terminate get exec %%EndDocument @endspecial 771 5027 a(Figure)20 b(6:)25 b(Con)m(v)o(erting)18 b(an)i(Linux)f(VFS)i(operation)e(to)h(an)g(XFS)h(vfs)f(operation.)1908 5656 y(13)p eop %%Page: 14 14 14 13 bop 0 390 a Fe(be)21 b(relati)n(v)o(ely)f(small:)27 b(the)21 b(wrapfs)f(stackable)h(\002le)g(system)h(layer)0 490 y([11)o(])d(w)o(as)h(found)d(to)i(yield)g(about)f(7-10\045)g (additional)g(o)o(v)o(erhead.)0 589 y(W)-7 b(e)24 b(e)o(xpect)e(the)h (XFS)h(translation)e(layer)h(o)o(v)o(erheads)e(to)i(be)g(less)0 689 y(than)30 b(5Changing)f(XFS)i(to)g(\002t)g(directly)f(into)g(the)h (Linux)e(XFS)0 789 y(interf)o(ace)h(is)i(still)g(an)f(option)f(for)h (this)g(project)f(in)h(the)g(future.)0 888 y(The)19 b(initial)h(XFS)g (port)f(will)h(be)f(to)h(the)f(2.2)g(k)o(ernel)g(as)h(a)g(module.)0 1147 y Fd(4.6)99 b(V)-10 b(olume)25 b(Management)0 1310 y Fe(XFS)20 b(depends)f(on)g(a)h(v)n(olume)f(manager)f(for)h(pro)o (viding)e(an)i(inte-)0 1410 y(grated)j(block)f(interf)o(ace)h(to)h(a)g (set)g(of)f(disk)h(dri)n(v)o(es.)31 b(The)22 b(current)0 1510 y(XFS)d(implementation)c(relies)k(on)e(xlv)-5 b(,)18 b(a)g(relati)n(v)o(ely)f(simple)h(log-)0 1609 y(ical)27 b(v)n(olume)e(manager)f(de)n(v)o(eloped)g(by)i(SGI)g(to)h(support)d (XFS.)0 1709 y(There)18 b(are)h(tw)o(o)h(v)n(olume)e(managers)g(a)n(v)n (ailable)h(in)g(Linux)f(today:)0 1809 y(Linux)30 b(lvm)g([13)o(])g(and) h(md)f([18)o(].)56 b(MD)31 b(focuses)f(on)g(softw)o(are)0 1908 y(RAID)f(support,)f(whereas)g(Linux)f(lvm)h(is)h(a)g(more)e (traditional)0 2008 y(logical)d(v)n(olume)e(management)g(layer)i (modeled)e(after)i(the)g(HP-)0 2107 y(UX)d(design,)e(which)h(itself)g (follo)n(wed)f(the)h(OSF/1)h(model.)83 2211 y(Linux)j(lvm)h(adds)g(an)h (additional)e(layer)h(between)f(the)h(phys-)0 2311 y(ical)j (peripherals)e(and)h(the)h(i/o)g(interf)o(ace)f(in)h(the)f(k)o(ernel)g (to)h(get)0 2410 y(a)c(logical)f(vie)n(w)g(of)g(disks.)35 b(Unlik)o(e)23 b(current)f(partition)g(schemes)0 2510 y(where)g(disks)i(are)f(di)n(vided)e(into)i(\002x)o(ed-sized)f (sections,)h(lvm)g(al-)0 2610 y(lo)n(ws)30 b(the)f(user)h(to)g (consider)e(disks,)k(also)e(kno)n(wn)e(as)i(physical)0 2709 y(v)n(olumes)19 b(\(PV\),)h(as)h(a)f(pool)f(\(or)h(v)n(olume\))e (of)i(data)g(storage,)f(con-)0 2809 y(sisting)i(of)f(equal-sized)e(e)o (xtents.)83 2912 y(An)h(lvm)g(v)n(olume)f(consists)i(of)f(arbitrary)f (groups)f(of)i(physical)0 3012 y(v)n(olumes,)25 b(or)o(ganized)d(into)i (v)n(olume)g(groups)f(\(V)o(G\).)h(A)h(v)n(olume)0 3112 y(group)16 b(can)h(consist)h(of)f(one)g(or)g(more)g(physical)g(v)n (olumes.)23 b(There)0 3211 y(can)g(be)g(more)f(than)h(one)g(v)n(olume)f (group)f(in)i(the)g(system.)34 b(Once)0 3311 y(created,)27 b(the)f(v)n(olume)f(group,)g(and)h(not)f(the)i(disk,)g(is)g(the)f (basic)0 3410 y(unit)20 b(of)g(data)g(storage.)83 3514 y(The)i(pool)f(of)h(disk)g(space)g(that)g(is)h(represented)e(by)h(a)g (v)n(olume)0 3614 y(group)27 b(can)h(be)g(di)n(vided)f(into)h(virtual)g (partitions)g(\(called)g(logi-)0 3713 y(cal)21 b(v)n(olumes)f(\226)h(L) -8 b(V\))20 b(of)g(v)n(arious)g(sizes.)27 b(A)21 b(logical)g(v)n(olume) e(can)0 3813 y(span)31 b(a)g(number)e(of)i(physical)e(v)n(olumes)h(or)h (represent)f(only)g(a)0 3912 y(portion)19 b(of)h(one)f(physical)g(v)n (olume.)24 b(The)c(size)h(of)f(a)h(logical)e(v)n(ol-)0 4012 y(ume)27 b(is)h(determined)e(by)h(the)g(number)f(of)h(e)o(xtents)g (it)h(contains.)0 4112 y(Once)k(created,)i(logical)d(v)n(olumes)h(can)g (be)g(used)f(lik)o(e)i(re)o(gular)0 4211 y(disk)20 b(partitions)g(to)g (create)g(a)g(\002le)h(system)g(or)f(as)h(a)f(sw)o(ap)h(de)n(vice.)83 4315 y(Currently)-5 b(,)31 b(we)g(plan)g(to)f(use)h(Linux)f(lvm)g(to)h (support)e(XFS)0 4414 y(logical)i(v)n(olume)f(manager)g(requirements.) 56 b(Ho)n(we)n(v)o(er)m(,)32 b(SGI')-5 b(s)0 4514 y(ne)n(w)39 b(XVM)h(v)n(olume)e(manager)g(will)i(become)e(a)n(v)n(ailable)g(on)0 4614 y(Linux)14 b(in)i(the)g(near)f(future,)g(and)g(XFS)h(will)g(e)o (xploit)f(its)h(adv)n(anced)0 4713 y(features.)0 5015 y Ff(5)119 b(Summary)0 5208 y Fe(As)88 b(the)g(XFS)g(port)f(to)h(Linux) e(proceeds,)103 b(source)0 5308 y(code)89 b(and)g(progress)f(reports)h (will)h(be)g(posted)f(to)0 5407 y Fb(http://oss.sgi.com/pr)l (ojects/xfs)p Fe(.)205 b(The)80 b(porting)f(team)1992 390 y(will)26 b(be)g(presenting)e(its)i(w)o(ork)f(at)h(v)n(arious)f (Linux)g(conferences)1992 490 y(o)o(v)o(er)k(the)i(coming)e(year)m(,)k (and)d(we)i(look)e(forw)o(ard)f(to)i(w)o(orking)1992 589 y(more)21 b(closely)h(with)g(the)h(Linux)e(de)n(v)o(eloper)f (community)g(as)j(the)1992 689 y(source)i(code)h(becomes)f(a)n(v)n (ailable.)43 b(At)27 b(the)f(present)g(time,)i(the)1992 789 y(source)35 b(code)g(is)h(being)f(re)n(vie)n(wed)g(to)g(insure)h (that)g(it)g(can)g(be)1992 888 y(GPL)-8 b('ed)18 b(without)h(an)o(y)f (restrictions.)24 b(Once)19 b(this)g(code)f(re)n(vie)n(w)h(is)1992 988 y(complete,)j(the)h(XFS)h(source)e(code)g(will)i(be)f(made)g(a)n(v) n(ailable)f(at)1992 1088 y(the)e(web)g(site.)1992 1372 y Ff(6)119 b(Ackno)o(wledgments)1992 1559 y Fe(The)31 b(original)f(XFS)j(team,)h(led)e(by)f(Geof)n(f)g(Peck,)k(made)c(XFS) 1992 1659 y(possible.)100 b(The)45 b(team)g(included)f(Adam)h(Sweene)o (y)-5 b(,)51 b(Doug)1992 1758 y(Doucette,)16 b(W)-7 b(ei)18 b(Hu,)f(Curtis)g(Anderson,)e(and)h(Mik)o(e)h(Nishimoto.)1992 1858 y(W)-7 b(e)25 b(w)o(ould)e(also)i(lik)o(e)f(to)g(thank)f(Stephen)h (T)-7 b(weedie,)24 b(T)-6 b(ed)24 b(Ts'o,)1992 1958 y(and)19 b(Peter)i(Braam)f(for)f(their)h(feedback)e(on)i(this)h(w)o(ork.)1992 2242 y Ff(Refer)n(ences)2033 2429 y Fe([1])40 b(Marshall)j(Kirk)g(McK)o (usick,)k(K)n(eith)c(Bostic,)49 b(Michael)2171 2529 y(Karels,)e(and)41 b(John)g(Quarterman.)95 b Fb(The)41 b(Design)g(and)2171 2629 y(Implementation)30 b(of)i(the)g(4.4)f(BSD)g(Oper)o(ating)g (System)p Fe(.)2171 2728 y(Addison-W)-7 b(esle)o(y)i(,)19 b(1996.)2033 2897 y([2])40 b(Adam)16 b(Sweene)o(y)-5 b(,)16 b(Doug)f(Doucette,)h(W)-7 b(ei)18 b(Hu,)f(Curtis)g(An-)2171 2997 y(derson,)34 b(Mik)o(e)f(Nishimoto,)h(and)e(Geof)n(f)f(Peck.)69 b(Scala-)2171 3097 y(bility)28 b(in)g(the)g(xfs)g(\002le)g(system.)54 b(In)28 b Fb(Pr)l(oceedings)f(of)h(the)2171 3196 y(USENIX)21 b(Annual)e(T)-8 b(ec)o(hnical)20 b(Confer)m(ence)p Fe(,)h(pages)f (1\22614,)2171 3296 y(San)h(Die)o(go,)e(CA,)i(January)e(1996.)2033 3465 y([3])40 b(Geof)n(f)31 b(Peck)h(et)g(al.)66 b(Original)31 b(xfs)h(design)f(documents.)2171 3565 y (http://oss.sgi.com/projects/xfs/,)17 b(1993.)2033 3734 y([4])40 b(J.)27 b(K)n(ent)f(Peacock)f(and)h(et)g(al.)48 b(F)o(ast)27 b(consistenc)o(y)e(check-)2171 3834 y(ing)c(for)f(the)h (solaris)g(\002le)h(system.)31 b(In)21 b Fb(Pr)l(oceedings)f(of)h(the) 2171 3933 y(USENIX)33 b(Annual)e(T)-8 b(ec)o(hnical)32 b(Confer)m(ence)p Fe(,)j(pages)d(77\226)2171 4033 y(89,)20 b(June)g(1998.)2033 4202 y([5])40 b(Michael)31 b(J.)g(F)o(olk,)h(Bill)g (Zoellick,)g(and)e(Gre)o(g)g(Riccardi.)2171 4302 y Fb(F)l(ile)21 b(Structur)m(es)p Fe(.)29 b(Addison-W)-7 b(esle)o(y)i(,)18 b(March)i(1998.)2033 4471 y([6])40 b(Douglas)15 b(Comer)-5 b(.)20 b(The)15 b(Ubiquitous)g(B-T)m(ree.)k Fb(Computing)2171 4571 y(Surve)n(ys)p Fe(,)h(11\(2\):121\226137,)15 b(June)k(1979.)2033 4740 y([7])40 b(Stephen)33 b(C.)h(T)-7 b(weedie.)72 b(A)34 b(journaled)e(\002le)i(system)g(for)2171 4839 y(linux.)26 b(In)19 b Fb(Pr)l(oceedings)f(of)h(the)g(4th)g(Annual)e(Linux)i(Expo)p Fe(,)2171 4939 y(Raleigh,)h(North)g(Carolina,)f(May)h(1998.)2033 5108 y([8])40 b(Theodore)d(Ts)7 b(\264)-35 b(o.)89 b(Introducing)36 b(b-trees)j(into)f(the)h(sec-)2171 5208 y(ond)24 b(e)o(xtended)f (\002lesystem.)43 b(In)25 b Fb(Pr)l(oceedings)e(of)i(the)g(4th)2171 5308 y(Annual)i(Linux)g(Expo)p Fe(,)i(Raleigh,)h(North)d(Carolina,)i (May)2171 5407 y(1998.)1908 5656 y(14)p eop %%Page: 15 15 15 14 bop 42 390 a Fe([9])40 b(Peter)28 b(Braam)h(and)f(Philip)g (Nelson.)55 b(Remo)o(ving)27 b(bottle-)180 490 y(necks)f(in)h(distrib)n (uted)f(\002lesystems.)50 b(In)26 b Fb(Pr)l(oceedings)g(of)180 589 y(the)16 b(5th)h(Annual)e(Linux)h(Expo)p Fe(,)g(pages)g (131\226139,)e(Raleigh,)180 689 y(North)19 b(Carolina,)h(May)g(1999.)0 855 y([10])40 b(K)n(enneth)18 b(Preslan)i(et)g(al.)28 b(A)21 b(64-bit,)d(shared)h(disk)g(\002le)i(sys-)180 955 y(tem)35 b(for)f(linux.)75 b(In)34 b Fb(Pr)l(oceedings)g(of)h(the)f (5th)h(Annual)180 1054 y(Linux)g(Expo)p Fe(,)k(pages)c(111\226130,)h (Raleigh,)k(North)35 b(Car)n(-)180 1154 y(olina,)19 b(May)h(1999.)0 1320 y([11])40 b(Erez)18 b(Zadok)f(and)h(Ion)f(Badulescu.)25 b(A)19 b(stackable)f(\002le)h(sys-)180 1420 y(tem)30 b(interf)o(ace)f(for)g(linux.)59 b(In)30 b Fb(Pr)l(oceedings)f(of)h (the)f(5th)180 1519 y(Annual)20 b(Linux)h(Expo)p Fe(,)h(pages)f (141\226151,)e(Raleigh,)j(North)180 1619 y(Carolina,)d(May)h(1999.)0 1785 y([12])40 b(Hans)118 b(Reiser)-5 b(.)344 b(Reiserfs)119 b(\002le)g(system.)180 1885 y(http://idiom.com/)769 1865 y(\230)762 1885 y(be)n(v)o(erly/reiserfs.h)o(tml,)14 b(July)21 b(1999.)0 2051 y([13])40 b(Heinz)19 b(Mauelshagen.)26 b(Linux)19 b(logical)g(v)n(olume)g(manager)180 2150 y(\(lvm\),)47 b(v)o(ersion)41 b(0.7.)101 b(http://linux.msede.com/lvm/,)180 2250 y(July)20 b(1999.)0 2416 y([14])40 b(S.R.)25 b(Kleiman.)42 b(Vnodes:)32 b(An)25 b(Architecture)e(for)g(Multi-)180 2516 y(ple)18 b(File)h(System)f(T)-7 b(ypes)17 b(in)h(Sun)g(UNIX.)25 b(In)17 b Fb(Pr)l(oceedings)180 2615 y(of)i(the)h(Summer)f(1986)f (USENIX)h(T)-8 b(ec)o(hnical)18 b(Confer)m(ence)p Fe(,)180 2715 y(pages)i(238\226247,)d(June)j(1986.)0 2881 y([15])40 b(Uresh)24 b(V)-9 b(ahalia.)41 b Fb(Unix)25 b(Internals:)32 b(The)24 b(Ne)o(w)h(F)-5 b(r)l(ontier)o(s)p Fe(.)180 2980 y(Prentice-Hall,)19 b(1996.)0 3147 y([16])40 b(L.)20 b(McV)-11 b(o)o(y)20 b(and)g(S.)g(Kleiman.)29 b(Extent-lik)o(e)19 b(performance)180 3246 y(from)h(a)j(unix)d(\002le)j(system.)34 b(In)21 b Fb(Pr)l(oceedings)g(of)h(the)f(1991)180 3346 y(W)-5 b(inter)33 b(USENIX)f(Confer)m(ence)p Fe(,)i(pages)e(33\22643,)i (Dallas,)180 3445 y(TX,)20 b(June)g(1991.)0 3611 y([17])40 b(M.)46 b(Beck,)53 b(H.)46 b(Bohme,)52 b(M.)46 b(Dziadzka,)52 b(U.)46 b(K)o(unitz,)180 3711 y(R.)25 b(Magnus,)g(and)f(D.)i(V)-9 b(erw)o(orner)k(.)42 b Fb(Linux)25 b(K)m(ernel)g(Inter)n(-)180 3811 y(nals)p Fe(.)k(Addison-W)-7 b(esle)o(y)i(,)18 b(second)h (edition,)h(1998.)0 3977 y([18])40 b(Jak)o(ob)101 b(Oster)o(gaard.)287 b(The)101 b(Softw)o(are-RAID)180 4076 y(HO)m(WT)o(O.)240 b(http://ostenfeld.dk/)1377 4057 y(\230)1379 4076 y(jak)o(ob/Softw)o (are-)180 4176 y(RAID.HO)m(WT)o(O/Softw)o(are-RAID.HO)m(WT)o(O.html.) 1908 5656 y(15)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF